\").html(e).find(t.opts.filter))),t.$slide.one(\"onReset\",function(){n(this).find(\"video,audio\").trigger(\"pause\"),t.$placeholder&&(t.$placeholder.after(e.removeClass(\"fancybox-content\").hide()).remove(),t.$placeholder=null),t.$smallBtn&&(t.$smallBtn.remove(),t.$smallBtn=null),t.hasError||(n(this).empty(),t.isLoaded=!1,t.isRevealed=!1)}),n(e).appendTo(t.$slide),n(e).is(\"video,audio\")&&(n(e).addClass(\"fancybox-video\"),n(e).wrap(\"
\"),t.contentType=\"video\",t.opts.width=t.opts.width||n(e).attr(\"width\"),t.opts.height=t.opts.height||n(e).attr(\"height\")),t.$content=t.$slide.children().filter(\"div,form,main,video,audio,article,.fancybox-content\").first(),t.$content.siblings().hide(),t.$content.length||(t.$content=t.$slide.wrapInner(\"
\").children().first()),t.$content.addClass(\"fancybox-content\"),t.$slide.addClass(\"fancybox-slide--\"+t.contentType),o.afterLoad(t))},setError:function(t){t.hasError=!0,t.$slide.trigger(\"onReset\").removeClass(\"fancybox-slide--\"+t.contentType).addClass(\"fancybox-slide--error\"),t.contentType=\"html\",this.setContent(t,this.translate(t,t.opts.errorTpl)),t.pos===this.currPos&&(this.isAnimating=!1)},showLoading:function(t){var e=this;(t=t||e.current)&&!t.$spinner&&(t.$spinner=n(e.translate(e,e.opts.spinnerTpl)).appendTo(t.$slide).hide().fadeIn(\"fast\"))},hideLoading:function(t){var e=this;(t=t||e.current)&&t.$spinner&&(t.$spinner.stop().remove(),delete t.$spinner)},afterLoad:function(t){var e=this;e.isClosing||(t.isLoading=!1,t.isLoaded=!0,e.trigger(\"afterLoad\",t),e.hideLoading(t),!t.opts.smallBtn||t.$smallBtn&&t.$smallBtn.length||(t.$smallBtn=n(e.translate(t,t.opts.btnTpl.smallBtn)).appendTo(t.$content)),t.opts.protect&&t.$content&&!t.hasError&&(t.$content.on(\"contextmenu.fb\",function(t){return 2==t.button&&t.preventDefault(),!0}),\"image\"===t.type&&n('
').appendTo(t.$content)),e.adjustCaption(t),e.adjustLayout(t),t.pos===e.currPos&&e.updateCursor(),e.revealContent(t))},adjustCaption:function(t){var e,n=this,o=t||n.current,i=o.opts.caption,a=o.opts.preventCaptionOverlap,s=n.$refs.caption,r=!1;s.toggleClass(\"fancybox-caption--separate\",a),a&&i&&i.length&&(o.pos!==n.currPos?(e=s.clone().appendTo(s.parent()),e.children().eq(0).empty().html(i),r=e.outerHeight(!0),e.empty().remove()):n.$caption&&(r=n.$caption.outerHeight(!0)),o.$slide.css(\"padding-bottom\",r||\"\"))},adjustLayout:function(t){var e,n,o,i,a=this,s=t||a.current;s.isLoaded&&!0!==s.opts.disableLayoutFix&&(s.$content.css(\"margin-bottom\",\"\"),s.$content.outerHeight()>s.$slide.height()+.5&&(o=s.$slide[0].style[\"padding-bottom\"],i=s.$slide.css(\"padding-bottom\"),parseFloat(i)>0&&(e=s.$slide[0].scrollHeight,s.$slide.css(\"padding-bottom\",0),Math.abs(e-s.$slide[0].scrollHeight)<1&&(n=i),s.$slide.css(\"padding-bottom\",o))),s.$content.css(\"margin-bottom\",n))},revealContent:function(t){var e,o,i,a,s=this,r=t.$slide,c=!1,l=!1,d=s.isMoved(t),u=t.isRevealed;return t.isRevealed=!0,e=t.opts[s.firstRun?\"animationEffect\":\"transitionEffect\"],i=t.opts[s.firstRun?\"animationDuration\":\"transitionDuration\"],i=parseInt(void 0===t.forcedDuration?i:t.forcedDuration,10),!d&&t.pos===s.currPos&&i||(e=!1),\"zoom\"===e&&(t.pos===s.currPos&&i&&\"image\"===t.type&&!t.hasError&&(l=s.getThumbPos(t))?c=s.getFitPos(t):e=\"fade\"),\"zoom\"===e?(s.isAnimating=!0,c.scaleX=c.width/l.width,c.scaleY=c.height/l.height,a=t.opts.zoomOpacity,\"auto\"==a&&(a=Math.abs(t.width/t.height-l.width/l.height)>.1),a&&(l.opacity=.1,c.opacity=1),n.fancybox.setTranslate(t.$content.removeClass(\"fancybox-is-hidden\"),l),p(t.$content),void n.fancybox.animate(t.$content,c,i,function(){s.isAnimating=!1,s.complete()})):(s.updateSlide(t),e?(n.fancybox.stop(r),o=\"fancybox-slide--\"+(t.pos>=s.prevPos?\"next\":\"previous\")+\" fancybox-animated fancybox-fx-\"+e,r.addClass(o).removeClass(\"fancybox-slide--current\"),t.$content.removeClass(\"fancybox-is-hidden\"),p(r),\"image\"!==t.type&&t.$content.hide().show(0),void n.fancybox.animate(r,\"fancybox-slide--current\",i,function(){r.removeClass(o).css({transform:\"\",opacity:\"\"}),t.pos===s.currPos&&s.complete()},!0)):(t.$content.removeClass(\"fancybox-is-hidden\"),u||!d||\"image\"!==t.type||t.hasError||t.$content.hide().fadeIn(\"fast\"),void(t.pos===s.currPos&&s.complete())))},getThumbPos:function(t){var e,o,i,a,s,r=!1,c=t.$thumb;return!(!c||!g(c[0]))&&(e=n.fancybox.getTranslate(c),o=parseFloat(c.css(\"border-top-width\")||0),i=parseFloat(c.css(\"border-right-width\")||0),a=parseFloat(c.css(\"border-bottom-width\")||0),s=parseFloat(c.css(\"border-left-width\")||0),r={top:e.top+o,left:e.left+s,width:e.width-i-s,height:e.height-o-a,scaleX:1,scaleY:1},e.width>0&&e.height>0&&r)},complete:function(){var t,e=this,o=e.current,i={};!e.isMoved()&&o.isLoaded&&(o.isComplete||(o.isComplete=!0,o.$slide.siblings().trigger(\"onReset\"),e.preload(\"inline\"),p(o.$slide),o.$slide.addClass(\"fancybox-slide--complete\"),n.each(e.slides,function(t,o){o.pos>=e.currPos-1&&o.pos<=e.currPos+1?i[o.pos]=o:o&&(n.fancybox.stop(o.$slide),o.$slide.off().remove())}),e.slides=i),e.isAnimating=!1,e.updateCursor(),e.trigger(\"afterShow\"),o.opts.video.autoStart&&o.$slide.find(\"video,audio\").filter(\":visible:first\").trigger(\"play\").one(\"ended\",function(){Document.exitFullscreen?Document.exitFullscreen():this.webkitExitFullscreen&&this.webkitExitFullscreen(),e.next()}),o.opts.autoFocus&&\"html\"===o.contentType&&(t=o.$content.find(\"input[autofocus]:enabled:visible:first\"),t.length?t.trigger(\"focus\"):e.focus(null,!0)),o.$slide.scrollTop(0).scrollLeft(0))},preload:function(t){var e,n,o=this;o.group.length<2||(n=o.slides[o.currPos+1],e=o.slides[o.currPos-1],e&&e.type===t&&o.loadSlide(e),n&&n.type===t&&o.loadSlide(n))},focus:function(t,o){var i,a,s=this,r=[\"a[href]\",\"area[href]\",'input:not([disabled]):not([type=\"hidden\"]):not([aria-hidden])',\"select:not([disabled]):not([aria-hidden])\",\"textarea:not([disabled]):not([aria-hidden])\",\"button:not([disabled]):not([aria-hidden])\",\"iframe\",\"object\",\"embed\",\"video\",\"audio\",\"[contenteditable]\",'[tabindex]:not([tabindex^=\"-\"])'].join(\",\");s.isClosing||(i=!t&&s.current&&s.current.isComplete?s.current.$slide.find(\"*:visible\"+(o?\":not(.fancybox-close-small)\":\"\")):s.$refs.container.find(\"*:visible\"),i=i.filter(r).filter(function(){return\"hidden\"!==n(this).css(\"visibility\")&&!n(this).hasClass(\"disabled\")}),i.length?(a=i.index(e.activeElement),t&&t.shiftKey?(a<0||0==a)&&(t.preventDefault(),i.eq(i.length-1).trigger(\"focus\")):(a<0||a==i.length-1)&&(t&&t.preventDefault(),i.eq(0).trigger(\"focus\"))):s.$refs.container.trigger(\"focus\"))},activate:function(){var t=this;n(\".fancybox-container\").each(function(){var e=n(this).data(\"FancyBox\");e&&e.id!==t.id&&!e.isClosing&&(e.trigger(\"onDeactivate\"),e.removeEvents(),e.isVisible=!1)}),t.isVisible=!0,(t.current||t.isIdle)&&(t.update(),t.updateControls()),t.trigger(\"onActivate\"),t.addEvents()},close:function(t,e){var o,i,a,s,r,c,l,u=this,f=u.current,h=function(){u.cleanUp(t)};return!u.isClosing&&(u.isClosing=!0,!1===u.trigger(\"beforeClose\",t)?(u.isClosing=!1,d(function(){u.update()}),!1):(u.removeEvents(),a=f.$content,o=f.opts.animationEffect,i=n.isNumeric(e)?e:o?f.opts.animationDuration:0,f.$slide.removeClass(\"fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated\"),!0!==t?n.fancybox.stop(f.$slide):o=!1,f.$slide.siblings().trigger(\"onReset\").remove(),i&&u.$refs.container.removeClass(\"fancybox-is-open\").addClass(\"fancybox-is-closing\").css(\"transition-duration\",i+\"ms\"),u.hideLoading(f),u.hideControls(!0),u.updateCursor(),\"zoom\"!==o||a&&i&&\"image\"===f.type&&!u.isMoved()&&!f.hasError&&(l=u.getThumbPos(f))||(o=\"fade\"),\"zoom\"===o?(n.fancybox.stop(a),s=n.fancybox.getTranslate(a),c={top:s.top,left:s.left,scaleX:s.width/l.width,scaleY:s.height/l.height,width:l.width,height:l.height},r=f.opts.zoomOpacity,\r\n\"auto\"==r&&(r=Math.abs(f.width/f.height-l.width/l.height)>.1),r&&(l.opacity=0),n.fancybox.setTranslate(a,c),p(a),n.fancybox.animate(a,l,i,h),!0):(o&&i?n.fancybox.animate(f.$slide.addClass(\"fancybox-slide--previous\").removeClass(\"fancybox-slide--current\"),\"fancybox-animated fancybox-fx-\"+o,i,h):!0===t?setTimeout(h,i):h(),!0)))},cleanUp:function(e){var o,i,a,s=this,r=s.current.opts.$orig;s.current.$slide.trigger(\"onReset\"),s.$refs.container.empty().remove(),s.trigger(\"afterClose\",e),s.current.opts.backFocus&&(r&&r.length&&r.is(\":visible\")||(r=s.$trigger),r&&r.length&&(i=t.scrollX,a=t.scrollY,r.trigger(\"focus\"),n(\"html, body\").scrollTop(a).scrollLeft(i))),s.current=null,o=n.fancybox.getInstance(),o?o.activate():(n(\"body\").removeClass(\"fancybox-active compensate-for-scrollbar\"),n(\"#fancybox-style-noscroll\").remove())},trigger:function(t,e){var o,i=Array.prototype.slice.call(arguments,1),a=this,s=e&&e.opts?e:a.current;if(s?i.unshift(s):s=a,i.unshift(a),n.isFunction(s.opts[t])&&(o=s.opts[t].apply(s,i)),!1===o)return o;\"afterClose\"!==t&&a.$refs?a.$refs.container.trigger(t+\".fb\",i):r.trigger(t+\".fb\",i)},updateControls:function(){var t=this,o=t.current,i=o.index,a=t.$refs.container,s=t.$refs.caption,r=o.opts.caption;o.$slide.trigger(\"refresh\"),r&&r.length?(t.$caption=s,s.children().eq(0).html(r)):t.$caption=null,t.hasHiddenControls||t.isIdle||t.showControls(),a.find(\"[data-fancybox-count]\").html(t.group.length),a.find(\"[data-fancybox-index]\").html(i+1),a.find(\"[data-fancybox-prev]\").prop(\"disabled\",!o.opts.loop&&i<=0),a.find(\"[data-fancybox-next]\").prop(\"disabled\",!o.opts.loop&&i>=t.group.length-1),\"image\"===o.type?a.find(\"[data-fancybox-zoom]\").show().end().find(\"[data-fancybox-download]\").attr(\"href\",o.opts.image.src||o.src).show():o.opts.toolbar&&a.find(\"[data-fancybox-download],[data-fancybox-zoom]\").hide(),n(e.activeElement).is(\":hidden,[disabled]\")&&t.$refs.container.trigger(\"focus\")},hideControls:function(t){var e=this,n=[\"infobar\",\"toolbar\",\"nav\"];!t&&e.current.opts.preventCaptionOverlap||n.push(\"caption\"),this.$refs.container.removeClass(n.map(function(t){return\"fancybox-show-\"+t}).join(\" \")),this.hasHiddenControls=!0},showControls:function(){var t=this,e=t.current?t.current.opts:t.opts,n=t.$refs.container;t.hasHiddenControls=!1,t.idleSecondsCounter=0,n.toggleClass(\"fancybox-show-toolbar\",!(!e.toolbar||!e.buttons)).toggleClass(\"fancybox-show-infobar\",!!(e.infobar&&t.group.length>1)).toggleClass(\"fancybox-show-caption\",!!t.$caption).toggleClass(\"fancybox-show-nav\",!!(e.arrows&&t.group.length>1)).toggleClass(\"fancybox-is-modal\",!!e.modal)},toggleControls:function(){this.hasHiddenControls?this.showControls():this.hideControls()}}),n.fancybox={version:\"3.5.7\",defaults:a,getInstance:function(t){var e=n('.fancybox-container:not(\".fancybox-is-closing\"):last').data(\"FancyBox\"),o=Array.prototype.slice.call(arguments,1);return e instanceof b&&(\"string\"===n.type(t)?e[t].apply(e,o):\"function\"===n.type(t)&&t.apply(e,o),e)},open:function(t,e,n){return new b(t,e,n)},close:function(t){var e=this.getInstance();e&&(e.close(),!0===t&&this.close(t))},destroy:function(){this.close(!0),r.add(\"body\").off(\"click.fb-start\",\"**\")},isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),use3d:function(){var n=e.createElement(\"div\");return t.getComputedStyle&&t.getComputedStyle(n)&&t.getComputedStyle(n).getPropertyValue(\"transform\")&&!(e.documentMode&&e.documentMode<11)}(),getTranslate:function(t){var e;return!(!t||!t.length)&&(e=t[0].getBoundingClientRect(),{top:e.top||0,left:e.left||0,width:e.width,height:e.height,opacity:parseFloat(t.css(\"opacity\"))})},setTranslate:function(t,e){var n=\"\",o={};if(t&&e)return void 0===e.left&&void 0===e.top||(n=(void 0===e.left?t.position().left:e.left)+\"px, \"+(void 0===e.top?t.position().top:e.top)+\"px\",n=this.use3d?\"translate3d(\"+n+\", 0px)\":\"translate(\"+n+\")\"),void 0!==e.scaleX&&void 0!==e.scaleY?n+=\" scale(\"+e.scaleX+\", \"+e.scaleY+\")\":void 0!==e.scaleX&&(n+=\" scaleX(\"+e.scaleX+\")\"),n.length&&(o.transform=n),void 0!==e.opacity&&(o.opacity=e.opacity),void 0!==e.width&&(o.width=e.width),void 0!==e.height&&(o.height=e.height),t.css(o)},animate:function(t,e,o,i,a){var s,r=this;n.isFunction(o)&&(i=o,o=null),r.stop(t),s=r.getTranslate(t),t.on(f,function(c){(!c||!c.originalEvent||t.is(c.originalEvent.target)&&\"z-index\"!=c.originalEvent.propertyName)&&(r.stop(t),n.isNumeric(o)&&t.css(\"transition-duration\",\"\"),n.isPlainObject(e)?void 0!==e.scaleX&&void 0!==e.scaleY&&r.setTranslate(t,{top:e.top,left:e.left,width:s.width*e.scaleX,height:s.height*e.scaleY,scaleX:1,scaleY:1}):!0!==a&&t.removeClass(e),n.isFunction(i)&&i(c))}),n.isNumeric(o)&&t.css(\"transition-duration\",o+\"ms\"),n.isPlainObject(e)?(void 0!==e.scaleX&&void 0!==e.scaleY&&(delete e.width,delete e.height,t.parent().hasClass(\"fancybox-slide--image\")&&t.parent().addClass(\"fancybox-is-scaling\")),n.fancybox.setTranslate(t,e)):t.addClass(e),t.data(\"timer\",setTimeout(function(){t.trigger(f)},o+33))},stop:function(t,e){t&&t.length&&(clearTimeout(t.data(\"timer\")),e&&t.trigger(f),t.off(f).css(\"transition-duration\",\"\"),t.parent().removeClass(\"fancybox-is-scaling\"))}},n.fn.fancybox=function(t){var e;return t=t||{},e=t.selector||!1,e?n(\"body\").off(\"click.fb-start\",e).on(\"click.fb-start\",e,{options:t},i):this.off(\"click.fb-start\").on(\"click.fb-start\",{items:this,options:t},i),this},r.on(\"click.fb-start\",\"[data-fancybox]\",i),r.on(\"click.fb-start\",\"[data-fancybox-trigger]\",function(t){n('[data-fancybox=\"'+n(this).attr(\"data-fancybox-trigger\")+'\"]').eq(n(this).attr(\"data-fancybox-index\")||0).trigger(\"click.fb-start\",{$trigger:n(this)})}),function(){var t=null;r.on(\"mousedown mouseup focus blur\",\".fancybox-button\",function(e){switch(e.type){case\"mousedown\":t=n(this);break;case\"mouseup\":t=null;break;case\"focusin\":n(\".fancybox-button\").removeClass(\"fancybox-focus\"),n(this).is(t)||n(this).is(\"[disabled]\")||n(this).addClass(\"fancybox-focus\");break;case\"focusout\":n(\".fancybox-button\").removeClass(\"fancybox-focus\")}})}()}}(window,document,jQuery),function(t){\"use strict\";var e={youtube:{matcher:/(youtube\\.com|youtu\\.be|youtube\\-nocookie\\.com)\\/(watch\\?(.*&)?v=|v\\/|u\\/|embed\\/?)?(videoseries\\?list=(.*)|[\\w-]{11}|\\?listType=(.*)&list=(.*))(.*)/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:\"transparent\",enablejsapi:1,html5:1},paramPlace:8,type:\"iframe\",url:\"https://www.youtube-nocookie.com/embed/$4\",thumb:\"https://img.youtube.com/vi/$4/hqdefault.jpg\"},vimeo:{matcher:/^.+vimeo.com\\/(.*\\/)?([\\d]+)(.*)?/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1},paramPlace:3,type:\"iframe\",url:\"//player.vimeo.com/video/$2\"},instagram:{matcher:/(instagr\\.am|instagram\\.com)\\/p\\/([a-zA-Z0-9_\\-]+)\\/?/i,type:\"image\",url:\"//$1/p/$2/media/?size=l\"},gmap_place:{matcher:/(maps\\.)?google\\.([a-z]{2,3}(\\.[a-z]{2})?)\\/(((maps\\/(place\\/(.*)\\/)?\\@(.*),(\\d+.?\\d+?)z))|(\\?ll=))(.*)?/i,type:\"iframe\",url:function(t){return\"//maps.google.\"+t[2]+\"/?ll=\"+(t[9]?t[9]+\"&z=\"+Math.floor(t[10])+(t[12]?t[12].replace(/^\\//,\"&\"):\"\"):t[12]+\"\").replace(/\\?/,\"&\")+\"&output=\"+(t[12]&&t[12].indexOf(\"layer=c\")>0?\"svembed\":\"embed\")}},gmap_search:{matcher:/(maps\\.)?google\\.([a-z]{2,3}(\\.[a-z]{2})?)\\/(maps\\/search\\/)(.*)/i,type:\"iframe\",url:function(t){return\"//maps.google.\"+t[2]+\"/maps?q=\"+t[5].replace(\"query=\",\"q=\").replace(\"api=1\",\"\")+\"&output=embed\"}}},n=function(e,n,o){if(e)return o=o||\"\",\"object\"===t.type(o)&&(o=t.param(o,!0)),t.each(n,function(t,n){e=e.replace(\"$\"+t,n||\"\")}),o.length&&(e+=(e.indexOf(\"?\")>0?\"&\":\"?\")+o),e};t(document).on(\"objectNeedsType.fb\",function(o,i,a){var s,r,c,l,d,u,f,p=a.src||\"\",h=!1;s=t.extend(!0,{},e,a.opts.media),t.each(s,function(e,o){if(c=p.match(o.matcher)){if(h=o.type,f=e,u={},o.paramPlace&&c[o.paramPlace]){d=c[o.paramPlace],\"?\"==d[0]&&(d=d.substring(1)),d=d.split(\"&\");for(var i=0;i
1&&(\"youtube\"===n.contentSource||\"vimeo\"===n.contentSource)&&o.load(n.contentSource)}})}(jQuery),function(t,e,n){\"use strict\";var o=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),i=function(){return t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)}}(),a=function(e){var n=[];e=e.originalEvent||e||t.e,e=e.touches&&e.touches.length?e.touches:e.changedTouches&&e.changedTouches.length?e.changedTouches:[e];for(var o in e)e[o].pageX?n.push({x:e[o].pageX,y:e[o].pageY}):e[o].clientX&&n.push({x:e[o].clientX,y:e[o].clientY});return n},s=function(t,e,n){return e&&t?\"x\"===n?t.x-e.x:\"y\"===n?t.y-e.y:Math.sqrt(Math.pow(t.x-e.x,2)+Math.pow(t.y-e.y,2)):0},r=function(t){if(t.is('a,area,button,[role=\"button\"],input,label,select,summary,textarea,video,audio,iframe')||n.isFunction(t.get(0).onclick)||t.data(\"selectable\"))return!0;for(var e=0,o=t[0].attributes,i=o.length;ee.clientHeight,a=(\"scroll\"===o||\"auto\"===o)&&e.scrollWidth>e.clientWidth;return i||a},l=function(t){for(var e=!1;;){if(e=c(t.get(0)))break;if(t=t.parent(),!t.length||t.hasClass(\"fancybox-stage\")||t.is(\"body\"))break}return e},d=function(t){var e=this;e.instance=t,e.$bg=t.$refs.bg,e.$stage=t.$refs.stage,e.$container=t.$refs.container,e.destroy(),e.$container.on(\"touchstart.fb.touch mousedown.fb.touch\",n.proxy(e,\"ontouchstart\"))};d.prototype.destroy=function(){var t=this;t.$container.off(\".fb.touch\"),n(e).off(\".fb.touch\"),t.requestId&&(i(t.requestId),t.requestId=null),t.tapped&&(clearTimeout(t.tapped),t.tapped=null)},d.prototype.ontouchstart=function(o){var i=this,c=n(o.target),d=i.instance,u=d.current,f=u.$slide,p=u.$content,h=\"touchstart\"==o.type;if(h&&i.$container.off(\"mousedown.fb.touch\"),(!o.originalEvent||2!=o.originalEvent.button)&&f.length&&c.length&&!r(c)&&!r(c.parent())&&(c.is(\"img\")||!(o.originalEvent.clientX>c[0].clientWidth+c.offset().left))){if(!u||d.isAnimating||u.$slide.hasClass(\"fancybox-animated\"))return o.stopPropagation(),void o.preventDefault();i.realPoints=i.startPoints=a(o),i.startPoints.length&&(u.touch&&o.stopPropagation(),i.startEvent=o,i.canTap=!0,i.$target=c,i.$content=p,i.opts=u.opts.touch,i.isPanning=!1,i.isSwiping=!1,i.isZooming=!1,i.isScrolling=!1,i.canPan=d.canPan(),i.startTime=(new Date).getTime(),i.distanceX=i.distanceY=i.distance=0,i.canvasWidth=Math.round(f[0].clientWidth),i.canvasHeight=Math.round(f[0].clientHeight),i.contentLastPos=null,i.contentStartPos=n.fancybox.getTranslate(i.$content)||{top:0,left:0},i.sliderStartPos=n.fancybox.getTranslate(f),i.stagePos=n.fancybox.getTranslate(d.$refs.stage),i.sliderStartPos.top-=i.stagePos.top,i.sliderStartPos.left-=i.stagePos.left,i.contentStartPos.top-=i.stagePos.top,i.contentStartPos.left-=i.stagePos.left,n(e).off(\".fb.touch\").on(h?\"touchend.fb.touch touchcancel.fb.touch\":\"mouseup.fb.touch mouseleave.fb.touch\",n.proxy(i,\"ontouchend\")).on(h?\"touchmove.fb.touch\":\"mousemove.fb.touch\",n.proxy(i,\"ontouchmove\")),n.fancybox.isMobile&&e.addEventListener(\"scroll\",i.onscroll,!0),((i.opts||i.canPan)&&(c.is(i.$stage)||i.$stage.find(c).length)||(c.is(\".fancybox-image\")&&o.preventDefault(),n.fancybox.isMobile&&c.parents(\".fancybox-caption\").length))&&(i.isScrollable=l(c)||l(c.parent()),n.fancybox.isMobile&&i.isScrollable||o.preventDefault(),(1===i.startPoints.length||u.hasError)&&(i.canPan?(n.fancybox.stop(i.$content),i.isPanning=!0):i.isSwiping=!0,i.$container.addClass(\"fancybox-is-grabbing\")),2===i.startPoints.length&&\"image\"===u.type&&(u.isLoaded||u.$ghost)&&(i.canTap=!1,i.isSwiping=!1,i.isPanning=!1,i.isZooming=!0,n.fancybox.stop(i.$content),i.centerPointStartX=.5*(i.startPoints[0].x+i.startPoints[1].x)-n(t).scrollLeft(),i.centerPointStartY=.5*(i.startPoints[0].y+i.startPoints[1].y)-n(t).scrollTop(),i.percentageOfImageAtPinchPointX=(i.centerPointStartX-i.contentStartPos.left)/i.contentStartPos.width,i.percentageOfImageAtPinchPointY=(i.centerPointStartY-i.contentStartPos.top)/i.contentStartPos.height,i.startDistanceBetweenFingers=s(i.startPoints[0],i.startPoints[1]))))}},d.prototype.onscroll=function(t){var n=this;n.isScrolling=!0,e.removeEventListener(\"scroll\",n.onscroll,!0)},d.prototype.ontouchmove=function(t){var e=this;return void 0!==t.originalEvent.buttons&&0===t.originalEvent.buttons?void e.ontouchend(t):e.isScrolling?void(e.canTap=!1):(e.newPoints=a(t),void((e.opts||e.canPan)&&e.newPoints.length&&e.newPoints.length&&(e.isSwiping&&!0===e.isSwiping||t.preventDefault(),e.distanceX=s(e.newPoints[0],e.startPoints[0],\"x\"),e.distanceY=s(e.newPoints[0],e.startPoints[0],\"y\"),e.distance=s(e.newPoints[0],e.startPoints[0]),e.distance>0&&(e.isSwiping?e.onSwipe(t):e.isPanning?e.onPan():e.isZooming&&e.onZoom()))))},d.prototype.onSwipe=function(e){var a,s=this,r=s.instance,c=s.isSwiping,l=s.sliderStartPos.left||0;if(!0!==c)\"x\"==c&&(s.distanceX>0&&(s.instance.group.length<2||0===s.instance.current.index&&!s.instance.current.opts.loop)?l+=Math.pow(s.distanceX,.8):s.distanceX<0&&(s.instance.group.length<2||s.instance.current.index===s.instance.group.length-1&&!s.instance.current.opts.loop)?l-=Math.pow(-s.distanceX,.8):l+=s.distanceX),s.sliderLastPos={top:\"x\"==c?0:s.sliderStartPos.top+s.distanceY,left:l},s.requestId&&(i(s.requestId),s.requestId=null),s.requestId=o(function(){s.sliderLastPos&&(n.each(s.instance.slides,function(t,e){var o=e.pos-s.instance.currPos;n.fancybox.setTranslate(e.$slide,{top:s.sliderLastPos.top,left:s.sliderLastPos.left+o*s.canvasWidth+o*e.opts.gutter})}),s.$container.addClass(\"fancybox-is-sliding\"))});else if(Math.abs(s.distance)>10){if(s.canTap=!1,r.group.length<2&&s.opts.vertical?s.isSwiping=\"y\":r.isDragging||!1===s.opts.vertical||\"auto\"===s.opts.vertical&&n(t).width()>800?s.isSwiping=\"x\":(a=Math.abs(180*Math.atan2(s.distanceY,s.distanceX)/Math.PI),s.isSwiping=a>45&&a<135?\"y\":\"x\"),\"y\"===s.isSwiping&&n.fancybox.isMobile&&s.isScrollable)return void(s.isScrolling=!0);r.isDragging=s.isSwiping,s.startPoints=s.newPoints,n.each(r.slides,function(t,e){var o,i;n.fancybox.stop(e.$slide),o=n.fancybox.getTranslate(e.$slide),i=n.fancybox.getTranslate(r.$refs.stage),e.$slide.css({transform:\"\",opacity:\"\",\"transition-duration\":\"\"}).removeClass(\"fancybox-animated\").removeClass(function(t,e){return(e.match(/(^|\\s)fancybox-fx-\\S+/g)||[]).join(\" \")}),e.pos===r.current.pos&&(s.sliderStartPos.top=o.top-i.top,s.sliderStartPos.left=o.left-i.left),n.fancybox.setTranslate(e.$slide,{top:o.top-i.top,left:o.left-i.left})}),r.SlideShow&&r.SlideShow.isActive&&r.SlideShow.stop()}},d.prototype.onPan=function(){var t=this;if(s(t.newPoints[0],t.realPoints[0])<(n.fancybox.isMobile?10:5))return void(t.startPoints=t.newPoints);t.canTap=!1,t.contentLastPos=t.limitMovement(),t.requestId&&i(t.requestId),t.requestId=o(function(){n.fancybox.setTranslate(t.$content,t.contentLastPos)})},d.prototype.limitMovement=function(){var t,e,n,o,i,a,s=this,r=s.canvasWidth,c=s.canvasHeight,l=s.distanceX,d=s.distanceY,u=s.contentStartPos,f=u.left,p=u.top,h=u.width,g=u.height;return i=h>r?f+l:f,a=p+d,t=Math.max(0,.5*r-.5*h),e=Math.max(0,.5*c-.5*g),n=Math.min(r-h,.5*r-.5*h),o=Math.min(c-g,.5*c-.5*g),l>0&&i>t&&(i=t-1+Math.pow(-t+f+l,.8)||0),l<0&&i0&&a>e&&(a=e-1+Math.pow(-e+p+d,.8)||0),d<0&&aa?(t=t>0?0:t,t=ts?(e=e>0?0:e,e=e1&&(o.dMs>130&&s>10||s>50);o.sliderLastPos=null,\"y\"==t&&!e&&Math.abs(o.distanceY)>50?(n.fancybox.animate(o.instance.current.$slide,{top:o.sliderStartPos.top+o.distanceY+150*o.velocityY,opacity:0},200),i=o.instance.close(!0,250)):r&&o.distanceX>0?i=o.instance.previous(300):r&&o.distanceX<0&&(i=o.instance.next(300)),!1!==i||\"x\"!=t&&\"y\"!=t||o.instance.centerSlide(200),o.$container.removeClass(\"fancybox-is-sliding\")},d.prototype.endPanning=function(){var t,e,o,i=this;i.contentLastPos&&(!1===i.opts.momentum||i.dMs>350?(t=i.contentLastPos.left,e=i.contentLastPos.top):(t=i.contentLastPos.left+500*i.velocityX,e=i.contentLastPos.top+500*i.velocityY),o=i.limitPosition(t,e,i.contentStartPos.width,i.contentStartPos.height),o.width=i.contentStartPos.width,o.height=i.contentStartPos.height,n.fancybox.animate(i.$content,o,366))},d.prototype.endZooming=function(){var t,e,o,i,a=this,s=a.instance.current,r=a.newWidth,c=a.newHeight;a.contentLastPos&&(t=a.contentLastPos.left,e=a.contentLastPos.top,i={top:e,left:t,width:r,height:c,scaleX:1,scaleY:1},n.fancybox.setTranslate(a.$content,i),rs.width||c>s.height?a.instance.scaleToActual(a.centerPointStartX,a.centerPointStartY,150):(o=a.limitPosition(t,e,r,c),n.fancybox.animate(a.$content,o,150)))},d.prototype.onTap=function(e){var o,i=this,s=n(e.target),r=i.instance,c=r.current,l=e&&a(e)||i.startPoints,d=l[0]?l[0].x-n(t).scrollLeft()-i.stagePos.left:0,u=l[0]?l[0].y-n(t).scrollTop()-i.stagePos.top:0,f=function(t){var o=c.opts[t];if(n.isFunction(o)&&(o=o.apply(r,[c,e])),o)switch(o){case\"close\":r.close(i.startEvent);break;case\"toggleControls\":r.toggleControls();break;case\"next\":r.next();break;case\"nextOrClose\":r.group.length>1?r.next():r.close(i.startEvent);break;case\"zoom\":\"image\"==c.type&&(c.isLoaded||c.$ghost)&&(r.canPan()?r.scaleToFit():r.isScaledDown()?r.scaleToActual(d,u):r.group.length<2&&r.close(i.startEvent))}};if((!e.originalEvent||2!=e.originalEvent.button)&&(s.is(\"img\")||!(d>s[0].clientWidth+s.offset().left))){if(s.is(\".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container\"))o=\"Outside\";else if(s.is(\".fancybox-slide\"))o=\"Slide\";else{if(!r.current.$content||!r.current.$content.find(s).addBack().filter(s).length)return;o=\"Content\"}if(i.tapped){if(clearTimeout(i.tapped),i.tapped=null,Math.abs(d-i.tapX)>50||Math.abs(u-i.tapY)>50)return this;f(\"dblclick\"+o)}else i.tapX=d,i.tapY=u,c.opts[\"dblclick\"+o]&&c.opts[\"dblclick\"+o]!==c.opts[\"click\"+o]?i.tapped=setTimeout(function(){i.tapped=null,r.isAnimating||f(\"click\"+o)},500):f(\"click\"+o);return this}},n(e).on(\"onActivate.fb\",function(t,e){e&&!e.Guestures&&(e.Guestures=new d(e))}).on(\"beforeClose.fb\",function(t,e){e&&e.Guestures&&e.Guestures.destroy()})}(window,document,jQuery),function(t,e){\"use strict\";e.extend(!0,e.fancybox.defaults,{btnTpl:{slideShow:''},slideShow:{autoStart:!1,speed:3e3,progress:!0}});var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{timer:null,isActive:!1,$button:null,init:function(){var t=this,n=t.instance,o=n.group[n.currIndex].opts.slideShow;t.$button=n.$refs.toolbar.find(\"[data-fancybox-play]\").on(\"click\",function(){t.toggle()}),n.group.length<2||!o?t.$button.hide():o.progress&&(t.$progress=e('').appendTo(n.$refs.inner))},set:function(t){var n=this,o=n.instance,i=o.current;i&&(!0===t||i.opts.loop||o.currIndex'},fullScreen:{autoStart:!1}}),e(t).on(n.fullscreenchange,function(){var t=o.isFullscreen(),n=e.fancybox.getInstance();n&&(n.current&&\"image\"===n.current.type&&n.isAnimating&&(n.isAnimating=!1,n.update(!0,!0,0),n.isComplete||n.complete()),n.trigger(\"onFullscreenChange\",t),n.$refs.container.toggleClass(\"fancybox-is-fullscreen\",t),n.$refs.toolbar.find(\"[data-fancybox-fullscreen]\").toggleClass(\"fancybox-button--fsenter\",!t).toggleClass(\"fancybox-button--fsexit\",t))})}e(t).on({\"onInit.fb\":function(t,e){var i;if(!n)return void e.$refs.toolbar.find(\"[data-fancybox-fullscreen]\").remove();e&&e.group[e.currIndex].opts.fullScreen?(i=e.$refs.container,i.on(\"click.fb-fullscreen\",\"[data-fancybox-fullscreen]\",function(t){t.stopPropagation(),t.preventDefault(),o.toggle()}),e.opts.fullScreen&&!0===e.opts.fullScreen.autoStart&&o.request(),e.FullScreen=o):e&&e.$refs.toolbar.find(\"[data-fancybox-fullscreen]\").hide()},\"afterKeydown.fb\":function(t,e,n,o,i){e&&e.FullScreen&&70===i&&(o.preventDefault(),e.FullScreen.toggle())},\"beforeClose.fb\":function(t,e){e&&e.FullScreen&&e.$refs.container.hasClass(\"fancybox-is-fullscreen\")&&o.exit()}})}(document,jQuery),function(t,e){\"use strict\";var n=\"fancybox-thumbs\";e.fancybox.defaults=e.extend(!0,{btnTpl:{thumbs:''},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:\".fancybox-container\",axis:\"y\"}},e.fancybox.defaults);var o=function(t){this.init(t)};e.extend(o.prototype,{$button:null,$grid:null,$list:null,isVisible:!1,isActive:!1,init:function(t){var e=this,n=t.group,o=0;e.instance=t,e.opts=n[t.currIndex].opts.thumbs,t.Thumbs=e,e.$button=t.$refs.toolbar.find(\"[data-fancybox-thumbs]\");for(var i=0,a=n.length;i1));i++);o>1&&e.opts?(e.$button.removeAttr(\"style\").on(\"click\",function(){e.toggle()}),e.isActive=!0):e.$button.hide()},create:function(){var t,o=this,i=o.instance,a=o.opts.parentEl,s=[];o.$grid||(o.$grid=e('').appendTo(i.$refs.container.find(a).addBack().filter(a)),o.$grid.on(\"click\",\"a\",function(){i.jumpTo(e(this).attr(\"data-index\"))})),o.$list||(o.$list=e('').appendTo(o.$grid)),e.each(i.group,function(e,n){t=n.thumb,t||\"image\"!==n.type||(t=n.src),s.push('
\")}),o.$list[0].innerHTML=s.join(\"\"),\"x\"===o.opts.axis&&o.$list.width(parseInt(o.$grid.css(\"padding-right\"),10)+i.group.length*o.$list.children().eq(0).outerWidth(!0))},focus:function(t){var e,n,o=this,i=o.$list,a=o.$grid;o.instance.current&&(e=i.children().removeClass(\"fancybox-thumbs-active\").filter('[data-index=\"'+o.instance.current.index+'\"]').addClass(\"fancybox-thumbs-active\"),n=e.position(),\"y\"===o.opts.axis&&(n.top<0||n.top>i.height()-e.outerHeight())?i.stop().animate({scrollTop:i.scrollTop()+n.top},t):\"x\"===o.opts.axis&&(n.left
a.scrollLeft()+(a.width()-e.outerWidth()))&&i.parent().stop().animate({scrollLeft:n.left},t))},update:function(){var t=this;t.instance.$refs.container.toggleClass(\"fancybox-show-thumbs\",this.isVisible),t.isVisible?(t.$grid||t.create(),t.instance.trigger(\"onThumbsShow\"),t.focus(0)):t.$grid&&t.instance.trigger(\"onThumbsHide\"),t.instance.update()},hide:function(){this.isVisible=!1,this.update()},show:function(){this.isVisible=!0,this.update()},toggle:function(){this.isVisible=!this.isVisible,this.update()}}),e(t).on({\"onInit.fb\":function(t,e){var n;e&&!e.Thumbs&&(n=new o(e),n.isActive&&!0===n.opts.autoStart&&n.show())},\"beforeShow.fb\":function(t,e,n,o){var i=e&&e.Thumbs;i&&i.isVisible&&i.focus(o?0:250)},\"afterKeydown.fb\":function(t,e,n,o,i){var a=e&&e.Thumbs;a&&a.isActive&&71===i&&(o.preventDefault(),a.toggle())},\"beforeClose.fb\":function(t,e){var n=e&&e.Thumbs;n&&n.isVisible&&!1!==n.opts.hideOnClose&&n.$grid.hide()}})}(document,jQuery),function(t,e){\"use strict\";function n(t){var e={\"&\":\"&\",\"<\":\"<\",\">\":\">\",'\"':\""\",\"'\":\"'\",\"/\":\"/\",\"`\":\"`\",\"=\":\"=\"};return String(t).replace(/[&<>\"'`=\\/]/g,function(t){return e[t]})}e.extend(!0,e.fancybox.defaults,{btnTpl:{share:''},share:{url:function(t,e){return!t.currentHash&&\"inline\"!==e.type&&\"html\"!==e.type&&(e.origSrc||e.src)||window.location},\r\ntpl:''}}),e(t).on(\"click\",\"[data-fancybox-share]\",function(){var t,o,i=e.fancybox.getInstance(),a=i.current||null;a&&(\"function\"===e.type(a.opts.share.url)&&(t=a.opts.share.url.apply(a,[i,a])),o=a.opts.share.tpl.replace(/\\{\\{media\\}\\}/g,\"image\"===a.type?encodeURIComponent(a.src):\"\").replace(/\\{\\{url\\}\\}/g,encodeURIComponent(t)).replace(/\\{\\{url_raw\\}\\}/g,n(t)).replace(/\\{\\{descr\\}\\}/g,i.$caption?encodeURIComponent(i.$caption.text()):\"\"),e.fancybox.open({src:i.translate(i,o),type:\"html\",opts:{touch:!1,animationEffect:!1,afterLoad:function(t,e){i.$refs.container.one(\"beforeClose.fb\",function(){t.close(null,0)}),e.$content.find(\".fancybox-share__button\").click(function(){return window.open(this.href,\"Share\",\"width=550, height=450\"),!1})},mobile:{autoFocus:!1}}}))})}(document,jQuery),function(t,e,n){\"use strict\";function o(){var e=t.location.hash.substr(1),n=e.split(\"-\"),o=n.length>1&&/^\\+?\\d+$/.test(n[n.length-1])?parseInt(n.pop(-1),10)||1:1,i=n.join(\"-\");return{hash:e,index:o<1?1:o,gallery:i}}function i(t){\"\"!==t.gallery&&n(\"[data-fancybox='\"+n.escapeSelector(t.gallery)+\"']\").eq(t.index-1).focus().trigger(\"click.fb-start\")}function a(t){var e,n;return!!t&&(e=t.current?t.current.opts:t.opts,\"\"!==(n=e.hash||(e.$orig?e.$orig.data(\"fancybox\")||e.$orig.data(\"fancybox-trigger\"):\"\"))&&n)}n.escapeSelector||(n.escapeSelector=function(t){return(t+\"\").replace(/([\\0-\\x1f\\x7f]|^-?\\d)|^-$|[^\\x80-\\uFFFF\\w-]/g,function(t,e){return e?\"\\0\"===t?\"�\":t.slice(0,-1)+\"\\\\\"+t.charCodeAt(t.length-1).toString(16)+\" \":\"\\\\\"+t})}),n(function(){!1!==n.fancybox.defaults.hash&&(n(e).on({\"onInit.fb\":function(t,e){var n,i;!1!==e.group[e.currIndex].opts.hash&&(n=o(),(i=a(e))&&n.gallery&&i==n.gallery&&(e.currIndex=n.index-1))},\"beforeShow.fb\":function(n,o,i,s){var r;i&&!1!==i.opts.hash&&(r=a(o))&&(o.currentHash=r+(o.group.length>1?\"-\"+(i.index+1):\"\"),t.location.hash!==\"#\"+o.currentHash&&(s&&!o.origHash&&(o.origHash=t.location.hash),o.hashTimer&&clearTimeout(o.hashTimer),o.hashTimer=setTimeout(function(){\"replaceState\"in t.history?(t.history[s?\"pushState\":\"replaceState\"]({},e.title,t.location.pathname+t.location.search+\"#\"+o.currentHash),s&&(o.hasCreatedHistory=!0)):t.location.hash=o.currentHash,o.hashTimer=null},300)))},\"beforeClose.fb\":function(n,o,i){i&&!1!==i.opts.hash&&(clearTimeout(o.hashTimer),o.currentHash&&o.hasCreatedHistory?t.history.back():o.currentHash&&(\"replaceState\"in t.history?t.history.replaceState({},e.title,t.location.pathname+t.location.search+(o.origHash||\"\")):t.location.hash=o.origHash),o.currentHash=null)}}),n(t).on(\"hashchange.fb\",function(){var t=o(),e=null;n.each(n(\".fancybox-container\").get().reverse(),function(t,o){var i=n(o).data(\"FancyBox\");if(i&&i.currentHash)return e=i,!1}),e?e.currentHash===t.gallery+\"-\"+t.index||1===t.index&&e.currentHash==t.gallery||(e.currentHash=null,e.close()):\"\"!==t.gallery&&i(t)}),setTimeout(function(){n.fancybox.getInstance()||i(o())},50))})}(window,document,jQuery),function(t,e){\"use strict\";var n=(new Date).getTime();e(t).on({\"onInit.fb\":function(t,e,o){e.$refs.stage.on(\"mousewheel DOMMouseScroll wheel MozMousePixelScroll\",function(t){var o=e.current,i=(new Date).getTime();e.group.length<2||!1===o.opts.wheel||\"auto\"===o.opts.wheel&&\"image\"!==o.type||(t.preventDefault(),t.stopPropagation(),o.$slide.hasClass(\"fancybox-animated\")||(t=t.originalEvent||t,i-n<250||(n=i,e[(-t.deltaY||-t.deltaX||t.wheelDelta||-t.detail)<0?\"next\":\"previous\"]())))})}})}(document,jQuery);","function createCountdownElm(counter, label) {\r\n return \"\" + counter + \"\" + label + \"
\";\r\n};\r\n\r\n$(document).ready(function () {\r\n $('.module-countdown-banner-countdown').each(function () {\r\n\r\n var countdownContainer = $(this);\r\n var endDateRaw = $('.module-countdown-hidden-enddate', countdownContainer).val();\r\n var labelDays = $('.module-countdown-hidden-days', countdownContainer).val();\r\n var labelHours = $('.module-countdown-hidden-hours', countdownContainer).val();\r\n var labelMins = $('.module-countdown-hidden-mins', countdownContainer).val();\r\n var labelSecs = $('.module-countdown-hidden-secs', countdownContainer).val();\r\n\r\n // Set the date we're counting down to\r\n var countDownDate = new Date(endDateRaw).getTime();\r\n\r\n // Update the count down every 1 second\r\n var x = setInterval(function () {\r\n\r\n // Get todays date and time\r\n var now = new Date().getTime();\r\n\r\n // Find the distance between now an the count down date\r\n var distance = countDownDate - now;\r\n\r\n // Time calculations for days, hours, minutes and seconds\r\n var days = Math.floor(distance / (1000 * 60 * 60 * 24));\r\n var hours = Math.floor((distance % (1000 * 60 * 60 * 24)) / (1000 * 60 * 60));\r\n var minutes = Math.floor((distance % (1000 * 60 * 60)) / (1000 * 60));\r\n var seconds = Math.floor((distance % (1000 * 60)) / 1000);\r\n\r\n // If the count down is finished, clear and set to 0\r\n if (distance <= 0) {\r\n clearInterval(x);\r\n days = hours = minutes = seconds = 0;\r\n }\r\n\r\n // Update countdown HTML\r\n var newHtml = createCountdownElm(days, labelDays) +\r\n createCountdownElm(hours, labelHours) +\r\n createCountdownElm(minutes, labelMins) +\r\n createCountdownElm(seconds, labelSecs);\r\n\r\n countdownContainer.html(newHtml);\r\n }, 1000);\r\n\r\n });\r\n});","$(document).ready(function () {\r\n\r\n var expandableFocusText = $(\".module-focustext-content-expandable-container\");\r\n\r\n if (expandableFocusText.length > 0) {\r\n\r\n expandableFocusText.each(function () {\r\n\r\n var expandableFocusTextItem = this;\r\n var expandableText = $(\".module-focustext-content-expandable\", expandableFocusTextItem);\r\n\r\n if (expandableText.innerHeight() > 220) {\r\n\r\n expandableText.css(\"max-height\", \"180px\").wrap(\"\").after(\"\");\r\n\r\n var expandableTextButton = $(\".module-focustext-content-expand-button\", expandableFocusTextItem);\r\n\r\n expandableTextButton.on('click', function (event) {\r\n event.preventDefault();\r\n expandableText.css(\"max-height\", \"100%\");\r\n $(expandableFocusTextItem).addClass(\"module-focustext-content-expandable-expanded\");\r\n expandableTextButton.hide();\r\n $(\".module-focustext-content-expandable-overlay\", expandableFocusTextItem).hide();\r\n });\r\n\r\n expandableTextButton.show();\r\n }\r\n })\r\n }\r\n});","$(document).ready(function() {\r\n var collapsibleContentComponent = $(\r\n \"body:not(.website-state-edit) .module-text-accordion-content\"\r\n );\r\n\r\n if (collapsibleContentComponent.length > 0) {\r\n collapsibleContentComponent.hide();\r\n\r\n //WRAP CONTENT BETWEEN H2 HEADINGS IN DIVS\r\n $(\".module-text-accordion-content h2\").each(function() {\r\n $(this)\r\n .attr(\"tabindex\", \"0\")\r\n .addClass(\"closed\")\r\n .nextUntil(\"h2\")\r\n .wrapAll(\r\n ''\r\n );\r\n });\r\n\r\n //ADD CLICK EVENT TO SHOW/HIDE CONTENT BELOW HEADERS\r\n $(\".module-text-accordion-content h2\").on(\"click\", function(event) {\r\n event.preventDefault();\r\n $(this)\r\n .toggleClass(\"closed\")\r\n .next()\r\n .slideToggle(\"fast\")\r\n .trigger(\"accordionToggled\");\r\n });\r\n\r\n //HANDLE KEYPRESS ON COLLAPSIBLE HEADERS AND TOGGLE-ALL\r\n $(\".module-text-accordion-content h2\").keypress(function(event) {\r\n if (event.which == 13 || event.which == 32) {\r\n event.preventDefault();\r\n this.click();\r\n }\r\n });\r\n\r\n //SHOW AFTER TRANSFORMATION\r\n collapsibleContentComponent.show();\r\n }\r\n});\r\n","$(document).ready(function () {\r\n\r\n var collapsibleContentComponent = $(\"body:not(.website-state-edit) .module-agenda-accordion-content\");\r\n\r\n if (collapsibleContentComponent.length > 0) {\r\n\r\n collapsibleContentComponent.hide();\r\n\r\n //WRAP CONTENT BETWEEN H2 HEADINGS IN DIVS\r\n $(\".module-agenda-sheet-item-clickable-container\").each(function () {\r\n $(this).attr('tabindex', '0').addClass('closed').next().hide();\r\n });\r\n\r\n //ADD CLICK EVENT TO SHOW/HIDE CONTENT BELOW HEADERS\r\n $(\".module-agenda-sheet-item-clickable-container\").on('click', function (event) {\r\n event.preventDefault();\r\n $(this).toggleClass('closed').next().slideToggle('fast');\r\n });\r\n\r\n $(\".module-agenda-accordion-content\").each(function () {\r\n\r\n var currentAgenda = this;\r\n //$(\".js-module-agenda-sheet-button\",this).prependTo(this);\r\n $(\".js-module-agenda-sheet-button\", $(this)).each(function () {\r\n\r\n $(this).appendTo($(\".js-module-agenda-button-container\", currentAgenda));\r\n\r\n var sheetId = this.id.replace(\"-button\", \"\");\r\n\r\n $(this).on('click', function (event) {\r\n event.preventDefault();\r\n\r\n //ONLY CLICK WHEN CHANGING SHEET\r\n var sheetElm = $('#' + sheetId);\r\n if (sheetElm.is(':visible')) return;\r\n\r\n $('.module-agenda-sheet', currentAgenda).hide();\r\n sheetElm.slideDown('fast');\r\n $(\".btn-default\", currentAgenda).removeClass('btn-default').addClass('btn-outline');\r\n $(this).removeClass('btn-outline').addClass('btn-default');\r\n });\r\n });\r\n\r\n $(\".module-agenda-sheet:not(:first)\", currentAgenda).hide();\r\n $(\".js-module-agenda-sheet-button:first\", currentAgenda).addClass('btn-default').removeClass('btn-outline');\r\n\r\n });\r\n\r\n //HANDLE KEYPRESS ON COLLAPSIBLE HEADERS\r\n $('.module-agenda-sheet-item-clickable-container').keypress(function (event) {\r\n if (event.which == 13 || event.which == 32) {\r\n event.preventDefault();\r\n this.click();\r\n }\r\n });\r\n\r\n //HANDLE KEYPRESS ON BUTTONS\r\n $('.js-module-agenda-sheet-button').keypress(function (event) {\r\n if (event.which == 13 || event.which == 32) {\r\n event.preventDefault();\r\n this.click();\r\n }\r\n });\r\n\r\n //SHOW AFTER TRANSFORMATION\r\n collapsibleContentComponent.show();\r\n\r\n }\r\n});","(function (_superfunction) {\r\n Date.prototype.toString = function (format, language) {\r\n if (!format) return _superfunction.call(this);\r\n\r\n var langs = {\r\n 'en-US': {\r\n days: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],\r\n months: ['Janurary', 'Februrary', 'Marts', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December']\r\n },\r\n 'da-DK': {\r\n days: ['søndag', 'mandag', 'tirsdag', 'onsdag', 'torsdag', 'fredag', 'lørdag'],\r\n months: ['januar', 'februar', 'marts', 'april', 'maj', 'juni', 'july', 'august', 'september', 'october', 'november', 'december']\r\n }\r\n }\r\n var lang = langs[language] || (typeof (navigator) !== 'undefined' ? langs[navigator.language] : false) || langs['en-US'];\r\n // Standard types\r\n return format\r\n .replace(/{yyyy}|{year}/g, this.getYear() + 1900)\r\n .replace(/{yy}/g, ('0' + (this.getYear() - 100)).slice(-2))\r\n .replace(/{MMMM}/g, lang.months[this.getMonth()])\r\n .replace(/{MMM}/g, lang.months[this.getMonth()].substr(0, 3))\r\n .replace(/{MM}|{month}/g, ('0' + (this.getMonth() + 1)).slice(-2))\r\n .replace(/{dddd}/g, lang.days[this.getDay()])\r\n .replace(/{ddd}/g, lang.days[this.getDay()].substr(0, 3))\r\n .replace(/{dd}|{date}/g, ('0' + this.getDate()).slice(-2))\r\n .replace(/{d}/g, this.getDate())\r\n .replace(/{hh}|{hour}/g, ('0' + this.getHours()).slice(-2))\r\n .replace(/{mm}|{minute}/g, ('0' + this.getMinutes()).slice(-2))\r\n .replace(/{ss}|{second}/g, ('0' + this.getSeconds()).slice(-2))\r\n .replace(/{ms}|{millisecond}/g, ('00' + this.getMilliseconds()).slice(-3))\r\n .replace(/{wd}|{weekday}|{dayofweek}/g, this.getDay())\r\n .replace(/{time}/g, this.getTime())\r\n .replace(/{.+}/g, undefined);\r\n };\r\n})(Date.prototype.toString);","$(document).ready(function () {\r\n if ($(\"form[data-wffm]\").length) {\r\n $(\"input:radio\").each(function () {\r\n $(this).parent().append(\"\");\r\n });\r\n $(\"input:checkbox\").each(function () {\r\n $(this).parent().append(\"\");\r\n });\r\n }\r\n});\r\n","window.onload = () => {\r\n (function(window, document, undefined) {\r\n \"use strict\";\r\n\r\n /**********************************\\\r\n - KEEPING TRACK OF INPUT METHODS\r\n \\**********************************/\r\n var tabActive = false;\r\n\r\n //KEY EVENTS\r\n function keyDownHandler(e) {\r\n tabActive = e.keyCode === 9 || e.which === 9;\r\n }\r\n\r\n function keyUpHandler(e) {\r\n tabActive = false;\r\n }\r\n\r\n document.documentElement.addEventListener('keydown', keyDownHandler, true);\r\n document.documentElement.addEventListener('keyup', keyUpHandler, true);\r\n\r\n\r\n /***************************************\\\r\n - UPDATING ATTRIBUTES ON FOCUS & BLUR\r\n \\***************************************/\r\n var focusableElems = Array.prototype.slice.call(\r\n document.querySelectorAll(\"a, input, textarea, select, button, [tabindex]\")\r\n );\r\n\r\n focusableElems.forEach(function(elem) {\r\n elem.addEventListener(\"focus\",\r\n function(e) {\r\n document.documentElement.dataset.focusSource = this.dataset.focusSource = tabActive ? \"tab\" : \"\";\r\n });\r\n\r\n elem.addEventListener(\"blur\",\r\n function(e) {\r\n document.documentElement.dataset.focusSource = this.dataset.focusSource = \"\";\r\n });\r\n });\r\n\r\n })(this, document)\r\n};","import \"../_lib/stacktable/stacktable.custom.js\"\r\nimport \"../_lib/datatables/datatables.js\"\r\n\r\nfunction showHideStackedTables(tables) {\r\n tables.each(function () {\r\n $(this).show();\r\n\r\n if ($(this).width() > $(this).parent().width()) {\r\n $(this).hide();\r\n\r\n if ($(this).prev().hasClass('card-table-container'))\r\n $(this).prev().show();\r\n }\r\n\r\n else {\r\n $(this).show();\r\n\r\n if ($(this).prev().hasClass('card-table-container'))\r\n $(this).prev().hide();\r\n }\r\n });\r\n}\r\n\r\n$(document).ready(function () {\r\n\r\n //DISABLE IN WEB EDIT\r\n if ($(\"body\").hasClass(\"website-state-edit\")) return;\r\n\r\n $('table.table-sortable').each(function() {\r\n var thisTable = $(this);\r\n var thisDataTable = thisTable.DataTable({\r\n \"autoWidth\": false\r\n });\r\n\r\n thisDataTable.on('draw.dt', function() {\r\n if (thisTable.hasClass('table-responsive')) {\r\n thisTable.removeClass('large-only').removeClass('stacktable').prev().remove();\r\n thisTable.cardtable({ myClass: 'card-table-container' });\r\n showHideStackedTables(thisTable);\r\n }\r\n \r\n });\r\n\r\n });\r\n\r\n // ADD SORTING AND FILTERING TO TABLES WITH table-sortable CLASS\r\n //var sortableSourceTables = $('table.table-sortable');\r\n //sortableSourceTables.DataTable();\r\n\r\n //$('#myTable').on( 'draw.dt', function () {\r\n // alert( 'Table redrawn' );\r\n //} );\r\n\r\n // ADD STACKTABLE TO TABLES WITH table-responsive CLASS\r\n var responsiveSourceTables = $('table.table-responsive');\r\n responsiveSourceTables.cardtable({ myClass: 'card-table-container' });\r\n\r\n responsiveSourceTables = $('table.table-responsive.large-only');\r\n showHideStackedTables(responsiveSourceTables);\r\n\r\n $(window).resize(function () {\r\n showHideStackedTables(responsiveSourceTables);\r\n });\r\n});","/**\r\n * stacktable.js\r\n * Author & copyright (c) 2012: John Polacek\r\n * CardTable by: Justin McNally (2015)\r\n * MIT license\r\n *\r\n * Page: http://johnpolacek.github.com/stacktable.js\r\n * Repo: https://github.com/johnpolacek/stacktable.js/\r\n *\r\n * jQuery plugin for stacking tables on small screens\r\n * Requires jQuery version 1.7 or above\r\n *\r\n */\r\n; (function ($) {\r\n $.fn.cardtable = function (options) {\r\n var $tables = this,\r\n defaults = { headIndex: 0 },\r\n settings = $.extend({}, defaults, options),\r\n headIndex;\r\n\r\n // checking the \"headIndex\" option presence... or defaults it to 0\r\n if (options && options.headIndex)\r\n headIndex = options.headIndex;\r\n else\r\n headIndex = 0;\r\n\r\n return $tables.each(function () {\r\n var $table = $(this);\r\n if ($table.hasClass('stacktable')) {\r\n return;\r\n }\r\n var table_css = $(this).prop('class');\r\n var $stacktable = $('');\r\n if (typeof settings.myClass !== 'undefined') $stacktable.addClass(settings.myClass);\r\n var markup = '';\r\n var $caption, $topRow, headMarkup, bodyMarkup, tr_class;\r\n\r\n $table.addClass('stacktable large-only');\r\n\r\n $caption = $table.find(\">caption\").clone();\r\n $topRow = $table.find('>thead>tr,>tbody>tr,>tfoot>tr,>tr').eq(0);\r\n\r\n // avoid duplication when paginating\r\n $table.siblings().filter('.small-only').remove();\r\n\r\n // using rowIndex and cellIndex in order to reduce ambiguity\r\n $table.find('>tbody>tr').each(function () {\r\n\r\n // declaring headMarkup and bodyMarkup, to be used for separately head and body of single records\r\n headMarkup = '';\r\n bodyMarkup = '';\r\n tr_class = $(this).prop('class');\r\n // for the first row, \"headIndex\" cell is the head of the table\r\n // for the other rows, put the \"headIndex\" cell as the head for that row\r\n // then iterate through the key/values\r\n $(this).find('>td,>th').each(function (cellIndex) {\r\n if ($(this).html() !== '') {\r\n bodyMarkup += '';\r\n if ($topRow.find('>td,>th').eq(cellIndex).html()) {\r\n bodyMarkup += '| ' + $topRow.find('>td,>th').eq(cellIndex).html() + ' | ';\r\n } else {\r\n bodyMarkup += ' | ';\r\n }\r\n bodyMarkup += '' + $(this).html() + ' | ';\r\n bodyMarkup += '
';\r\n }\r\n });\r\n\r\n markup += '' + headMarkup + bodyMarkup + '
';\r\n });\r\n\r\n $table.find('>tfoot>tr').each(function () {\r\n\r\n // declaring headMarkup and bodyMarkup, to be used for separately head and body of single records\r\n headMarkup = '';\r\n bodyMarkup = '';\r\n tr_class = $(this).prop('class');\r\n // for the first row, \"headIndex\" cell is the head of the table\r\n // for the other rows, put the \"headIndex\" cell as the head for that row\r\n // then iterate through the key/values\r\n $(this).find('>td,>th').each(function (cellIndex) {\r\n if ($(this).html() !== '') {\r\n bodyMarkup += '';\r\n if ($topRow.find('>td,>th').eq(cellIndex).html()) {\r\n bodyMarkup += '| ' + $topRow.find('>td,>th').eq(cellIndex).html() + ' | ';\r\n } else {\r\n bodyMarkup += ' | ';\r\n }\r\n bodyMarkup += '' + $(this).html() + ' | ';\r\n bodyMarkup += '
';\r\n }\r\n });\r\n\r\n markup += '' + headMarkup + bodyMarkup + '
';\r\n });\r\n\r\n $stacktable.prepend($caption);\r\n $stacktable.append($(markup));\r\n $table.before($stacktable);\r\n });\r\n };\r\n\r\n}(jQuery));\r\n","/*\r\n * This combined file was created by the DataTables downloader builder:\r\n * https://datatables.net/download\r\n *\r\n * To rebuild or modify this file with the latest versions of the included\r\n * software please visit:\r\n * https://datatables.net/download/#dt/dt-1.10.16\r\n *\r\n * Included libraries:\r\n * DataTables 1.10.16\r\n */\r\n\r\n/*! DataTables 1.10.16\r\n * ©2008-2017 SpryMedia Ltd - datatables.net/license\r\n */\r\n\r\n/**\r\n * @summary DataTables\r\n * @description Paginate, search and order HTML tables\r\n * @version 1.10.16\r\n * @file jquery.dataTables.js\r\n * @author SpryMedia Ltd\r\n * @contact www.datatables.net\r\n * @copyright Copyright 2008-2017 SpryMedia Ltd.\r\n *\r\n * This source file is free software, available under the following license:\r\n * MIT license - http://datatables.net/license\r\n *\r\n * This source file is distributed in the hope that it will be useful, but\r\n * WITHOUT ANY WARRANTY; without even the implied warranty of MERCHANTABILITY\r\n * or FITNESS FOR A PARTICULAR PURPOSE. See the license files for details.\r\n *\r\n * For details please refer to: http://www.datatables.net\r\n */\r\n\r\n/*jslint evil: true, undef: true, browser: true */\r\n/*globals $,require,jQuery,define,_selector_run,_selector_opts,_selector_first,_selector_row_indexes,_ext,_Api,_api_register,_api_registerPlural,_re_new_lines,_re_html,_re_formatted_numeric,_re_escape_regex,_empty,_intVal,_numToDecimal,_isNumber,_isHtml,_htmlNumeric,_pluck,_pluck_order,_range,_stripHtml,_unique,_fnBuildAjax,_fnAjaxUpdate,_fnAjaxParameters,_fnAjaxUpdateDraw,_fnAjaxDataSrc,_fnAddColumn,_fnColumnOptions,_fnAdjustColumnSizing,_fnVisibleToColumnIndex,_fnColumnIndexToVisible,_fnVisbleColumns,_fnGetColumns,_fnColumnTypes,_fnApplyColumnDefs,_fnHungarianMap,_fnCamelToHungarian,_fnLanguageCompat,_fnBrowserDetect,_fnAddData,_fnAddTr,_fnNodeToDataIndex,_fnNodeToColumnIndex,_fnGetCellData,_fnSetCellData,_fnSplitObjNotation,_fnGetObjectDataFn,_fnSetObjectDataFn,_fnGetDataMaster,_fnClearTable,_fnDeleteIndex,_fnInvalidate,_fnGetRowElements,_fnCreateTr,_fnBuildHead,_fnDrawHead,_fnDraw,_fnReDraw,_fnAddOptionsHtml,_fnDetectHeader,_fnGetUniqueThs,_fnFeatureHtmlFilter,_fnFilterComplete,_fnFilterCustom,_fnFilterColumn,_fnFilter,_fnFilterCreateSearch,_fnEscapeRegex,_fnFilterData,_fnFeatureHtmlInfo,_fnUpdateInfo,_fnInfoMacros,_fnInitialise,_fnInitComplete,_fnLengthChange,_fnFeatureHtmlLength,_fnFeatureHtmlPaginate,_fnPageChange,_fnFeatureHtmlProcessing,_fnProcessingDisplay,_fnFeatureHtmlTable,_fnScrollDraw,_fnApplyToChildren,_fnCalculateColumnWidths,_fnThrottle,_fnConvertToWidth,_fnGetWidestNode,_fnGetMaxLenString,_fnStringToCss,_fnSortFlatten,_fnSort,_fnSortAria,_fnSortListener,_fnSortAttachListener,_fnSortingClasses,_fnSortData,_fnSaveState,_fnLoadState,_fnSettingsFromNode,_fnLog,_fnMap,_fnBindAction,_fnCallbackReg,_fnCallbackFire,_fnLengthOverflow,_fnRenderer,_fnDataSource,_fnRowAttributes*/\r\n\r\n(function( factory ) {\r\n\t\"use strict\";\r\n\r\n\tif ( typeof define === 'function' && define.amd ) {\r\n\t\t// AMD\r\n\t\tdefine( ['jquery'], function ( $ ) {\r\n\t\t\treturn factory( $, window, document );\r\n\t\t} );\r\n\t}\r\n\telse if ( typeof exports === 'object' ) {\r\n\t\t// CommonJS\r\n\t\tmodule.exports = function (root, $) {\r\n\t\t\tif ( ! root ) {\r\n\t\t\t\t// CommonJS environments without a window global must pass a\r\n\t\t\t\t// root. This will give an error otherwise\r\n\t\t\t\troot = window;\r\n\t\t\t}\r\n\r\n\t\t\tif ( ! $ ) {\r\n\t\t\t\t$ = typeof window !== 'undefined' ? // jQuery's factory checks for a global window\r\n\t\t\t\t\trequire('jquery') :\r\n\t\t\t\t\trequire('jquery')( root );\r\n\t\t\t}\r\n\r\n\t\t\treturn factory( $, root, root.document );\r\n\t\t};\r\n\t}\r\n\telse {\r\n\t\t// Browser\r\n\t\tfactory( jQuery, window, document );\r\n\t}\r\n}\r\n(function( $, window, document, undefined ) {\r\n\t\"use strict\";\r\n\r\n\t/**\r\n\t * DataTables is a plug-in for the jQuery Javascript library. It is a highly\r\n\t * flexible tool, based upon the foundations of progressive enhancement,\r\n\t * which will add advanced interaction controls to any HTML table. For a\r\n\t * full list of features please refer to\r\n\t * [DataTables.net](href=\"http://datatables.net).\r\n\t *\r\n\t * Note that the `DataTable` object is not a global variable but is aliased\r\n\t * to `jQuery.fn.DataTable` and `jQuery.fn.dataTable` through which it may\r\n\t * be accessed.\r\n\t *\r\n\t * @class\r\n\t * @param {object} [init={}] Configuration object for DataTables. Options\r\n\t * are defined by {@link DataTable.defaults}\r\n\t * @requires jQuery 1.7+\r\n\t *\r\n\t * @example\r\n\t * // Basic initialisation\r\n\t * $(document).ready( function {\r\n\t * $('#example').dataTable();\r\n\t * } );\r\n\t *\r\n\t * @example\r\n\t * // Initialisation with configuration options - in this case, disable\r\n\t * // pagination and sorting.\r\n\t * $(document).ready( function {\r\n\t * $('#example').dataTable( {\r\n\t * \"paginate\": false,\r\n\t * \"sort\": false\r\n\t * } );\r\n\t * } );\r\n\t */\r\n\tvar DataTable = function ( options )\r\n\t{\r\n\t\t/**\r\n\t\t * Perform a jQuery selector action on the table's TR elements (from the tbody) and\r\n\t\t * return the resulting jQuery object.\r\n\t\t * @param {string|node|jQuery} sSelector jQuery selector or node collection to act on\r\n\t\t * @param {object} [oOpts] Optional parameters for modifying the rows to be included\r\n\t\t * @param {string} [oOpts.filter=none] Select TR elements that meet the current filter\r\n\t\t * criterion (\"applied\") or all TR elements (i.e. no filter).\r\n\t\t * @param {string} [oOpts.order=current] Order of the TR elements in the processed array.\r\n\t\t * Can be either 'current', whereby the current sorting of the table is used, or\r\n\t\t * 'original' whereby the original order the data was read into the table is used.\r\n\t\t * @param {string} [oOpts.page=all] Limit the selection to the currently displayed page\r\n\t\t * (\"current\") or not (\"all\"). If 'current' is given, then order is assumed to be\r\n\t\t * 'current' and filter is 'applied', regardless of what they might be given as.\r\n\t\t * @returns {object} jQuery object, filtered by the given selector.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Highlight every second row\r\n\t\t * oTable.$('tr:odd').css('backgroundColor', 'blue');\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Filter to rows with 'Webkit' in them, add a background colour and then\r\n\t\t * // remove the filter, thus highlighting the 'Webkit' rows only.\r\n\t\t * oTable.fnFilter('Webkit');\r\n\t\t * oTable.$('tr', {\"search\": \"applied\"}).css('backgroundColor', 'blue');\r\n\t\t * oTable.fnFilter('');\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.$ = function ( sSelector, oOpts )\r\n\t\t{\r\n\t\t\treturn this.api(true).$( sSelector, oOpts );\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Almost identical to $ in operation, but in this case returns the data for the matched\r\n\t\t * rows - as such, the jQuery selector used should match TR row nodes or TD/TH cell nodes\r\n\t\t * rather than any descendants, so the data can be obtained for the row/cell. If matching\r\n\t\t * rows are found, the data returned is the original data array/object that was used to\r\n\t\t * create the row (or a generated array if from a DOM source).\r\n\t\t *\r\n\t\t * This method is often useful in-combination with $ where both functions are given the\r\n\t\t * same parameters and the array indexes will match identically.\r\n\t\t * @param {string|node|jQuery} sSelector jQuery selector or node collection to act on\r\n\t\t * @param {object} [oOpts] Optional parameters for modifying the rows to be included\r\n\t\t * @param {string} [oOpts.filter=none] Select elements that meet the current filter\r\n\t\t * criterion (\"applied\") or all elements (i.e. no filter).\r\n\t\t * @param {string} [oOpts.order=current] Order of the data in the processed array.\r\n\t\t * Can be either 'current', whereby the current sorting of the table is used, or\r\n\t\t * 'original' whereby the original order the data was read into the table is used.\r\n\t\t * @param {string} [oOpts.page=all] Limit the selection to the currently displayed page\r\n\t\t * (\"current\") or not (\"all\"). If 'current' is given, then order is assumed to be\r\n\t\t * 'current' and filter is 'applied', regardless of what they might be given as.\r\n\t\t * @returns {array} Data for the matched elements. If any elements, as a result of the\r\n\t\t * selector, were not TR, TD or TH elements in the DataTable, they will have a null\r\n\t\t * entry in the array.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Get the data from the first row in the table\r\n\t\t * var data = oTable._('tr:first');\r\n\t\t *\r\n\t\t * // Do something useful with the data\r\n\t\t * alert( \"First cell is: \"+data[0] );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Filter to 'Webkit' and get all data for\r\n\t\t * oTable.fnFilter('Webkit');\r\n\t\t * var data = oTable._('tr', {\"search\": \"applied\"});\r\n\t\t *\r\n\t\t * // Do something with the data\r\n\t\t * alert( data.length+\" rows matched the search\" );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis._ = function ( sSelector, oOpts )\r\n\t\t{\r\n\t\t\treturn this.api(true).rows( sSelector, oOpts ).data();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Create a DataTables Api instance, with the currently selected tables for\r\n\t\t * the Api's context.\r\n\t\t * @param {boolean} [traditional=false] Set the API instance's context to be\r\n\t\t * only the table referred to by the `DataTable.ext.iApiIndex` option, as was\r\n\t\t * used in the API presented by DataTables 1.9- (i.e. the traditional mode),\r\n\t\t * or if all tables captured in the jQuery object should be used.\r\n\t\t * @return {DataTables.Api}\r\n\t\t */\r\n\t\tthis.api = function ( traditional )\r\n\t\t{\r\n\t\t\treturn traditional ?\r\n\t\t\t\tnew _Api(\r\n\t\t\t\t\t_fnSettingsFromNode( this[ _ext.iApiIndex ] )\r\n\t\t\t\t) :\r\n\t\t\t\tnew _Api( this );\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Add a single new row or multiple rows of data to the table. Please note\r\n\t\t * that this is suitable for client-side processing only - if you are using\r\n\t\t * server-side processing (i.e. \"bServerSide\": true), then to add data, you\r\n\t\t * must add it to the data source, i.e. the server-side, through an Ajax call.\r\n\t\t * @param {array|object} data The data to be added to the table. This can be:\r\n\t\t * \r\n\t\t * - 1D array of data - add a single row with the data provided
\r\n\t\t * - 2D array of arrays - add multiple rows in a single call
\r\n\t\t * - object - data object when using mData
\r\n\t\t * - array of objects - multiple data objects when using mData
\r\n\t\t *
\r\n\t\t * @param {bool} [redraw=true] redraw the table or not\r\n\t\t * @returns {array} An array of integers, representing the list of indexes in\r\n\t\t * aoData ({@link DataTable.models.oSettings}) that have been added to\r\n\t\t * the table.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Global var for counter\r\n\t\t * var giCount = 2;\r\n\t\t *\r\n\t\t * $(document).ready(function() {\r\n\t\t * $('#example').dataTable();\r\n\t\t * } );\r\n\t\t *\r\n\t\t * function fnClickAddRow() {\r\n\t\t * $('#example').dataTable().fnAddData( [\r\n\t\t * giCount+\".1\",\r\n\t\t * giCount+\".2\",\r\n\t\t * giCount+\".3\",\r\n\t\t * giCount+\".4\" ]\r\n\t\t * );\r\n\t\t *\r\n\t\t * giCount++;\r\n\t\t * }\r\n\t\t */\r\n\t\tthis.fnAddData = function( data, redraw )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\r\n\t\t\t/* Check if we want to add multiple rows or not */\r\n\t\t\tvar rows = $.isArray(data) && ( $.isArray(data[0]) || $.isPlainObject(data[0]) ) ?\r\n\t\t\t\tapi.rows.add( data ) :\r\n\t\t\t\tapi.row.add( data );\r\n\t\t\r\n\t\t\tif ( redraw === undefined || redraw ) {\r\n\t\t\t\tapi.draw();\r\n\t\t\t}\r\n\t\t\r\n\t\t\treturn rows.flatten().toArray();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * This function will make DataTables recalculate the column sizes, based on the data\r\n\t\t * contained in the table and the sizes applied to the columns (in the DOM, CSS or\r\n\t\t * through the sWidth parameter). This can be useful when the width of the table's\r\n\t\t * parent element changes (for example a window resize).\r\n\t\t * @param {boolean} [bRedraw=true] Redraw the table or not, you will typically want to\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable( {\r\n\t\t * \"sScrollY\": \"200px\",\r\n\t\t * \"bPaginate\": false\r\n\t\t * } );\r\n\t\t *\r\n\t\t * $(window).on('resize', function () {\r\n\t\t * oTable.fnAdjustColumnSizing();\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnAdjustColumnSizing = function ( bRedraw )\r\n\t\t{\r\n\t\t\tvar api = this.api( true ).columns.adjust();\r\n\t\t\tvar settings = api.settings()[0];\r\n\t\t\tvar scroll = settings.oScroll;\r\n\t\t\r\n\t\t\tif ( bRedraw === undefined || bRedraw ) {\r\n\t\t\t\tapi.draw( false );\r\n\t\t\t}\r\n\t\t\telse if ( scroll.sX !== \"\" || scroll.sY !== \"\" ) {\r\n\t\t\t\t/* If not redrawing, but scrolling, we want to apply the new column sizes anyway */\r\n\t\t\t\t_fnScrollDraw( settings );\r\n\t\t\t}\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Quickly and simply clear a table\r\n\t\t * @param {bool} [bRedraw=true] redraw the table or not\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Immediately 'nuke' the current rows (perhaps waiting for an Ajax callback...)\r\n\t\t * oTable.fnClearTable();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnClearTable = function( bRedraw )\r\n\t\t{\r\n\t\t\tvar api = this.api( true ).clear();\r\n\t\t\r\n\t\t\tif ( bRedraw === undefined || bRedraw ) {\r\n\t\t\t\tapi.draw();\r\n\t\t\t}\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * The exact opposite of 'opening' a row, this function will close any rows which\r\n\t\t * are currently 'open'.\r\n\t\t * @param {node} nTr the table row to 'close'\r\n\t\t * @returns {int} 0 on success, or 1 if failed (can't find the row)\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable;\r\n\t\t *\r\n\t\t * // 'open' an information row when a row is clicked on\r\n\t\t * $('#example tbody tr').click( function () {\r\n\t\t * if ( oTable.fnIsOpen(this) ) {\r\n\t\t * oTable.fnClose( this );\r\n\t\t * } else {\r\n\t\t * oTable.fnOpen( this, \"Temporary row opened\", \"info_row\" );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * oTable = $('#example').dataTable();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnClose = function( nTr )\r\n\t\t{\r\n\t\t\tthis.api( true ).row( nTr ).child.hide();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Remove a row for the table\r\n\t\t * @param {mixed} target The index of the row from aoData to be deleted, or\r\n\t\t * the TR element you want to delete\r\n\t\t * @param {function|null} [callBack] Callback function\r\n\t\t * @param {bool} [redraw=true] Redraw the table or not\r\n\t\t * @returns {array} The row that was deleted\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Immediately remove the first row\r\n\t\t * oTable.fnDeleteRow( 0 );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnDeleteRow = function( target, callback, redraw )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\tvar rows = api.rows( target );\r\n\t\t\tvar settings = rows.settings()[0];\r\n\t\t\tvar data = settings.aoData[ rows[0][0] ];\r\n\t\t\r\n\t\t\trows.remove();\r\n\t\t\r\n\t\t\tif ( callback ) {\r\n\t\t\t\tcallback.call( this, settings, data );\r\n\t\t\t}\r\n\t\t\r\n\t\t\tif ( redraw === undefined || redraw ) {\r\n\t\t\t\tapi.draw();\r\n\t\t\t}\r\n\t\t\r\n\t\t\treturn data;\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Restore the table to it's original state in the DOM by removing all of DataTables\r\n\t\t * enhancements, alterations to the DOM structure of the table and event listeners.\r\n\t\t * @param {boolean} [remove=false] Completely remove the table from the DOM\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * // This example is fairly pointless in reality, but shows how fnDestroy can be used\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t * oTable.fnDestroy();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnDestroy = function ( remove )\r\n\t\t{\r\n\t\t\tthis.api( true ).destroy( remove );\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Redraw the table\r\n\t\t * @param {bool} [complete=true] Re-filter and resort (if enabled) the table before the draw.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Re-draw the table - you wouldn't want to do it here, but it's an example :-)\r\n\t\t * oTable.fnDraw();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnDraw = function( complete )\r\n\t\t{\r\n\t\t\t// Note that this isn't an exact match to the old call to _fnDraw - it takes\r\n\t\t\t// into account the new data, but can hold position.\r\n\t\t\tthis.api( true ).draw( complete );\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Filter the input based on data\r\n\t\t * @param {string} sInput String to filter the table on\r\n\t\t * @param {int|null} [iColumn] Column to limit filtering to\r\n\t\t * @param {bool} [bRegex=false] Treat as regular expression or not\r\n\t\t * @param {bool} [bSmart=true] Perform smart filtering or not\r\n\t\t * @param {bool} [bShowGlobal=true] Show the input global filter in it's input box(es)\r\n\t\t * @param {bool} [bCaseInsensitive=true] Do case-insensitive matching (true) or not (false)\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Sometime later - filter...\r\n\t\t * oTable.fnFilter( 'test string' );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnFilter = function( sInput, iColumn, bRegex, bSmart, bShowGlobal, bCaseInsensitive )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\r\n\t\t\tif ( iColumn === null || iColumn === undefined ) {\r\n\t\t\t\tapi.search( sInput, bRegex, bSmart, bCaseInsensitive );\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\tapi.column( iColumn ).search( sInput, bRegex, bSmart, bCaseInsensitive );\r\n\t\t\t}\r\n\t\t\r\n\t\t\tapi.draw();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Get the data for the whole table, an individual row or an individual cell based on the\r\n\t\t * provided parameters.\r\n\t\t * @param {int|node} [src] A TR row node, TD/TH cell node or an integer. If given as\r\n\t\t * a TR node then the data source for the whole row will be returned. If given as a\r\n\t\t * TD/TH cell node then iCol will be automatically calculated and the data for the\r\n\t\t * cell returned. If given as an integer, then this is treated as the aoData internal\r\n\t\t * data index for the row (see fnGetPosition) and the data for that row used.\r\n\t\t * @param {int} [col] Optional column index that you want the data of.\r\n\t\t * @returns {array|object|string} If mRow is undefined, then the data for all rows is\r\n\t\t * returned. If mRow is defined, just data for that row, and is iCol is\r\n\t\t * defined, only data for the designated cell is returned.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Row data\r\n\t\t * $(document).ready(function() {\r\n\t\t * oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * oTable.$('tr').click( function () {\r\n\t\t * var data = oTable.fnGetData( this );\r\n\t\t * // ... do something with the array / object of data for the row\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Individual cell data\r\n\t\t * $(document).ready(function() {\r\n\t\t * oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * oTable.$('td').click( function () {\r\n\t\t * var sData = oTable.fnGetData( this );\r\n\t\t * alert( 'The cell clicked on had the value of '+sData );\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnGetData = function( src, col )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\r\n\t\t\tif ( src !== undefined ) {\r\n\t\t\t\tvar type = src.nodeName ? src.nodeName.toLowerCase() : '';\r\n\t\t\r\n\t\t\t\treturn col !== undefined || type == 'td' || type == 'th' ?\r\n\t\t\t\t\tapi.cell( src, col ).data() :\r\n\t\t\t\t\tapi.row( src ).data() || null;\r\n\t\t\t}\r\n\t\t\r\n\t\t\treturn api.data().toArray();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Get an array of the TR nodes that are used in the table's body. Note that you will\r\n\t\t * typically want to use the '$' API method in preference to this as it is more\r\n\t\t * flexible.\r\n\t\t * @param {int} [iRow] Optional row index for the TR element you want\r\n\t\t * @returns {array|node} If iRow is undefined, returns an array of all TR elements\r\n\t\t * in the table's body, or iRow is defined, just the TR element requested.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Get the nodes from the table\r\n\t\t * var nNodes = oTable.fnGetNodes( );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnGetNodes = function( iRow )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\r\n\t\t\treturn iRow !== undefined ?\r\n\t\t\t\tapi.row( iRow ).node() :\r\n\t\t\t\tapi.rows().nodes().flatten().toArray();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Get the array indexes of a particular cell from it's DOM element\r\n\t\t * and column index including hidden columns\r\n\t\t * @param {node} node this can either be a TR, TD or TH in the table's body\r\n\t\t * @returns {int} If nNode is given as a TR, then a single index is returned, or\r\n\t\t * if given as a cell, an array of [row index, column index (visible),\r\n\t\t * column index (all)] is given.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * $('#example tbody td').click( function () {\r\n\t\t * // Get the position of the current data from the node\r\n\t\t * var aPos = oTable.fnGetPosition( this );\r\n\t\t *\r\n\t\t * // Get the data array for this row\r\n\t\t * var aData = oTable.fnGetData( aPos[0] );\r\n\t\t *\r\n\t\t * // Update the data array and return the value\r\n\t\t * aData[ aPos[1] ] = 'clicked';\r\n\t\t * this.innerHTML = 'clicked';\r\n\t\t * } );\r\n\t\t *\r\n\t\t * // Init DataTables\r\n\t\t * oTable = $('#example').dataTable();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnGetPosition = function( node )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\tvar nodeName = node.nodeName.toUpperCase();\r\n\t\t\r\n\t\t\tif ( nodeName == 'TR' ) {\r\n\t\t\t\treturn api.row( node ).index();\r\n\t\t\t}\r\n\t\t\telse if ( nodeName == 'TD' || nodeName == 'TH' ) {\r\n\t\t\t\tvar cell = api.cell( node ).index();\r\n\t\t\r\n\t\t\t\treturn [\r\n\t\t\t\t\tcell.row,\r\n\t\t\t\t\tcell.columnVisible,\r\n\t\t\t\t\tcell.column\r\n\t\t\t\t];\r\n\t\t\t}\r\n\t\t\treturn null;\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Check to see if a row is 'open' or not.\r\n\t\t * @param {node} nTr the table row to check\r\n\t\t * @returns {boolean} true if the row is currently open, false otherwise\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable;\r\n\t\t *\r\n\t\t * // 'open' an information row when a row is clicked on\r\n\t\t * $('#example tbody tr').click( function () {\r\n\t\t * if ( oTable.fnIsOpen(this) ) {\r\n\t\t * oTable.fnClose( this );\r\n\t\t * } else {\r\n\t\t * oTable.fnOpen( this, \"Temporary row opened\", \"info_row\" );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * oTable = $('#example').dataTable();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnIsOpen = function( nTr )\r\n\t\t{\r\n\t\t\treturn this.api( true ).row( nTr ).child.isShown();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * This function will place a new row directly after a row which is currently\r\n\t\t * on display on the page, with the HTML contents that is passed into the\r\n\t\t * function. This can be used, for example, to ask for confirmation that a\r\n\t\t * particular record should be deleted.\r\n\t\t * @param {node} nTr The table row to 'open'\r\n\t\t * @param {string|node|jQuery} mHtml The HTML to put into the row\r\n\t\t * @param {string} sClass Class to give the new TD cell\r\n\t\t * @returns {node} The row opened. Note that if the table row passed in as the\r\n\t\t * first parameter, is not found in the table, this method will silently\r\n\t\t * return.\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable;\r\n\t\t *\r\n\t\t * // 'open' an information row when a row is clicked on\r\n\t\t * $('#example tbody tr').click( function () {\r\n\t\t * if ( oTable.fnIsOpen(this) ) {\r\n\t\t * oTable.fnClose( this );\r\n\t\t * } else {\r\n\t\t * oTable.fnOpen( this, \"Temporary row opened\", \"info_row\" );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * oTable = $('#example').dataTable();\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnOpen = function( nTr, mHtml, sClass )\r\n\t\t{\r\n\t\t\treturn this.api( true )\r\n\t\t\t\t.row( nTr )\r\n\t\t\t\t.child( mHtml, sClass )\r\n\t\t\t\t.show()\r\n\t\t\t\t.child()[0];\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Change the pagination - provides the internal logic for pagination in a simple API\r\n\t\t * function. With this function you can have a DataTables table go to the next,\r\n\t\t * previous, first or last pages.\r\n\t\t * @param {string|int} mAction Paging action to take: \"first\", \"previous\", \"next\" or \"last\"\r\n\t\t * or page number to jump to (integer), note that page 0 is the first page.\r\n\t\t * @param {bool} [bRedraw=true] Redraw the table or not\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t * oTable.fnPageChange( 'next' );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnPageChange = function ( mAction, bRedraw )\r\n\t\t{\r\n\t\t\tvar api = this.api( true ).page( mAction );\r\n\t\t\r\n\t\t\tif ( bRedraw === undefined || bRedraw ) {\r\n\t\t\t\tapi.draw(false);\r\n\t\t\t}\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Show a particular column\r\n\t\t * @param {int} iCol The column whose display should be changed\r\n\t\t * @param {bool} bShow Show (true) or hide (false) the column\r\n\t\t * @param {bool} [bRedraw=true] Redraw the table or not\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Hide the second column after initialisation\r\n\t\t * oTable.fnSetColumnVis( 1, false );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnSetColumnVis = function ( iCol, bShow, bRedraw )\r\n\t\t{\r\n\t\t\tvar api = this.api( true ).column( iCol ).visible( bShow );\r\n\t\t\r\n\t\t\tif ( bRedraw === undefined || bRedraw ) {\r\n\t\t\t\tapi.columns.adjust().draw();\r\n\t\t\t}\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Get the settings for a particular table for external manipulation\r\n\t\t * @returns {object} DataTables settings object. See\r\n\t\t * {@link DataTable.models.oSettings}\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t * var oSettings = oTable.fnSettings();\r\n\t\t *\r\n\t\t * // Show an example parameter from the settings\r\n\t\t * alert( oSettings._iDisplayStart );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnSettings = function()\r\n\t\t{\r\n\t\t\treturn _fnSettingsFromNode( this[_ext.iApiIndex] );\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Sort the table by a particular column\r\n\t\t * @param {int} iCol the data index to sort on. Note that this will not match the\r\n\t\t * 'display index' if you have hidden data entries\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Sort immediately with columns 0 and 1\r\n\t\t * oTable.fnSort( [ [0,'asc'], [1,'asc'] ] );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnSort = function( aaSort )\r\n\t\t{\r\n\t\t\tthis.api( true ).order( aaSort ).draw();\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Attach a sort listener to an element for a given column\r\n\t\t * @param {node} nNode the element to attach the sort listener to\r\n\t\t * @param {int} iColumn the column that a click on this node will sort on\r\n\t\t * @param {function} [fnCallback] callback function when sort is run\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t *\r\n\t\t * // Sort on column 1, when 'sorter' is clicked on\r\n\t\t * oTable.fnSortListener( document.getElementById('sorter'), 1 );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnSortListener = function( nNode, iColumn, fnCallback )\r\n\t\t{\r\n\t\t\tthis.api( true ).order.listener( nNode, iColumn, fnCallback );\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Update a table cell or row - this method will accept either a single value to\r\n\t\t * update the cell with, an array of values with one element for each column or\r\n\t\t * an object in the same format as the original data source. The function is\r\n\t\t * self-referencing in order to make the multi column updates easier.\r\n\t\t * @param {object|array|string} mData Data to update the cell/row with\r\n\t\t * @param {node|int} mRow TR element you want to update or the aoData index\r\n\t\t * @param {int} [iColumn] The column to update, give as null or undefined to\r\n\t\t * update a whole row.\r\n\t\t * @param {bool} [bRedraw=true] Redraw the table or not\r\n\t\t * @param {bool} [bAction=true] Perform pre-draw actions or not\r\n\t\t * @returns {int} 0 on success, 1 on error\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t * oTable.fnUpdate( 'Example update', 0, 0 ); // Single cell\r\n\t\t * oTable.fnUpdate( ['a', 'b', 'c', 'd', 'e'], $('tbody tr')[0] ); // Row\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnUpdate = function( mData, mRow, iColumn, bRedraw, bAction )\r\n\t\t{\r\n\t\t\tvar api = this.api( true );\r\n\t\t\r\n\t\t\tif ( iColumn === undefined || iColumn === null ) {\r\n\t\t\t\tapi.row( mRow ).data( mData );\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\tapi.cell( mRow, iColumn ).data( mData );\r\n\t\t\t}\r\n\t\t\r\n\t\t\tif ( bAction === undefined || bAction ) {\r\n\t\t\t\tapi.columns.adjust();\r\n\t\t\t}\r\n\t\t\r\n\t\t\tif ( bRedraw === undefined || bRedraw ) {\r\n\t\t\t\tapi.draw();\r\n\t\t\t}\r\n\t\t\treturn 0;\r\n\t\t};\r\n\t\t\r\n\t\t\r\n\t\t/**\r\n\t\t * Provide a common method for plug-ins to check the version of DataTables being used, in order\r\n\t\t * to ensure compatibility.\r\n\t\t * @param {string} sVersion Version string to check for, in the format \"X.Y.Z\". Note that the\r\n\t\t * formats \"X\" and \"X.Y\" are also acceptable.\r\n\t\t * @returns {boolean} true if this version of DataTables is greater or equal to the required\r\n\t\t * version, or false if this version of DataTales is not suitable\r\n\t\t * @method\r\n\t\t * @dtopt API\r\n\t\t * @deprecated Since v1.10\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready(function() {\r\n\t\t * var oTable = $('#example').dataTable();\r\n\t\t * alert( oTable.fnVersionCheck( '1.9.0' ) );\r\n\t\t * } );\r\n\t\t */\r\n\t\tthis.fnVersionCheck = _ext.fnVersionCheck;\r\n\t\t\r\n\r\n\t\tvar _that = this;\r\n\t\tvar emptyInit = options === undefined;\r\n\t\tvar len = this.length;\r\n\r\n\t\tif ( emptyInit ) {\r\n\t\t\toptions = {};\r\n\t\t}\r\n\r\n\t\tthis.oApi = this.internal = _ext.internal;\r\n\r\n\t\t// Extend with old style plug-in API methods\r\n\t\tfor ( var fn in DataTable.ext.internal ) {\r\n\t\t\tif ( fn ) {\r\n\t\t\t\tthis[fn] = _fnExternApiFunc(fn);\r\n\t\t\t}\r\n\t\t}\r\n\r\n\t\tthis.each(function() {\r\n\t\t\t// For each initialisation we want to give it a clean initialisation\r\n\t\t\t// object that can be bashed around\r\n\t\t\tvar o = {};\r\n\t\t\tvar oInit = len > 1 ? // optimisation for single table case\r\n\t\t\t\t_fnExtend( o, options, true ) :\r\n\t\t\t\toptions;\r\n\r\n\t\t\t/*global oInit,_that,emptyInit*/\r\n\t\t\tvar i=0, iLen, j, jLen, k, kLen;\r\n\t\t\tvar sId = this.getAttribute( 'id' );\r\n\t\t\tvar bInitHandedOff = false;\r\n\t\t\tvar defaults = DataTable.defaults;\r\n\t\t\tvar $this = $(this);\r\n\t\t\t\r\n\t\t\t\r\n\t\t\t/* Sanity check */\r\n\t\t\tif ( this.nodeName.toLowerCase() != 'table' )\r\n\t\t\t{\r\n\t\t\t\t_fnLog( null, 0, 'Non-table node initialisation ('+this.nodeName+')', 2 );\r\n\t\t\t\treturn;\r\n\t\t\t}\r\n\t\t\t\r\n\t\t\t/* Backwards compatibility for the defaults */\r\n\t\t\t_fnCompatOpts( defaults );\r\n\t\t\t_fnCompatCols( defaults.column );\r\n\t\t\t\r\n\t\t\t/* Convert the camel-case defaults to Hungarian */\r\n\t\t\t_fnCamelToHungarian( defaults, defaults, true );\r\n\t\t\t_fnCamelToHungarian( defaults.column, defaults.column, true );\r\n\t\t\t\r\n\t\t\t/* Setting up the initialisation object */\r\n\t\t\t_fnCamelToHungarian( defaults, $.extend( oInit, $this.data() ) );\r\n\t\t\t\r\n\t\t\t\r\n\t\t\t\r\n\t\t\t/* Check to see if we are re-initialising a table */\r\n\t\t\tvar allSettings = DataTable.settings;\r\n\t\t\tfor ( i=0, iLen=allSettings.length ; i').appendTo($this);\r\n\t\t\t\t}\r\n\t\t\t\toSettings.nTHead = thead[0];\r\n\t\t\t\r\n\t\t\t\tvar tbody = $this.children('tbody');\r\n\t\t\t\tif ( tbody.length === 0 ) {\r\n\t\t\t\t\ttbody = $('').appendTo($this);\r\n\t\t\t\t}\r\n\t\t\t\toSettings.nTBody = tbody[0];\r\n\t\t\t\r\n\t\t\t\tvar tfoot = $this.children('tfoot');\r\n\t\t\t\tif ( tfoot.length === 0 && captions.length > 0 && (oSettings.oScroll.sX !== \"\" || oSettings.oScroll.sY !== \"\") ) {\r\n\t\t\t\t\t// If we are a scrolling table, and no footer has been given, then we need to create\r\n\t\t\t\t\t// a tfoot element for the caption element to be appended to\r\n\t\t\t\t\ttfoot = $('').appendTo($this);\r\n\t\t\t\t}\r\n\t\t\t\r\n\t\t\t\tif ( tfoot.length === 0 || tfoot.children().length === 0 ) {\r\n\t\t\t\t\t$this.addClass( oClasses.sNoFooter );\r\n\t\t\t\t}\r\n\t\t\t\telse if ( tfoot.length > 0 ) {\r\n\t\t\t\t\toSettings.nTFoot = tfoot[0];\r\n\t\t\t\t\t_fnDetectHeader( oSettings.aoFooter, oSettings.nTFoot );\r\n\t\t\t\t}\r\n\t\t\t\r\n\t\t\t\t/* Check if there is data passing into the constructor */\r\n\t\t\t\tif ( oInit.aaData ) {\r\n\t\t\t\t\tfor ( i=0 ; i/g;\r\n\t\r\n\t// This is not strict ISO8601 - Date.parse() is quite lax, although\r\n\t// implementations differ between browsers.\r\n\tvar _re_date = /^\\d{2,4}[\\.\\/\\-]\\d{1,2}[\\.\\/\\-]\\d{1,2}([T ]{1}\\d{1,2}[:\\.]\\d{2}([\\.:]\\d{2})?)?$/;\r\n\t\r\n\t// Escape regular expression special characters\r\n\tvar _re_escape_regex = new RegExp( '(\\\\' + [ '/', '.', '*', '+', '?', '|', '(', ')', '[', ']', '{', '}', '\\\\', '$', '^', '-' ].join('|\\\\') + ')', 'g' );\r\n\t\r\n\t// http://en.wikipedia.org/wiki/Foreign_exchange_market\r\n\t// - \\u20BD - Russian ruble.\r\n\t// - \\u20a9 - South Korean Won\r\n\t// - \\u20BA - Turkish Lira\r\n\t// - \\u20B9 - Indian Rupee\r\n\t// - R - Brazil (R$) and South Africa\r\n\t// - fr - Swiss Franc\r\n\t// - kr - Swedish krona, Norwegian krone and Danish krone\r\n\t// - \\u2009 is thin space and \\u202F is narrow no-break space, both used in many\r\n\t// standards as thousands separators.\r\n\tvar _re_formatted_numeric = /[',$£€¥%\\u2009\\u202F\\u20BD\\u20a9\\u20BArfk]/gi;\r\n\t\r\n\t\r\n\tvar _empty = function ( d ) {\r\n\t\treturn !d || d === true || d === '-' ? true : false;\r\n\t};\r\n\t\r\n\t\r\n\tvar _intVal = function ( s ) {\r\n\t\tvar integer = parseInt( s, 10 );\r\n\t\treturn !isNaN(integer) && isFinite(s) ? integer : null;\r\n\t};\r\n\t\r\n\t// Convert from a formatted number with characters other than `.` as the\r\n\t// decimal place, to a Javascript number\r\n\tvar _numToDecimal = function ( num, decimalPoint ) {\r\n\t\t// Cache created regular expressions for speed as this function is called often\r\n\t\tif ( ! _re_dic[ decimalPoint ] ) {\r\n\t\t\t_re_dic[ decimalPoint ] = new RegExp( _fnEscapeRegex( decimalPoint ), 'g' );\r\n\t\t}\r\n\t\treturn typeof num === 'string' && decimalPoint !== '.' ?\r\n\t\t\tnum.replace( /\\./g, '' ).replace( _re_dic[ decimalPoint ], '.' ) :\r\n\t\t\tnum;\r\n\t};\r\n\t\r\n\t\r\n\tvar _isNumber = function ( d, decimalPoint, formatted ) {\r\n\t\tvar strType = typeof d === 'string';\r\n\t\r\n\t\t// If empty return immediately so there must be a number if it is a\r\n\t\t// formatted string (this stops the string \"k\", or \"kr\", etc being detected\r\n\t\t// as a formatted number for currency\r\n\t\tif ( _empty( d ) ) {\r\n\t\t\treturn true;\r\n\t\t}\r\n\t\r\n\t\tif ( decimalPoint && strType ) {\r\n\t\t\td = _numToDecimal( d, decimalPoint );\r\n\t\t}\r\n\t\r\n\t\tif ( formatted && strType ) {\r\n\t\t\td = d.replace( _re_formatted_numeric, '' );\r\n\t\t}\r\n\t\r\n\t\treturn !isNaN( parseFloat(d) ) && isFinite( d );\r\n\t};\r\n\t\r\n\t\r\n\t// A string without HTML in it can be considered to be HTML still\r\n\tvar _isHtml = function ( d ) {\r\n\t\treturn _empty( d ) || typeof d === 'string';\r\n\t};\r\n\t\r\n\t\r\n\tvar _htmlNumeric = function ( d, decimalPoint, formatted ) {\r\n\t\tif ( _empty( d ) ) {\r\n\t\t\treturn true;\r\n\t\t}\r\n\t\r\n\t\tvar html = _isHtml( d );\r\n\t\treturn ! html ?\r\n\t\t\tnull :\r\n\t\t\t_isNumber( _stripHtml( d ), decimalPoint, formatted ) ?\r\n\t\t\t\ttrue :\r\n\t\t\t\tnull;\r\n\t};\r\n\t\r\n\t\r\n\tvar _pluck = function ( a, prop, prop2 ) {\r\n\t\tvar out = [];\r\n\t\tvar i=0, ien=a.length;\r\n\t\r\n\t\t// Could have the test in the loop for slightly smaller code, but speed\r\n\t\t// is essential here\r\n\t\tif ( prop2 !== undefined ) {\r\n\t\t\tfor ( ; i')\r\n\t\t\t\t.css( {\r\n\t\t\t\t\tposition: 'fixed',\r\n\t\t\t\t\ttop: 0,\r\n\t\t\t\t\tleft: $(window).scrollLeft()*-1, // allow for scrolling\r\n\t\t\t\t\theight: 1,\r\n\t\t\t\t\twidth: 1,\r\n\t\t\t\t\toverflow: 'hidden'\r\n\t\t\t\t} )\r\n\t\t\t\t.append(\r\n\t\t\t\t\t$('')\r\n\t\t\t\t\t\t.css( {\r\n\t\t\t\t\t\t\tposition: 'absolute',\r\n\t\t\t\t\t\t\ttop: 1,\r\n\t\t\t\t\t\t\tleft: 1,\r\n\t\t\t\t\t\t\twidth: 100,\r\n\t\t\t\t\t\t\toverflow: 'scroll'\r\n\t\t\t\t\t\t} )\r\n\t\t\t\t\t\t.append(\r\n\t\t\t\t\t\t\t$('')\r\n\t\t\t\t\t\t\t\t.css( {\r\n\t\t\t\t\t\t\t\t\twidth: '100%',\r\n\t\t\t\t\t\t\t\t\theight: 10\r\n\t\t\t\t\t\t\t\t} )\r\n\t\t\t\t\t\t)\r\n\t\t\t\t)\r\n\t\t\t\t.appendTo( 'body' );\r\n\t\r\n\t\t\tvar outer = n.children();\r\n\t\t\tvar inner = outer.children();\r\n\t\r\n\t\t\t// Numbers below, in order, are:\r\n\t\t\t// inner.offsetWidth, inner.clientWidth, outer.offsetWidth, outer.clientWidth\r\n\t\t\t//\r\n\t\t\t// IE6 XP: 100 100 100 83\r\n\t\t\t// IE7 Vista: 100 100 100 83\r\n\t\t\t// IE 8+ Windows: 83 83 100 83\r\n\t\t\t// Evergreen Windows: 83 83 100 83\r\n\t\t\t// Evergreen Mac with scrollbars: 85 85 100 85\r\n\t\t\t// Evergreen Mac without scrollbars: 100 100 100 100\r\n\t\r\n\t\t\t// Get scrollbar width\r\n\t\t\tbrowser.barWidth = outer[0].offsetWidth - outer[0].clientWidth;\r\n\t\r\n\t\t\t// IE6/7 will oversize a width 100% element inside a scrolling element, to\r\n\t\t\t// include the width of the scrollbar, while other browsers ensure the inner\r\n\t\t\t// element is contained without forcing scrolling\r\n\t\t\tbrowser.bScrollOversize = inner[0].offsetWidth === 100 && outer[0].clientWidth !== 100;\r\n\t\r\n\t\t\t// In rtl text layout, some browsers (most, but not all) will place the\r\n\t\t\t// scrollbar on the left, rather than the right.\r\n\t\t\tbrowser.bScrollbarLeft = Math.round( inner.offset().left ) !== 1;\r\n\t\r\n\t\t\t// IE8- don't provide height and width for getBoundingClientRect\r\n\t\t\tbrowser.bBounding = n[0].getBoundingClientRect().width ? true : false;\r\n\t\r\n\t\t\tn.remove();\r\n\t\t}\r\n\t\r\n\t\t$.extend( settings.oBrowser, DataTable.__browser );\r\n\t\tsettings.oScroll.iBarWidth = DataTable.__browser.barWidth;\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Array.prototype reduce[Right] method, used for browsers which don't support\r\n\t * JS 1.6. Done this way to reduce code size, since we iterate either way\r\n\t * @param {object} settings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnReduce ( that, fn, init, start, end, inc )\r\n\t{\r\n\t\tvar\r\n\t\t\ti = start,\r\n\t\t\tvalue,\r\n\t\t\tisSet = false;\r\n\t\r\n\t\tif ( init !== undefined ) {\r\n\t\t\tvalue = init;\r\n\t\t\tisSet = true;\r\n\t\t}\r\n\t\r\n\t\twhile ( i !== end ) {\r\n\t\t\tif ( ! that.hasOwnProperty(i) ) {\r\n\t\t\t\tcontinue;\r\n\t\t\t}\r\n\t\r\n\t\t\tvalue = isSet ?\r\n\t\t\t\tfn( value, that[i], i, that ) :\r\n\t\t\t\tthat[i];\r\n\t\r\n\t\t\tisSet = true;\r\n\t\t\ti += inc;\r\n\t\t}\r\n\t\r\n\t\treturn value;\r\n\t}\r\n\t\r\n\t/**\r\n\t * Add a column to the list used for the table with default values\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @param {node} nTh The th element for this column\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnAddColumn( oSettings, nTh )\r\n\t{\r\n\t\t// Add column to aoColumns array\r\n\t\tvar oDefaults = DataTable.defaults.column;\r\n\t\tvar iCol = oSettings.aoColumns.length;\r\n\t\tvar oCol = $.extend( {}, DataTable.models.oColumn, oDefaults, {\r\n\t\t\t\"nTh\": nTh ? nTh : document.createElement('th'),\r\n\t\t\t\"sTitle\": oDefaults.sTitle ? oDefaults.sTitle : nTh ? nTh.innerHTML : '',\r\n\t\t\t\"aDataSort\": oDefaults.aDataSort ? oDefaults.aDataSort : [iCol],\r\n\t\t\t\"mData\": oDefaults.mData ? oDefaults.mData : iCol,\r\n\t\t\tidx: iCol\r\n\t\t} );\r\n\t\toSettings.aoColumns.push( oCol );\r\n\t\r\n\t\t// Add search object for column specific search. Note that the `searchCols[ iCol ]`\r\n\t\t// passed into extend can be undefined. This allows the user to give a default\r\n\t\t// with only some of the parameters defined, and also not give a default\r\n\t\tvar searchCols = oSettings.aoPreSearchCols;\r\n\t\tsearchCols[ iCol ] = $.extend( {}, DataTable.models.oSearch, searchCols[ iCol ] );\r\n\t\r\n\t\t// Use the default column options function to initialise classes etc\r\n\t\t_fnColumnOptions( oSettings, iCol, $(nTh).data() );\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Apply options for a column\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @param {int} iCol column index to consider\r\n\t * @param {object} oOptions object with sType, bVisible and bSearchable etc\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnColumnOptions( oSettings, iCol, oOptions )\r\n\t{\r\n\t\tvar oCol = oSettings.aoColumns[ iCol ];\r\n\t\tvar oClasses = oSettings.oClasses;\r\n\t\tvar th = $(oCol.nTh);\r\n\t\r\n\t\t// Try to get width information from the DOM. We can't get it from CSS\r\n\t\t// as we'd need to parse the CSS stylesheet. `width` option can override\r\n\t\tif ( ! oCol.sWidthOrig ) {\r\n\t\t\t// Width attribute\r\n\t\t\toCol.sWidthOrig = th.attr('width') || null;\r\n\t\r\n\t\t\t// Style attribute\r\n\t\t\tvar t = (th.attr('style') || '').match(/width:\\s*(\\d+[pxem%]+)/);\r\n\t\t\tif ( t ) {\r\n\t\t\t\toCol.sWidthOrig = t[1];\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\t/* User specified column options */\r\n\t\tif ( oOptions !== undefined && oOptions !== null )\r\n\t\t{\r\n\t\t\t// Backwards compatibility\r\n\t\t\t_fnCompatCols( oOptions );\r\n\t\r\n\t\t\t// Map camel case parameters to their Hungarian counterparts\r\n\t\t\t_fnCamelToHungarian( DataTable.defaults.column, oOptions );\r\n\t\r\n\t\t\t/* Backwards compatibility for mDataProp */\r\n\t\t\tif ( oOptions.mDataProp !== undefined && !oOptions.mData )\r\n\t\t\t{\r\n\t\t\t\toOptions.mData = oOptions.mDataProp;\r\n\t\t\t}\r\n\t\r\n\t\t\tif ( oOptions.sType )\r\n\t\t\t{\r\n\t\t\t\toCol._sManualType = oOptions.sType;\r\n\t\t\t}\r\n\t\r\n\t\t\t// `class` is a reserved word in Javascript, so we need to provide\r\n\t\t\t// the ability to use a valid name for the camel case input\r\n\t\t\tif ( oOptions.className && ! oOptions.sClass )\r\n\t\t\t{\r\n\t\t\t\toOptions.sClass = oOptions.className;\r\n\t\t\t}\r\n\t\t\tif ( oOptions.sClass ) {\r\n\t\t\t\tth.addClass( oOptions.sClass );\r\n\t\t\t}\r\n\t\r\n\t\t\t$.extend( oCol, oOptions );\r\n\t\t\t_fnMap( oCol, oOptions, \"sWidth\", \"sWidthOrig\" );\r\n\t\r\n\t\t\t/* iDataSort to be applied (backwards compatibility), but aDataSort will take\r\n\t\t\t * priority if defined\r\n\t\t\t */\r\n\t\t\tif ( oOptions.iDataSort !== undefined )\r\n\t\t\t{\r\n\t\t\t\toCol.aDataSort = [ oOptions.iDataSort ];\r\n\t\t\t}\r\n\t\t\t_fnMap( oCol, oOptions, \"aDataSort\" );\r\n\t\t}\r\n\t\r\n\t\t/* Cache the data get and set functions for speed */\r\n\t\tvar mDataSrc = oCol.mData;\r\n\t\tvar mData = _fnGetObjectDataFn( mDataSrc );\r\n\t\tvar mRender = oCol.mRender ? _fnGetObjectDataFn( oCol.mRender ) : null;\r\n\t\r\n\t\tvar attrTest = function( src ) {\r\n\t\t\treturn typeof src === 'string' && src.indexOf('@') !== -1;\r\n\t\t};\r\n\t\toCol._bAttrSrc = $.isPlainObject( mDataSrc ) && (\r\n\t\t\tattrTest(mDataSrc.sort) || attrTest(mDataSrc.type) || attrTest(mDataSrc.filter)\r\n\t\t);\r\n\t\toCol._setter = null;\r\n\t\r\n\t\toCol.fnGetData = function (rowData, type, meta) {\r\n\t\t\tvar innerData = mData( rowData, type, undefined, meta );\r\n\t\r\n\t\t\treturn mRender && type ?\r\n\t\t\t\tmRender( innerData, type, rowData, meta ) :\r\n\t\t\t\tinnerData;\r\n\t\t};\r\n\t\toCol.fnSetData = function ( rowData, val, meta ) {\r\n\t\t\treturn _fnSetObjectDataFn( mDataSrc )( rowData, val, meta );\r\n\t\t};\r\n\t\r\n\t\t// Indicate if DataTables should read DOM data as an object or array\r\n\t\t// Used in _fnGetRowElements\r\n\t\tif ( typeof mDataSrc !== 'number' ) {\r\n\t\t\toSettings._rowReadObject = true;\r\n\t\t}\r\n\t\r\n\t\t/* Feature sorting overrides column specific when off */\r\n\t\tif ( !oSettings.oFeatures.bSort )\r\n\t\t{\r\n\t\t\toCol.bSortable = false;\r\n\t\t\tth.addClass( oClasses.sSortableNone ); // Have to add class here as order event isn't called\r\n\t\t}\r\n\t\r\n\t\t/* Check that the class assignment is correct for sorting */\r\n\t\tvar bAsc = $.inArray('asc', oCol.asSorting) !== -1;\r\n\t\tvar bDesc = $.inArray('desc', oCol.asSorting) !== -1;\r\n\t\tif ( !oCol.bSortable || (!bAsc && !bDesc) )\r\n\t\t{\r\n\t\t\toCol.sSortingClass = oClasses.sSortableNone;\r\n\t\t\toCol.sSortingClassJUI = \"\";\r\n\t\t}\r\n\t\telse if ( bAsc && !bDesc )\r\n\t\t{\r\n\t\t\toCol.sSortingClass = oClasses.sSortableAsc;\r\n\t\t\toCol.sSortingClassJUI = oClasses.sSortJUIAscAllowed;\r\n\t\t}\r\n\t\telse if ( !bAsc && bDesc )\r\n\t\t{\r\n\t\t\toCol.sSortingClass = oClasses.sSortableDesc;\r\n\t\t\toCol.sSortingClassJUI = oClasses.sSortJUIDescAllowed;\r\n\t\t}\r\n\t\telse\r\n\t\t{\r\n\t\t\toCol.sSortingClass = oClasses.sSortable;\r\n\t\t\toCol.sSortingClassJUI = oClasses.sSortJUI;\r\n\t\t}\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Adjust the table column widths for new data. Note: you would probably want to\r\n\t * do a redraw after calling this function!\r\n\t * @param {object} settings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnAdjustColumnSizing ( settings )\r\n\t{\r\n\t\t/* Not interested in doing column width calculation if auto-width is disabled */\r\n\t\tif ( settings.oFeatures.bAutoWidth !== false )\r\n\t\t{\r\n\t\t\tvar columns = settings.aoColumns;\r\n\t\r\n\t\t\t_fnCalculateColumnWidths( settings );\r\n\t\t\tfor ( var i=0 , iLen=columns.length ; i=0 ; i-- )\r\n\t\t\t{\r\n\t\t\t\tdef = aoColDefs[i];\r\n\t\r\n\t\t\t\t/* Each definition can target multiple columns, as it is an array */\r\n\t\t\t\tvar aTargets = def.targets !== undefined ?\r\n\t\t\t\t\tdef.targets :\r\n\t\t\t\t\tdef.aTargets;\r\n\t\r\n\t\t\t\tif ( ! $.isArray( aTargets ) )\r\n\t\t\t\t{\r\n\t\t\t\t\taTargets = [ aTargets ];\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\tfor ( j=0, jLen=aTargets.length ; j= 0 )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\t/* Add columns that we don't yet know about */\r\n\t\t\t\t\t\twhile( columns.length <= aTargets[j] )\r\n\t\t\t\t\t\t{\r\n\t\t\t\t\t\t\t_fnAddColumn( oSettings );\r\n\t\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\t\t/* Integer, basic index */\r\n\t\t\t\t\t\tfn( aTargets[j], def );\r\n\t\t\t\t\t}\r\n\t\t\t\t\telse if ( typeof aTargets[j] === 'number' && aTargets[j] < 0 )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\t/* Negative integer, right to left column counting */\r\n\t\t\t\t\t\tfn( columns.length+aTargets[j], def );\r\n\t\t\t\t\t}\r\n\t\t\t\t\telse if ( typeof aTargets[j] === 'string' )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\t/* Class name matching on TH element */\r\n\t\t\t\t\t\tfor ( k=0, kLen=columns.length ; k=0 if successful (index of new aoData entry), -1 if failed\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnAddData ( oSettings, aDataIn, nTr, anTds )\r\n\t{\r\n\t\t/* Create the object for storing information about this new row */\r\n\t\tvar iRow = oSettings.aoData.length;\r\n\t\tvar oData = $.extend( true, {}, DataTable.models.oRow, {\r\n\t\t\tsrc: nTr ? 'dom' : 'data',\r\n\t\t\tidx: iRow\r\n\t\t} );\r\n\t\r\n\t\toData._aData = aDataIn;\r\n\t\toSettings.aoData.push( oData );\r\n\t\r\n\t\t/* Create the cells */\r\n\t\tvar nTd, sThisType;\r\n\t\tvar columns = oSettings.aoColumns;\r\n\t\r\n\t\t// Invalidate the column types as the new data needs to be revalidated\r\n\t\tfor ( var i=0, iLen=columns.length ; i iTarget )\r\n\t\t\t{\r\n\t\t\t\ta[i]--;\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\tif ( iTargetIndex != -1 && splice === undefined )\r\n\t\t{\r\n\t\t\ta.splice( iTargetIndex, 1 );\r\n\t\t}\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Mark cached data as invalid such that a re-read of the data will occur when\r\n\t * the cached data is next requested. Also update from the data source object.\r\n\t *\r\n\t * @param {object} settings DataTables settings object\r\n\t * @param {int} rowIdx Row index to invalidate\r\n\t * @param {string} [src] Source to invalidate from: undefined, 'auto', 'dom'\r\n\t * or 'data'\r\n\t * @param {int} [colIdx] Column index to invalidate. If undefined the whole\r\n\t * row will be invalidated\r\n\t * @memberof DataTable#oApi\r\n\t *\r\n\t * @todo For the modularisation of v1.11 this will need to become a callback, so\r\n\t * the sort and filter methods can subscribe to it. That will required\r\n\t * initialisation options for sorting, which is why it is not already baked in\r\n\t */\r\n\tfunction _fnInvalidate( settings, rowIdx, src, colIdx )\r\n\t{\r\n\t\tvar row = settings.aoData[ rowIdx ];\r\n\t\tvar i, ien;\r\n\t\tvar cellWrite = function ( cell, col ) {\r\n\t\t\t// This is very frustrating, but in IE if you just write directly\r\n\t\t\t// to innerHTML, and elements that are overwritten are GC'ed,\r\n\t\t\t// even if there is a reference to them elsewhere\r\n\t\t\twhile ( cell.childNodes.length ) {\r\n\t\t\t\tcell.removeChild( cell.firstChild );\r\n\t\t\t}\r\n\t\r\n\t\t\tcell.innerHTML = _fnGetCellData( settings, rowIdx, col, 'display' );\r\n\t\t};\r\n\t\r\n\t\t// Are we reading last data from DOM or the data object?\r\n\t\tif ( src === 'dom' || ((! src || src === 'auto') && row.src === 'dom') ) {\r\n\t\t\t// Read the data from the DOM\r\n\t\t\trow._aData = _fnGetRowElements(\r\n\t\t\t\t\tsettings, row, colIdx, colIdx === undefined ? undefined : row._aData\r\n\t\t\t\t)\r\n\t\t\t\t.data;\r\n\t\t}\r\n\t\telse {\r\n\t\t\t// Reading from data object, update the DOM\r\n\t\t\tvar cells = row.anCells;\r\n\t\r\n\t\t\tif ( cells ) {\r\n\t\t\t\tif ( colIdx !== undefined ) {\r\n\t\t\t\t\tcellWrite( cells[colIdx], colIdx );\r\n\t\t\t\t}\r\n\t\t\t\telse {\r\n\t\t\t\t\tfor ( i=0, ien=cells.length ; i').appendTo( thead );\r\n\t\t}\r\n\t\r\n\t\tfor ( i=0, ien=columns.length ; itr').attr('role', 'row');\r\n\t\r\n\t\t/* Deal with the footer - add classes if required */\r\n\t\t$(thead).find('>tr>th, >tr>td').addClass( classes.sHeaderTH );\r\n\t\t$(tfoot).find('>tr>th, >tr>td').addClass( classes.sFooterTH );\r\n\t\r\n\t\t// Cache the footer cells. Note that we only take the cells from the first\r\n\t\t// row in the footer. If there is more than one row the user wants to\r\n\t\t// interact with, they need to use the table().foot() method. Note also this\r\n\t\t// allows cells to be used for multiple columns using colspan\r\n\t\tif ( tfoot !== null ) {\r\n\t\t\tvar cells = oSettings.aoFooter[0];\r\n\t\r\n\t\t\tfor ( i=0, ien=cells.length ; i=0 ; j-- )\r\n\t\t\t{\r\n\t\t\t\tif ( !oSettings.aoColumns[j].bVisible && !bIncludeHidden )\r\n\t\t\t\t{\r\n\t\t\t\t\taoLocal[i].splice( j, 1 );\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\r\n\t\t\t/* Prep the applied array - it needs an element for each row */\r\n\t\t\taApplied.push( [] );\r\n\t\t}\r\n\t\r\n\t\tfor ( i=0, iLen=aoLocal.length ; i= oSettings.fnRecordsDisplay() ?\r\n\t\t\t\t\t0 :\r\n\t\t\t\t\tiInitDisplayStart;\r\n\t\r\n\t\t\toSettings.iInitDisplayStart = -1;\r\n\t\t}\r\n\t\r\n\t\tvar iDisplayStart = oSettings._iDisplayStart;\r\n\t\tvar iDisplayEnd = oSettings.fnDisplayEnd();\r\n\t\r\n\t\t/* Server-side processing draw intercept */\r\n\t\tif ( oSettings.bDeferLoading )\r\n\t\t{\r\n\t\t\toSettings.bDeferLoading = false;\r\n\t\t\toSettings.iDraw++;\r\n\t\t\t_fnProcessingDisplay( oSettings, false );\r\n\t\t}\r\n\t\telse if ( !bServerSide )\r\n\t\t{\r\n\t\t\toSettings.iDraw++;\r\n\t\t}\r\n\t\telse if ( !oSettings.bDestroying && !_fnAjaxUpdate( oSettings ) )\r\n\t\t{\r\n\t\t\treturn;\r\n\t\t}\r\n\t\r\n\t\tif ( aiDisplay.length !== 0 )\r\n\t\t{\r\n\t\t\tvar iStart = bServerSide ? 0 : iDisplayStart;\r\n\t\t\tvar iEnd = bServerSide ? oSettings.aoData.length : iDisplayEnd;\r\n\t\r\n\t\t\tfor ( var j=iStart ; j', { 'class': iStripes ? asStripeClasses[0] : '' } )\r\n\t\t\t\t.append( $(' | ', {\r\n\t\t\t\t\t'valign': 'top',\r\n\t\t\t\t\t'colSpan': _fnVisbleColumns( oSettings ),\r\n\t\t\t\t\t'class': oSettings.oClasses.sRowEmpty\r\n\t\t\t\t} ).html( sZero ) )[0];\r\n\t\t}\r\n\t\r\n\t\t/* Header and footer callbacks */\r\n\t\t_fnCallbackFire( oSettings, 'aoHeaderCallback', 'header', [ $(oSettings.nTHead).children('tr')[0],\r\n\t\t\t_fnGetDataMaster( oSettings ), iDisplayStart, iDisplayEnd, aiDisplay ] );\r\n\t\r\n\t\t_fnCallbackFire( oSettings, 'aoFooterCallback', 'footer', [ $(oSettings.nTFoot).children('tr')[0],\r\n\t\t\t_fnGetDataMaster( oSettings ), iDisplayStart, iDisplayEnd, aiDisplay ] );\r\n\t\r\n\t\tvar body = $(oSettings.nTBody);\r\n\t\r\n\t\tbody.children().detach();\r\n\t\tbody.append( $(anRows) );\r\n\t\r\n\t\t/* Call all required callback functions for the end of a draw */\r\n\t\t_fnCallbackFire( oSettings, 'aoDrawCallback', 'draw', [oSettings] );\r\n\t\r\n\t\t/* Draw is complete, sorting and filtering must be as well */\r\n\t\toSettings.bSorted = false;\r\n\t\toSettings.bFiltered = false;\r\n\t\toSettings.bDrawing = false;\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Redraw the table - taking account of the various features which are enabled\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @param {boolean} [holdPosition] Keep the current paging position. By default\r\n\t * the paging is reset to the first page\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnReDraw( settings, holdPosition )\r\n\t{\r\n\t\tvar\r\n\t\t\tfeatures = settings.oFeatures,\r\n\t\t\tsort = features.bSort,\r\n\t\t\tfilter = features.bFilter;\r\n\t\r\n\t\tif ( sort ) {\r\n\t\t\t_fnSort( settings );\r\n\t\t}\r\n\t\r\n\t\tif ( filter ) {\r\n\t\t\t_fnFilterComplete( settings, settings.oPreviousSearch );\r\n\t\t}\r\n\t\telse {\r\n\t\t\t// No filtering, so we want to just use the display master\r\n\t\t\tsettings.aiDisplay = settings.aiDisplayMaster.slice();\r\n\t\t}\r\n\t\r\n\t\tif ( holdPosition !== true ) {\r\n\t\t\tsettings._iDisplayStart = 0;\r\n\t\t}\r\n\t\r\n\t\t// Let any modules know about the draw hold position state (used by\r\n\t\t// scrolling internally)\r\n\t\tsettings._drawHold = holdPosition;\r\n\t\r\n\t\t_fnDraw( settings );\r\n\t\r\n\t\tsettings._drawHold = false;\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Add the options to the page HTML for the table\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnAddOptionsHtml ( oSettings )\r\n\t{\r\n\t\tvar classes = oSettings.oClasses;\r\n\t\tvar table = $(oSettings.nTable);\r\n\t\tvar holding = $('').insertBefore( table ); // Holding element for speed\r\n\t\tvar features = oSettings.oFeatures;\r\n\t\r\n\t\t// All DataTables are wrapped in a div\r\n\t\tvar insert = $('', {\r\n\t\t\tid: oSettings.sTableId+'_wrapper',\r\n\t\t\t'class': classes.sWrapper + (oSettings.nTFoot ? '' : ' '+classes.sNoFooter)\r\n\t\t} );\r\n\t\r\n\t\toSettings.nHolding = holding[0];\r\n\t\toSettings.nTableWrapper = insert[0];\r\n\t\toSettings.nTableReinsertBefore = oSettings.nTable.nextSibling;\r\n\t\r\n\t\t/* Loop over the user set positioning and place the elements as needed */\r\n\t\tvar aDom = oSettings.sDom.split('');\r\n\t\tvar featureNode, cOption, nNewNode, cNext, sAttr, j;\r\n\t\tfor ( var i=0 ; i')[0];\r\n\t\r\n\t\t\t\t/* Check to see if we should append an id and/or a class name to the container */\r\n\t\t\t\tcNext = aDom[i+1];\r\n\t\t\t\tif ( cNext == \"'\" || cNext == '\"' )\r\n\t\t\t\t{\r\n\t\t\t\t\tsAttr = \"\";\r\n\t\t\t\t\tj = 2;\r\n\t\t\t\t\twhile ( aDom[i+j] != cNext )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tsAttr += aDom[i+j];\r\n\t\t\t\t\t\tj++;\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\t/* Replace jQuery UI constants @todo depreciated */\r\n\t\t\t\t\tif ( sAttr == \"H\" )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tsAttr = classes.sJUIHeader;\r\n\t\t\t\t\t}\r\n\t\t\t\t\telse if ( sAttr == \"F\" )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tsAttr = classes.sJUIFooter;\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\t/* The attribute can be in the format of \"#id.class\", \"#id\" or \"class\" This logic\r\n\t\t\t\t\t * breaks the string into parts and applies them as needed\r\n\t\t\t\t\t */\r\n\t\t\t\t\tif ( sAttr.indexOf('.') != -1 )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tvar aSplit = sAttr.split('.');\r\n\t\t\t\t\t\tnNewNode.id = aSplit[0].substr(1, aSplit[0].length-1);\r\n\t\t\t\t\t\tnNewNode.className = aSplit[1];\r\n\t\t\t\t\t}\r\n\t\t\t\t\telse if ( sAttr.charAt(0) == \"#\" )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tnNewNode.id = sAttr.substr(1, sAttr.length-1);\r\n\t\t\t\t\t}\r\n\t\t\t\t\telse\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tnNewNode.className = sAttr;\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\ti += j; /* Move along the position array */\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\tinsert.append( nNewNode );\r\n\t\t\t\tinsert = $(nNewNode);\r\n\t\t\t}\r\n\t\t\telse if ( cOption == '>' )\r\n\t\t\t{\r\n\t\t\t\t/* End container div */\r\n\t\t\t\tinsert = insert.parent();\r\n\t\t\t}\r\n\t\t\t// @todo Move options into their own plugins?\r\n\t\t\telse if ( cOption == 'l' && features.bPaginate && features.bLengthChange )\r\n\t\t\t{\r\n\t\t\t\t/* Length */\r\n\t\t\t\tfeatureNode = _fnFeatureHtmlLength( oSettings );\r\n\t\t\t}\r\n\t\t\telse if ( cOption == 'f' && features.bFilter )\r\n\t\t\t{\r\n\t\t\t\t/* Filter */\r\n\t\t\t\tfeatureNode = _fnFeatureHtmlFilter( oSettings );\r\n\t\t\t}\r\n\t\t\telse if ( cOption == 'r' && features.bProcessing )\r\n\t\t\t{\r\n\t\t\t\t/* pRocessing */\r\n\t\t\t\tfeatureNode = _fnFeatureHtmlProcessing( oSettings );\r\n\t\t\t}\r\n\t\t\telse if ( cOption == 't' )\r\n\t\t\t{\r\n\t\t\t\t/* Table */\r\n\t\t\t\tfeatureNode = _fnFeatureHtmlTable( oSettings );\r\n\t\t\t}\r\n\t\t\telse if ( cOption == 'i' && features.bInfo )\r\n\t\t\t{\r\n\t\t\t\t/* Info */\r\n\t\t\t\tfeatureNode = _fnFeatureHtmlInfo( oSettings );\r\n\t\t\t}\r\n\t\t\telse if ( cOption == 'p' && features.bPaginate )\r\n\t\t\t{\r\n\t\t\t\t/* Pagination */\r\n\t\t\t\tfeatureNode = _fnFeatureHtmlPaginate( oSettings );\r\n\t\t\t}\r\n\t\t\telse if ( DataTable.ext.feature.length !== 0 )\r\n\t\t\t{\r\n\t\t\t\t/* Plug-in features */\r\n\t\t\t\tvar aoFeatures = DataTable.ext.feature;\r\n\t\t\t\tfor ( var k=0, kLen=aoFeatures.length ; k';\r\n\t\r\n\t\tvar str = language.sSearch;\r\n\t\tstr = str.match(/_INPUT_/) ?\r\n\t\t\tstr.replace('_INPUT_', input) :\r\n\t\t\tstr+input;\r\n\t\r\n\t\tvar filter = $('', {\r\n\t\t\t\t'id': ! features.f ? tableId+'_filter' : null,\r\n\t\t\t\t'class': classes.sFilter\r\n\t\t\t} )\r\n\t\t\t.append( $('' ).append( str ) );\r\n\t\r\n\t\tvar searchFn = function() {\r\n\t\t\t/* Update all other filter input elements for the new display */\r\n\t\t\tvar n = features.f;\r\n\t\t\tvar val = !this.value ? \"\" : this.value; // mental IE8 fix :-(\r\n\t\r\n\t\t\t/* Now do the filter */\r\n\t\t\tif ( val != previousSearch.sSearch ) {\r\n\t\t\t\t_fnFilterComplete( settings, {\r\n\t\t\t\t\t\"sSearch\": val,\r\n\t\t\t\t\t\"bRegex\": previousSearch.bRegex,\r\n\t\t\t\t\t\"bSmart\": previousSearch.bSmart ,\r\n\t\t\t\t\t\"bCaseInsensitive\": previousSearch.bCaseInsensitive\r\n\t\t\t\t} );\r\n\t\r\n\t\t\t\t// Need to redraw, without resorting\r\n\t\t\t\tsettings._iDisplayStart = 0;\r\n\t\t\t\t_fnDraw( settings );\r\n\t\t\t}\r\n\t\t};\r\n\t\r\n\t\tvar searchDelay = settings.searchDelay !== null ?\r\n\t\t\tsettings.searchDelay :\r\n\t\t\t_fnDataSource( settings ) === 'ssp' ?\r\n\t\t\t\t400 :\r\n\t\t\t\t0;\r\n\t\r\n\t\tvar jqFilter = $('input', filter)\r\n\t\t\t.val( previousSearch.sSearch )\r\n\t\t\t.attr( 'placeholder', language.sSearchPlaceholder )\r\n\t\t\t.on(\r\n\t\t\t\t'keyup.DT search.DT input.DT paste.DT cut.DT',\r\n\t\t\t\tsearchDelay ?\r\n\t\t\t\t\t_fnThrottle( searchFn, searchDelay ) :\r\n\t\t\t\t\tsearchFn\r\n\t\t\t)\r\n\t\t\t.on( 'keypress.DT', function(e) {\r\n\t\t\t\t/* Prevent form submission */\r\n\t\t\t\tif ( e.keyCode == 13 ) {\r\n\t\t\t\t\treturn false;\r\n\t\t\t\t}\r\n\t\t\t} )\r\n\t\t\t.attr('aria-controls', tableId);\r\n\t\r\n\t\t// Update the input elements whenever the table is filtered\r\n\t\t$(settings.nTable).on( 'search.dt.DT', function ( ev, s ) {\r\n\t\t\tif ( settings === s ) {\r\n\t\t\t\t// IE9 throws an 'unknown error' if document.activeElement is used\r\n\t\t\t\t// inside an iframe or frame...\r\n\t\t\t\ttry {\r\n\t\t\t\t\tif ( jqFilter[0] !== document.activeElement ) {\r\n\t\t\t\t\t\tjqFilter.val( previousSearch.sSearch );\r\n\t\t\t\t\t}\r\n\t\t\t\t}\r\n\t\t\t\tcatch ( e ) {}\r\n\t\t\t}\r\n\t\t} );\r\n\t\r\n\t\treturn filter[0];\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Filter the table using both the global filter and column based filtering\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @param {object} oSearch search information\r\n\t * @param {int} [iForce] force a research of the master array (1) or not (undefined or 0)\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnFilterComplete ( oSettings, oInput, iForce )\r\n\t{\r\n\t\tvar oPrevSearch = oSettings.oPreviousSearch;\r\n\t\tvar aoPrevSearch = oSettings.aoPreSearchCols;\r\n\t\tvar fnSaveFilter = function ( oFilter ) {\r\n\t\t\t/* Save the filtering values */\r\n\t\t\toPrevSearch.sSearch = oFilter.sSearch;\r\n\t\t\toPrevSearch.bRegex = oFilter.bRegex;\r\n\t\t\toPrevSearch.bSmart = oFilter.bSmart;\r\n\t\t\toPrevSearch.bCaseInsensitive = oFilter.bCaseInsensitive;\r\n\t\t};\r\n\t\tvar fnRegex = function ( o ) {\r\n\t\t\t// Backwards compatibility with the bEscapeRegex option\r\n\t\t\treturn o.bEscapeRegex !== undefined ? !o.bEscapeRegex : o.bRegex;\r\n\t\t};\r\n\t\r\n\t\t// Resolve any column types that are unknown due to addition or invalidation\r\n\t\t// @todo As per sort - can this be moved into an event handler?\r\n\t\t_fnColumnTypes( oSettings );\r\n\t\r\n\t\t/* In server-side processing all filtering is done by the server, so no point hanging around here */\r\n\t\tif ( _fnDataSource( oSettings ) != 'ssp' )\r\n\t\t{\r\n\t\t\t/* Global filter */\r\n\t\t\t_fnFilter( oSettings, oInput.sSearch, iForce, fnRegex(oInput), oInput.bSmart, oInput.bCaseInsensitive );\r\n\t\t\tfnSaveFilter( oInput );\r\n\t\r\n\t\t\t/* Now do the individual column filter */\r\n\t\t\tfor ( var i=0 ; i input.length ||\r\n\t\t\t\t input.indexOf(prevSearch) !== 0 ||\r\n\t\t\t\t settings.bSorted // On resort, the display master needs to be\r\n\t\t\t\t // re-filtered since indexes will have changed\r\n\t\t\t) {\r\n\t\t\t\tsettings.aiDisplay = displayMaster.slice();\r\n\t\t\t}\r\n\t\r\n\t\t\t// Search the display array\r\n\t\t\tdisplay = settings.aiDisplay;\r\n\t\r\n\t\t\tfor ( i=0 ; i')[0];\r\n\tvar __filter_div_textContent = __filter_div.textContent !== undefined;\r\n\t\r\n\t// Update the filtering data for each row if needed (by invalidation or first run)\r\n\tfunction _fnFilterData ( settings )\r\n\t{\r\n\t\tvar columns = settings.aoColumns;\r\n\t\tvar column;\r\n\t\tvar i, j, ien, jen, filterData, cellData, row;\r\n\t\tvar fomatters = DataTable.ext.type.search;\r\n\t\tvar wasInvalidated = false;\r\n\t\r\n\t\tfor ( i=0, ien=settings.aoData.length ; i', {\r\n\t\t\t\t'class': settings.oClasses.sInfo,\r\n\t\t\t\t'id': ! nodes ? tid+'_info' : null\r\n\t\t\t} );\r\n\t\r\n\t\tif ( ! nodes ) {\r\n\t\t\t// Update display on each draw\r\n\t\t\tsettings.aoDrawCallback.push( {\r\n\t\t\t\t\"fn\": _fnUpdateInfo,\r\n\t\t\t\t\"sName\": \"information\"\r\n\t\t\t} );\r\n\t\r\n\t\t\tn\r\n\t\t\t\t.attr( 'role', 'status' )\r\n\t\t\t\t.attr( 'aria-live', 'polite' );\r\n\t\r\n\t\t\t// Table is described by our info div\r\n\t\t\t$(settings.nTable).attr( 'aria-describedby', tid+'_info' );\r\n\t\t}\r\n\t\r\n\t\treturn n[0];\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Update the information elements in the display\r\n\t * @param {object} settings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnUpdateInfo ( settings )\r\n\t{\r\n\t\t/* Show information about the table */\r\n\t\tvar nodes = settings.aanFeatures.i;\r\n\t\tif ( nodes.length === 0 ) {\r\n\t\t\treturn;\r\n\t\t}\r\n\t\r\n\t\tvar\r\n\t\t\tlang = settings.oLanguage,\r\n\t\t\tstart = settings._iDisplayStart+1,\r\n\t\t\tend = settings.fnDisplayEnd(),\r\n\t\t\tmax = settings.fnRecordsTotal(),\r\n\t\t\ttotal = settings.fnRecordsDisplay(),\r\n\t\t\tout = total ?\r\n\t\t\t\tlang.sInfo :\r\n\t\t\t\tlang.sInfoEmpty;\r\n\t\r\n\t\tif ( total !== max ) {\r\n\t\t\t/* Record set after filtering */\r\n\t\t\tout += ' ' + lang.sInfoFiltered;\r\n\t\t}\r\n\t\r\n\t\t// Convert the macros\r\n\t\tout += lang.sInfoPostFix;\r\n\t\tout = _fnInfoMacros( settings, out );\r\n\t\r\n\t\tvar callback = lang.fnInfoCallback;\r\n\t\tif ( callback !== null ) {\r\n\t\t\tout = callback.call( settings.oInstance,\r\n\t\t\t\tsettings, start, end, max, total, out\r\n\t\t\t);\r\n\t\t}\r\n\t\r\n\t\t$(nodes).html( out );\r\n\t}\r\n\t\r\n\t\r\n\tfunction _fnInfoMacros ( settings, str )\r\n\t{\r\n\t\t// When infinite scrolling, we are always starting at 1. _iDisplayStart is used only\r\n\t\t// internally\r\n\t\tvar\r\n\t\t\tformatter = settings.fnFormatNumber,\r\n\t\t\tstart = settings._iDisplayStart+1,\r\n\t\t\tlen = settings._iDisplayLength,\r\n\t\t\tvis = settings.fnRecordsDisplay(),\r\n\t\t\tall = len === -1;\r\n\t\r\n\t\treturn str.\r\n\t\t\treplace(/_START_/g, formatter.call( settings, start ) ).\r\n\t\t\treplace(/_END_/g, formatter.call( settings, settings.fnDisplayEnd() ) ).\r\n\t\t\treplace(/_MAX_/g, formatter.call( settings, settings.fnRecordsTotal() ) ).\r\n\t\t\treplace(/_TOTAL_/g, formatter.call( settings, vis ) ).\r\n\t\t\treplace(/_PAGE_/g, formatter.call( settings, all ? 1 : Math.ceil( start / len ) ) ).\r\n\t\t\treplace(/_PAGES_/g, formatter.call( settings, all ? 1 : Math.ceil( vis / len ) ) );\r\n\t}\r\n\t\r\n\t\r\n\t\r\n\t/**\r\n\t * Draw the table for the first time, adding all required features\r\n\t * @param {object} settings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnInitialise ( settings )\r\n\t{\r\n\t\tvar i, iLen, iAjaxStart=settings.iInitDisplayStart;\r\n\t\tvar columns = settings.aoColumns, column;\r\n\t\tvar features = settings.oFeatures;\r\n\t\tvar deferLoading = settings.bDeferLoading; // value modified by the draw\r\n\t\r\n\t\t/* Ensure that the table data is fully initialised */\r\n\t\tif ( ! settings.bInitialised ) {\r\n\t\t\tsetTimeout( function(){ _fnInitialise( settings ); }, 200 );\r\n\t\t\treturn;\r\n\t\t}\r\n\t\r\n\t\t/* Show the display HTML options */\r\n\t\t_fnAddOptionsHtml( settings );\r\n\t\r\n\t\t/* Build and draw the header / footer for the table */\r\n\t\t_fnBuildHead( settings );\r\n\t\t_fnDrawHead( settings, settings.aoHeader );\r\n\t\t_fnDrawHead( settings, settings.aoFooter );\r\n\t\r\n\t\t/* Okay to show that something is going on now */\r\n\t\t_fnProcessingDisplay( settings, true );\r\n\t\r\n\t\t/* Calculate sizes for columns */\r\n\t\tif ( features.bAutoWidth ) {\r\n\t\t\t_fnCalculateColumnWidths( settings );\r\n\t\t}\r\n\t\r\n\t\tfor ( i=0, iLen=columns.length ; i', {\r\n\t\t\t'name': tableId+'_length',\r\n\t\t\t'aria-controls': tableId,\r\n\t\t\t'class': classes.sLengthSelect\r\n\t\t} );\r\n\t\r\n\t\tfor ( var i=0, ien=lengths.length ; i'+headerContent[i]+'
';\r\n\t\t\tnSizer.style.width = headerWidths[i];\r\n\t\t}, headerSrcEls );\r\n\t\r\n\t\tif ( footer )\r\n\t\t{\r\n\t\t\t_fnApplyToChildren( function(nSizer, i) {\r\n\t\t\t\tnSizer.innerHTML = ''+footerContent[i]+'
';\r\n\t\t\t\tnSizer.style.width = footerWidths[i];\r\n\t\t\t}, footerSrcEls );\r\n\t\t}\r\n\t\r\n\t\t// Sanity check that the table is of a sensible width. If not then we are going to get\r\n\t\t// misalignment - try to prevent this by not allowing the table to shrink below its min width\r\n\t\tif ( table.outerWidth() < sanityWidth )\r\n\t\t{\r\n\t\t\t// The min width depends upon if we have a vertical scrollbar visible or not */\r\n\t\t\tcorrection = ((divBodyEl.scrollHeight > divBodyEl.offsetHeight ||\r\n\t\t\t\tdivBody.css('overflow-y') == \"scroll\")) ?\r\n\t\t\t\t\tsanityWidth+barWidth :\r\n\t\t\t\t\tsanityWidth;\r\n\t\r\n\t\t\t// IE6/7 are a law unto themselves...\r\n\t\t\tif ( ie67 && (divBodyEl.scrollHeight >\r\n\t\t\t\tdivBodyEl.offsetHeight || divBody.css('overflow-y') == \"scroll\")\r\n\t\t\t) {\r\n\t\t\t\ttableStyle.width = _fnStringToCss( correction-barWidth );\r\n\t\t\t}\r\n\t\r\n\t\t\t// And give the user a warning that we've stopped the table getting too small\r\n\t\t\tif ( scrollX === \"\" || scrollXInner !== \"\" ) {\r\n\t\t\t\t_fnLog( settings, 1, 'Possible column misalignment', 6 );\r\n\t\t\t}\r\n\t\t}\r\n\t\telse\r\n\t\t{\r\n\t\t\tcorrection = '100%';\r\n\t\t}\r\n\t\r\n\t\t// Apply to the container elements\r\n\t\tdivBodyStyle.width = _fnStringToCss( correction );\r\n\t\tdivHeaderStyle.width = _fnStringToCss( correction );\r\n\t\r\n\t\tif ( footer ) {\r\n\t\t\tsettings.nScrollFoot.style.width = _fnStringToCss( correction );\r\n\t\t}\r\n\t\r\n\t\r\n\t\t/*\r\n\t\t * 4. Clean up\r\n\t\t */\r\n\t\tif ( ! scrollY ) {\r\n\t\t\t/* IE7< puts a vertical scrollbar in place (when it shouldn't be) due to subtracting\r\n\t\t\t * the scrollbar height from the visible display, rather than adding it on. We need to\r\n\t\t\t * set the height in order to sort this. Don't want to do it in any other browsers.\r\n\t\t\t */\r\n\t\t\tif ( ie67 ) {\r\n\t\t\t\tdivBodyStyle.height = _fnStringToCss( tableEl.offsetHeight+barWidth );\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\t/* Finally set the width's of the header and footer tables */\r\n\t\tvar iOuterWidth = table.outerWidth();\r\n\t\tdivHeaderTable[0].style.width = _fnStringToCss( iOuterWidth );\r\n\t\tdivHeaderInnerStyle.width = _fnStringToCss( iOuterWidth );\r\n\t\r\n\t\t// Figure out if there are scrollbar present - if so then we need a the header and footer to\r\n\t\t// provide a bit more space to allow \"overflow\" scrolling (i.e. past the scrollbar)\r\n\t\tvar bScrolling = table.height() > divBodyEl.clientHeight || divBody.css('overflow-y') == \"scroll\";\r\n\t\tvar padding = 'padding' + (browser.bScrollbarLeft ? 'Left' : 'Right' );\r\n\t\tdivHeaderInnerStyle[ padding ] = bScrolling ? barWidth+\"px\" : \"0px\";\r\n\t\r\n\t\tif ( footer ) {\r\n\t\t\tdivFooterTable[0].style.width = _fnStringToCss( iOuterWidth );\r\n\t\t\tdivFooterInner[0].style.width = _fnStringToCss( iOuterWidth );\r\n\t\t\tdivFooterInner[0].style[padding] = bScrolling ? barWidth+\"px\" : \"0px\";\r\n\t\t}\r\n\t\r\n\t\t// Correct DOM ordering for colgroup - comes before the thead\r\n\t\ttable.children('colgroup').insertBefore( table.children('thead') );\r\n\t\r\n\t\t/* Adjust the position of the header in case we loose the y-scrollbar */\r\n\t\tdivBody.scroll();\r\n\t\r\n\t\t// If sorting or filtering has occurred, jump the scrolling back to the top\r\n\t\t// only if we aren't holding the position\r\n\t\tif ( (settings.bSorted || settings.bFiltered) && ! settings._drawHold ) {\r\n\t\t\tdivBodyEl.scrollTop = 0;\r\n\t\t}\r\n\t}\r\n\t\r\n\t\r\n\t\r\n\t/**\r\n\t * Apply a given function to the display child nodes of an element array (typically\r\n\t * TD children of TR rows\r\n\t * @param {function} fn Method to apply to the objects\r\n\t * @param array {nodes} an1 List of elements to look through for display children\r\n\t * @param array {nodes} an2 Another list (identical structure to the first) - optional\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnApplyToChildren( fn, an1, an2 )\r\n\t{\r\n\t\tvar index=0, i=0, iLen=an1.length;\r\n\t\tvar nNode1, nNode2;\r\n\t\r\n\t\twhile ( i < iLen ) {\r\n\t\t\tnNode1 = an1[i].firstChild;\r\n\t\t\tnNode2 = an2 ? an2[i].firstChild : null;\r\n\t\r\n\t\t\twhile ( nNode1 ) {\r\n\t\t\t\tif ( nNode1.nodeType === 1 ) {\r\n\t\t\t\t\tif ( an2 ) {\r\n\t\t\t\t\t\tfn( nNode1, nNode2, index );\r\n\t\t\t\t\t}\r\n\t\t\t\t\telse {\r\n\t\t\t\t\t\tfn( nNode1, index );\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\tindex++;\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\tnNode1 = nNode1.nextSibling;\r\n\t\t\t\tnNode2 = an2 ? nNode2.nextSibling : null;\r\n\t\t\t}\r\n\t\r\n\t\t\ti++;\r\n\t\t}\r\n\t}\r\n\t\r\n\t\r\n\t\r\n\tvar __re_html_remove = /<.*?>/g;\r\n\t\r\n\t\r\n\t/**\r\n\t * Calculate the width of columns for the table\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnCalculateColumnWidths ( oSettings )\r\n\t{\r\n\t\tvar\r\n\t\t\ttable = oSettings.nTable,\r\n\t\t\tcolumns = oSettings.aoColumns,\r\n\t\t\tscroll = oSettings.oScroll,\r\n\t\t\tscrollY = scroll.sY,\r\n\t\t\tscrollX = scroll.sX,\r\n\t\t\tscrollXInner = scroll.sXInner,\r\n\t\t\tcolumnCount = columns.length,\r\n\t\t\tvisibleColumns = _fnGetColumns( oSettings, 'bVisible' ),\r\n\t\t\theaderCells = $('th', oSettings.nTHead),\r\n\t\t\ttableWidthAttr = table.getAttribute('width'), // from DOM element\r\n\t\t\ttableContainer = table.parentNode,\r\n\t\t\tuserInputs = false,\r\n\t\t\ti, column, columnIdx, width, outerWidth,\r\n\t\t\tbrowser = oSettings.oBrowser,\r\n\t\t\tie67 = browser.bScrollOversize;\r\n\t\r\n\t\tvar styleWidth = table.style.width;\r\n\t\tif ( styleWidth && styleWidth.indexOf('%') !== -1 ) {\r\n\t\t\ttableWidthAttr = styleWidth;\r\n\t\t}\r\n\t\r\n\t\t/* Convert any user input sizes into pixel sizes */\r\n\t\tfor ( i=0 ; i').appendTo( tmpTable.find('tbody') );\r\n\t\r\n\t\t\t// Clone the table header and footer - we can't use the header / footer\r\n\t\t\t// from the cloned table, since if scrolling is active, the table's\r\n\t\t\t// real header and footer are contained in different table tags\r\n\t\t\ttmpTable.find('thead, tfoot').remove();\r\n\t\t\ttmpTable\r\n\t\t\t\t.append( $(oSettings.nTHead).clone() )\r\n\t\t\t\t.append( $(oSettings.nTFoot).clone() );\r\n\t\r\n\t\t\t// Remove any assigned widths from the footer (from scrolling)\r\n\t\t\ttmpTable.find('tfoot th, tfoot td').css('width', '');\r\n\t\r\n\t\t\t// Apply custom sizing to the cloned header\r\n\t\t\theaderCells = _fnGetUniqueThs( oSettings, tmpTable.find('thead')[0] );\r\n\t\r\n\t\t\tfor ( i=0 ; i').css( {\r\n\t\t\t\t\t\twidth: column.sWidthOrig,\r\n\t\t\t\t\t\tmargin: 0,\r\n\t\t\t\t\t\tpadding: 0,\r\n\t\t\t\t\t\tborder: 0,\r\n\t\t\t\t\t\theight: 1\r\n\t\t\t\t\t} ) );\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\r\n\t\t\t// Find the widest cell for each column and put it into the table\r\n\t\t\tif ( oSettings.aoData.length ) {\r\n\t\t\t\tfor ( i=0 ; i').css( scrollX || scrollY ?\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\tposition: 'absolute',\r\n\t\t\t\t\t\ttop: 0,\r\n\t\t\t\t\t\tleft: 0,\r\n\t\t\t\t\t\theight: 1,\r\n\t\t\t\t\t\tright: 0,\r\n\t\t\t\t\t\toverflow: 'hidden'\r\n\t\t\t\t\t} :\r\n\t\t\t\t\t{}\r\n\t\t\t\t)\r\n\t\t\t\t.append( tmpTable )\r\n\t\t\t\t.appendTo( tableContainer );\r\n\t\r\n\t\t\t// When scrolling (X or Y) we want to set the width of the table as \r\n\t\t\t// appropriate. However, when not scrolling leave the table width as it\r\n\t\t\t// is. This results in slightly different, but I think correct behaviour\r\n\t\t\tif ( scrollX && scrollXInner ) {\r\n\t\t\t\ttmpTable.width( scrollXInner );\r\n\t\t\t}\r\n\t\t\telse if ( scrollX ) {\r\n\t\t\t\ttmpTable.css( 'width', 'auto' );\r\n\t\t\t\ttmpTable.removeAttr('width');\r\n\t\r\n\t\t\t\t// If there is no width attribute or style, then allow the table to\r\n\t\t\t\t// collapse\r\n\t\t\t\tif ( tmpTable.width() < tableContainer.clientWidth && tableWidthAttr ) {\r\n\t\t\t\t\ttmpTable.width( tableContainer.clientWidth );\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t\telse if ( scrollY ) {\r\n\t\t\t\ttmpTable.width( tableContainer.clientWidth );\r\n\t\t\t}\r\n\t\t\telse if ( tableWidthAttr ) {\r\n\t\t\t\ttmpTable.width( tableWidthAttr );\r\n\t\t\t}\r\n\t\r\n\t\t\t// Get the width of each column in the constructed table - we need to\r\n\t\t\t// know the inner width (so it can be assigned to the other table's\r\n\t\t\t// cells) and the outer width so we can calculate the full width of the\r\n\t\t\t// table. This is safe since DataTables requires a unique cell for each\r\n\t\t\t// column, but if ever a header can span multiple columns, this will\r\n\t\t\t// need to be modified.\r\n\t\t\tvar total = 0;\r\n\t\t\tfor ( i=0 ; i')\r\n\t\t\t.css( 'width', _fnStringToCss( width ) )\r\n\t\t\t.appendTo( parent || document.body );\r\n\t\r\n\t\tvar val = n[0].offsetWidth;\r\n\t\tn.remove();\r\n\t\r\n\t\treturn val;\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Get the widest node\r\n\t * @param {object} settings dataTables settings object\r\n\t * @param {int} colIdx column of interest\r\n\t * @returns {node} widest table node\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnGetWidestNode( settings, colIdx )\r\n\t{\r\n\t\tvar idx = _fnGetMaxLenString( settings, colIdx );\r\n\t\tif ( idx < 0 ) {\r\n\t\t\treturn null;\r\n\t\t}\r\n\t\r\n\t\tvar data = settings.aoData[ idx ];\r\n\t\treturn ! data.nTr ? // Might not have been created when deferred rendering\r\n\t\t\t$(' | ').html( _fnGetCellData( settings, idx, colIdx, 'display' ) )[0] :\r\n\t\t\tdata.anCells[ colIdx ];\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Get the maximum strlen for each data column\r\n\t * @param {object} settings dataTables settings object\r\n\t * @param {int} colIdx column of interest\r\n\t * @returns {string} max string length for each column\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnGetMaxLenString( settings, colIdx )\r\n\t{\r\n\t\tvar s, max=-1, maxIdx = -1;\r\n\t\r\n\t\tfor ( var i=0, ien=settings.aoData.length ; i max ) {\r\n\t\t\t\tmax = s.length;\r\n\t\t\t\tmaxIdx = i;\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\treturn maxIdx;\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Append a CSS unit (only if required) to a string\r\n\t * @param {string} value to css-ify\r\n\t * @returns {string} value with css unit\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnStringToCss( s )\r\n\t{\r\n\t\tif ( s === null ) {\r\n\t\t\treturn '0px';\r\n\t\t}\r\n\t\r\n\t\tif ( typeof s == 'number' ) {\r\n\t\t\treturn s < 0 ?\r\n\t\t\t\t'0px' :\r\n\t\t\t\ts+'px';\r\n\t\t}\r\n\t\r\n\t\t// Check it has a unit character already\r\n\t\treturn s.match(/\\d$/) ?\r\n\t\t\ts+'px' :\r\n\t\t\ts;\r\n\t}\r\n\t\r\n\t\r\n\t\r\n\tfunction _fnSortFlatten ( settings )\r\n\t{\r\n\t\tvar\r\n\t\t\ti, iLen, k, kLen,\r\n\t\t\taSort = [],\r\n\t\t\taiOrig = [],\r\n\t\t\taoColumns = settings.aoColumns,\r\n\t\t\taDataSort, iCol, sType, srcCol,\r\n\t\t\tfixed = settings.aaSortingFixed,\r\n\t\t\tfixedObj = $.isPlainObject( fixed ),\r\n\t\t\tnestedSort = [],\r\n\t\t\tadd = function ( a ) {\r\n\t\t\t\tif ( a.length && ! $.isArray( a[0] ) ) {\r\n\t\t\t\t\t// 1D array\r\n\t\t\t\t\tnestedSort.push( a );\r\n\t\t\t\t}\r\n\t\t\t\telse {\r\n\t\t\t\t\t// 2D array\r\n\t\t\t\t\t$.merge( nestedSort, a );\r\n\t\t\t\t}\r\n\t\t\t};\r\n\t\r\n\t\t// Build the sort array, with pre-fix and post-fix options if they have been\r\n\t\t// specified\r\n\t\tif ( $.isArray( fixed ) ) {\r\n\t\t\tadd( fixed );\r\n\t\t}\r\n\t\r\n\t\tif ( fixedObj && fixed.pre ) {\r\n\t\t\tadd( fixed.pre );\r\n\t\t}\r\n\t\r\n\t\tadd( settings.aaSorting );\r\n\t\r\n\t\tif (fixedObj && fixed.post ) {\r\n\t\t\tadd( fixed.post );\r\n\t\t}\r\n\t\r\n\t\tfor ( i=0 ; iy ? 1 : 0;\r\n\t\t\t\t\t\tif ( test !== 0 ) {\r\n\t\t\t\t\t\t\treturn sort.dir === 'asc' ? test : -test;\r\n\t\t\t\t\t\t}\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\tx = aiOrig[a];\r\n\t\t\t\t\ty = aiOrig[b];\r\n\t\t\t\t\treturn xy ? 1 : 0;\r\n\t\t\t\t} );\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\t// Depreciated - remove in 1.11 (providing a plug-in option)\r\n\t\t\t\t// Not all sort types have formatting methods, so we have to call their sorting\r\n\t\t\t\t// methods.\r\n\t\t\t\tdisplayMaster.sort( function ( a, b ) {\r\n\t\t\t\t\tvar\r\n\t\t\t\t\t\tx, y, k, l, test, sort, fn,\r\n\t\t\t\t\t\tlen=aSort.length,\r\n\t\t\t\t\t\tdataA = aoData[a]._aSortData,\r\n\t\t\t\t\t\tdataB = aoData[b]._aSortData;\r\n\t\r\n\t\t\t\t\tfor ( k=0 ; ky ? 1 : 0;\r\n\t\t\t\t} );\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\t/* Tell the draw function that we have sorted the data */\r\n\t\toSettings.bSorted = true;\r\n\t}\r\n\t\r\n\t\r\n\tfunction _fnSortAria ( settings )\r\n\t{\r\n\t\tvar label;\r\n\t\tvar nextSort;\r\n\t\tvar columns = settings.aoColumns;\r\n\t\tvar aSort = _fnSortFlatten( settings );\r\n\t\tvar oAria = settings.oLanguage.oAria;\r\n\t\r\n\t\t// ARIA attributes - need to loop all columns, to update all (removing old\r\n\t\t// attributes as needed)\r\n\t\tfor ( var i=0, iLen=columns.length ; i/g, \"\" );\r\n\t\t\tvar th = col.nTh;\r\n\t\r\n\t\t\t// IE7 is throwing an error when setting these properties with jQuery's\r\n\t\t\t// attr() and removeAttr() methods...\r\n\t\t\tth.removeAttribute('aria-sort');\r\n\t\r\n\t\t\t/* In ARIA only the first sorting column can be marked as sorting - no multi-sort option */\r\n\t\t\tif ( col.bSortable ) {\r\n\t\t\t\tif ( aSort.length > 0 && aSort[0].col == i ) {\r\n\t\t\t\t\tth.setAttribute('aria-sort', aSort[0].dir==\"asc\" ? \"ascending\" : \"descending\" );\r\n\t\t\t\t\tnextSort = asSorting[ aSort[0].index+1 ] || asSorting[0];\r\n\t\t\t\t}\r\n\t\t\t\telse {\r\n\t\t\t\t\tnextSort = asSorting[0];\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\tlabel = sTitle + ( nextSort === \"asc\" ?\r\n\t\t\t\t\toAria.sSortAscending :\r\n\t\t\t\t\toAria.sSortDescending\r\n\t\t\t\t);\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\tlabel = sTitle;\r\n\t\t\t}\r\n\t\r\n\t\t\tth.setAttribute('aria-label', label);\r\n\t\t}\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Function to run on user sort request\r\n\t * @param {object} settings dataTables settings object\r\n\t * @param {node} attachTo node to attach the handler to\r\n\t * @param {int} colIdx column sorting index\r\n\t * @param {boolean} [append=false] Append the requested sort to the existing\r\n\t * sort if true (i.e. multi-column sort)\r\n\t * @param {function} [callback] callback function\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnSortListener ( settings, colIdx, append, callback )\r\n\t{\r\n\t\tvar col = settings.aoColumns[ colIdx ];\r\n\t\tvar sorting = settings.aaSorting;\r\n\t\tvar asSorting = col.asSorting;\r\n\t\tvar nextSortIdx;\r\n\t\tvar next = function ( a, overflow ) {\r\n\t\t\tvar idx = a._idx;\r\n\t\t\tif ( idx === undefined ) {\r\n\t\t\t\tidx = $.inArray( a[1], asSorting );\r\n\t\t\t}\r\n\t\r\n\t\t\treturn idx+1 < asSorting.length ?\r\n\t\t\t\tidx+1 :\r\n\t\t\t\toverflow ?\r\n\t\t\t\t\tnull :\r\n\t\t\t\t\t0;\r\n\t\t};\r\n\t\r\n\t\t// Convert to 2D array if needed\r\n\t\tif ( typeof sorting[0] === 'number' ) {\r\n\t\t\tsorting = settings.aaSorting = [ sorting ];\r\n\t\t}\r\n\t\r\n\t\t// If appending the sort then we are multi-column sorting\r\n\t\tif ( append && settings.oFeatures.bSortMulti ) {\r\n\t\t\t// Are we already doing some kind of sort on this column?\r\n\t\t\tvar sortIdx = $.inArray( colIdx, _pluck(sorting, '0') );\r\n\t\r\n\t\t\tif ( sortIdx !== -1 ) {\r\n\t\t\t\t// Yes, modify the sort\r\n\t\t\t\tnextSortIdx = next( sorting[sortIdx], true );\r\n\t\r\n\t\t\t\tif ( nextSortIdx === null && sorting.length === 1 ) {\r\n\t\t\t\t\tnextSortIdx = 0; // can't remove sorting completely\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\tif ( nextSortIdx === null ) {\r\n\t\t\t\t\tsorting.splice( sortIdx, 1 );\r\n\t\t\t\t}\r\n\t\t\t\telse {\r\n\t\t\t\t\tsorting[sortIdx][1] = asSorting[ nextSortIdx ];\r\n\t\t\t\t\tsorting[sortIdx]._idx = nextSortIdx;\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\t// No sort on this column yet\r\n\t\t\t\tsorting.push( [ colIdx, asSorting[0], 0 ] );\r\n\t\t\t\tsorting[sorting.length-1]._idx = 0;\r\n\t\t\t}\r\n\t\t}\r\n\t\telse if ( sorting.length && sorting[0][0] == colIdx ) {\r\n\t\t\t// Single column - already sorting on this column, modify the sort\r\n\t\t\tnextSortIdx = next( sorting[0] );\r\n\t\r\n\t\t\tsorting.length = 1;\r\n\t\t\tsorting[0][1] = asSorting[ nextSortIdx ];\r\n\t\t\tsorting[0]._idx = nextSortIdx;\r\n\t\t}\r\n\t\telse {\r\n\t\t\t// Single column - sort only on this column\r\n\t\t\tsorting.length = 0;\r\n\t\t\tsorting.push( [ colIdx, asSorting[0] ] );\r\n\t\t\tsorting[0]._idx = 0;\r\n\t\t}\r\n\t\r\n\t\t// Run the sort by calling a full redraw\r\n\t\t_fnReDraw( settings );\r\n\t\r\n\t\t// callback used for async user interaction\r\n\t\tif ( typeof callback == 'function' ) {\r\n\t\t\tcallback( settings );\r\n\t\t}\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Attach a sort handler (click) to a node\r\n\t * @param {object} settings dataTables settings object\r\n\t * @param {node} attachTo node to attach the handler to\r\n\t * @param {int} colIdx column sorting index\r\n\t * @param {function} [callback] callback function\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnSortAttachListener ( settings, attachTo, colIdx, callback )\r\n\t{\r\n\t\tvar col = settings.aoColumns[ colIdx ];\r\n\t\r\n\t\t_fnBindAction( attachTo, {}, function (e) {\r\n\t\t\t/* If the column is not sortable - don't to anything */\r\n\t\t\tif ( col.bSortable === false ) {\r\n\t\t\t\treturn;\r\n\t\t\t}\r\n\t\r\n\t\t\t// If processing is enabled use a timeout to allow the processing\r\n\t\t\t// display to be shown - otherwise to it synchronously\r\n\t\t\tif ( settings.oFeatures.bProcessing ) {\r\n\t\t\t\t_fnProcessingDisplay( settings, true );\r\n\t\r\n\t\t\t\tsetTimeout( function() {\r\n\t\t\t\t\t_fnSortListener( settings, colIdx, e.shiftKey, callback );\r\n\t\r\n\t\t\t\t\t// In server-side processing, the draw callback will remove the\r\n\t\t\t\t\t// processing display\r\n\t\t\t\t\tif ( _fnDataSource( settings ) !== 'ssp' ) {\r\n\t\t\t\t\t\t_fnProcessingDisplay( settings, false );\r\n\t\t\t\t\t}\r\n\t\t\t\t}, 0 );\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\t_fnSortListener( settings, colIdx, e.shiftKey, callback );\r\n\t\t\t}\r\n\t\t} );\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Set the sorting classes on table's body, Note: it is safe to call this function\r\n\t * when bSort and bSortClasses are false\r\n\t * @param {object} oSettings dataTables settings object\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnSortingClasses( settings )\r\n\t{\r\n\t\tvar oldSort = settings.aLastSort;\r\n\t\tvar sortClass = settings.oClasses.sSortColumn;\r\n\t\tvar sort = _fnSortFlatten( settings );\r\n\t\tvar features = settings.oFeatures;\r\n\t\tvar i, ien, colIdx;\r\n\t\r\n\t\tif ( features.bSort && features.bSortClasses ) {\r\n\t\t\t// Remove old sorting classes\r\n\t\t\tfor ( i=0, ien=oldSort.length ; i 0 && s.time < +new Date() - (duration*1000) ) {\r\n\t\t\t\tcallback();\r\n\t\t\t\treturn;\r\n\t\t\t}\r\n\t\r\n\t\t\t// Number of columns have changed - all bets are off, no restore of settings\r\n\t\t\tif ( s.columns && columns.length !== s.columns.length ) {\r\n\t\t\t\tcallback();\r\n\t\t\t\treturn;\r\n\t\t\t}\r\n\t\r\n\t\t\t// Store the saved state so it might be accessed at any time\r\n\t\t\tsettings.oLoadedState = $.extend( true, {}, s );\r\n\t\r\n\t\t\t// Restore key features - todo - for 1.11 this needs to be done by\r\n\t\t\t// subscribed events\r\n\t\t\tif ( s.start !== undefined ) {\r\n\t\t\t\tsettings._iDisplayStart = s.start;\r\n\t\t\t\tsettings.iInitDisplayStart = s.start;\r\n\t\t\t}\r\n\t\t\tif ( s.length !== undefined ) {\r\n\t\t\t\tsettings._iDisplayLength = s.length;\r\n\t\t\t}\r\n\t\r\n\t\t\t// Order\r\n\t\t\tif ( s.order !== undefined ) {\r\n\t\t\t\tsettings.aaSorting = [];\r\n\t\t\t\t$.each( s.order, function ( i, col ) {\r\n\t\t\t\t\tsettings.aaSorting.push( col[0] >= columns.length ?\r\n\t\t\t\t\t\t[ 0, col[1] ] :\r\n\t\t\t\t\t\tcol\r\n\t\t\t\t\t);\r\n\t\t\t\t} );\r\n\t\t\t}\r\n\t\r\n\t\t\t// Search\r\n\t\t\tif ( s.search !== undefined ) {\r\n\t\t\t\t$.extend( settings.oPreviousSearch, _fnSearchToHung( s.search ) );\r\n\t\t\t}\r\n\t\r\n\t\t\t// Columns\r\n\t\t\t//\r\n\t\t\tif ( s.columns ) {\r\n\t\t\t\tfor ( i=0, ien=s.columns.length ; i= end )\r\n\t\t{\r\n\t\t\tstart = end - len;\r\n\t\t}\r\n\t\r\n\t\t// Keep the start record on the current page\r\n\t\tstart -= (start % len);\r\n\t\r\n\t\tif ( len === -1 || start < 0 )\r\n\t\t{\r\n\t\t\tstart = 0;\r\n\t\t}\r\n\t\r\n\t\tsettings._iDisplayStart = start;\r\n\t}\r\n\t\r\n\t\r\n\tfunction _fnRenderer( settings, type )\r\n\t{\r\n\t\tvar renderer = settings.renderer;\r\n\t\tvar host = DataTable.ext.renderer[type];\r\n\t\r\n\t\tif ( $.isPlainObject( renderer ) && renderer[type] ) {\r\n\t\t\t// Specific renderer for this type. If available use it, otherwise use\r\n\t\t\t// the default.\r\n\t\t\treturn host[renderer[type]] || host._;\r\n\t\t}\r\n\t\telse if ( typeof renderer === 'string' ) {\r\n\t\t\t// Common renderer - if there is one available for this type use it,\r\n\t\t\t// otherwise use the default\r\n\t\t\treturn host[renderer] || host._;\r\n\t\t}\r\n\t\r\n\t\t// Use the default\r\n\t\treturn host._;\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Detect the data source being used for the table. Used to simplify the code\r\n\t * a little (ajax) and to make it compress a little smaller.\r\n\t *\r\n\t * @param {object} settings dataTables settings object\r\n\t * @returns {string} Data source\r\n\t * @memberof DataTable#oApi\r\n\t */\r\n\tfunction _fnDataSource ( settings )\r\n\t{\r\n\t\tif ( settings.oFeatures.bServerSide ) {\r\n\t\t\treturn 'ssp';\r\n\t\t}\r\n\t\telse if ( settings.ajax || settings.sAjaxSource ) {\r\n\t\t\treturn 'ajax';\r\n\t\t}\r\n\t\treturn 'dom';\r\n\t}\r\n\t\r\n\r\n\t\r\n\t\r\n\t/**\r\n\t * Computed structure of the DataTables API, defined by the options passed to\r\n\t * `DataTable.Api.register()` when building the API.\r\n\t *\r\n\t * The structure is built in order to speed creation and extension of the Api\r\n\t * objects since the extensions are effectively pre-parsed.\r\n\t *\r\n\t * The array is an array of objects with the following structure, where this\r\n\t * base array represents the Api prototype base:\r\n\t *\r\n\t * [\r\n\t * {\r\n\t * name: 'data' -- string - Property name\r\n\t * val: function () {}, -- function - Api method (or undefined if just an object\r\n\t * methodExt: [ ... ], -- array - Array of Api object definitions to extend the method result\r\n\t * propExt: [ ... ] -- array - Array of Api object definitions to extend the property\r\n\t * },\r\n\t * {\r\n\t * name: 'row'\r\n\t * val: {},\r\n\t * methodExt: [ ... ],\r\n\t * propExt: [\r\n\t * {\r\n\t * name: 'data'\r\n\t * val: function () {},\r\n\t * methodExt: [ ... ],\r\n\t * propExt: [ ... ]\r\n\t * },\r\n\t * ...\r\n\t * ]\r\n\t * }\r\n\t * ]\r\n\t *\r\n\t * @type {Array}\r\n\t * @ignore\r\n\t */\r\n\tvar __apiStruct = [];\r\n\t\r\n\t\r\n\t/**\r\n\t * `Array.prototype` reference.\r\n\t *\r\n\t * @type object\r\n\t * @ignore\r\n\t */\r\n\tvar __arrayProto = Array.prototype;\r\n\t\r\n\t\r\n\t/**\r\n\t * Abstraction for `context` parameter of the `Api` constructor to allow it to\r\n\t * take several different forms for ease of use.\r\n\t *\r\n\t * Each of the input parameter types will be converted to a DataTables settings\r\n\t * object where possible.\r\n\t *\r\n\t * @param {string|node|jQuery|object} mixed DataTable identifier. Can be one\r\n\t * of:\r\n\t *\r\n\t * * `string` - jQuery selector. Any DataTables' matching the given selector\r\n\t * with be found and used.\r\n\t * * `node` - `TABLE` node which has already been formed into a DataTable.\r\n\t * * `jQuery` - A jQuery object of `TABLE` nodes.\r\n\t * * `object` - DataTables settings object\r\n\t * * `DataTables.Api` - API instance\r\n\t * @return {array|null} Matching DataTables settings objects. `null` or\r\n\t * `undefined` is returned if no matching DataTable is found.\r\n\t * @ignore\r\n\t */\r\n\tvar _toSettings = function ( mixed )\r\n\t{\r\n\t\tvar idx, jq;\r\n\t\tvar settings = DataTable.settings;\r\n\t\tvar tables = $.map( settings, function (el, i) {\r\n\t\t\treturn el.nTable;\r\n\t\t} );\r\n\t\r\n\t\tif ( ! mixed ) {\r\n\t\t\treturn [];\r\n\t\t}\r\n\t\telse if ( mixed.nTable && mixed.oApi ) {\r\n\t\t\t// DataTables settings object\r\n\t\t\treturn [ mixed ];\r\n\t\t}\r\n\t\telse if ( mixed.nodeName && mixed.nodeName.toLowerCase() === 'table' ) {\r\n\t\t\t// Table node\r\n\t\t\tidx = $.inArray( mixed, tables );\r\n\t\t\treturn idx !== -1 ? [ settings[idx] ] : null;\r\n\t\t}\r\n\t\telse if ( mixed && typeof mixed.settings === 'function' ) {\r\n\t\t\treturn mixed.settings().toArray();\r\n\t\t}\r\n\t\telse if ( typeof mixed === 'string' ) {\r\n\t\t\t// jQuery selector\r\n\t\t\tjq = $(mixed);\r\n\t\t}\r\n\t\telse if ( mixed instanceof $ ) {\r\n\t\t\t// jQuery object (also DataTables instance)\r\n\t\t\tjq = mixed;\r\n\t\t}\r\n\t\r\n\t\tif ( jq ) {\r\n\t\t\treturn jq.map( function(i) {\r\n\t\t\t\tidx = $.inArray( this, tables );\r\n\t\t\t\treturn idx !== -1 ? settings[idx] : null;\r\n\t\t\t} ).toArray();\r\n\t\t}\r\n\t};\r\n\t\r\n\t\r\n\t/**\r\n\t * DataTables API class - used to control and interface with one or more\r\n\t * DataTables enhanced tables.\r\n\t *\r\n\t * The API class is heavily based on jQuery, presenting a chainable interface\r\n\t * that you can use to interact with tables. Each instance of the API class has\r\n\t * a \"context\" - i.e. the tables that it will operate on. This could be a single\r\n\t * table, all tables on a page or a sub-set thereof.\r\n\t *\r\n\t * Additionally the API is designed to allow you to easily work with the data in\r\n\t * the tables, retrieving and manipulating it as required. This is done by\r\n\t * presenting the API class as an array like interface. The contents of the\r\n\t * array depend upon the actions requested by each method (for example\r\n\t * `rows().nodes()` will return an array of nodes, while `rows().data()` will\r\n\t * return an array of objects or arrays depending upon your table's\r\n\t * configuration). The API object has a number of array like methods (`push`,\r\n\t * `pop`, `reverse` etc) as well as additional helper methods (`each`, `pluck`,\r\n\t * `unique` etc) to assist your working with the data held in a table.\r\n\t *\r\n\t * Most methods (those which return an Api instance) are chainable, which means\r\n\t * the return from a method call also has all of the methods available that the\r\n\t * top level object had. For example, these two calls are equivalent:\r\n\t *\r\n\t * // Not chained\r\n\t * api.row.add( {...} );\r\n\t * api.draw();\r\n\t *\r\n\t * // Chained\r\n\t * api.row.add( {...} ).draw();\r\n\t *\r\n\t * @class DataTable.Api\r\n\t * @param {array|object|string|jQuery} context DataTable identifier. This is\r\n\t * used to define which DataTables enhanced tables this API will operate on.\r\n\t * Can be one of:\r\n\t *\r\n\t * * `string` - jQuery selector. Any DataTables' matching the given selector\r\n\t * with be found and used.\r\n\t * * `node` - `TABLE` node which has already been formed into a DataTable.\r\n\t * * `jQuery` - A jQuery object of `TABLE` nodes.\r\n\t * * `object` - DataTables settings object\r\n\t * @param {array} [data] Data to initialise the Api instance with.\r\n\t *\r\n\t * @example\r\n\t * // Direct initialisation during DataTables construction\r\n\t * var api = $('#example').DataTable();\r\n\t *\r\n\t * @example\r\n\t * // Initialisation using a DataTables jQuery object\r\n\t * var api = $('#example').dataTable().api();\r\n\t *\r\n\t * @example\r\n\t * // Initialisation as a constructor\r\n\t * var api = new $.fn.DataTable.Api( 'table.dataTable' );\r\n\t */\r\n\t_Api = function ( context, data )\r\n\t{\r\n\t\tif ( ! (this instanceof _Api) ) {\r\n\t\t\treturn new _Api( context, data );\r\n\t\t}\r\n\t\r\n\t\tvar settings = [];\r\n\t\tvar ctxSettings = function ( o ) {\r\n\t\t\tvar a = _toSettings( o );\r\n\t\t\tif ( a ) {\r\n\t\t\t\tsettings = settings.concat( a );\r\n\t\t\t}\r\n\t\t};\r\n\t\r\n\t\tif ( $.isArray( context ) ) {\r\n\t\t\tfor ( var i=0, ien=context.length ; i idx ?\r\n\t\t\t\tnew _Api( ctx[idx], this[idx] ) :\r\n\t\t\t\tnull;\r\n\t\t},\r\n\t\r\n\t\r\n\t\tfilter: function ( fn )\r\n\t\t{\r\n\t\t\tvar a = [];\r\n\t\r\n\t\t\tif ( __arrayProto.filter ) {\r\n\t\t\t\ta = __arrayProto.filter.call( this, fn, this );\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\t// Compatibility for browsers without EMCA-252-5 (JS 1.6)\r\n\t\t\t\tfor ( var i=0, ien=this.length ; i 0 ) {\r\n\t\t\treturn ctx[0].json;\r\n\t\t}\r\n\t\r\n\t\t// else return undefined;\r\n\t} );\r\n\t\r\n\t\r\n\t/**\r\n\t * Get the data submitted in the last Ajax request\r\n\t */\r\n\t_api_register( 'ajax.params()', function () {\r\n\t\tvar ctx = this.context;\r\n\t\r\n\t\tif ( ctx.length > 0 ) {\r\n\t\t\treturn ctx[0].oAjaxData;\r\n\t\t}\r\n\t\r\n\t\t// else return undefined;\r\n\t} );\r\n\t\r\n\t\r\n\t/**\r\n\t * Reload tables from the Ajax data source. Note that this function will\r\n\t * automatically re-draw the table when the remote data has been loaded.\r\n\t *\r\n\t * @param {boolean} [reset=true] Reset (default) or hold the current paging\r\n\t * position. A full re-sort and re-filter is performed when this method is\r\n\t * called, which is why the pagination reset is the default action.\r\n\t * @returns {DataTables.Api} this\r\n\t */\r\n\t_api_register( 'ajax.reload()', function ( callback, resetPaging ) {\r\n\t\treturn this.iterator( 'table', function (settings) {\r\n\t\t\t__reload( settings, resetPaging===false, callback );\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t/**\r\n\t * Get the current Ajax URL. Note that this returns the URL from the first\r\n\t * table in the current context.\r\n\t *\r\n\t * @return {string} Current Ajax source URL\r\n\t *//**\r\n\t * Set the Ajax URL. Note that this will set the URL for all tables in the\r\n\t * current context.\r\n\t *\r\n\t * @param {string} url URL to set.\r\n\t * @returns {DataTables.Api} this\r\n\t */\r\n\t_api_register( 'ajax.url()', function ( url ) {\r\n\t\tvar ctx = this.context;\r\n\t\r\n\t\tif ( url === undefined ) {\r\n\t\t\t// get\r\n\t\t\tif ( ctx.length === 0 ) {\r\n\t\t\t\treturn undefined;\r\n\t\t\t}\r\n\t\t\tctx = ctx[0];\r\n\t\r\n\t\t\treturn ctx.ajax ?\r\n\t\t\t\t$.isPlainObject( ctx.ajax ) ?\r\n\t\t\t\t\tctx.ajax.url :\r\n\t\t\t\t\tctx.ajax :\r\n\t\t\t\tctx.sAjaxSource;\r\n\t\t}\r\n\t\r\n\t\t// set\r\n\t\treturn this.iterator( 'table', function ( settings ) {\r\n\t\t\tif ( $.isPlainObject( settings.ajax ) ) {\r\n\t\t\t\tsettings.ajax.url = url;\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\tsettings.ajax = url;\r\n\t\t\t}\r\n\t\t\t// No need to consider sAjaxSource here since DataTables gives priority\r\n\t\t\t// to `ajax` over `sAjaxSource`. So setting `ajax` here, renders any\r\n\t\t\t// value of `sAjaxSource` redundant.\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t/**\r\n\t * Load data from the newly set Ajax URL. Note that this method is only\r\n\t * available when `ajax.url()` is used to set a URL. Additionally, this method\r\n\t * has the same effect as calling `ajax.reload()` but is provided for\r\n\t * convenience when setting a new URL. Like `ajax.reload()` it will\r\n\t * automatically redraw the table once the remote data has been loaded.\r\n\t *\r\n\t * @returns {DataTables.Api} this\r\n\t */\r\n\t_api_register( 'ajax.url().load()', function ( callback, resetPaging ) {\r\n\t\t// Same as a reload, but makes sense to present it for easy access after a\r\n\t\t// url change\r\n\t\treturn this.iterator( 'table', function ( ctx ) {\r\n\t\t\t__reload( ctx, resetPaging===false, callback );\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t\r\n\t\r\n\tvar _selector_run = function ( type, selector, selectFn, settings, opts )\r\n\t{\r\n\t\tvar\r\n\t\t\tout = [], res,\r\n\t\t\ta, i, ien, j, jen,\r\n\t\t\tselectorType = typeof selector;\r\n\t\r\n\t\t// Can't just check for isArray here, as an API or jQuery instance might be\r\n\t\t// given with their array like look\r\n\t\tif ( ! selector || selectorType === 'string' || selectorType === 'function' || selector.length === undefined ) {\r\n\t\t\tselector = [ selector ];\r\n\t\t}\r\n\t\r\n\t\tfor ( i=0, ien=selector.length ; i 0 ) {\r\n\t\t\t\t// Assign the first element to the first item in the instance\r\n\t\t\t\t// and truncate the instance and context\r\n\t\t\t\tinst[0] = inst[i];\r\n\t\t\t\tinst[0].length = 1;\r\n\t\t\t\tinst.length = 1;\r\n\t\t\t\tinst.context = [ inst.context[i] ];\r\n\t\r\n\t\t\t\treturn inst;\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\t// Not found - return an empty instance\r\n\t\tinst.length = 0;\r\n\t\treturn inst;\r\n\t};\r\n\t\r\n\t\r\n\tvar _selector_row_indexes = function ( settings, opts )\r\n\t{\r\n\t\tvar\r\n\t\t\ti, ien, tmp, a=[],\r\n\t\t\tdisplayFiltered = settings.aiDisplay,\r\n\t\t\tdisplayMaster = settings.aiDisplayMaster;\r\n\t\r\n\t\tvar\r\n\t\t\tsearch = opts.search, // none, applied, removed\r\n\t\t\torder = opts.order, // applied, current, index (original - compatibility with 1.9)\r\n\t\t\tpage = opts.page; // all, current\r\n\t\r\n\t\tif ( _fnDataSource( settings ) == 'ssp' ) {\r\n\t\t\t// In server-side processing mode, most options are irrelevant since\r\n\t\t\t// rows not shown don't exist and the index order is the applied order\r\n\t\t\t// Removed is a special case - for consistency just return an empty\r\n\t\t\t// array\r\n\t\t\treturn search === 'removed' ?\r\n\t\t\t\t[] :\r\n\t\t\t\t_range( 0, displayMaster.length );\r\n\t\t}\r\n\t\telse if ( page == 'current' ) {\r\n\t\t\t// Current page implies that order=current and fitler=applied, since it is\r\n\t\t\t// fairly senseless otherwise, regardless of what order and search actually\r\n\t\t\t// are\r\n\t\t\tfor ( i=settings._iDisplayStart, ien=settings.fnDisplayEnd() ; i= 0 && search == 'applied') )\r\n\t\t\t\t\t{\r\n\t\t\t\t\t\ta.push( i );\r\n\t\t\t\t\t}\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\treturn a;\r\n\t};\r\n\t\r\n\t\r\n\t/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *\r\n\t * Rows\r\n\t *\r\n\t * {} - no selector - use all available rows\r\n\t * {integer} - row aoData index\r\n\t * {node} - TR node\r\n\t * {string} - jQuery selector to apply to the TR elements\r\n\t * {array} - jQuery array of nodes, or simply an array of TR nodes\r\n\t *\r\n\t */\r\n\t\r\n\t\r\n\tvar __row_selector = function ( settings, selector, opts )\r\n\t{\r\n\t\tvar rows;\r\n\t\tvar run = function ( sel ) {\r\n\t\t\tvar selInt = _intVal( sel );\r\n\t\t\tvar i, ien;\r\n\t\r\n\t\t\t// Short cut - selector is a number and no options provided (default is\r\n\t\t\t// all records, so no need to check if the index is in there, since it\r\n\t\t\t// must be - dev error if the index doesn't exist).\r\n\t\t\tif ( selInt !== null && ! opts ) {\r\n\t\t\t\treturn [ selInt ];\r\n\t\t\t}\r\n\t\r\n\t\t\tif ( ! rows ) {\r\n\t\t\t\trows = _selector_row_indexes( settings, opts );\r\n\t\t\t}\r\n\t\r\n\t\t\tif ( selInt !== null && $.inArray( selInt, rows ) !== -1 ) {\r\n\t\t\t\t// Selector - integer\r\n\t\t\t\treturn [ selInt ];\r\n\t\t\t}\r\n\t\t\telse if ( sel === null || sel === undefined || sel === '' ) {\r\n\t\t\t\t// Selector - none\r\n\t\t\t\treturn rows;\r\n\t\t\t}\r\n\t\r\n\t\t\t// Selector - function\r\n\t\t\tif ( typeof sel === 'function' ) {\r\n\t\t\t\treturn $.map( rows, function (idx) {\r\n\t\t\t\t\tvar row = settings.aoData[ idx ];\r\n\t\t\t\t\treturn sel( idx, row._aData, row.nTr ) ? idx : null;\r\n\t\t\t\t} );\r\n\t\t\t}\r\n\t\r\n\t\t\t// Get nodes in the order from the `rows` array with null values removed\r\n\t\t\tvar nodes = _removeEmpty(\r\n\t\t\t\t_pluck_order( settings.aoData, rows, 'nTr' )\r\n\t\t\t);\r\n\t\r\n\t\t\t// Selector - node\r\n\t\t\tif ( sel.nodeName ) {\r\n\t\t\t\tif ( sel._DT_RowIndex !== undefined ) {\r\n\t\t\t\t\treturn [ sel._DT_RowIndex ]; // Property added by DT for fast lookup\r\n\t\t\t\t}\r\n\t\t\t\telse if ( sel._DT_CellIndex ) {\r\n\t\t\t\t\treturn [ sel._DT_CellIndex.row ];\r\n\t\t\t\t}\r\n\t\t\t\telse {\r\n\t\t\t\t\tvar host = $(sel).closest('*[data-dt-row]');\r\n\t\t\t\t\treturn host.length ?\r\n\t\t\t\t\t\t[ host.data('dt-row') ] :\r\n\t\t\t\t\t\t[];\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\r\n\t\t\t// ID selector. Want to always be able to select rows by id, regardless\r\n\t\t\t// of if the tr element has been created or not, so can't rely upon\r\n\t\t\t// jQuery here - hence a custom implementation. This does not match\r\n\t\t\t// Sizzle's fast selector or HTML4 - in HTML5 the ID can be anything,\r\n\t\t\t// but to select it using a CSS selector engine (like Sizzle or\r\n\t\t\t// querySelect) it would need to need to be escaped for some characters.\r\n\t\t\t// DataTables simplifies this for row selectors since you can select\r\n\t\t\t// only a row. A # indicates an id any anything that follows is the id -\r\n\t\t\t// unescaped.\r\n\t\t\tif ( typeof sel === 'string' && sel.charAt(0) === '#' ) {\r\n\t\t\t\t// get row index from id\r\n\t\t\t\tvar rowObj = settings.aIds[ sel.replace( /^#/, '' ) ];\r\n\t\t\t\tif ( rowObj !== undefined ) {\r\n\t\t\t\t\treturn [ rowObj.idx ];\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\t// need to fall through to jQuery in case there is DOM id that\r\n\t\t\t\t// matches\r\n\t\t\t}\r\n\t\r\n\t\t\t// Selector - jQuery selector string, array of nodes or jQuery object/\r\n\t\t\t// As jQuery's .filter() allows jQuery objects to be passed in filter,\r\n\t\t\t// it also allows arrays, so this will cope with all three options\r\n\t\t\treturn $(nodes)\r\n\t\t\t\t.filter( sel )\r\n\t\t\t\t.map( function () {\r\n\t\t\t\t\treturn this._DT_RowIndex;\r\n\t\t\t\t} )\r\n\t\t\t\t.toArray();\r\n\t\t};\r\n\t\r\n\t\treturn _selector_run( 'row', selector, run, settings, opts );\r\n\t};\r\n\t\r\n\t\r\n\t_api_register( 'rows()', function ( selector, opts ) {\r\n\t\t// argument shifting\r\n\t\tif ( selector === undefined ) {\r\n\t\t\tselector = '';\r\n\t\t}\r\n\t\telse if ( $.isPlainObject( selector ) ) {\r\n\t\t\topts = selector;\r\n\t\t\tselector = '';\r\n\t\t}\r\n\t\r\n\t\topts = _selector_opts( opts );\r\n\t\r\n\t\tvar inst = this.iterator( 'table', function ( settings ) {\r\n\t\t\treturn __row_selector( settings, selector, opts );\r\n\t\t}, 1 );\r\n\t\r\n\t\t// Want argument shifting here and in __row_selector?\r\n\t\tinst.selector.rows = selector;\r\n\t\tinst.selector.opts = opts;\r\n\t\r\n\t\treturn inst;\r\n\t} );\r\n\t\r\n\t_api_register( 'rows().nodes()', function () {\r\n\t\treturn this.iterator( 'row', function ( settings, row ) {\r\n\t\t\treturn settings.aoData[ row ].nTr || undefined;\r\n\t\t}, 1 );\r\n\t} );\r\n\t\r\n\t_api_register( 'rows().data()', function () {\r\n\t\treturn this.iterator( true, 'rows', function ( settings, rows ) {\r\n\t\t\treturn _pluck_order( settings.aoData, rows, '_aData' );\r\n\t\t}, 1 );\r\n\t} );\r\n\t\r\n\t_api_registerPlural( 'rows().cache()', 'row().cache()', function ( type ) {\r\n\t\treturn this.iterator( 'row', function ( settings, row ) {\r\n\t\t\tvar r = settings.aoData[ row ];\r\n\t\t\treturn type === 'search' ? r._aFilterData : r._aSortData;\r\n\t\t}, 1 );\r\n\t} );\r\n\t\r\n\t_api_registerPlural( 'rows().invalidate()', 'row().invalidate()', function ( src ) {\r\n\t\treturn this.iterator( 'row', function ( settings, row ) {\r\n\t\t\t_fnInvalidate( settings, row, src );\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t_api_registerPlural( 'rows().indexes()', 'row().index()', function () {\r\n\t\treturn this.iterator( 'row', function ( settings, row ) {\r\n\t\t\treturn row;\r\n\t\t}, 1 );\r\n\t} );\r\n\t\r\n\t_api_registerPlural( 'rows().ids()', 'row().id()', function ( hash ) {\r\n\t\tvar a = [];\r\n\t\tvar context = this.context;\r\n\t\r\n\t\t// `iterator` will drop undefined values, but in this case we want them\r\n\t\tfor ( var i=0, ien=context.length ; i 0 ) {\r\n\t\t\t\tsettings._iRecordsDisplay--;\r\n\t\t\t}\r\n\t\r\n\t\t\t// Check for an 'overflow' they case for displaying the table\r\n\t\t\t_fnLengthOverflow( settings );\r\n\t\r\n\t\t\t// Remove the row's ID reference if there is one\r\n\t\t\tvar id = settings.rowIdFn( rowData._aData );\r\n\t\t\tif ( id !== undefined ) {\r\n\t\t\t\tdelete settings.aIds[ id ];\r\n\t\t\t}\r\n\t\t} );\r\n\t\r\n\t\tthis.iterator( 'table', function ( settings ) {\r\n\t\t\tfor ( var i=0, ien=settings.aoData.length ; i | ').addClass( k );\r\n\t\t\t\t$('td', created)\r\n\t\t\t\t\t.addClass( k )\r\n\t\t\t\t\t.html( r )\r\n\t\t\t\t\t[0].colSpan = _fnVisbleColumns( ctx );\r\n\t\r\n\t\t\t\trows.push( created[0] );\r\n\t\t\t}\r\n\t\t};\r\n\t\r\n\t\taddRow( data, klass );\r\n\t\r\n\t\tif ( row._details ) {\r\n\t\t\trow._details.detach();\r\n\t\t}\r\n\t\r\n\t\trow._details = $(rows);\r\n\t\r\n\t\t// If the children were already shown, that state should be retained\r\n\t\tif ( row._detailsShow ) {\r\n\t\t\trow._details.insertAfter( row.nTr );\r\n\t\t}\r\n\t};\r\n\t\r\n\t\r\n\tvar __details_remove = function ( api, idx )\r\n\t{\r\n\t\tvar ctx = api.context;\r\n\t\r\n\t\tif ( ctx.length ) {\r\n\t\t\tvar row = ctx[0].aoData[ idx !== undefined ? idx : api[0] ];\r\n\t\r\n\t\t\tif ( row && row._details ) {\r\n\t\t\t\trow._details.remove();\r\n\t\r\n\t\t\t\trow._detailsShow = undefined;\r\n\t\t\t\trow._details = undefined;\r\n\t\t\t}\r\n\t\t}\r\n\t};\r\n\t\r\n\t\r\n\tvar __details_display = function ( api, show ) {\r\n\t\tvar ctx = api.context;\r\n\t\r\n\t\tif ( ctx.length && api.length ) {\r\n\t\t\tvar row = ctx[0].aoData[ api[0] ];\r\n\t\r\n\t\t\tif ( row._details ) {\r\n\t\t\t\trow._detailsShow = show;\r\n\t\r\n\t\t\t\tif ( show ) {\r\n\t\t\t\t\trow._details.insertAfter( row.nTr );\r\n\t\t\t\t}\r\n\t\t\t\telse {\r\n\t\t\t\t\trow._details.detach();\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\t__details_events( ctx[0] );\r\n\t\t\t}\r\n\t\t}\r\n\t};\r\n\t\r\n\t\r\n\tvar __details_events = function ( settings )\r\n\t{\r\n\t\tvar api = new _Api( settings );\r\n\t\tvar namespace = '.dt.DT_details';\r\n\t\tvar drawEvent = 'draw'+namespace;\r\n\t\tvar colvisEvent = 'column-visibility'+namespace;\r\n\t\tvar destroyEvent = 'destroy'+namespace;\r\n\t\tvar data = settings.aoData;\r\n\t\r\n\t\tapi.off( drawEvent +' '+ colvisEvent +' '+ destroyEvent );\r\n\t\r\n\t\tif ( _pluck( data, '_details' ).length > 0 ) {\r\n\t\t\t// On each draw, insert the required elements into the document\r\n\t\t\tapi.on( drawEvent, function ( e, ctx ) {\r\n\t\t\t\tif ( settings !== ctx ) {\r\n\t\t\t\t\treturn;\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\tapi.rows( {page:'current'} ).eq(0).each( function (idx) {\r\n\t\t\t\t\t// Internal data grab\r\n\t\t\t\t\tvar row = data[ idx ];\r\n\t\r\n\t\t\t\t\tif ( row._detailsShow ) {\r\n\t\t\t\t\t\trow._details.insertAfter( row.nTr );\r\n\t\t\t\t\t}\r\n\t\t\t\t} );\r\n\t\t\t} );\r\n\t\r\n\t\t\t// Column visibility change - update the colspan\r\n\t\t\tapi.on( colvisEvent, function ( e, ctx, idx, vis ) {\r\n\t\t\t\tif ( settings !== ctx ) {\r\n\t\t\t\t\treturn;\r\n\t\t\t\t}\r\n\t\r\n\t\t\t\t// Update the colspan for the details rows (note, only if it already has\r\n\t\t\t\t// a colspan)\r\n\t\t\t\tvar row, visible = _fnVisbleColumns( ctx );\r\n\t\r\n\t\t\t\tfor ( var i=0, ien=data.length ; i=0 count from left, <0 count from right)\r\n\t * \"{integer}:visIdx\" - visible column index (i.e. translate to column index) (>=0 count from left, <0 count from right)\r\n\t * \"{integer}:visible\" - alias for {integer}:visIdx (>=0 count from left, <0 count from right)\r\n\t * \"{string}:name\" - column name\r\n\t * \"{string}\" - jQuery selector on column header nodes\r\n\t *\r\n\t */\r\n\t\r\n\t// can be an array of these items, comma separated list, or an array of comma\r\n\t// separated lists\r\n\t\r\n\tvar __re_column_selector = /^([^:]+):(name|visIdx|visible)$/;\r\n\t\r\n\t\r\n\t// r1 and r2 are redundant - but it means that the parameters match for the\r\n\t// iterator callback in columns().data()\r\n\tvar __columnData = function ( settings, column, r1, r2, rows ) {\r\n\t\tvar a = [];\r\n\t\tfor ( var row=0, ien=rows.length ; row= 0 ?\r\n\t\t\t\t\tselInt : // Count from left\r\n\t\t\t\t\tcolumns.length + selInt // Count from right (+ because its a negative value)\r\n\t\t\t\t];\r\n\t\t\t}\r\n\t\r\n\t\t\t// Selector = function\r\n\t\t\tif ( typeof s === 'function' ) {\r\n\t\t\t\tvar rows = _selector_row_indexes( settings, opts );\r\n\t\r\n\t\t\t\treturn $.map( columns, function (col, idx) {\r\n\t\t\t\t\treturn s(\r\n\t\t\t\t\t\t\tidx,\r\n\t\t\t\t\t\t\t__columnData( settings, idx, 0, 0, rows ),\r\n\t\t\t\t\t\t\tnodes[ idx ]\r\n\t\t\t\t\t\t) ? idx : null;\r\n\t\t\t\t} );\r\n\t\t\t}\r\n\t\r\n\t\t\t// jQuery or string selector\r\n\t\t\tvar match = typeof s === 'string' ?\r\n\t\t\t\ts.match( __re_column_selector ) :\r\n\t\t\t\t'';\r\n\t\r\n\t\t\tif ( match ) {\r\n\t\t\t\tswitch( match[2] ) {\r\n\t\t\t\t\tcase 'visIdx':\r\n\t\t\t\t\tcase 'visible':\r\n\t\t\t\t\t\tvar idx = parseInt( match[1], 10 );\r\n\t\t\t\t\t\t// Visible index given, convert to column index\r\n\t\t\t\t\t\tif ( idx < 0 ) {\r\n\t\t\t\t\t\t\t// Counting from the right\r\n\t\t\t\t\t\t\tvar visColumns = $.map( columns, function (col,i) {\r\n\t\t\t\t\t\t\t\treturn col.bVisible ? i : null;\r\n\t\t\t\t\t\t\t} );\r\n\t\t\t\t\t\t\treturn [ visColumns[ visColumns.length + idx ] ];\r\n\t\t\t\t\t\t}\r\n\t\t\t\t\t\t// Counting from the left\r\n\t\t\t\t\t\treturn [ _fnVisibleToColumnIndex( settings, idx ) ];\r\n\t\r\n\t\t\t\t\tcase 'name':\r\n\t\t\t\t\t\t// match by name. `names` is column index complete and in order\r\n\t\t\t\t\t\treturn $.map( names, function (name, i) {\r\n\t\t\t\t\t\t\treturn name === match[1] ? i : null;\r\n\t\t\t\t\t\t} );\r\n\t\r\n\t\t\t\t\tdefault:\r\n\t\t\t\t\t\treturn [];\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\r\n\t\t\t// Cell in the table body\r\n\t\t\tif ( s.nodeName && s._DT_CellIndex ) {\r\n\t\t\t\treturn [ s._DT_CellIndex.column ];\r\n\t\t\t}\r\n\t\r\n\t\t\t// jQuery selector on the TH elements for the columns\r\n\t\t\tvar jqResult = $( nodes )\r\n\t\t\t\t.filter( s )\r\n\t\t\t\t.map( function () {\r\n\t\t\t\t\treturn $.inArray( this, nodes ); // `nodes` is column index complete and in order\r\n\t\t\t\t} )\r\n\t\t\t\t.toArray();\r\n\t\r\n\t\t\tif ( jqResult.length || ! s.nodeName ) {\r\n\t\t\t\treturn jqResult;\r\n\t\t\t}\r\n\t\r\n\t\t\t// Otherwise a node which might have a `dt-column` data attribute, or be\r\n\t\t\t// a child or such an element\r\n\t\t\tvar host = $(s).closest('*[data-dt-column]');\r\n\t\t\treturn host.length ?\r\n\t\t\t\t[ host.data('dt-column') ] :\r\n\t\t\t\t[];\r\n\t\t};\r\n\t\r\n\t\treturn _selector_run( 'column', selector, run, settings, opts );\r\n\t};\r\n\t\r\n\t\r\n\tvar __setColumnVis = function ( settings, column, vis ) {\r\n\t\tvar\r\n\t\t\tcols = settings.aoColumns,\r\n\t\t\tcol = cols[ column ],\r\n\t\t\tdata = settings.aoData,\r\n\t\t\trow, cells, i, ien, tr;\r\n\t\r\n\t\t// Get\r\n\t\tif ( vis === undefined ) {\r\n\t\t\treturn col.bVisible;\r\n\t\t}\r\n\t\r\n\t\t// Set\r\n\t\t// No change\r\n\t\tif ( col.bVisible === vis ) {\r\n\t\t\treturn;\r\n\t\t}\r\n\t\r\n\t\tif ( vis ) {\r\n\t\t\t// Insert column\r\n\t\t\t// Need to decide if we should use appendChild or insertBefore\r\n\t\t\tvar insertBefore = $.inArray( true, _pluck(cols, 'bVisible'), column+1 );\r\n\t\r\n\t\t\tfor ( i=0, ien=data.length ; i iThat;\r\n\t\t}\r\n\t\r\n\t\treturn true;\r\n\t};\r\n\t\r\n\t\r\n\t/**\r\n\t * Check if a `` node is a DataTable table already or not.\r\n\t *\r\n\t * @param {node|jquery|string} table Table node, jQuery object or jQuery\r\n\t * selector for the table to test. Note that if more than more than one\r\n\t * table is passed on, only the first will be checked\r\n\t * @returns {boolean} true the table given is a DataTable, or false otherwise\r\n\t * @static\r\n\t * @dtopt API-Static\r\n\t *\r\n\t * @example\r\n\t * if ( ! $.fn.DataTable.isDataTable( '#example' ) ) {\r\n\t * $('#example').dataTable();\r\n\t * }\r\n\t */\r\n\tDataTable.isDataTable = DataTable.fnIsDataTable = function ( table )\r\n\t{\r\n\t\tvar t = $(table).get(0);\r\n\t\tvar is = false;\r\n\t\r\n\t\tif ( table instanceof DataTable.Api ) {\r\n\t\t\treturn true;\r\n\t\t}\r\n\t\r\n\t\t$.each( DataTable.settings, function (i, o) {\r\n\t\t\tvar head = o.nScrollHead ? $('table', o.nScrollHead)[0] : null;\r\n\t\t\tvar foot = o.nScrollFoot ? $('table', o.nScrollFoot)[0] : null;\r\n\t\r\n\t\t\tif ( o.nTable === t || head === t || foot === t ) {\r\n\t\t\t\tis = true;\r\n\t\t\t}\r\n\t\t} );\r\n\t\r\n\t\treturn is;\r\n\t};\r\n\t\r\n\t\r\n\t/**\r\n\t * Get all DataTable tables that have been initialised - optionally you can\r\n\t * select to get only currently visible tables.\r\n\t *\r\n\t * @param {boolean} [visible=false] Flag to indicate if you want all (default)\r\n\t * or visible tables only.\r\n\t * @returns {array} Array of `table` nodes (not DataTable instances) which are\r\n\t * DataTables\r\n\t * @static\r\n\t * @dtopt API-Static\r\n\t *\r\n\t * @example\r\n\t * $.each( $.fn.dataTable.tables(true), function () {\r\n\t * $(table).DataTable().columns.adjust();\r\n\t * } );\r\n\t */\r\n\tDataTable.tables = DataTable.fnTables = function ( visible )\r\n\t{\r\n\t\tvar api = false;\r\n\t\r\n\t\tif ( $.isPlainObject( visible ) ) {\r\n\t\t\tapi = visible.api;\r\n\t\t\tvisible = visible.visible;\r\n\t\t}\r\n\t\r\n\t\tvar a = $.map( DataTable.settings, function (o) {\r\n\t\t\tif ( !visible || (visible && $(o.nTable).is(':visible')) ) {\r\n\t\t\t\treturn o.nTable;\r\n\t\t\t}\r\n\t\t} );\r\n\t\r\n\t\treturn api ?\r\n\t\t\tnew _Api( a ) :\r\n\t\t\ta;\r\n\t};\r\n\t\r\n\t\r\n\t/**\r\n\t * Convert from camel case parameters to Hungarian notation. This is made public\r\n\t * for the extensions to provide the same ability as DataTables core to accept\r\n\t * either the 1.9 style Hungarian notation, or the 1.10+ style camelCase\r\n\t * parameters.\r\n\t *\r\n\t * @param {object} src The model object which holds all parameters that can be\r\n\t * mapped.\r\n\t * @param {object} user The object to convert from camel case to Hungarian.\r\n\t * @param {boolean} force When set to `true`, properties which already have a\r\n\t * Hungarian value in the `user` object will be overwritten. Otherwise they\r\n\t * won't be.\r\n\t */\r\n\tDataTable.camelToHungarian = _fnCamelToHungarian;\r\n\t\r\n\t\r\n\t\r\n\t/**\r\n\t *\r\n\t */\r\n\t_api_register( '$()', function ( selector, opts ) {\r\n\t\tvar\r\n\t\t\trows = this.rows( opts ).nodes(), // Get all rows\r\n\t\t\tjqRows = $(rows);\r\n\t\r\n\t\treturn $( [].concat(\r\n\t\t\tjqRows.filter( selector ).toArray(),\r\n\t\t\tjqRows.find( selector ).toArray()\r\n\t\t) );\r\n\t} );\r\n\t\r\n\t\r\n\t// jQuery functions to operate on the tables\r\n\t$.each( [ 'on', 'one', 'off' ], function (i, key) {\r\n\t\t_api_register( key+'()', function ( /* event, handler */ ) {\r\n\t\t\tvar args = Array.prototype.slice.call(arguments);\r\n\t\r\n\t\t\t// Add the `dt` namespace automatically if it isn't already present\r\n\t\t\targs[0] = $.map( args[0].split( /\\s/ ), function ( e ) {\r\n\t\t\t\treturn ! e.match(/\\.dt\\b/) ?\r\n\t\t\t\t\te+'.dt' :\r\n\t\t\t\t\te;\r\n\t\t\t\t} ).join( ' ' );\r\n\t\r\n\t\t\tvar inst = $( this.tables().nodes() );\r\n\t\t\tinst[key].apply( inst, args );\r\n\t\t\treturn this;\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t_api_register( 'clear()', function () {\r\n\t\treturn this.iterator( 'table', function ( settings ) {\r\n\t\t\t_fnClearTable( settings );\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t_api_register( 'settings()', function () {\r\n\t\treturn new _Api( this.context, this.context );\r\n\t} );\r\n\t\r\n\t\r\n\t_api_register( 'init()', function () {\r\n\t\tvar ctx = this.context;\r\n\t\treturn ctx.length ? ctx[0].oInit : null;\r\n\t} );\r\n\t\r\n\t\r\n\t_api_register( 'data()', function () {\r\n\t\treturn this.iterator( 'table', function ( settings ) {\r\n\t\t\treturn _pluck( settings.aoData, '_aData' );\r\n\t\t} ).flatten();\r\n\t} );\r\n\t\r\n\t\r\n\t_api_register( 'destroy()', function ( remove ) {\r\n\t\tremove = remove || false;\r\n\t\r\n\t\treturn this.iterator( 'table', function ( settings ) {\r\n\t\t\tvar orig = settings.nTableWrapper.parentNode;\r\n\t\t\tvar classes = settings.oClasses;\r\n\t\t\tvar table = settings.nTable;\r\n\t\t\tvar tbody = settings.nTBody;\r\n\t\t\tvar thead = settings.nTHead;\r\n\t\t\tvar tfoot = settings.nTFoot;\r\n\t\t\tvar jqTable = $(table);\r\n\t\t\tvar jqTbody = $(tbody);\r\n\t\t\tvar jqWrapper = $(settings.nTableWrapper);\r\n\t\t\tvar rows = $.map( settings.aoData, function (r) { return r.nTr; } );\r\n\t\t\tvar i, ien;\r\n\t\r\n\t\t\t// Flag to note that the table is currently being destroyed - no action\r\n\t\t\t// should be taken\r\n\t\t\tsettings.bDestroying = true;\r\n\t\r\n\t\t\t// Fire off the destroy callbacks for plug-ins etc\r\n\t\t\t_fnCallbackFire( settings, \"aoDestroyCallback\", \"destroy\", [settings] );\r\n\t\r\n\t\t\t// If not being removed from the document, make all columns visible\r\n\t\t\tif ( ! remove ) {\r\n\t\t\t\tnew _Api( settings ).columns().visible( true );\r\n\t\t\t}\r\n\t\r\n\t\t\t// Blitz all `DT` namespaced events (these are internal events, the\r\n\t\t\t// lowercase, `dt` events are user subscribed and they are responsible\r\n\t\t\t// for removing them\r\n\t\t\tjqWrapper.off('.DT').find(':not(tbody *)').off('.DT');\r\n\t\t\t$(window).off('.DT-'+settings.sInstance);\r\n\t\r\n\t\t\t// When scrolling we had to break the table up - restore it\r\n\t\t\tif ( table != thead.parentNode ) {\r\n\t\t\t\tjqTable.children('thead').detach();\r\n\t\t\t\tjqTable.append( thead );\r\n\t\t\t}\r\n\t\r\n\t\t\tif ( tfoot && table != tfoot.parentNode ) {\r\n\t\t\t\tjqTable.children('tfoot').detach();\r\n\t\t\t\tjqTable.append( tfoot );\r\n\t\t\t}\r\n\t\r\n\t\t\tsettings.aaSorting = [];\r\n\t\t\tsettings.aaSortingFixed = [];\r\n\t\t\t_fnSortingClasses( settings );\r\n\t\r\n\t\t\t$( rows ).removeClass( settings.asStripeClasses.join(' ') );\r\n\t\r\n\t\t\t$('th, td', thead).removeClass( classes.sSortable+' '+\r\n\t\t\t\tclasses.sSortableAsc+' '+classes.sSortableDesc+' '+classes.sSortableNone\r\n\t\t\t);\r\n\t\r\n\t\t\t// Add the TR elements back into the table in their original order\r\n\t\t\tjqTbody.children().detach();\r\n\t\t\tjqTbody.append( rows );\r\n\t\r\n\t\t\t// Remove the DataTables generated nodes, events and classes\r\n\t\t\tvar removedMethod = remove ? 'remove' : 'detach';\r\n\t\t\tjqTable[ removedMethod ]();\r\n\t\t\tjqWrapper[ removedMethod ]();\r\n\t\r\n\t\t\t// If we need to reattach the table to the document\r\n\t\t\tif ( ! remove && orig ) {\r\n\t\t\t\t// insertBefore acts like appendChild if !arg[1]\r\n\t\t\t\torig.insertBefore( table, settings.nTableReinsertBefore );\r\n\t\r\n\t\t\t\t// Restore the width of the original table - was read from the style property,\r\n\t\t\t\t// so we can restore directly to that\r\n\t\t\t\tjqTable\r\n\t\t\t\t\t.css( 'width', settings.sDestroyWidth )\r\n\t\t\t\t\t.removeClass( classes.sTable );\r\n\t\r\n\t\t\t\t// If the were originally stripe classes - then we add them back here.\r\n\t\t\t\t// Note this is not fool proof (for example if not all rows had stripe\r\n\t\t\t\t// classes - but it's a good effort without getting carried away\r\n\t\t\t\tien = settings.asDestroyStripes.length;\r\n\t\r\n\t\t\t\tif ( ien ) {\r\n\t\t\t\t\tjqTbody.children().each( function (i) {\r\n\t\t\t\t\t\t$(this).addClass( settings.asDestroyStripes[i % ien] );\r\n\t\t\t\t\t} );\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\r\n\t\t\t/* Remove the settings object from the settings array */\r\n\t\t\tvar idx = $.inArray( settings, DataTable.settings );\r\n\t\t\tif ( idx !== -1 ) {\r\n\t\t\t\tDataTable.settings.splice( idx, 1 );\r\n\t\t\t}\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t// Add the `every()` method for rows, columns and cells in a compact form\r\n\t$.each( [ 'column', 'row', 'cell' ], function ( i, type ) {\r\n\t\t_api_register( type+'s().every()', function ( fn ) {\r\n\t\t\tvar opts = this.selector.opts;\r\n\t\t\tvar api = this;\r\n\t\r\n\t\t\treturn this.iterator( type, function ( settings, arg1, arg2, arg3, arg4 ) {\r\n\t\t\t\t// Rows and columns:\r\n\t\t\t\t// arg1 - index\r\n\t\t\t\t// arg2 - table counter\r\n\t\t\t\t// arg3 - loop counter\r\n\t\t\t\t// arg4 - undefined\r\n\t\t\t\t// Cells:\r\n\t\t\t\t// arg1 - row index\r\n\t\t\t\t// arg2 - column index\r\n\t\t\t\t// arg3 - table counter\r\n\t\t\t\t// arg4 - loop counter\r\n\t\t\t\tfn.call(\r\n\t\t\t\t\tapi[ type ](\r\n\t\t\t\t\t\targ1,\r\n\t\t\t\t\t\ttype==='cell' ? arg2 : opts,\r\n\t\t\t\t\t\ttype==='cell' ? opts : undefined\r\n\t\t\t\t\t),\r\n\t\t\t\t\targ1, arg2, arg3, arg4\r\n\t\t\t\t);\r\n\t\t\t} );\r\n\t\t} );\r\n\t} );\r\n\t\r\n\t\r\n\t// i18n method for extensions to be able to use the language object from the\r\n\t// DataTable\r\n\t_api_register( 'i18n()', function ( token, def, plural ) {\r\n\t\tvar ctx = this.context[0];\r\n\t\tvar resolved = _fnGetObjectDataFn( token )( ctx.oLanguage );\r\n\t\r\n\t\tif ( resolved === undefined ) {\r\n\t\t\tresolved = def;\r\n\t\t}\r\n\t\r\n\t\tif ( plural !== undefined && $.isPlainObject( resolved ) ) {\r\n\t\t\tresolved = resolved[ plural ] !== undefined ?\r\n\t\t\t\tresolved[ plural ] :\r\n\t\t\t\tresolved._;\r\n\t\t}\r\n\t\r\n\t\treturn resolved.replace( '%d', plural ); // nb: plural might be undefined,\r\n\t} );\r\n\r\n\t/**\r\n\t * Version string for plug-ins to check compatibility. Allowed format is\r\n\t * `a.b.c-d` where: a:int, b:int, c:int, d:string(dev|beta|alpha). `d` is used\r\n\t * only for non-release builds. See http://semver.org/ for more information.\r\n\t * @member\r\n\t * @type string\r\n\t * @default Version number\r\n\t */\r\n\tDataTable.version = \"1.10.16\";\r\n\r\n\t/**\r\n\t * Private data store, containing all of the settings objects that are\r\n\t * created for the tables on a given page.\r\n\t *\r\n\t * Note that the `DataTable.settings` object is aliased to\r\n\t * `jQuery.fn.dataTableExt` through which it may be accessed and\r\n\t * manipulated, or `jQuery.fn.dataTable.settings`.\r\n\t * @member\r\n\t * @type array\r\n\t * @default []\r\n\t * @private\r\n\t */\r\n\tDataTable.settings = [];\r\n\r\n\t/**\r\n\t * Object models container, for the various models that DataTables has\r\n\t * available to it. These models define the objects that are used to hold\r\n\t * the active state and configuration of the table.\r\n\t * @namespace\r\n\t */\r\n\tDataTable.models = {};\r\n\t\r\n\t\r\n\t\r\n\t/**\r\n\t * Template object for the way in which DataTables holds information about\r\n\t * search information for the global filter and individual column filters.\r\n\t * @namespace\r\n\t */\r\n\tDataTable.models.oSearch = {\r\n\t\t/**\r\n\t\t * Flag to indicate if the filtering should be case insensitive or not\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t */\r\n\t\t\"bCaseInsensitive\": true,\r\n\t\r\n\t\t/**\r\n\t\t * Applied search term\r\n\t\t * @type string\r\n\t\t * @default Empty string\r\n\t\t */\r\n\t\t\"sSearch\": \"\",\r\n\t\r\n\t\t/**\r\n\t\t * Flag to indicate if the search term should be interpreted as a\r\n\t\t * regular expression (true) or not (false) and therefore and special\r\n\t\t * regex characters escaped.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t */\r\n\t\t\"bRegex\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Flag to indicate if DataTables is to use its smart filtering or not.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t */\r\n\t\t\"bSmart\": true\r\n\t};\r\n\t\r\n\t\r\n\t\r\n\t\r\n\t/**\r\n\t * Template object for the way in which DataTables holds information about\r\n\t * each individual row. This is the object format used for the settings\r\n\t * aoData array.\r\n\t * @namespace\r\n\t */\r\n\tDataTable.models.oRow = {\r\n\t\t/**\r\n\t\t * TR element for the row\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTr\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Array of TD elements for each row. This is null until the row has been\r\n\t\t * created.\r\n\t\t * @type array nodes\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"anCells\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Data object from the original data source for the row. This is either\r\n\t\t * an array if using the traditional form of DataTables, or an object if\r\n\t\t * using mData options. The exact type will depend on the passed in\r\n\t\t * data from the data source, or will be an array if using DOM a data\r\n\t\t * source.\r\n\t\t * @type array|object\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"_aData\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Sorting data cache - this array is ostensibly the same length as the\r\n\t\t * number of columns (although each index is generated only as it is\r\n\t\t * needed), and holds the data that is used for sorting each column in the\r\n\t\t * row. We do this cache generation at the start of the sort in order that\r\n\t\t * the formatting of the sort data need be done only once for each cell\r\n\t\t * per sort. This array should not be read from or written to by anything\r\n\t\t * other than the master sorting methods.\r\n\t\t * @type array\r\n\t\t * @default null\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_aSortData\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Per cell filtering data cache. As per the sort data cache, used to\r\n\t\t * increase the performance of the filtering in DataTables\r\n\t\t * @type array\r\n\t\t * @default null\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_aFilterData\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Filtering data cache. This is the same as the cell filtering cache, but\r\n\t\t * in this case a string rather than an array. This is easily computed with\r\n\t\t * a join on `_aFilterData`, but is provided as a cache so the join isn't\r\n\t\t * needed on every search (memory traded for performance)\r\n\t\t * @type array\r\n\t\t * @default null\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_sFilterRow\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Cache of the class name that DataTables has applied to the row, so we\r\n\t\t * can quickly look at this variable rather than needing to do a DOM check\r\n\t\t * on className for the nTr property.\r\n\t\t * @type string\r\n\t\t * @default Empty string\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_sRowStripe\": \"\",\r\n\t\r\n\t\t/**\r\n\t\t * Denote if the original data source was from the DOM, or the data source\r\n\t\t * object. This is used for invalidating data, so DataTables can\r\n\t\t * automatically read data from the original source, unless uninstructed\r\n\t\t * otherwise.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"src\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Index in the aoData array. This saves an indexOf lookup when we have the\r\n\t\t * object, but want to know the index\r\n\t\t * @type integer\r\n\t\t * @default -1\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"idx\": -1\r\n\t};\r\n\t\r\n\t\r\n\t/**\r\n\t * Template object for the column information object in DataTables. This object\r\n\t * is held in the settings aoColumns array and contains all the information that\r\n\t * DataTables needs about each individual column.\r\n\t *\r\n\t * Note that this object is related to {@link DataTable.defaults.column}\r\n\t * but this one is the internal data store for DataTables's cache of columns.\r\n\t * It should NOT be manipulated outside of DataTables. Any configuration should\r\n\t * be done through the initialisation options.\r\n\t * @namespace\r\n\t */\r\n\tDataTable.models.oColumn = {\r\n\t\t/**\r\n\t\t * Column index. This could be worked out on-the-fly with $.inArray, but it\r\n\t\t * is faster to just hold it as a variable\r\n\t\t * @type integer\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"idx\": null,\r\n\t\r\n\t\t/**\r\n\t\t * A list of the columns that sorting should occur on when this column\r\n\t\t * is sorted. That this property is an array allows multi-column sorting\r\n\t\t * to be defined for a column (for example first name / last name columns\r\n\t\t * would benefit from this). The values are integers pointing to the\r\n\t\t * columns to be sorted on (typically it will be a single integer pointing\r\n\t\t * at itself, but that doesn't need to be the case).\r\n\t\t * @type array\r\n\t\t */\r\n\t\t\"aDataSort\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Define the sorting directions that are applied to the column, in sequence\r\n\t\t * as the column is repeatedly sorted upon - i.e. the first value is used\r\n\t\t * as the sorting direction when the column if first sorted (clicked on).\r\n\t\t * Sort it again (click again) and it will move on to the next index.\r\n\t\t * Repeat until loop.\r\n\t\t * @type array\r\n\t\t */\r\n\t\t\"asSorting\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Flag to indicate if the column is searchable, and thus should be included\r\n\t\t * in the filtering or not.\r\n\t\t * @type boolean\r\n\t\t */\r\n\t\t\"bSearchable\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Flag to indicate if the column is sortable or not.\r\n\t\t * @type boolean\r\n\t\t */\r\n\t\t\"bSortable\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Flag to indicate if the column is currently visible in the table or not\r\n\t\t * @type boolean\r\n\t\t */\r\n\t\t\"bVisible\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Store for manual type assignment using the `column.type` option. This\r\n\t\t * is held in store so we can manipulate the column's `sType` property.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_sManualType\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Flag to indicate if HTML5 data attributes should be used as the data\r\n\t\t * source for filtering or sorting. True is either are.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_bAttrSrc\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Developer definable function that is called whenever a cell is created (Ajax source,\r\n\t\t * etc) or processed for input (DOM source). This can be used as a compliment to mRender\r\n\t\t * allowing you to modify the DOM element (add background colour for example) when the\r\n\t\t * element is available.\r\n\t\t * @type function\r\n\t\t * @param {element} nTd The TD node that has been created\r\n\t\t * @param {*} sData The Data for the cell\r\n\t\t * @param {array|object} oData The data for the whole row\r\n\t\t * @param {int} iRow The row index for the aoData data store\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"fnCreatedCell\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Function to get data from a cell in a column. You should never\r\n\t\t * access data directly through _aData internally in DataTables - always use\r\n\t\t * the method attached to this property. It allows mData to function as\r\n\t\t * required. This function is automatically assigned by the column\r\n\t\t * initialisation method\r\n\t\t * @type function\r\n\t\t * @param {array|object} oData The data array/object for the array\r\n\t\t * (i.e. aoData[]._aData)\r\n\t\t * @param {string} sSpecific The specific data type you want to get -\r\n\t\t * 'display', 'type' 'filter' 'sort'\r\n\t\t * @returns {*} The data for the cell from the given row's data\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"fnGetData\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Function to set data for a cell in the column. You should never\r\n\t\t * set the data directly to _aData internally in DataTables - always use\r\n\t\t * this method. It allows mData to function as required. This function\r\n\t\t * is automatically assigned by the column initialisation method\r\n\t\t * @type function\r\n\t\t * @param {array|object} oData The data array/object for the array\r\n\t\t * (i.e. aoData[]._aData)\r\n\t\t * @param {*} sValue Value to set\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"fnSetData\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Property to read the value for the cells in the column from the data\r\n\t\t * source array / object. If null, then the default content is used, if a\r\n\t\t * function is given then the return from the function is used.\r\n\t\t * @type function|int|string|null\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"mData\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Partner property to mData which is used (only when defined) to get\r\n\t\t * the data - i.e. it is basically the same as mData, but without the\r\n\t\t * 'set' option, and also the data fed to it is the result from mData.\r\n\t\t * This is the rendering method to match the data method of mData.\r\n\t\t * @type function|int|string|null\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"mRender\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Unique header TH/TD element for this column - this is what the sorting\r\n\t\t * listener is attached to (if sorting is enabled.)\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTh\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Unique footer TH/TD element for this column (if there is one). Not used\r\n\t\t * in DataTables as such, but can be used for plug-ins to reference the\r\n\t\t * footer for each column.\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTf\": null,\r\n\t\r\n\t\t/**\r\n\t\t * The class to apply to all TD elements in the table's TBODY for the column\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sClass\": null,\r\n\t\r\n\t\t/**\r\n\t\t * When DataTables calculates the column widths to assign to each column,\r\n\t\t * it finds the longest string in each column and then constructs a\r\n\t\t * temporary table and reads the widths from that. The problem with this\r\n\t\t * is that \"mmm\" is much wider then \"iiii\", but the latter is a longer\r\n\t\t * string - thus the calculation can go wrong (doing it properly and putting\r\n\t\t * it into an DOM object and measuring that is horribly(!) slow). Thus as\r\n\t\t * a \"work around\" we provide this option. It will append its value to the\r\n\t\t * text that is found to be the longest string for the column - i.e. padding.\r\n\t\t * @type string\r\n\t\t */\r\n\t\t\"sContentPadding\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Allows a default value to be given for a column's data, and will be used\r\n\t\t * whenever a null data source is encountered (this can be because mData\r\n\t\t * is set to null, or because the data source itself is null).\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sDefaultContent\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Name for the column, allowing reference to the column by name as well as\r\n\t\t * by index (needs a lookup to work by name).\r\n\t\t * @type string\r\n\t\t */\r\n\t\t\"sName\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Custom sorting data type - defines which of the available plug-ins in\r\n\t\t * afnSortData the custom sorting will use - if any is defined.\r\n\t\t * @type string\r\n\t\t * @default std\r\n\t\t */\r\n\t\t\"sSortDataType\": 'std',\r\n\t\r\n\t\t/**\r\n\t\t * Class to be applied to the header element when sorting on this column\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sSortingClass\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Class to be applied to the header element when sorting on this column -\r\n\t\t * when jQuery UI theming is used.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sSortingClassJUI\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Title of the column - what is seen in the TH element (nTh).\r\n\t\t * @type string\r\n\t\t */\r\n\t\t\"sTitle\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Column sorting and filtering type\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sType\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Width of the column\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sWidth\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Width of the column when it was first \"encountered\"\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sWidthOrig\": null\r\n\t};\r\n\t\r\n\t\r\n\t/*\r\n\t * Developer note: The properties of the object below are given in Hungarian\r\n\t * notation, that was used as the interface for DataTables prior to v1.10, however\r\n\t * from v1.10 onwards the primary interface is camel case. In order to avoid\r\n\t * breaking backwards compatibility utterly with this change, the Hungarian\r\n\t * version is still, internally the primary interface, but is is not documented\r\n\t * - hence the @name tags in each doc comment. This allows a Javascript function\r\n\t * to create a map from Hungarian notation to camel case (going the other direction\r\n\t * would require each property to be listed, which would at around 3K to the size\r\n\t * of DataTables, while this method is about a 0.5K hit.\r\n\t *\r\n\t * Ultimately this does pave the way for Hungarian notation to be dropped\r\n\t * completely, but that is a massive amount of work and will break current\r\n\t * installs (therefore is on-hold until v2).\r\n\t */\r\n\t\r\n\t/**\r\n\t * Initialisation options that can be given to DataTables at initialisation\r\n\t * time.\r\n\t * @namespace\r\n\t */\r\n\tDataTable.defaults = {\r\n\t\t/**\r\n\t\t * An array of data to use for the table, passed in at initialisation which\r\n\t\t * will be used in preference to any data which is already in the DOM. This is\r\n\t\t * particularly useful for constructing tables purely in Javascript, for\r\n\t\t * example with a custom Ajax call.\r\n\t\t * @type array\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.data\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using a 2D array data source\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"data\": [\r\n\t\t * ['Trident', 'Internet Explorer 4.0', 'Win 95+', 4, 'X'],\r\n\t\t * ['Trident', 'Internet Explorer 5.0', 'Win 95+', 5, 'C'],\r\n\t\t * ],\r\n\t\t * \"columns\": [\r\n\t\t * { \"title\": \"Engine\" },\r\n\t\t * { \"title\": \"Browser\" },\r\n\t\t * { \"title\": \"Platform\" },\r\n\t\t * { \"title\": \"Version\" },\r\n\t\t * { \"title\": \"Grade\" }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using an array of objects as a data source (`data`)\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"data\": [\r\n\t\t * {\r\n\t\t * \"engine\": \"Trident\",\r\n\t\t * \"browser\": \"Internet Explorer 4.0\",\r\n\t\t * \"platform\": \"Win 95+\",\r\n\t\t * \"version\": 4,\r\n\t\t * \"grade\": \"X\"\r\n\t\t * },\r\n\t\t * {\r\n\t\t * \"engine\": \"Trident\",\r\n\t\t * \"browser\": \"Internet Explorer 5.0\",\r\n\t\t * \"platform\": \"Win 95+\",\r\n\t\t * \"version\": 5,\r\n\t\t * \"grade\": \"C\"\r\n\t\t * }\r\n\t\t * ],\r\n\t\t * \"columns\": [\r\n\t\t * { \"title\": \"Engine\", \"data\": \"engine\" },\r\n\t\t * { \"title\": \"Browser\", \"data\": \"browser\" },\r\n\t\t * { \"title\": \"Platform\", \"data\": \"platform\" },\r\n\t\t * { \"title\": \"Version\", \"data\": \"version\" },\r\n\t\t * { \"title\": \"Grade\", \"data\": \"grade\" }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"aaData\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * If ordering is enabled, then DataTables will perform a first pass sort on\r\n\t\t * initialisation. You can define which column(s) the sort is performed\r\n\t\t * upon, and the sorting direction, with this variable. The `sorting` array\r\n\t\t * should contain an array for each column to be sorted initially containing\r\n\t\t * the column's index and a direction string ('asc' or 'desc').\r\n\t\t * @type array\r\n\t\t * @default [[0,'asc']]\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.order\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Sort by 3rd column first, and then 4th column\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"order\": [[2,'asc'], [3,'desc']]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * // No initial sorting\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"order\": []\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"aaSorting\": [[0,'asc']],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This parameter is basically identical to the `sorting` parameter, but\r\n\t\t * cannot be overridden by user interaction with the table. What this means\r\n\t\t * is that you could have a column (visible or hidden) which the sorting\r\n\t\t * will always be forced on first - any sorting after that (from the user)\r\n\t\t * will then be performed as required. This can be useful for grouping rows\r\n\t\t * together.\r\n\t\t * @type array\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.orderFixed\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"orderFixed\": [[0,'asc']]\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"aaSortingFixed\": [],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * DataTables can be instructed to load data to display in the table from a\r\n\t\t * Ajax source. This option defines how that Ajax call is made and where to.\r\n\t\t *\r\n\t\t * The `ajax` property has three different modes of operation, depending on\r\n\t\t * how it is defined. These are:\r\n\t\t *\r\n\t\t * * `string` - Set the URL from where the data should be loaded from.\r\n\t\t * * `object` - Define properties for `jQuery.ajax`.\r\n\t\t * * `function` - Custom data get function\r\n\t\t *\r\n\t\t * `string`\r\n\t\t * --------\r\n\t\t *\r\n\t\t * As a string, the `ajax` property simply defines the URL from which\r\n\t\t * DataTables will load data.\r\n\t\t *\r\n\t\t * `object`\r\n\t\t * --------\r\n\t\t *\r\n\t\t * As an object, the parameters in the object are passed to\r\n\t\t * [jQuery.ajax](http://api.jquery.com/jQuery.ajax/) allowing fine control\r\n\t\t * of the Ajax request. DataTables has a number of default parameters which\r\n\t\t * you can override using this option. Please refer to the jQuery\r\n\t\t * documentation for a full description of the options available, although\r\n\t\t * the following parameters provide additional options in DataTables or\r\n\t\t * require special consideration:\r\n\t\t *\r\n\t\t * * `data` - As with jQuery, `data` can be provided as an object, but it\r\n\t\t * can also be used as a function to manipulate the data DataTables sends\r\n\t\t * to the server. The function takes a single parameter, an object of\r\n\t\t * parameters with the values that DataTables has readied for sending. An\r\n\t\t * object may be returned which will be merged into the DataTables\r\n\t\t * defaults, or you can add the items to the object that was passed in and\r\n\t\t * not return anything from the function. This supersedes `fnServerParams`\r\n\t\t * from DataTables 1.9-.\r\n\t\t *\r\n\t\t * * `dataSrc` - By default DataTables will look for the property `data` (or\r\n\t\t * `aaData` for compatibility with DataTables 1.9-) when obtaining data\r\n\t\t * from an Ajax source or for server-side processing - this parameter\r\n\t\t * allows that property to be changed. You can use Javascript dotted\r\n\t\t * object notation to get a data source for multiple levels of nesting, or\r\n\t\t * it my be used as a function. As a function it takes a single parameter,\r\n\t\t * the JSON returned from the server, which can be manipulated as\r\n\t\t * required, with the returned value being that used by DataTables as the\r\n\t\t * data source for the table. This supersedes `sAjaxDataProp` from\r\n\t\t * DataTables 1.9-.\r\n\t\t *\r\n\t\t * * `success` - Should not be overridden it is used internally in\r\n\t\t * DataTables. To manipulate / transform the data returned by the server\r\n\t\t * use `ajax.dataSrc`, or use `ajax` as a function (see below).\r\n\t\t *\r\n\t\t * `function`\r\n\t\t * ----------\r\n\t\t *\r\n\t\t * As a function, making the Ajax call is left up to yourself allowing\r\n\t\t * complete control of the Ajax request. Indeed, if desired, a method other\r\n\t\t * than Ajax could be used to obtain the required data, such as Web storage\r\n\t\t * or an AIR database.\r\n\t\t *\r\n\t\t * The function is given four parameters and no return is required. The\r\n\t\t * parameters are:\r\n\t\t *\r\n\t\t * 1. _object_ - Data to send to the server\r\n\t\t * 2. _function_ - Callback function that must be executed when the required\r\n\t\t * data has been obtained. That data should be passed into the callback\r\n\t\t * as the only parameter\r\n\t\t * 3. _object_ - DataTables settings object for the table\r\n\t\t *\r\n\t\t * Note that this supersedes `fnServerData` from DataTables 1.9-.\r\n\t\t *\r\n\t\t * @type string|object|function\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.ajax\r\n\t\t * @since 1.10.0\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Get JSON data from a file via Ajax.\r\n\t\t * // Note DataTables expects data in the form `{ data: [ ...data... ] }` by default).\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": \"data.json\"\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Get JSON data from a file via Ajax, using `dataSrc` to change\r\n\t\t * // `data` to `tableData` (i.e. `{ tableData: [ ...data... ] }`)\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": {\r\n\t\t * \"url\": \"data.json\",\r\n\t\t * \"dataSrc\": \"tableData\"\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Get JSON data from a file via Ajax, using `dataSrc` to read data\r\n\t\t * // from a plain array rather than an array in an object\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": {\r\n\t\t * \"url\": \"data.json\",\r\n\t\t * \"dataSrc\": \"\"\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Manipulate the data returned from the server - add a link to data\r\n\t\t * // (note this can, should, be done using `render` for the column - this\r\n\t\t * // is just a simple example of how the data can be manipulated).\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": {\r\n\t\t * \"url\": \"data.json\",\r\n\t\t * \"dataSrc\": function ( json ) {\r\n\t\t * for ( var i=0, ien=json.length ; iView message';\r\n\t\t * }\r\n\t\t * return json;\r\n\t\t * }\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Add data to the request\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": {\r\n\t\t * \"url\": \"data.json\",\r\n\t\t * \"data\": function ( d ) {\r\n\t\t * return {\r\n\t\t * \"extra_search\": $('#extra').val()\r\n\t\t * };\r\n\t\t * }\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Send request as POST\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": {\r\n\t\t * \"url\": \"data.json\",\r\n\t\t * \"type\": \"POST\"\r\n\t\t * }\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Get the data from localStorage (could interface with a form for\r\n\t\t * // adding, editing and removing rows).\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": function (data, callback, settings) {\r\n\t\t * callback(\r\n\t\t * JSON.parse( localStorage.getItem('dataTablesData') )\r\n\t\t * );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"ajax\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This parameter allows you to readily specify the entries in the length drop\r\n\t\t * down menu that DataTables shows when pagination is enabled. It can be\r\n\t\t * either a 1D array of options which will be used for both the displayed\r\n\t\t * option and the value, or a 2D array which will use the array in the first\r\n\t\t * position as the value, and the array in the second position as the\r\n\t\t * displayed options (useful for language strings such as 'All').\r\n\t\t *\r\n\t\t * Note that the `pageLength` property will be automatically set to the\r\n\t\t * first value given in this array, unless `pageLength` is also provided.\r\n\t\t * @type array\r\n\t\t * @default [ 10, 25, 50, 100 ]\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.lengthMenu\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"lengthMenu\": [[10, 25, 50, -1], [10, 25, 50, \"All\"]]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"aLengthMenu\": [ 10, 25, 50, 100 ],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * The `columns` option in the initialisation parameter allows you to define\r\n\t\t * details about the way individual columns behave. For a full list of\r\n\t\t * column options that can be set, please see\r\n\t\t * {@link DataTable.defaults.column}. Note that if you use `columns` to\r\n\t\t * define your columns, you must have an entry in the array for every single\r\n\t\t * column that you have in your table (these can be null if you don't which\r\n\t\t * to specify any options).\r\n\t\t * @member\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column\r\n\t\t */\r\n\t\t\"aoColumns\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Very similar to `columns`, `columnDefs` allows you to target a specific\r\n\t\t * column, multiple columns, or all columns, using the `targets` property of\r\n\t\t * each object in the array. This allows great flexibility when creating\r\n\t\t * tables, as the `columnDefs` arrays can be of any length, targeting the\r\n\t\t * columns you specifically want. `columnDefs` may use any of the column\r\n\t\t * options available: {@link DataTable.defaults.column}, but it _must_\r\n\t\t * have `targets` defined in each object in the array. Values in the `targets`\r\n\t\t * array may be:\r\n\t\t * \r\n\t\t * - a string - class name will be matched on the TH for the column
\r\n\t\t * - 0 or a positive integer - column index counting from the left
\r\n\t\t * - a negative integer - column index counting from the right
\r\n\t\t * - the string \"_all\" - all columns (i.e. assign a default)
\r\n\t\t *
\r\n\t\t * @member\r\n\t\t *\r\n\t\t * @name DataTable.defaults.columnDefs\r\n\t\t */\r\n\t\t\"aoColumnDefs\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Basically the same as `search`, this parameter defines the individual column\r\n\t\t * filtering state at initialisation time. The array must be of the same size\r\n\t\t * as the number of columns, and each element be an object with the parameters\r\n\t\t * `search` and `escapeRegex` (the latter is optional). 'null' is also\r\n\t\t * accepted and the default will be used.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.searchCols\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"searchCols\": [\r\n\t\t * null,\r\n\t\t * { \"search\": \"My filter\" },\r\n\t\t * null,\r\n\t\t * { \"search\": \"^[0-9]\", \"escapeRegex\": false }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"aoSearchCols\": [],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * An array of CSS classes that should be applied to displayed rows. This\r\n\t\t * array may be of any length, and DataTables will apply each class\r\n\t\t * sequentially, looping when required.\r\n\t\t * @type array\r\n\t\t * @default null Will take the values determined by the `oClasses.stripe*`\r\n\t\t * options\r\n\t\t *\r\n\t\t * @dtopt Option\r\n\t\t * @name DataTable.defaults.stripeClasses\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stripeClasses\": [ 'strip1', 'strip2', 'strip3' ]\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"asStripeClasses\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable automatic column width calculation. This can be disabled\r\n\t\t * as an optimisation (it takes some time to calculate the widths) if the\r\n\t\t * tables widths are passed in using `columns`.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.autoWidth\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"autoWidth\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bAutoWidth\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Deferred rendering can provide DataTables with a huge speed boost when you\r\n\t\t * are using an Ajax or JS data source for the table. This option, when set to\r\n\t\t * true, will cause DataTables to defer the creation of the table elements for\r\n\t\t * each row until they are needed for a draw - saving a significant amount of\r\n\t\t * time.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.deferRender\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajax\": \"sources/arrays.txt\",\r\n\t\t * \"deferRender\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bDeferRender\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Replace a DataTable which matches the given selector and replace it with\r\n\t\t * one which has the properties of the new initialisation object passed. If no\r\n\t\t * table matches the selector, then the new DataTable will be constructed as\r\n\t\t * per normal.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.destroy\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"srollY\": \"200px\",\r\n\t\t * \"paginate\": false\r\n\t\t * } );\r\n\t\t *\r\n\t\t * // Some time later....\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"filter\": false,\r\n\t\t * \"destroy\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bDestroy\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable filtering of data. Filtering in DataTables is \"smart\" in\r\n\t\t * that it allows the end user to input multiple words (space separated) and\r\n\t\t * will match a row containing those words, even if not in the order that was\r\n\t\t * specified (this allow matching across multiple columns). Note that if you\r\n\t\t * wish to use filtering in DataTables this must remain 'true' - to remove the\r\n\t\t * default filtering input box and retain filtering abilities, please use\r\n\t\t * {@link DataTable.defaults.dom}.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.searching\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"searching\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bFilter\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable the table information display. This shows information\r\n\t\t * about the data that is currently visible on the page, including information\r\n\t\t * about filtered data if that action is being performed.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.info\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"info\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bInfo\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Allows the end user to select the size of a formatted page from a select\r\n\t\t * menu (sizes are 10, 25, 50 and 100). Requires pagination (`paginate`).\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.lengthChange\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"lengthChange\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bLengthChange\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable pagination.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.paging\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"paging\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bPaginate\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable the display of a 'processing' indicator when the table is\r\n\t\t * being processed (e.g. a sort). This is particularly useful for tables with\r\n\t\t * large amounts of data where it can take a noticeable amount of time to sort\r\n\t\t * the entries.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.processing\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"processing\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bProcessing\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Retrieve the DataTables object for the given selector. Note that if the\r\n\t\t * table has already been initialised, this parameter will cause DataTables\r\n\t\t * to simply return the object that has already been set up - it will not take\r\n\t\t * account of any changes you might have made to the initialisation object\r\n\t\t * passed to DataTables (setting this parameter to true is an acknowledgement\r\n\t\t * that you understand this). `destroy` can be used to reinitialise a table if\r\n\t\t * you need.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.retrieve\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * initTable();\r\n\t\t * tableActions();\r\n\t\t * } );\r\n\t\t *\r\n\t\t * function initTable ()\r\n\t\t * {\r\n\t\t * return $('#example').dataTable( {\r\n\t\t * \"scrollY\": \"200px\",\r\n\t\t * \"paginate\": false,\r\n\t\t * \"retrieve\": true\r\n\t\t * } );\r\n\t\t * }\r\n\t\t *\r\n\t\t * function tableActions ()\r\n\t\t * {\r\n\t\t * var table = initTable();\r\n\t\t * // perform API operations with oTable\r\n\t\t * }\r\n\t\t */\r\n\t\t\"bRetrieve\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * When vertical (y) scrolling is enabled, DataTables will force the height of\r\n\t\t * the table's viewport to the given height at all times (useful for layout).\r\n\t\t * However, this can look odd when filtering data down to a small data set,\r\n\t\t * and the footer is left \"floating\" further down. This parameter (when\r\n\t\t * enabled) will cause DataTables to collapse the table's viewport down when\r\n\t\t * the result set will fit within the given Y height.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.scrollCollapse\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"scrollY\": \"200\",\r\n\t\t * \"scrollCollapse\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bScrollCollapse\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Configure DataTables to use server-side processing. Note that the\r\n\t\t * `ajax` parameter must also be given in order to give DataTables a\r\n\t\t * source to obtain the required data for each draw.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @dtopt Server-side\r\n\t\t * @name DataTable.defaults.serverSide\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"serverSide\": true,\r\n\t\t * \"ajax\": \"xhr.php\"\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bServerSide\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable sorting of columns. Sorting of individual columns can be\r\n\t\t * disabled by the `sortable` option for each column.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.ordering\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ordering\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bSort\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or display DataTables' ability to sort multiple columns at the\r\n\t\t * same time (activated by shift-click by the user).\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.orderMulti\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Disable multiple column sorting ability\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"orderMulti\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bSortMulti\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Allows control over whether DataTables should use the top (true) unique\r\n\t\t * cell that is found for a single column, or the bottom (false - default).\r\n\t\t * This is useful when using complex headers.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.orderCellsTop\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"orderCellsTop\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bSortCellsTop\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable the addition of the classes `sorting\\_1`, `sorting\\_2` and\r\n\t\t * `sorting\\_3` to the columns which are currently being sorted on. This is\r\n\t\t * presented as a feature switch as it can increase processing time (while\r\n\t\t * classes are removed and added) so for large data sets you might want to\r\n\t\t * turn this off.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.orderClasses\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"orderClasses\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bSortClasses\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable state saving. When enabled HTML5 `localStorage` will be\r\n\t\t * used to save table display information such as pagination information,\r\n\t\t * display length, filtering and sorting. As such when the end user reloads\r\n\t\t * the page the display display will match what thy had previously set up.\r\n\t\t *\r\n\t\t * Due to the use of `localStorage` the default state saving is not supported\r\n\t\t * in IE6 or 7. If state saving is required in those browsers, use\r\n\t\t * `stateSaveCallback` to provide a storage solution such as cookies.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.stateSave\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function () {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bStateSave\": false,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This function is called when a TR element is created (and all TD child\r\n\t\t * elements have been inserted), or registered if using a DOM source, allowing\r\n\t\t * manipulation of the TR element (adding classes etc).\r\n\t\t * @type function\r\n\t\t * @param {node} row \"TR\" element for the current row\r\n\t\t * @param {array} data Raw data array for this row\r\n\t\t * @param {int} dataIndex The index of this row in the internal aoData array\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.createdRow\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"createdRow\": function( row, data, dataIndex ) {\r\n\t\t * // Bold the grade for all 'A' grade browsers\r\n\t\t * if ( data[4] == \"A\" )\r\n\t\t * {\r\n\t\t * $('td:eq(4)', row).html( 'A' );\r\n\t\t * }\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnCreatedRow\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This function is called on every 'draw' event, and allows you to\r\n\t\t * dynamically modify any aspect you want about the created DOM.\r\n\t\t * @type function\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.drawCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"drawCallback\": function( settings ) {\r\n\t\t * alert( 'DataTables has redrawn the table' );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnDrawCallback\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Identical to fnHeaderCallback() but for the table footer this function\r\n\t\t * allows you to modify the table footer on every 'draw' event.\r\n\t\t * @type function\r\n\t\t * @param {node} foot \"TR\" element for the footer\r\n\t\t * @param {array} data Full table data (as derived from the original HTML)\r\n\t\t * @param {int} start Index for the current display starting point in the\r\n\t\t * display array\r\n\t\t * @param {int} end Index for the current display ending point in the\r\n\t\t * display array\r\n\t\t * @param {array int} display Index array to translate the visual position\r\n\t\t * to the full data array\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.footerCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"footerCallback\": function( tfoot, data, start, end, display ) {\r\n\t\t * tfoot.getElementsByTagName('th')[0].innerHTML = \"Starting index is \"+start;\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"fnFooterCallback\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * When rendering large numbers in the information element for the table\r\n\t\t * (i.e. \"Showing 1 to 10 of 57 entries\") DataTables will render large numbers\r\n\t\t * to have a comma separator for the 'thousands' units (e.g. 1 million is\r\n\t\t * rendered as \"1,000,000\") to help readability for the end user. This\r\n\t\t * function will override the default method DataTables uses.\r\n\t\t * @type function\r\n\t\t * @member\r\n\t\t * @param {int} toFormat number to be formatted\r\n\t\t * @returns {string} formatted string for DataTables to show the number\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.formatNumber\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Format a number using a single quote for the separator (note that\r\n\t\t * // this can also be done with the language.thousands option)\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"formatNumber\": function ( toFormat ) {\r\n\t\t * return toFormat.toString().replace(\r\n\t\t * /\\B(?=(\\d{3})+(?!\\d))/g, \"'\"\r\n\t\t * );\r\n\t\t * };\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnFormatNumber\": function ( toFormat ) {\r\n\t\t\treturn toFormat.toString().replace(\r\n\t\t\t\t/\\B(?=(\\d{3})+(?!\\d))/g,\r\n\t\t\t\tthis.oLanguage.sThousands\r\n\t\t\t);\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This function is called on every 'draw' event, and allows you to\r\n\t\t * dynamically modify the header row. This can be used to calculate and\r\n\t\t * display useful information about the table.\r\n\t\t * @type function\r\n\t\t * @param {node} head \"TR\" element for the header\r\n\t\t * @param {array} data Full table data (as derived from the original HTML)\r\n\t\t * @param {int} start Index for the current display starting point in the\r\n\t\t * display array\r\n\t\t * @param {int} end Index for the current display ending point in the\r\n\t\t * display array\r\n\t\t * @param {array int} display Index array to translate the visual position\r\n\t\t * to the full data array\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.headerCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"fheaderCallback\": function( head, data, start, end, display ) {\r\n\t\t * head.getElementsByTagName('th')[0].innerHTML = \"Displaying \"+(end-start)+\" records\";\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"fnHeaderCallback\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * The information element can be used to convey information about the current\r\n\t\t * state of the table. Although the internationalisation options presented by\r\n\t\t * DataTables are quite capable of dealing with most customisations, there may\r\n\t\t * be times where you wish to customise the string further. This callback\r\n\t\t * allows you to do exactly that.\r\n\t\t * @type function\r\n\t\t * @param {object} oSettings DataTables settings object\r\n\t\t * @param {int} start Starting position in data for the draw\r\n\t\t * @param {int} end End position in data for the draw\r\n\t\t * @param {int} max Total number of rows in the table (regardless of\r\n\t\t * filtering)\r\n\t\t * @param {int} total Total number of rows in the data set, after filtering\r\n\t\t * @param {string} pre The string that DataTables has formatted using it's\r\n\t\t * own rules\r\n\t\t * @returns {string} The string to be displayed in the information element.\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.infoCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"infoCallback\": function( settings, start, end, max, total, pre ) {\r\n\t\t * return start +\" to \"+ end;\r\n\t\t * }\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnInfoCallback\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Called when the table has been initialised. Normally DataTables will\r\n\t\t * initialise sequentially and there will be no need for this function,\r\n\t\t * however, this does not hold true when using external language information\r\n\t\t * since that is obtained using an async XHR call.\r\n\t\t * @type function\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @param {object} json The JSON object request from the server - only\r\n\t\t * present if client-side Ajax sourced data is used\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.initComplete\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"initComplete\": function(settings, json) {\r\n\t\t * alert( 'DataTables has finished its initialisation.' );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"fnInitComplete\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Called at the very start of each table draw and can be used to cancel the\r\n\t\t * draw by returning false, any other return (including undefined) results in\r\n\t\t * the full draw occurring).\r\n\t\t * @type function\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @returns {boolean} False will cancel the draw, anything else (including no\r\n\t\t * return) will allow it to complete.\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.preDrawCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"preDrawCallback\": function( settings ) {\r\n\t\t * if ( $('#test').val() == 1 ) {\r\n\t\t * return false;\r\n\t\t * }\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnPreDrawCallback\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This function allows you to 'post process' each row after it have been\r\n\t\t * generated for each table draw, but before it is rendered on screen. This\r\n\t\t * function might be used for setting the row class name etc.\r\n\t\t * @type function\r\n\t\t * @param {node} row \"TR\" element for the current row\r\n\t\t * @param {array} data Raw data array for this row\r\n\t\t * @param {int} displayIndex The display index for the current table draw\r\n\t\t * @param {int} displayIndexFull The index of the data in the full list of\r\n\t\t * rows (after filtering)\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.rowCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"rowCallback\": function( row, data, displayIndex, displayIndexFull ) {\r\n\t\t * // Bold the grade for all 'A' grade browsers\r\n\t\t * if ( data[4] == \"A\" ) {\r\n\t\t * $('td:eq(4)', row).html( 'A' );\r\n\t\t * }\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnRowCallback\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * __Deprecated__ The functionality provided by this parameter has now been\r\n\t\t * superseded by that provided through `ajax`, which should be used instead.\r\n\t\t *\r\n\t\t * This parameter allows you to override the default function which obtains\r\n\t\t * the data from the server so something more suitable for your application.\r\n\t\t * For example you could use POST data, or pull information from a Gears or\r\n\t\t * AIR database.\r\n\t\t * @type function\r\n\t\t * @member\r\n\t\t * @param {string} source HTTP source to obtain the data from (`ajax`)\r\n\t\t * @param {array} data A key/value pair object containing the data to send\r\n\t\t * to the server\r\n\t\t * @param {function} callback to be called on completion of the data get\r\n\t\t * process that will draw the data on the page.\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @dtopt Server-side\r\n\t\t * @name DataTable.defaults.serverData\r\n\t\t *\r\n\t\t * @deprecated 1.10. Please use `ajax` for this functionality now.\r\n\t\t */\r\n\t\t\"fnServerData\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * __Deprecated__ The functionality provided by this parameter has now been\r\n\t\t * superseded by that provided through `ajax`, which should be used instead.\r\n\t\t *\r\n\t\t * It is often useful to send extra data to the server when making an Ajax\r\n\t\t * request - for example custom filtering information, and this callback\r\n\t\t * function makes it trivial to send extra information to the server. The\r\n\t\t * passed in parameter is the data set that has been constructed by\r\n\t\t * DataTables, and you can add to this or modify it as you require.\r\n\t\t * @type function\r\n\t\t * @param {array} data Data array (array of objects which are name/value\r\n\t\t * pairs) that has been constructed by DataTables and will be sent to the\r\n\t\t * server. In the case of Ajax sourced data with server-side processing\r\n\t\t * this will be an empty array, for server-side processing there will be a\r\n\t\t * significant number of parameters!\r\n\t\t * @returns {undefined} Ensure that you modify the data array passed in,\r\n\t\t * as this is passed by reference.\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @dtopt Server-side\r\n\t\t * @name DataTable.defaults.serverParams\r\n\t\t *\r\n\t\t * @deprecated 1.10. Please use `ajax` for this functionality now.\r\n\t\t */\r\n\t\t\"fnServerParams\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Load the table state. With this function you can define from where, and how, the\r\n\t\t * state of a table is loaded. By default DataTables will load from `localStorage`\r\n\t\t * but you might wish to use a server-side database or cookies.\r\n\t\t * @type function\r\n\t\t * @member\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @param {object} callback Callback that can be executed when done. It\r\n\t\t * should be passed the loaded state object.\r\n\t\t * @return {object} The DataTables state object to be loaded\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.stateLoadCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true,\r\n\t\t * \"stateLoadCallback\": function (settings, callback) {\r\n\t\t * $.ajax( {\r\n\t\t * \"url\": \"/state_load\",\r\n\t\t * \"dataType\": \"json\",\r\n\t\t * \"success\": function (json) {\r\n\t\t * callback( json );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnStateLoadCallback\": function ( settings ) {\r\n\t\t\ttry {\r\n\t\t\t\treturn JSON.parse(\r\n\t\t\t\t\t(settings.iStateDuration === -1 ? sessionStorage : localStorage).getItem(\r\n\t\t\t\t\t\t'DataTables_'+settings.sInstance+'_'+location.pathname\r\n\t\t\t\t\t)\r\n\t\t\t\t);\r\n\t\t\t} catch (e) {}\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Callback which allows modification of the saved state prior to loading that state.\r\n\t\t * This callback is called when the table is loading state from the stored data, but\r\n\t\t * prior to the settings object being modified by the saved state. Note that for\r\n\t\t * plug-in authors, you should use the `stateLoadParams` event to load parameters for\r\n\t\t * a plug-in.\r\n\t\t * @type function\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @param {object} data The state object that is to be loaded\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.stateLoadParams\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Remove a saved filter, so filtering is never loaded\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true,\r\n\t\t * \"stateLoadParams\": function (settings, data) {\r\n\t\t * data.oSearch.sSearch = \"\";\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Disallow state loading by returning false\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true,\r\n\t\t * \"stateLoadParams\": function (settings, data) {\r\n\t\t * return false;\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnStateLoadParams\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Callback that is called when the state has been loaded from the state saving method\r\n\t\t * and the DataTables settings object has been modified as a result of the loaded state.\r\n\t\t * @type function\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @param {object} data The state object that was loaded\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.stateLoaded\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Show an alert with the filtering value that was saved\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true,\r\n\t\t * \"stateLoaded\": function (settings, data) {\r\n\t\t * alert( 'Saved filter was: '+data.oSearch.sSearch );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnStateLoaded\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Save the table state. This function allows you to define where and how the state\r\n\t\t * information for the table is stored By default DataTables will use `localStorage`\r\n\t\t * but you might wish to use a server-side database or cookies.\r\n\t\t * @type function\r\n\t\t * @member\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @param {object} data The state object to be saved\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.stateSaveCallback\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true,\r\n\t\t * \"stateSaveCallback\": function (settings, data) {\r\n\t\t * // Send an Ajax request to the server with the state object\r\n\t\t * $.ajax( {\r\n\t\t * \"url\": \"/state_save\",\r\n\t\t * \"data\": data,\r\n\t\t * \"dataType\": \"json\",\r\n\t\t * \"method\": \"POST\"\r\n\t\t * \"success\": function () {}\r\n\t\t * } );\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnStateSaveCallback\": function ( settings, data ) {\r\n\t\t\ttry {\r\n\t\t\t\t(settings.iStateDuration === -1 ? sessionStorage : localStorage).setItem(\r\n\t\t\t\t\t'DataTables_'+settings.sInstance+'_'+location.pathname,\r\n\t\t\t\t\tJSON.stringify( data )\r\n\t\t\t\t);\r\n\t\t\t} catch (e) {}\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Callback which allows modification of the state to be saved. Called when the table\r\n\t\t * has changed state a new state save is required. This method allows modification of\r\n\t\t * the state saving object prior to actually doing the save, including addition or\r\n\t\t * other state properties or modification. Note that for plug-in authors, you should\r\n\t\t * use the `stateSaveParams` event to save parameters for a plug-in.\r\n\t\t * @type function\r\n\t\t * @param {object} settings DataTables settings object\r\n\t\t * @param {object} data The state object to be saved\r\n\t\t *\r\n\t\t * @dtopt Callbacks\r\n\t\t * @name DataTable.defaults.stateSaveParams\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Remove a saved filter, so filtering is never saved\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateSave\": true,\r\n\t\t * \"stateSaveParams\": function (settings, data) {\r\n\t\t * data.oSearch.sSearch = \"\";\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnStateSaveParams\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Duration for which the saved state information is considered valid. After this period\r\n\t\t * has elapsed the state will be returned to the default.\r\n\t\t * Value is given in seconds.\r\n\t\t * @type int\r\n\t\t * @default 7200 (2 hours)\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.stateDuration\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"stateDuration\": 60*60*24; // 1 day\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"iStateDuration\": 7200,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * When enabled DataTables will not make a request to the server for the first\r\n\t\t * page draw - rather it will use the data already on the page (no sorting etc\r\n\t\t * will be applied to it), thus saving on an XHR at load time. `deferLoading`\r\n\t\t * is used to indicate that deferred loading is required, but it is also used\r\n\t\t * to tell DataTables how many records there are in the full table (allowing\r\n\t\t * the information element and pagination to be displayed correctly). In the case\r\n\t\t * where a filtering is applied to the table on initial load, this can be\r\n\t\t * indicated by giving the parameter as an array, where the first element is\r\n\t\t * the number of records available after filtering and the second element is the\r\n\t\t * number of records without filtering (allowing the table information element\r\n\t\t * to be shown correctly).\r\n\t\t * @type int | array\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.deferLoading\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // 57 records available in the table, no filtering applied\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"serverSide\": true,\r\n\t\t * \"ajax\": \"scripts/server_processing.php\",\r\n\t\t * \"deferLoading\": 57\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // 57 records after filtering, 100 without filtering (an initial filter applied)\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"serverSide\": true,\r\n\t\t * \"ajax\": \"scripts/server_processing.php\",\r\n\t\t * \"deferLoading\": [ 57, 100 ],\r\n\t\t * \"search\": {\r\n\t\t * \"search\": \"my_filter\"\r\n\t\t * }\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"iDeferLoading\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Number of rows to display on a single page when using pagination. If\r\n\t\t * feature enabled (`lengthChange`) then the end user will be able to override\r\n\t\t * this to a custom setting using a pop-up menu.\r\n\t\t * @type int\r\n\t\t * @default 10\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.pageLength\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"pageLength\": 50\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"iDisplayLength\": 10,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Define the starting point for data display when using DataTables with\r\n\t\t * pagination. Note that this parameter is the number of records, rather than\r\n\t\t * the page number, so if you have 10 records per page and want to start on\r\n\t\t * the third page, it should be \"20\".\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.displayStart\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"displayStart\": 20\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"iDisplayStart\": 0,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * By default DataTables allows keyboard navigation of the table (sorting, paging,\r\n\t\t * and filtering) by adding a `tabindex` attribute to the required elements. This\r\n\t\t * allows you to tab through the controls and press the enter key to activate them.\r\n\t\t * The tabindex is default 0, meaning that the tab follows the flow of the document.\r\n\t\t * You can overrule this using this parameter if you wish. Use a value of -1 to\r\n\t\t * disable built-in keyboard navigation.\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.tabIndex\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"tabIndex\": 1\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"iTabIndex\": 0,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Classes that DataTables assigns to the various components and features\r\n\t\t * that it adds to the HTML table. This allows classes to be configured\r\n\t\t * during initialisation in addition to through the static\r\n\t\t * {@link DataTable.ext.oStdClasses} object).\r\n\t\t * @namespace\r\n\t\t * @name DataTable.defaults.classes\r\n\t\t */\r\n\t\t\"oClasses\": {},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * All strings that DataTables uses in the user interface that it creates\r\n\t\t * are defined in this object, allowing you to modified them individually or\r\n\t\t * completely replace them all as required.\r\n\t\t * @namespace\r\n\t\t * @name DataTable.defaults.language\r\n\t\t */\r\n\t\t\"oLanguage\": {\r\n\t\t\t/**\r\n\t\t\t * Strings that are used for WAI-ARIA labels and controls only (these are not\r\n\t\t\t * actually visible on the page, but will be read by screenreaders, and thus\r\n\t\t\t * must be internationalised as well).\r\n\t\t\t * @namespace\r\n\t\t\t * @name DataTable.defaults.language.aria\r\n\t\t\t */\r\n\t\t\t\"oAria\": {\r\n\t\t\t\t/**\r\n\t\t\t\t * ARIA label that is added to the table headers when the column may be\r\n\t\t\t\t * sorted ascending by activing the column (click or return when focused).\r\n\t\t\t\t * Note that the column header is prefixed to this string.\r\n\t\t\t\t * @type string\r\n\t\t\t\t * @default : activate to sort column ascending\r\n\t\t\t\t *\r\n\t\t\t\t * @dtopt Language\r\n\t\t\t\t * @name DataTable.defaults.language.aria.sortAscending\r\n\t\t\t\t *\r\n\t\t\t\t * @example\r\n\t\t\t\t * $(document).ready( function() {\r\n\t\t\t\t * $('#example').dataTable( {\r\n\t\t\t\t * \"language\": {\r\n\t\t\t\t * \"aria\": {\r\n\t\t\t\t * \"sortAscending\": \" - click/return to sort ascending\"\r\n\t\t\t\t * }\r\n\t\t\t\t * }\r\n\t\t\t\t * } );\r\n\t\t\t\t * } );\r\n\t\t\t\t */\r\n\t\t\t\t\"sSortAscending\": \": activate to sort column ascending\",\r\n\t\r\n\t\t\t\t/**\r\n\t\t\t\t * ARIA label that is added to the table headers when the column may be\r\n\t\t\t\t * sorted descending by activing the column (click or return when focused).\r\n\t\t\t\t * Note that the column header is prefixed to this string.\r\n\t\t\t\t * @type string\r\n\t\t\t\t * @default : activate to sort column ascending\r\n\t\t\t\t *\r\n\t\t\t\t * @dtopt Language\r\n\t\t\t\t * @name DataTable.defaults.language.aria.sortDescending\r\n\t\t\t\t *\r\n\t\t\t\t * @example\r\n\t\t\t\t * $(document).ready( function() {\r\n\t\t\t\t * $('#example').dataTable( {\r\n\t\t\t\t * \"language\": {\r\n\t\t\t\t * \"aria\": {\r\n\t\t\t\t * \"sortDescending\": \" - click/return to sort descending\"\r\n\t\t\t\t * }\r\n\t\t\t\t * }\r\n\t\t\t\t * } );\r\n\t\t\t\t * } );\r\n\t\t\t\t */\r\n\t\t\t\t\"sSortDescending\": \": activate to sort column descending\"\r\n\t\t\t},\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Pagination string used by DataTables for the built-in pagination\r\n\t\t\t * control types.\r\n\t\t\t * @namespace\r\n\t\t\t * @name DataTable.defaults.language.paginate\r\n\t\t\t */\r\n\t\t\t\"oPaginate\": {\r\n\t\t\t\t/**\r\n\t\t\t\t * Text to use when using the 'full_numbers' type of pagination for the\r\n\t\t\t\t * button to take the user to the first page.\r\n\t\t\t\t * @type string\r\n\t\t\t\t * @default First\r\n\t\t\t\t *\r\n\t\t\t\t * @dtopt Language\r\n\t\t\t\t * @name DataTable.defaults.language.paginate.first\r\n\t\t\t\t *\r\n\t\t\t\t * @example\r\n\t\t\t\t * $(document).ready( function() {\r\n\t\t\t\t * $('#example').dataTable( {\r\n\t\t\t\t * \"language\": {\r\n\t\t\t\t * \"paginate\": {\r\n\t\t\t\t * \"first\": \"First page\"\r\n\t\t\t\t * }\r\n\t\t\t\t * }\r\n\t\t\t\t * } );\r\n\t\t\t\t * } );\r\n\t\t\t\t */\r\n\t\t\t\t\"sFirst\": \"First\",\r\n\t\r\n\t\r\n\t\t\t\t/**\r\n\t\t\t\t * Text to use when using the 'full_numbers' type of pagination for the\r\n\t\t\t\t * button to take the user to the last page.\r\n\t\t\t\t * @type string\r\n\t\t\t\t * @default Last\r\n\t\t\t\t *\r\n\t\t\t\t * @dtopt Language\r\n\t\t\t\t * @name DataTable.defaults.language.paginate.last\r\n\t\t\t\t *\r\n\t\t\t\t * @example\r\n\t\t\t\t * $(document).ready( function() {\r\n\t\t\t\t * $('#example').dataTable( {\r\n\t\t\t\t * \"language\": {\r\n\t\t\t\t * \"paginate\": {\r\n\t\t\t\t * \"last\": \"Last page\"\r\n\t\t\t\t * }\r\n\t\t\t\t * }\r\n\t\t\t\t * } );\r\n\t\t\t\t * } );\r\n\t\t\t\t */\r\n\t\t\t\t\"sLast\": \"Last\",\r\n\t\r\n\t\r\n\t\t\t\t/**\r\n\t\t\t\t * Text to use for the 'next' pagination button (to take the user to the\r\n\t\t\t\t * next page).\r\n\t\t\t\t * @type string\r\n\t\t\t\t * @default Next\r\n\t\t\t\t *\r\n\t\t\t\t * @dtopt Language\r\n\t\t\t\t * @name DataTable.defaults.language.paginate.next\r\n\t\t\t\t *\r\n\t\t\t\t * @example\r\n\t\t\t\t * $(document).ready( function() {\r\n\t\t\t\t * $('#example').dataTable( {\r\n\t\t\t\t * \"language\": {\r\n\t\t\t\t * \"paginate\": {\r\n\t\t\t\t * \"next\": \"Next page\"\r\n\t\t\t\t * }\r\n\t\t\t\t * }\r\n\t\t\t\t * } );\r\n\t\t\t\t * } );\r\n\t\t\t\t */\r\n\t\t\t\t\"sNext\": \"Next\",\r\n\t\r\n\t\r\n\t\t\t\t/**\r\n\t\t\t\t * Text to use for the 'previous' pagination button (to take the user to\r\n\t\t\t\t * the previous page).\r\n\t\t\t\t * @type string\r\n\t\t\t\t * @default Previous\r\n\t\t\t\t *\r\n\t\t\t\t * @dtopt Language\r\n\t\t\t\t * @name DataTable.defaults.language.paginate.previous\r\n\t\t\t\t *\r\n\t\t\t\t * @example\r\n\t\t\t\t * $(document).ready( function() {\r\n\t\t\t\t * $('#example').dataTable( {\r\n\t\t\t\t * \"language\": {\r\n\t\t\t\t * \"paginate\": {\r\n\t\t\t\t * \"previous\": \"Previous page\"\r\n\t\t\t\t * }\r\n\t\t\t\t * }\r\n\t\t\t\t * } );\r\n\t\t\t\t * } );\r\n\t\t\t\t */\r\n\t\t\t\t\"sPrevious\": \"Previous\"\r\n\t\t\t},\r\n\t\r\n\t\t\t/**\r\n\t\t\t * This string is shown in preference to `zeroRecords` when the table is\r\n\t\t\t * empty of data (regardless of filtering). Note that this is an optional\r\n\t\t\t * parameter - if it is not given, the value of `zeroRecords` will be used\r\n\t\t\t * instead (either the default or given value).\r\n\t\t\t * @type string\r\n\t\t\t * @default No data available in table\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.emptyTable\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"emptyTable\": \"No data available in table\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sEmptyTable\": \"No data available in table\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * This string gives information to the end user about the information\r\n\t\t\t * that is current on display on the page. The following tokens can be\r\n\t\t\t * used in the string and will be dynamically replaced as the table\r\n\t\t\t * display updates. This tokens can be placed anywhere in the string, or\r\n\t\t\t * removed as needed by the language requires:\r\n\t\t\t *\r\n\t\t\t * * `\\_START\\_` - Display index of the first record on the current page\r\n\t\t\t * * `\\_END\\_` - Display index of the last record on the current page\r\n\t\t\t * * `\\_TOTAL\\_` - Number of records in the table after filtering\r\n\t\t\t * * `\\_MAX\\_` - Number of records in the table without filtering\r\n\t\t\t * * `\\_PAGE\\_` - Current page number\r\n\t\t\t * * `\\_PAGES\\_` - Total number of pages of data in the table\r\n\t\t\t *\r\n\t\t\t * @type string\r\n\t\t\t * @default Showing _START_ to _END_ of _TOTAL_ entries\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.info\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"info\": \"Showing page _PAGE_ of _PAGES_\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sInfo\": \"Showing _START_ to _END_ of _TOTAL_ entries\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Display information string for when the table is empty. Typically the\r\n\t\t\t * format of this string should match `info`.\r\n\t\t\t * @type string\r\n\t\t\t * @default Showing 0 to 0 of 0 entries\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.infoEmpty\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"infoEmpty\": \"No entries to show\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sInfoEmpty\": \"Showing 0 to 0 of 0 entries\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * When a user filters the information in a table, this string is appended\r\n\t\t\t * to the information (`info`) to give an idea of how strong the filtering\r\n\t\t\t * is. The variable _MAX_ is dynamically updated.\r\n\t\t\t * @type string\r\n\t\t\t * @default (filtered from _MAX_ total entries)\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.infoFiltered\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"infoFiltered\": \" - filtering from _MAX_ records\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sInfoFiltered\": \"(filtered from _MAX_ total entries)\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * If can be useful to append extra information to the info string at times,\r\n\t\t\t * and this variable does exactly that. This information will be appended to\r\n\t\t\t * the `info` (`infoEmpty` and `infoFiltered` in whatever combination they are\r\n\t\t\t * being used) at all times.\r\n\t\t\t * @type string\r\n\t\t\t * @default Empty string\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.infoPostFix\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"infoPostFix\": \"All records shown are derived from real information.\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sInfoPostFix\": \"\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * This decimal place operator is a little different from the other\r\n\t\t\t * language options since DataTables doesn't output floating point\r\n\t\t\t * numbers, so it won't ever use this for display of a number. Rather,\r\n\t\t\t * what this parameter does is modify the sort methods of the table so\r\n\t\t\t * that numbers which are in a format which has a character other than\r\n\t\t\t * a period (`.`) as a decimal place will be sorted numerically.\r\n\t\t\t *\r\n\t\t\t * Note that numbers with different decimal places cannot be shown in\r\n\t\t\t * the same table and still be sortable, the table must be consistent.\r\n\t\t\t * However, multiple different tables on the page can use different\r\n\t\t\t * decimal place characters.\r\n\t\t\t * @type string\r\n\t\t\t * @default \r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.decimal\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"decimal\": \",\"\r\n\t\t\t * \"thousands\": \".\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sDecimal\": \"\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * DataTables has a build in number formatter (`formatNumber`) which is\r\n\t\t\t * used to format large numbers that are used in the table information.\r\n\t\t\t * By default a comma is used, but this can be trivially changed to any\r\n\t\t\t * character you wish with this parameter.\r\n\t\t\t * @type string\r\n\t\t\t * @default ,\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.thousands\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"thousands\": \"'\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sThousands\": \",\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Detail the action that will be taken when the drop down menu for the\r\n\t\t\t * pagination length option is changed. The '_MENU_' variable is replaced\r\n\t\t\t * with a default select list of 10, 25, 50 and 100, and can be replaced\r\n\t\t\t * with a custom select box if required.\r\n\t\t\t * @type string\r\n\t\t\t * @default Show _MENU_ entries\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.lengthMenu\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Language change only\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"lengthMenu\": \"Display _MENU_ records\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Language and options change\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"lengthMenu\": 'Display records'\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sLengthMenu\": \"Show _MENU_ entries\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * When using Ajax sourced data and during the first draw when DataTables is\r\n\t\t\t * gathering the data, this message is shown in an empty row in the table to\r\n\t\t\t * indicate to the end user the the data is being loaded. Note that this\r\n\t\t\t * parameter is not used when loading data by server-side processing, just\r\n\t\t\t * Ajax sourced data with client-side processing.\r\n\t\t\t * @type string\r\n\t\t\t * @default Loading...\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.loadingRecords\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"loadingRecords\": \"Please wait - loading...\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sLoadingRecords\": \"Loading...\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Text which is displayed when the table is processing a user action\r\n\t\t\t * (usually a sort command or similar).\r\n\t\t\t * @type string\r\n\t\t\t * @default Processing...\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.processing\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"processing\": \"DataTables is currently busy\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sProcessing\": \"Processing...\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Details the actions that will be taken when the user types into the\r\n\t\t\t * filtering input text box. The variable \"_INPUT_\", if used in the string,\r\n\t\t\t * is replaced with the HTML text box for the filtering input allowing\r\n\t\t\t * control over where it appears in the string. If \"_INPUT_\" is not given\r\n\t\t\t * then the input box is appended to the string automatically.\r\n\t\t\t * @type string\r\n\t\t\t * @default Search:\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.search\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Input text box will be appended at the end automatically\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"search\": \"Filter records:\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Specify where the filter should appear\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"search\": \"Apply filter _INPUT_ to table\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sSearch\": \"Search:\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Assign a `placeholder` attribute to the search `input` element\r\n\t\t\t * @type string\r\n\t\t\t * @default \r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.searchPlaceholder\r\n\t\t\t */\r\n\t\t\t\"sSearchPlaceholder\": \"\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * All of the language information can be stored in a file on the\r\n\t\t\t * server-side, which DataTables will look up if this parameter is passed.\r\n\t\t\t * It must store the URL of the language file, which is in a JSON format,\r\n\t\t\t * and the object has the same properties as the oLanguage object in the\r\n\t\t\t * initialiser object (i.e. the above parameters). Please refer to one of\r\n\t\t\t * the example language files to see how this works in action.\r\n\t\t\t * @type string\r\n\t\t\t * @default Empty string - i.e. disabled\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.url\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"url\": \"http://www.sprymedia.co.uk/dataTables/lang.txt\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sUrl\": \"\",\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Text shown inside the table records when the is no information to be\r\n\t\t\t * displayed after filtering. `emptyTable` is shown when there is simply no\r\n\t\t\t * information in the table at all (regardless of filtering).\r\n\t\t\t * @type string\r\n\t\t\t * @default No matching records found\r\n\t\t\t *\r\n\t\t\t * @dtopt Language\r\n\t\t\t * @name DataTable.defaults.language.zeroRecords\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $(document).ready( function() {\r\n\t\t\t * $('#example').dataTable( {\r\n\t\t\t * \"language\": {\r\n\t\t\t * \"zeroRecords\": \"No records to display\"\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\t\"sZeroRecords\": \"No matching records found\"\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This parameter allows you to have define the global filtering state at\r\n\t\t * initialisation time. As an object the `search` parameter must be\r\n\t\t * defined, but all other parameters are optional. When `regex` is true,\r\n\t\t * the search string will be treated as a regular expression, when false\r\n\t\t * (default) it will be treated as a straight string. When `smart`\r\n\t\t * DataTables will use it's smart filtering methods (to word match at\r\n\t\t * any point in the data), when false this will not be done.\r\n\t\t * @namespace\r\n\t\t * @extends DataTable.models.oSearch\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.search\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"search\": {\"search\": \"Initial search\"}\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"oSearch\": $.extend( {}, DataTable.models.oSearch ),\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * __Deprecated__ The functionality provided by this parameter has now been\r\n\t\t * superseded by that provided through `ajax`, which should be used instead.\r\n\t\t *\r\n\t\t * By default DataTables will look for the property `data` (or `aaData` for\r\n\t\t * compatibility with DataTables 1.9-) when obtaining data from an Ajax\r\n\t\t * source or for server-side processing - this parameter allows that\r\n\t\t * property to be changed. You can use Javascript dotted object notation to\r\n\t\t * get a data source for multiple levels of nesting.\r\n\t\t * @type string\r\n\t\t * @default data\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @dtopt Server-side\r\n\t\t * @name DataTable.defaults.ajaxDataProp\r\n\t\t *\r\n\t\t * @deprecated 1.10. Please use `ajax` for this functionality now.\r\n\t\t */\r\n\t\t\"sAjaxDataProp\": \"data\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * __Deprecated__ The functionality provided by this parameter has now been\r\n\t\t * superseded by that provided through `ajax`, which should be used instead.\r\n\t\t *\r\n\t\t * You can instruct DataTables to load data from an external\r\n\t\t * source using this parameter (use aData if you want to pass data in you\r\n\t\t * already have). Simply provide a url a JSON object can be obtained from.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @dtopt Server-side\r\n\t\t * @name DataTable.defaults.ajaxSource\r\n\t\t *\r\n\t\t * @deprecated 1.10. Please use `ajax` for this functionality now.\r\n\t\t */\r\n\t\t\"sAjaxSource\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This initialisation variable allows you to specify exactly where in the\r\n\t\t * DOM you want DataTables to inject the various controls it adds to the page\r\n\t\t * (for example you might want the pagination controls at the top of the\r\n\t\t * table). DIV elements (with or without a custom class) can also be added to\r\n\t\t * aid styling. The follow syntax is used:\r\n\t\t * \r\n\t\t * - The following options are allowed:\r\n\t\t *
\r\n\t\t * - 'l' - Length changing
\r\n\t\t * - 'f' - Filtering input
\r\n\t\t * - 't' - The table!
\r\n\t\t * - 'i' - Information
\r\n\t\t * - 'p' - Pagination
\r\n\t\t * - 'r' - pRocessing
\r\n\t\t *
\r\n\t\t * \r\n\t\t * - The following constants are allowed:\r\n\t\t *
\r\n\t\t * - 'H' - jQueryUI theme \"header\" classes ('fg-toolbar ui-widget-header ui-corner-tl ui-corner-tr ui-helper-clearfix')
\r\n\t\t * - 'F' - jQueryUI theme \"footer\" classes ('fg-toolbar ui-widget-header ui-corner-bl ui-corner-br ui-helper-clearfix')
\r\n\t\t *
\r\n\t\t * \r\n\t\t * - The following syntax is expected:\r\n\t\t *
\r\n\t\t * - '<' and '>' - div elements
\r\n\t\t * - '<\"class\" and '>' - div with a class
\r\n\t\t * - '<\"#id\" and '>' - div with an ID
\r\n\t\t *
\r\n\t\t * \r\n\t\t * - Examples:\r\n\t\t *
\r\n\t\t * - '<\"wrapper\"flipt>'
\r\n\t\t * - '<lf<t>ip>'
\r\n\t\t *
\r\n\t\t * \r\n\t\t *
\r\n\t\t * @type string\r\n\t\t * @default lfrtip (when `jQueryUI` is false) or\r\n\t\t * <\"H\"lfr>t<\"F\"ip> (when `jQueryUI` is true)\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.dom\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"dom\": '<\"top\"i>rt<\"bottom\"flp><\"clear\">'\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sDom\": \"lfrtip\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Search delay option. This will throttle full table searches that use the\r\n\t\t * DataTables provided search input element (it does not effect calls to\r\n\t\t * `dt-api search()`, providing a delay before the search is made.\r\n\t\t * @type integer\r\n\t\t * @default 0\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.searchDelay\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"searchDelay\": 200\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"searchDelay\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * DataTables features six different built-in options for the buttons to\r\n\t\t * display for pagination control:\r\n\t\t *\r\n\t\t * * `numbers` - Page number buttons only\r\n\t\t * * `simple` - 'Previous' and 'Next' buttons only\r\n\t\t * * 'simple_numbers` - 'Previous' and 'Next' buttons, plus page numbers\r\n\t\t * * `full` - 'First', 'Previous', 'Next' and 'Last' buttons\r\n\t\t * * `full_numbers` - 'First', 'Previous', 'Next' and 'Last' buttons, plus page numbers\r\n\t\t * * `first_last_numbers` - 'First' and 'Last' buttons, plus page numbers\r\n\t\t * \r\n\t\t * Further methods can be added using {@link DataTable.ext.oPagination}.\r\n\t\t * @type string\r\n\t\t * @default simple_numbers\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.pagingType\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"pagingType\": \"full_numbers\"\r\n\t\t * } );\r\n\t\t * } )\r\n\t\t */\r\n\t\t\"sPaginationType\": \"simple_numbers\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable horizontal scrolling. When a table is too wide to fit into a\r\n\t\t * certain layout, or you have a large number of columns in the table, you\r\n\t\t * can enable x-scrolling to show the table in a viewport, which can be\r\n\t\t * scrolled. This property can be `true` which will allow the table to\r\n\t\t * scroll horizontally when needed, or any CSS unit, or a number (in which\r\n\t\t * case it will be treated as a pixel measurement). Setting as simply `true`\r\n\t\t * is recommended.\r\n\t\t * @type boolean|string\r\n\t\t * @default blank string - i.e. disabled\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.scrollX\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"scrollX\": true,\r\n\t\t * \"scrollCollapse\": true\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sScrollX\": \"\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This property can be used to force a DataTable to use more width than it\r\n\t\t * might otherwise do when x-scrolling is enabled. For example if you have a\r\n\t\t * table which requires to be well spaced, this parameter is useful for\r\n\t\t * \"over-sizing\" the table, and thus forcing scrolling. This property can by\r\n\t\t * any CSS unit, or a number (in which case it will be treated as a pixel\r\n\t\t * measurement).\r\n\t\t * @type string\r\n\t\t * @default blank string - i.e. disabled\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @name DataTable.defaults.scrollXInner\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"scrollX\": \"100%\",\r\n\t\t * \"scrollXInner\": \"110%\"\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sScrollXInner\": \"\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable vertical scrolling. Vertical scrolling will constrain the DataTable\r\n\t\t * to the given height, and enable scrolling for any data which overflows the\r\n\t\t * current viewport. This can be used as an alternative to paging to display\r\n\t\t * a lot of data in a small area (although paging and scrolling can both be\r\n\t\t * enabled at the same time). This property can be any CSS unit, or a number\r\n\t\t * (in which case it will be treated as a pixel measurement).\r\n\t\t * @type string\r\n\t\t * @default blank string - i.e. disabled\r\n\t\t *\r\n\t\t * @dtopt Features\r\n\t\t * @name DataTable.defaults.scrollY\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"scrollY\": \"200px\",\r\n\t\t * \"paginate\": false\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sScrollY\": \"\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * __Deprecated__ The functionality provided by this parameter has now been\r\n\t\t * superseded by that provided through `ajax`, which should be used instead.\r\n\t\t *\r\n\t\t * Set the HTTP method that is used to make the Ajax call for server-side\r\n\t\t * processing or Ajax sourced data.\r\n\t\t * @type string\r\n\t\t * @default GET\r\n\t\t *\r\n\t\t * @dtopt Options\r\n\t\t * @dtopt Server-side\r\n\t\t * @name DataTable.defaults.serverMethod\r\n\t\t *\r\n\t\t * @deprecated 1.10. Please use `ajax` for this functionality now.\r\n\t\t */\r\n\t\t\"sServerMethod\": \"GET\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * DataTables makes use of renderers when displaying HTML elements for\r\n\t\t * a table. These renderers can be added or modified by plug-ins to\r\n\t\t * generate suitable mark-up for a site. For example the Bootstrap\r\n\t\t * integration plug-in for DataTables uses a paging button renderer to\r\n\t\t * display pagination buttons in the mark-up required by Bootstrap.\r\n\t\t *\r\n\t\t * For further information about the renderers available see\r\n\t\t * DataTable.ext.renderer\r\n\t\t * @type string|object\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @name DataTable.defaults.renderer\r\n\t\t *\r\n\t\t */\r\n\t\t\"renderer\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Set the data property name that DataTables should use to get a row's id\r\n\t\t * to set as the `id` property in the node.\r\n\t\t * @type string\r\n\t\t * @default DT_RowId\r\n\t\t *\r\n\t\t * @name DataTable.defaults.rowId\r\n\t\t */\r\n\t\t\"rowId\": \"DT_RowId\"\r\n\t};\r\n\t\r\n\t_fnHungarianMap( DataTable.defaults );\r\n\t\r\n\t\r\n\t\r\n\t/*\r\n\t * Developer note - See note in model.defaults.js about the use of Hungarian\r\n\t * notation and camel case.\r\n\t */\r\n\t\r\n\t/**\r\n\t * Column options that can be given to DataTables at initialisation time.\r\n\t * @namespace\r\n\t */\r\n\tDataTable.defaults.column = {\r\n\t\t/**\r\n\t\t * Define which column(s) an order will occur on for this column. This\r\n\t\t * allows a column's ordering to take multiple columns into account when\r\n\t\t * doing a sort or use the data from a different column. For example first\r\n\t\t * name / last name columns make sense to do a multi-column sort over the\r\n\t\t * two columns.\r\n\t\t * @type array|int\r\n\t\t * @default null Takes the value of the column index automatically\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.orderData\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"orderData\": [ 0, 1 ], \"targets\": [ 0 ] },\r\n\t\t * { \"orderData\": [ 1, 0 ], \"targets\": [ 1 ] },\r\n\t\t * { \"orderData\": 2, \"targets\": [ 2 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"orderData\": [ 0, 1 ] },\r\n\t\t * { \"orderData\": [ 1, 0 ] },\r\n\t\t * { \"orderData\": 2 },\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"aDataSort\": null,\r\n\t\t\"iDataSort\": -1,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * You can control the default ordering direction, and even alter the\r\n\t\t * behaviour of the sort handler (i.e. only allow ascending ordering etc)\r\n\t\t * using this parameter.\r\n\t\t * @type array\r\n\t\t * @default [ 'asc', 'desc' ]\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.orderSequence\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"orderSequence\": [ \"asc\" ], \"targets\": [ 1 ] },\r\n\t\t * { \"orderSequence\": [ \"desc\", \"asc\", \"asc\" ], \"targets\": [ 2 ] },\r\n\t\t * { \"orderSequence\": [ \"desc\" ], \"targets\": [ 3 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * null,\r\n\t\t * { \"orderSequence\": [ \"asc\" ] },\r\n\t\t * { \"orderSequence\": [ \"desc\", \"asc\", \"asc\" ] },\r\n\t\t * { \"orderSequence\": [ \"desc\" ] },\r\n\t\t * null\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"asSorting\": [ 'asc', 'desc' ],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable filtering on the data in this column.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.searchable\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"searchable\": false, \"targets\": [ 0 ] }\r\n\t\t * ] } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"searchable\": false },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ] } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bSearchable\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable ordering on this column.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.orderable\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"orderable\": false, \"targets\": [ 0 ] }\r\n\t\t * ] } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"orderable\": false },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ] } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bSortable\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Enable or disable the display of this column.\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.visible\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"visible\": false, \"targets\": [ 0 ] }\r\n\t\t * ] } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"visible\": false },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ] } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"bVisible\": true,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Developer definable function that is called whenever a cell is created (Ajax source,\r\n\t\t * etc) or processed for input (DOM source). This can be used as a compliment to mRender\r\n\t\t * allowing you to modify the DOM element (add background colour for example) when the\r\n\t\t * element is available.\r\n\t\t * @type function\r\n\t\t * @param {element} td The TD node that has been created\r\n\t\t * @param {*} cellData The Data for the cell\r\n\t\t * @param {array|object} rowData The data for the whole row\r\n\t\t * @param {int} row The row index for the aoData data store\r\n\t\t * @param {int} col The column index for aoColumns\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.createdCell\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [3],\r\n\t\t * \"createdCell\": function (td, cellData, rowData, row, col) {\r\n\t\t * if ( cellData == \"1.7\" ) {\r\n\t\t * $(td).css('color', 'blue')\r\n\t\t * }\r\n\t\t * }\r\n\t\t * } ]\r\n\t\t * });\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"fnCreatedCell\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This parameter has been replaced by `data` in DataTables to ensure naming\r\n\t\t * consistency. `dataProp` can still be used, as there is backwards\r\n\t\t * compatibility in DataTables for this option, but it is strongly\r\n\t\t * recommended that you use `data` in preference to `dataProp`.\r\n\t\t * @name DataTable.defaults.column.dataProp\r\n\t\t */\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This property can be used to read data from any data source property,\r\n\t\t * including deeply nested objects / properties. `data` can be given in a\r\n\t\t * number of different ways which effect its behaviour:\r\n\t\t *\r\n\t\t * * `integer` - treated as an array index for the data source. This is the\r\n\t\t * default that DataTables uses (incrementally increased for each column).\r\n\t\t * * `string` - read an object property from the data source. There are\r\n\t\t * three 'special' options that can be used in the string to alter how\r\n\t\t * DataTables reads the data from the source object:\r\n\t\t * * `.` - Dotted Javascript notation. Just as you use a `.` in\r\n\t\t * Javascript to read from nested objects, so to can the options\r\n\t\t * specified in `data`. For example: `browser.version` or\r\n\t\t * `browser.name`. If your object parameter name contains a period, use\r\n\t\t * `\\\\` to escape it - i.e. `first\\\\.name`.\r\n\t\t * * `[]` - Array notation. DataTables can automatically combine data\r\n\t\t * from and array source, joining the data with the characters provided\r\n\t\t * between the two brackets. For example: `name[, ]` would provide a\r\n\t\t * comma-space separated list from the source array. If no characters\r\n\t\t * are provided between the brackets, the original array source is\r\n\t\t * returned.\r\n\t\t * * `()` - Function notation. Adding `()` to the end of a parameter will\r\n\t\t * execute a function of the name given. For example: `browser()` for a\r\n\t\t * simple function on the data source, `browser.version()` for a\r\n\t\t * function in a nested property or even `browser().version` to get an\r\n\t\t * object property if the function called returns an object. Note that\r\n\t\t * function notation is recommended for use in `render` rather than\r\n\t\t * `data` as it is much simpler to use as a renderer.\r\n\t\t * * `null` - use the original data source for the row rather than plucking\r\n\t\t * data directly from it. This action has effects on two other\r\n\t\t * initialisation options:\r\n\t\t * * `defaultContent` - When null is given as the `data` option and\r\n\t\t * `defaultContent` is specified for the column, the value defined by\r\n\t\t * `defaultContent` will be used for the cell.\r\n\t\t * * `render` - When null is used for the `data` option and the `render`\r\n\t\t * option is specified for the column, the whole data source for the\r\n\t\t * row is used for the renderer.\r\n\t\t * * `function` - the function given will be executed whenever DataTables\r\n\t\t * needs to set or get the data for a cell in the column. The function\r\n\t\t * takes three parameters:\r\n\t\t * * Parameters:\r\n\t\t * * `{array|object}` The data source for the row\r\n\t\t * * `{string}` The type call data requested - this will be 'set' when\r\n\t\t * setting data or 'filter', 'display', 'type', 'sort' or undefined\r\n\t\t * when gathering data. Note that when `undefined` is given for the\r\n\t\t * type DataTables expects to get the raw data for the object back<\r\n\t\t * * `{*}` Data to set when the second parameter is 'set'.\r\n\t\t * * Return:\r\n\t\t * * The return value from the function is not required when 'set' is\r\n\t\t * the type of call, but otherwise the return is what will be used\r\n\t\t * for the data requested.\r\n\t\t *\r\n\t\t * Note that `data` is a getter and setter option. If you just require\r\n\t\t * formatting of data for output, you will likely want to use `render` which\r\n\t\t * is simply a getter and thus simpler to use.\r\n\t\t *\r\n\t\t * Note that prior to DataTables 1.9.2 `data` was called `mDataProp`. The\r\n\t\t * name change reflects the flexibility of this property and is consistent\r\n\t\t * with the naming of mRender. If 'mDataProp' is given, then it will still\r\n\t\t * be used by DataTables, as it automatically maps the old name to the new\r\n\t\t * if required.\r\n\t\t *\r\n\t\t * @type string|int|function|null\r\n\t\t * @default null Use automatically calculated column index\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.data\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Read table data from objects\r\n\t\t * // JSON structure for each row:\r\n\t\t * // {\r\n\t\t * // \"engine\": {value},\r\n\t\t * // \"browser\": {value},\r\n\t\t * // \"platform\": {value},\r\n\t\t * // \"version\": {value},\r\n\t\t * // \"grade\": {value}\r\n\t\t * // }\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajaxSource\": \"sources/objects.txt\",\r\n\t\t * \"columns\": [\r\n\t\t * { \"data\": \"engine\" },\r\n\t\t * { \"data\": \"browser\" },\r\n\t\t * { \"data\": \"platform\" },\r\n\t\t * { \"data\": \"version\" },\r\n\t\t * { \"data\": \"grade\" }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Read information from deeply nested objects\r\n\t\t * // JSON structure for each row:\r\n\t\t * // {\r\n\t\t * // \"engine\": {value},\r\n\t\t * // \"browser\": {value},\r\n\t\t * // \"platform\": {\r\n\t\t * // \"inner\": {value}\r\n\t\t * // },\r\n\t\t * // \"details\": [\r\n\t\t * // {value}, {value}\r\n\t\t * // ]\r\n\t\t * // }\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajaxSource\": \"sources/deep.txt\",\r\n\t\t * \"columns\": [\r\n\t\t * { \"data\": \"engine\" },\r\n\t\t * { \"data\": \"browser\" },\r\n\t\t * { \"data\": \"platform.inner\" },\r\n\t\t * { \"data\": \"platform.details.0\" },\r\n\t\t * { \"data\": \"platform.details.1\" }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `data` as a function to provide different information for\r\n\t\t * // sorting, filtering and display. In this case, currency (price)\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"data\": function ( source, type, val ) {\r\n\t\t * if (type === 'set') {\r\n\t\t * source.price = val;\r\n\t\t * // Store the computed dislay and filter values for efficiency\r\n\t\t * source.price_display = val==\"\" ? \"\" : \"$\"+numberFormat(val);\r\n\t\t * source.price_filter = val==\"\" ? \"\" : \"$\"+numberFormat(val)+\" \"+val;\r\n\t\t * return;\r\n\t\t * }\r\n\t\t * else if (type === 'display') {\r\n\t\t * return source.price_display;\r\n\t\t * }\r\n\t\t * else if (type === 'filter') {\r\n\t\t * return source.price_filter;\r\n\t\t * }\r\n\t\t * // 'sort', 'type' and undefined all just use the integer\r\n\t\t * return source.price;\r\n\t\t * }\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using default content\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"data\": null,\r\n\t\t * \"defaultContent\": \"Click to edit\"\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using array notation - outputting a list from an array\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"data\": \"name[, ]\"\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t */\r\n\t\t\"mData\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This property is the rendering partner to `data` and it is suggested that\r\n\t\t * when you want to manipulate data for display (including filtering,\r\n\t\t * sorting etc) without altering the underlying data for the table, use this\r\n\t\t * property. `render` can be considered to be the the read only companion to\r\n\t\t * `data` which is read / write (then as such more complex). Like `data`\r\n\t\t * this option can be given in a number of different ways to effect its\r\n\t\t * behaviour:\r\n\t\t *\r\n\t\t * * `integer` - treated as an array index for the data source. This is the\r\n\t\t * default that DataTables uses (incrementally increased for each column).\r\n\t\t * * `string` - read an object property from the data source. There are\r\n\t\t * three 'special' options that can be used in the string to alter how\r\n\t\t * DataTables reads the data from the source object:\r\n\t\t * * `.` - Dotted Javascript notation. Just as you use a `.` in\r\n\t\t * Javascript to read from nested objects, so to can the options\r\n\t\t * specified in `data`. For example: `browser.version` or\r\n\t\t * `browser.name`. If your object parameter name contains a period, use\r\n\t\t * `\\\\` to escape it - i.e. `first\\\\.name`.\r\n\t\t * * `[]` - Array notation. DataTables can automatically combine data\r\n\t\t * from and array source, joining the data with the characters provided\r\n\t\t * between the two brackets. For example: `name[, ]` would provide a\r\n\t\t * comma-space separated list from the source array. If no characters\r\n\t\t * are provided between the brackets, the original array source is\r\n\t\t * returned.\r\n\t\t * * `()` - Function notation. Adding `()` to the end of a parameter will\r\n\t\t * execute a function of the name given. For example: `browser()` for a\r\n\t\t * simple function on the data source, `browser.version()` for a\r\n\t\t * function in a nested property or even `browser().version` to get an\r\n\t\t * object property if the function called returns an object.\r\n\t\t * * `object` - use different data for the different data types requested by\r\n\t\t * DataTables ('filter', 'display', 'type' or 'sort'). The property names\r\n\t\t * of the object is the data type the property refers to and the value can\r\n\t\t * defined using an integer, string or function using the same rules as\r\n\t\t * `render` normally does. Note that an `_` option _must_ be specified.\r\n\t\t * This is the default value to use if you haven't specified a value for\r\n\t\t * the data type requested by DataTables.\r\n\t\t * * `function` - the function given will be executed whenever DataTables\r\n\t\t * needs to set or get the data for a cell in the column. The function\r\n\t\t * takes three parameters:\r\n\t\t * * Parameters:\r\n\t\t * * {array|object} The data source for the row (based on `data`)\r\n\t\t * * {string} The type call data requested - this will be 'filter',\r\n\t\t * 'display', 'type' or 'sort'.\r\n\t\t * * {array|object} The full data source for the row (not based on\r\n\t\t * `data`)\r\n\t\t * * Return:\r\n\t\t * * The return value from the function is what will be used for the\r\n\t\t * data requested.\r\n\t\t *\r\n\t\t * @type string|int|function|object|null\r\n\t\t * @default null Use the data source value.\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.render\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Create a comma separated list from an array of objects\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"ajaxSource\": \"sources/deep.txt\",\r\n\t\t * \"columns\": [\r\n\t\t * { \"data\": \"engine\" },\r\n\t\t * { \"data\": \"browser\" },\r\n\t\t * {\r\n\t\t * \"data\": \"platform\",\r\n\t\t * \"render\": \"[, ].name\"\r\n\t\t * }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Execute a function to obtain data\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"data\": null, // Use the full data source object for the renderer's source\r\n\t\t * \"render\": \"browserName()\"\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // As an object, extracting different data for the different types\r\n\t\t * // This would be used with a data source such as:\r\n\t\t * // { \"phone\": 5552368, \"phone_filter\": \"5552368 555-2368\", \"phone_display\": \"555-2368\" }\r\n\t\t * // Here the `phone` integer is used for sorting and type detection, while `phone_filter`\r\n\t\t * // (which has both forms) is used for filtering for if a user inputs either format, while\r\n\t\t * // the formatted phone number is the one that is shown in the table.\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"data\": null, // Use the full data source object for the renderer's source\r\n\t\t * \"render\": {\r\n\t\t * \"_\": \"phone\",\r\n\t\t * \"filter\": \"phone_filter\",\r\n\t\t * \"display\": \"phone_display\"\r\n\t\t * }\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Use as a function to create a link from the data source\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"data\": \"download_link\",\r\n\t\t * \"render\": function ( data, type, full ) {\r\n\t\t * return 'Download';\r\n\t\t * }\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"mRender\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Change the cell type created for the column - either TD cells or TH cells. This\r\n\t\t * can be useful as TH cells have semantic meaning in the table body, allowing them\r\n\t\t * to act as a header for a row (you may wish to add scope='row' to the TH elements).\r\n\t\t * @type string\r\n\t\t * @default td\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.cellType\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Make the first column use TH cells\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [ {\r\n\t\t * \"targets\": [ 0 ],\r\n\t\t * \"cellType\": \"th\"\r\n\t\t * } ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sCellType\": \"td\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Class to give to each cell in this column.\r\n\t\t * @type string\r\n\t\t * @default Empty string\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.class\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"class\": \"my_class\", \"targets\": [ 0 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"class\": \"my_class\" },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sClass\": \"\",\r\n\t\r\n\t\t/**\r\n\t\t * When DataTables calculates the column widths to assign to each column,\r\n\t\t * it finds the longest string in each column and then constructs a\r\n\t\t * temporary table and reads the widths from that. The problem with this\r\n\t\t * is that \"mmm\" is much wider then \"iiii\", but the latter is a longer\r\n\t\t * string - thus the calculation can go wrong (doing it properly and putting\r\n\t\t * it into an DOM object and measuring that is horribly(!) slow). Thus as\r\n\t\t * a \"work around\" we provide this option. It will append its value to the\r\n\t\t * text that is found to be the longest string for the column - i.e. padding.\r\n\t\t * Generally you shouldn't need this!\r\n\t\t * @type string\r\n\t\t * @default Empty string\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.contentPadding\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * {\r\n\t\t * \"contentPadding\": \"mmm\"\r\n\t\t * }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sContentPadding\": \"\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Allows a default value to be given for a column's data, and will be used\r\n\t\t * whenever a null data source is encountered (this can be because `data`\r\n\t\t * is set to null, or because the data source itself is null).\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.defaultContent\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * {\r\n\t\t * \"data\": null,\r\n\t\t * \"defaultContent\": \"Edit\",\r\n\t\t * \"targets\": [ -1 ]\r\n\t\t * }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * {\r\n\t\t * \"data\": null,\r\n\t\t * \"defaultContent\": \"Edit\"\r\n\t\t * }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sDefaultContent\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * This parameter is only used in DataTables' server-side processing. It can\r\n\t\t * be exceptionally useful to know what columns are being displayed on the\r\n\t\t * client side, and to map these to database fields. When defined, the names\r\n\t\t * also allow DataTables to reorder information from the server if it comes\r\n\t\t * back in an unexpected order (i.e. if you switch your columns around on the\r\n\t\t * client-side, your server-side code does not also need updating).\r\n\t\t * @type string\r\n\t\t * @default Empty string\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.name\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"name\": \"engine\", \"targets\": [ 0 ] },\r\n\t\t * { \"name\": \"browser\", \"targets\": [ 1 ] },\r\n\t\t * { \"name\": \"platform\", \"targets\": [ 2 ] },\r\n\t\t * { \"name\": \"version\", \"targets\": [ 3 ] },\r\n\t\t * { \"name\": \"grade\", \"targets\": [ 4 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"name\": \"engine\" },\r\n\t\t * { \"name\": \"browser\" },\r\n\t\t * { \"name\": \"platform\" },\r\n\t\t * { \"name\": \"version\" },\r\n\t\t * { \"name\": \"grade\" }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sName\": \"\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Defines a data source type for the ordering which can be used to read\r\n\t\t * real-time information from the table (updating the internally cached\r\n\t\t * version) prior to ordering. This allows ordering to occur on user\r\n\t\t * editable elements such as form inputs.\r\n\t\t * @type string\r\n\t\t * @default std\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.orderDataType\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"orderDataType\": \"dom-text\", \"targets\": [ 2, 3 ] },\r\n\t\t * { \"type\": \"numeric\", \"targets\": [ 3 ] },\r\n\t\t * { \"orderDataType\": \"dom-select\", \"targets\": [ 4 ] },\r\n\t\t * { \"orderDataType\": \"dom-checkbox\", \"targets\": [ 5 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * { \"orderDataType\": \"dom-text\" },\r\n\t\t * { \"orderDataType\": \"dom-text\", \"type\": \"numeric\" },\r\n\t\t * { \"orderDataType\": \"dom-select\" },\r\n\t\t * { \"orderDataType\": \"dom-checkbox\" }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sSortDataType\": \"std\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * The title of this column.\r\n\t\t * @type string\r\n\t\t * @default null Derived from the 'TH' value for this column in the\r\n\t\t * original HTML table.\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.title\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"title\": \"My column title\", \"targets\": [ 0 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"title\": \"My column title\" },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sTitle\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * The type allows you to specify how the data for this column will be\r\n\t\t * ordered. Four types (string, numeric, date and html (which will strip\r\n\t\t * HTML tags before ordering)) are currently available. Note that only date\r\n\t\t * formats understood by Javascript's Date() object will be accepted as type\r\n\t\t * date. For example: \"Mar 26, 2008 5:03 PM\". May take the values: 'string',\r\n\t\t * 'numeric', 'date' or 'html' (by default). Further types can be adding\r\n\t\t * through plug-ins.\r\n\t\t * @type string\r\n\t\t * @default null Auto-detected from raw data\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.type\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"type\": \"html\", \"targets\": [ 0 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"type\": \"html\" },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sType\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Defining the width of the column, this parameter may take any CSS value\r\n\t\t * (3em, 20px etc). DataTables applies 'smart' widths to columns which have not\r\n\t\t * been given a specific width through this interface ensuring that the table\r\n\t\t * remains readable.\r\n\t\t * @type string\r\n\t\t * @default null Automatic\r\n\t\t *\r\n\t\t * @name DataTable.defaults.column.width\r\n\t\t * @dtopt Columns\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columnDefs`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columnDefs\": [\r\n\t\t * { \"width\": \"20%\", \"targets\": [ 0 ] }\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Using `columns`\r\n\t\t * $(document).ready( function() {\r\n\t\t * $('#example').dataTable( {\r\n\t\t * \"columns\": [\r\n\t\t * { \"width\": \"20%\" },\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null,\r\n\t\t * null\r\n\t\t * ]\r\n\t\t * } );\r\n\t\t * } );\r\n\t\t */\r\n\t\t\"sWidth\": null\r\n\t};\r\n\t\r\n\t_fnHungarianMap( DataTable.defaults.column );\r\n\t\r\n\t\r\n\t\r\n\t/**\r\n\t * DataTables settings object - this holds all the information needed for a\r\n\t * given table, including configuration, data and current application of the\r\n\t * table options. DataTables does not have a single instance for each DataTable\r\n\t * with the settings attached to that instance, but rather instances of the\r\n\t * DataTable \"class\" are created on-the-fly as needed (typically by a\r\n\t * $().dataTable() call) and the settings object is then applied to that\r\n\t * instance.\r\n\t *\r\n\t * Note that this object is related to {@link DataTable.defaults} but this\r\n\t * one is the internal data store for DataTables's cache of columns. It should\r\n\t * NOT be manipulated outside of DataTables. Any configuration should be done\r\n\t * through the initialisation options.\r\n\t * @namespace\r\n\t * @todo Really should attach the settings object to individual instances so we\r\n\t * don't need to create new instances on each $().dataTable() call (if the\r\n\t * table already exists). It would also save passing oSettings around and\r\n\t * into every single function. However, this is a very significant\r\n\t * architecture change for DataTables and will almost certainly break\r\n\t * backwards compatibility with older installations. This is something that\r\n\t * will be done in 2.0.\r\n\t */\r\n\tDataTable.models.oSettings = {\r\n\t\t/**\r\n\t\t * Primary features of DataTables and their enablement state.\r\n\t\t * @namespace\r\n\t\t */\r\n\t\t\"oFeatures\": {\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Flag to say if DataTables should automatically try to calculate the\r\n\t\t\t * optimum table and columns widths (true) or not (false).\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bAutoWidth\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Delay the creation of TR and TD elements until they are actually\r\n\t\t\t * needed by a driven page draw. This can give a significant speed\r\n\t\t\t * increase for Ajax source and Javascript source data, but makes no\r\n\t\t\t * difference at all fro DOM and server-side processing tables.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bDeferRender\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Enable filtering on the table or not. Note that if this is disabled\r\n\t\t\t * then there is no filtering at all on the table, including fnFilter.\r\n\t\t\t * To just remove the filtering input use sDom and remove the 'f' option.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bFilter\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Table information element (the 'Showing x of y records' div) enable\r\n\t\t\t * flag.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bInfo\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Present a user control allowing the end user to change the page size\r\n\t\t\t * when pagination is enabled.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bLengthChange\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Pagination enabled or not. Note that if this is disabled then length\r\n\t\t\t * changing must also be disabled.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bPaginate\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Processing indicator enable flag whenever DataTables is enacting a\r\n\t\t\t * user request - typically an Ajax request for server-side processing.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bProcessing\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Server-side processing enabled flag - when enabled DataTables will\r\n\t\t\t * get all data from the server for every draw - there is no filtering,\r\n\t\t\t * sorting or paging done on the client-side.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bServerSide\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Sorting enablement flag.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bSort\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Multi-column sorting\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bSortMulti\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Apply a class to the columns which are being sorted to provide a\r\n\t\t\t * visual highlight or not. This can slow things down when enabled since\r\n\t\t\t * there is a lot of DOM interaction.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bSortClasses\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * State saving enablement flag.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bStateSave\": null\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Scrolling settings for a table.\r\n\t\t * @namespace\r\n\t\t */\r\n\t\t\"oScroll\": {\r\n\t\t\t/**\r\n\t\t\t * When the table is shorter in height than sScrollY, collapse the\r\n\t\t\t * table container down to the height of the table (when true).\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type boolean\r\n\t\t\t */\r\n\t\t\t\"bCollapse\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Width of the scrollbar for the web-browser's platform. Calculated\r\n\t\t\t * during table initialisation.\r\n\t\t\t * @type int\r\n\t\t\t * @default 0\r\n\t\t\t */\r\n\t\t\t\"iBarWidth\": 0,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Viewport width for horizontal scrolling. Horizontal scrolling is\r\n\t\t\t * disabled if an empty string.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type string\r\n\t\t\t */\r\n\t\t\t\"sX\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Width to expand the table to when using x-scrolling. Typically you\r\n\t\t\t * should not need to use this.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type string\r\n\t\t\t * @deprecated\r\n\t\t\t */\r\n\t\t\t\"sXInner\": null,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Viewport height for vertical scrolling. Vertical scrolling is disabled\r\n\t\t\t * if an empty string.\r\n\t\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t\t * @type string\r\n\t\t\t */\r\n\t\t\t\"sY\": null\r\n\t\t},\r\n\t\r\n\t\t/**\r\n\t\t * Language information for the table.\r\n\t\t * @namespace\r\n\t\t * @extends DataTable.defaults.oLanguage\r\n\t\t */\r\n\t\t\"oLanguage\": {\r\n\t\t\t/**\r\n\t\t\t * Information callback function. See\r\n\t\t\t * {@link DataTable.defaults.fnInfoCallback}\r\n\t\t\t * @type function\r\n\t\t\t * @default null\r\n\t\t\t */\r\n\t\t\t\"fnInfoCallback\": null\r\n\t\t},\r\n\t\r\n\t\t/**\r\n\t\t * Browser support parameters\r\n\t\t * @namespace\r\n\t\t */\r\n\t\t\"oBrowser\": {\r\n\t\t\t/**\r\n\t\t\t * Indicate if the browser incorrectly calculates width:100% inside a\r\n\t\t\t * scrolling element (IE6/7)\r\n\t\t\t * @type boolean\r\n\t\t\t * @default false\r\n\t\t\t */\r\n\t\t\t\"bScrollOversize\": false,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Determine if the vertical scrollbar is on the right or left of the\r\n\t\t\t * scrolling container - needed for rtl language layout, although not\r\n\t\t\t * all browsers move the scrollbar (Safari).\r\n\t\t\t * @type boolean\r\n\t\t\t * @default false\r\n\t\t\t */\r\n\t\t\t\"bScrollbarLeft\": false,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Flag for if `getBoundingClientRect` is fully supported or not\r\n\t\t\t * @type boolean\r\n\t\t\t * @default false\r\n\t\t\t */\r\n\t\t\t\"bBounding\": false,\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Browser scrollbar width\r\n\t\t\t * @type integer\r\n\t\t\t * @default 0\r\n\t\t\t */\r\n\t\t\t\"barWidth\": 0\r\n\t\t},\r\n\t\r\n\t\r\n\t\t\"ajax\": null,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Array referencing the nodes which are used for the features. The\r\n\t\t * parameters of this object match what is allowed by sDom - i.e.\r\n\t\t * \r\n\t\t * - 'l' - Length changing
\r\n\t\t * - 'f' - Filtering input
\r\n\t\t * - 't' - The table!
\r\n\t\t * - 'i' - Information
\r\n\t\t * - 'p' - Pagination
\r\n\t\t * - 'r' - pRocessing
\r\n\t\t *
\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aanFeatures\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Store data information - see {@link DataTable.models.oRow} for detailed\r\n\t\t * information.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoData\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Array of indexes which are in the current display (after filtering etc)\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aiDisplay\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Array of indexes for display - no filtering\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aiDisplayMaster\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Map of row ids to data indexes\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t */\r\n\t\t\"aIds\": {},\r\n\t\r\n\t\t/**\r\n\t\t * Store information about each column that is in use\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoColumns\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Store information about the table's header\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoHeader\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Store information about the table's footer\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoFooter\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Store the applied global search information in case we want to force a\r\n\t\t * research or compare the old search to a new one.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @namespace\r\n\t\t * @extends DataTable.models.oSearch\r\n\t\t */\r\n\t\t\"oPreviousSearch\": {},\r\n\t\r\n\t\t/**\r\n\t\t * Store the applied search for each column - see\r\n\t\t * {@link DataTable.models.oSearch} for the format that is used for the\r\n\t\t * filtering information for each column.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoPreSearchCols\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Sorting that is applied to the table. Note that the inner arrays are\r\n\t\t * used in the following manner:\r\n\t\t * \r\n\t\t * - Index 0 - column number
\r\n\t\t * - Index 1 - current sorting direction
\r\n\t\t *
\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type array\r\n\t\t * @todo These inner arrays should really be objects\r\n\t\t */\r\n\t\t\"aaSorting\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Sorting that is always applied to the table (i.e. prefixed in front of\r\n\t\t * aaSorting).\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aaSortingFixed\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Classes to use for the striping of a table.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"asStripeClasses\": null,\r\n\t\r\n\t\t/**\r\n\t\t * If restoring a table - we should restore its striping classes as well\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"asDestroyStripes\": [],\r\n\t\r\n\t\t/**\r\n\t\t * If restoring a table - we should restore its width\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t */\r\n\t\t\"sDestroyWidth\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * Callback functions array for every time a row is inserted (i.e. on a draw).\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoRowCallback\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Callback functions for the header on each draw.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoHeaderCallback\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Callback function for the footer on each draw.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoFooterCallback\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Array of callback functions for draw callback functions\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoDrawCallback\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Array of callback functions for row created function\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoRowCreatedCallback\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Callback functions for just before the table is redrawn. A return of\r\n\t\t * false will be used to cancel the draw.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoPreDrawCallback\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Callback functions for when the table has been initialised.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoInitComplete\": [],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Callbacks for modifying the settings to be stored for state saving, prior to\r\n\t\t * saving state.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoStateSaveParams\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Callbacks for modifying the settings that have been stored for state saving\r\n\t\t * prior to using the stored values to restore the state.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoStateLoadParams\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Callbacks for operating on the settings object once the saved state has been\r\n\t\t * loaded\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoStateLoaded\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Cache the table ID for quick access\r\n\t\t * @type string\r\n\t\t * @default Empty string\r\n\t\t */\r\n\t\t\"sTableId\": \"\",\r\n\t\r\n\t\t/**\r\n\t\t * The TABLE node for the main table\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTable\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Permanent ref to the thead element\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTHead\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Permanent ref to the tfoot element - if it exists\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTFoot\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Permanent ref to the tbody element\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTBody\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Cache the wrapper node (contains all DataTables controlled elements)\r\n\t\t * @type node\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"nTableWrapper\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Indicate if when using server-side processing the loading of data\r\n\t\t * should be deferred until the second draw.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t */\r\n\t\t\"bDeferLoading\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Indicate if all required information has been read in\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t */\r\n\t\t\"bInitialised\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Information about open rows. Each object in the array has the parameters\r\n\t\t * 'nTr' and 'nParent'\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoOpenRows\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Dictate the positioning of DataTables' control elements - see\r\n\t\t * {@link DataTable.model.oInit.sDom}.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sDom\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Search delay (in mS)\r\n\t\t * @type integer\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"searchDelay\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Which type of pagination should be used.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type string\r\n\t\t * @default two_button\r\n\t\t */\r\n\t\t\"sPaginationType\": \"two_button\",\r\n\t\r\n\t\t/**\r\n\t\t * The state duration (for `stateSave`) in seconds.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t */\r\n\t\t\"iStateDuration\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * Array of callback functions for state saving. Each array element is an\r\n\t\t * object with the following parameters:\r\n\t\t * \r\n\t\t * - function:fn - function to call. Takes two parameters, oSettings\r\n\t\t * and the JSON string to save that has been thus far created. Returns\r\n\t\t * a JSON string to be inserted into a json object\r\n\t\t * (i.e. '\"param\": [ 0, 1, 2]')
\r\n\t\t * - string:sName - name of callback
\r\n\t\t *
\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoStateSave\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Array of callback functions for state loading. Each array element is an\r\n\t\t * object with the following parameters:\r\n\t\t * \r\n\t\t * - function:fn - function to call. Takes two parameters, oSettings\r\n\t\t * and the object stored. May return false to cancel state loading
\r\n\t\t * - string:sName - name of callback
\r\n\t\t *
\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoStateLoad\": [],\r\n\t\r\n\t\t/**\r\n\t\t * State that was saved. Useful for back reference\r\n\t\t * @type object\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"oSavedState\": null,\r\n\t\r\n\t\t/**\r\n\t\t * State that was loaded. Useful for back reference\r\n\t\t * @type object\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"oLoadedState\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Source url for AJAX data for the table.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sAjaxSource\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Property from a given object from which to read the table data from. This\r\n\t\t * can be an empty string (when not server-side processing), in which case\r\n\t\t * it is assumed an an array is given directly.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type string\r\n\t\t */\r\n\t\t\"sAjaxDataProp\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Note if draw should be blocked while getting data\r\n\t\t * @type boolean\r\n\t\t * @default true\r\n\t\t */\r\n\t\t\"bAjaxDataGet\": true,\r\n\t\r\n\t\t/**\r\n\t\t * The last jQuery XHR object that was used for server-side data gathering.\r\n\t\t * This can be used for working with the XHR information in one of the\r\n\t\t * callbacks\r\n\t\t * @type object\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"jqXHR\": null,\r\n\t\r\n\t\t/**\r\n\t\t * JSON returned from the server in the last Ajax request\r\n\t\t * @type object\r\n\t\t * @default undefined\r\n\t\t */\r\n\t\t\"json\": undefined,\r\n\t\r\n\t\t/**\r\n\t\t * Data submitted as part of the last Ajax request\r\n\t\t * @type object\r\n\t\t * @default undefined\r\n\t\t */\r\n\t\t\"oAjaxData\": undefined,\r\n\t\r\n\t\t/**\r\n\t\t * Function to get the server-side data.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type function\r\n\t\t */\r\n\t\t\"fnServerData\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Functions which are called prior to sending an Ajax request so extra\r\n\t\t * parameters can easily be sent to the server\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoServerParams\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Send the XHR HTTP method - GET or POST (could be PUT or DELETE if\r\n\t\t * required).\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type string\r\n\t\t */\r\n\t\t\"sServerMethod\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Format numbers for display.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type function\r\n\t\t */\r\n\t\t\"fnFormatNumber\": null,\r\n\t\r\n\t\t/**\r\n\t\t * List of options that can be used for the user selectable length menu.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aLengthMenu\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Counter for the draws that the table does. Also used as a tracker for\r\n\t\t * server-side processing\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t */\r\n\t\t\"iDraw\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * Indicate if a redraw is being done - useful for Ajax\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t */\r\n\t\t\"bDrawing\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Draw index (iDraw) of the last error when parsing the returned data\r\n\t\t * @type int\r\n\t\t * @default -1\r\n\t\t */\r\n\t\t\"iDrawError\": -1,\r\n\t\r\n\t\t/**\r\n\t\t * Paging display length\r\n\t\t * @type int\r\n\t\t * @default 10\r\n\t\t */\r\n\t\t\"_iDisplayLength\": 10,\r\n\t\r\n\t\t/**\r\n\t\t * Paging start point - aiDisplay index\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t */\r\n\t\t\"_iDisplayStart\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * Server-side processing - number of records in the result set\r\n\t\t * (i.e. before filtering), Use fnRecordsTotal rather than\r\n\t\t * this property to get the value of the number of records, regardless of\r\n\t\t * the server-side processing setting.\r\n\t\t * @type int\r\n\t\t * @default 0\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_iRecordsTotal\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * Server-side processing - number of records in the current display set\r\n\t\t * (i.e. after filtering). Use fnRecordsDisplay rather than\r\n\t\t * this property to get the value of the number of records, regardless of\r\n\t\t * the server-side processing setting.\r\n\t\t * @type boolean\r\n\t\t * @default 0\r\n\t\t * @private\r\n\t\t */\r\n\t\t\"_iRecordsDisplay\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * The classes to use for the table\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t */\r\n\t\t\"oClasses\": {},\r\n\t\r\n\t\t/**\r\n\t\t * Flag attached to the settings object so you can check in the draw\r\n\t\t * callback if filtering has been done in the draw. Deprecated in favour of\r\n\t\t * events.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t * @deprecated\r\n\t\t */\r\n\t\t\"bFiltered\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Flag attached to the settings object so you can check in the draw\r\n\t\t * callback if sorting has been done in the draw. Deprecated in favour of\r\n\t\t * events.\r\n\t\t * @type boolean\r\n\t\t * @default false\r\n\t\t * @deprecated\r\n\t\t */\r\n\t\t\"bSorted\": false,\r\n\t\r\n\t\t/**\r\n\t\t * Indicate that if multiple rows are in the header and there is more than\r\n\t\t * one unique cell per column, if the top one (true) or bottom one (false)\r\n\t\t * should be used for sorting / title by DataTables.\r\n\t\t * Note that this parameter will be set by the initialisation routine. To\r\n\t\t * set a default use {@link DataTable.defaults}.\r\n\t\t * @type boolean\r\n\t\t */\r\n\t\t\"bSortCellsTop\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Initialisation object that is used for the table\r\n\t\t * @type object\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"oInit\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Destroy callback functions - for plug-ins to attach themselves to the\r\n\t\t * destroy so they can clean up markup and events.\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aoDestroyCallback\": [],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Get the number of records in the current record set, before filtering\r\n\t\t * @type function\r\n\t\t */\r\n\t\t\"fnRecordsTotal\": function ()\r\n\t\t{\r\n\t\t\treturn _fnDataSource( this ) == 'ssp' ?\r\n\t\t\t\tthis._iRecordsTotal * 1 :\r\n\t\t\t\tthis.aiDisplayMaster.length;\r\n\t\t},\r\n\t\r\n\t\t/**\r\n\t\t * Get the number of records in the current record set, after filtering\r\n\t\t * @type function\r\n\t\t */\r\n\t\t\"fnRecordsDisplay\": function ()\r\n\t\t{\r\n\t\t\treturn _fnDataSource( this ) == 'ssp' ?\r\n\t\t\t\tthis._iRecordsDisplay * 1 :\r\n\t\t\t\tthis.aiDisplay.length;\r\n\t\t},\r\n\t\r\n\t\t/**\r\n\t\t * Get the display end point - aiDisplay index\r\n\t\t * @type function\r\n\t\t */\r\n\t\t\"fnDisplayEnd\": function ()\r\n\t\t{\r\n\t\t\tvar\r\n\t\t\t\tlen = this._iDisplayLength,\r\n\t\t\t\tstart = this._iDisplayStart,\r\n\t\t\t\tcalc = start + len,\r\n\t\t\t\trecords = this.aiDisplay.length,\r\n\t\t\t\tfeatures = this.oFeatures,\r\n\t\t\t\tpaginate = features.bPaginate;\r\n\t\r\n\t\t\tif ( features.bServerSide ) {\r\n\t\t\t\treturn paginate === false || len === -1 ?\r\n\t\t\t\t\tstart + records :\r\n\t\t\t\t\tMath.min( start+len, this._iRecordsDisplay );\r\n\t\t\t}\r\n\t\t\telse {\r\n\t\t\t\treturn ! paginate || calc>records || len===-1 ?\r\n\t\t\t\t\trecords :\r\n\t\t\t\t\tcalc;\r\n\t\t\t}\r\n\t\t},\r\n\t\r\n\t\t/**\r\n\t\t * The DataTables object for this table\r\n\t\t * @type object\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"oInstance\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Unique identifier for each instance of the DataTables object. If there\r\n\t\t * is an ID on the table node, then it takes that value, otherwise an\r\n\t\t * incrementing internal counter is used.\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"sInstance\": null,\r\n\t\r\n\t\t/**\r\n\t\t * tabindex attribute value that is added to DataTables control elements, allowing\r\n\t\t * keyboard navigation of the table and its controls.\r\n\t\t */\r\n\t\t\"iTabIndex\": 0,\r\n\t\r\n\t\t/**\r\n\t\t * DIV container for the footer scrolling table if scrolling\r\n\t\t */\r\n\t\t\"nScrollHead\": null,\r\n\t\r\n\t\t/**\r\n\t\t * DIV container for the footer scrolling table if scrolling\r\n\t\t */\r\n\t\t\"nScrollFoot\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Last applied sort\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t */\r\n\t\t\"aLastSort\": [],\r\n\t\r\n\t\t/**\r\n\t\t * Stored plug-in instances\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t */\r\n\t\t\"oPlugins\": {},\r\n\t\r\n\t\t/**\r\n\t\t * Function used to get a row's id from the row's data\r\n\t\t * @type function\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"rowIdFn\": null,\r\n\t\r\n\t\t/**\r\n\t\t * Data location where to store a row's id\r\n\t\t * @type string\r\n\t\t * @default null\r\n\t\t */\r\n\t\t\"rowId\": null\r\n\t};\r\n\r\n\t/**\r\n\t * Extension object for DataTables that is used to provide all extension\r\n\t * options.\r\n\t *\r\n\t * Note that the `DataTable.ext` object is available through\r\n\t * `jQuery.fn.dataTable.ext` where it may be accessed and manipulated. It is\r\n\t * also aliased to `jQuery.fn.dataTableExt` for historic reasons.\r\n\t * @namespace\r\n\t * @extends DataTable.models.ext\r\n\t */\r\n\t\r\n\t\r\n\t/**\r\n\t * DataTables extensions\r\n\t * \r\n\t * This namespace acts as a collection area for plug-ins that can be used to\r\n\t * extend DataTables capabilities. Indeed many of the build in methods\r\n\t * use this method to provide their own capabilities (sorting methods for\r\n\t * example).\r\n\t *\r\n\t * Note that this namespace is aliased to `jQuery.fn.dataTableExt` for legacy\r\n\t * reasons\r\n\t *\r\n\t * @namespace\r\n\t */\r\n\tDataTable.ext = _ext = {\r\n\t\t/**\r\n\t\t * Buttons. For use with the Buttons extension for DataTables. This is\r\n\t\t * defined here so other extensions can define buttons regardless of load\r\n\t\t * order. It is _not_ used by DataTables core.\r\n\t\t *\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t */\r\n\t\tbuttons: {},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Element class names\r\n\t\t *\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t */\r\n\t\tclasses: {},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * DataTables build type (expanded by the download builder)\r\n\t\t *\r\n\t\t * @type string\r\n\t\t */\r\n\t\tbuild:\"dt/dt-1.10.16\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Error reporting.\r\n\t\t * \r\n\t\t * How should DataTables report an error. Can take the value 'alert',\r\n\t\t * 'throw', 'none' or a function.\r\n\t\t *\r\n\t\t * @type string|function\r\n\t\t * @default alert\r\n\t\t */\r\n\t\terrMode: \"alert\",\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Feature plug-ins.\r\n\t\t * \r\n\t\t * This is an array of objects which describe the feature plug-ins that are\r\n\t\t * available to DataTables. These feature plug-ins are then available for\r\n\t\t * use through the `dom` initialisation option.\r\n\t\t * \r\n\t\t * Each feature plug-in is described by an object which must have the\r\n\t\t * following properties:\r\n\t\t * \r\n\t\t * * `fnInit` - function that is used to initialise the plug-in,\r\n\t\t * * `cFeature` - a character so the feature can be enabled by the `dom`\r\n\t\t * instillation option. This is case sensitive.\r\n\t\t *\r\n\t\t * The `fnInit` function has the following input parameters:\r\n\t\t *\r\n\t\t * 1. `{object}` DataTables settings object: see\r\n\t\t * {@link DataTable.models.oSettings}\r\n\t\t *\r\n\t\t * And the following return is expected:\r\n\t\t * \r\n\t\t * * {node|null} The element which contains your feature. Note that the\r\n\t\t * return may also be void if your plug-in does not require to inject any\r\n\t\t * DOM elements into DataTables control (`dom`) - for example this might\r\n\t\t * be useful when developing a plug-in which allows table control via\r\n\t\t * keyboard entry\r\n\t\t *\r\n\t\t * @type array\r\n\t\t *\r\n\t\t * @example\r\n\t\t * $.fn.dataTable.ext.features.push( {\r\n\t\t * \"fnInit\": function( oSettings ) {\r\n\t\t * return new TableTools( { \"oDTSettings\": oSettings } );\r\n\t\t * },\r\n\t\t * \"cFeature\": \"T\"\r\n\t\t * } );\r\n\t\t */\r\n\t\tfeature: [],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Row searching.\r\n\t\t * \r\n\t\t * This method of searching is complimentary to the default type based\r\n\t\t * searching, and a lot more comprehensive as it allows you complete control\r\n\t\t * over the searching logic. Each element in this array is a function\r\n\t\t * (parameters described below) that is called for every row in the table,\r\n\t\t * and your logic decides if it should be included in the searching data set\r\n\t\t * or not.\r\n\t\t *\r\n\t\t * Searching functions have the following input parameters:\r\n\t\t *\r\n\t\t * 1. `{object}` DataTables settings object: see\r\n\t\t * {@link DataTable.models.oSettings}\r\n\t\t * 2. `{array|object}` Data for the row to be processed (same as the\r\n\t\t * original format that was passed in as the data source, or an array\r\n\t\t * from a DOM data source\r\n\t\t * 3. `{int}` Row index ({@link DataTable.models.oSettings.aoData}), which\r\n\t\t * can be useful to retrieve the `TR` element if you need DOM interaction.\r\n\t\t *\r\n\t\t * And the following return is expected:\r\n\t\t *\r\n\t\t * * {boolean} Include the row in the searched result set (true) or not\r\n\t\t * (false)\r\n\t\t *\r\n\t\t * Note that as with the main search ability in DataTables, technically this\r\n\t\t * is \"filtering\", since it is subtractive. However, for consistency in\r\n\t\t * naming we call it searching here.\r\n\t\t *\r\n\t\t * @type array\r\n\t\t * @default []\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // The following example shows custom search being applied to the\r\n\t\t * // fourth column (i.e. the data[3] index) based on two input values\r\n\t\t * // from the end-user, matching the data in a certain range.\r\n\t\t * $.fn.dataTable.ext.search.push(\r\n\t\t * function( settings, data, dataIndex ) {\r\n\t\t * var min = document.getElementById('min').value * 1;\r\n\t\t * var max = document.getElementById('max').value * 1;\r\n\t\t * var version = data[3] == \"-\" ? 0 : data[3]*1;\r\n\t\t *\r\n\t\t * if ( min == \"\" && max == \"\" ) {\r\n\t\t * return true;\r\n\t\t * }\r\n\t\t * else if ( min == \"\" && version < max ) {\r\n\t\t * return true;\r\n\t\t * }\r\n\t\t * else if ( min < version && \"\" == max ) {\r\n\t\t * return true;\r\n\t\t * }\r\n\t\t * else if ( min < version && version < max ) {\r\n\t\t * return true;\r\n\t\t * }\r\n\t\t * return false;\r\n\t\t * }\r\n\t\t * );\r\n\t\t */\r\n\t\tsearch: [],\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Selector extensions\r\n\t\t *\r\n\t\t * The `selector` option can be used to extend the options available for the\r\n\t\t * selector modifier options (`selector-modifier` object data type) that\r\n\t\t * each of the three built in selector types offer (row, column and cell +\r\n\t\t * their plural counterparts). For example the Select extension uses this\r\n\t\t * mechanism to provide an option to select only rows, columns and cells\r\n\t\t * that have been marked as selected by the end user (`{selected: true}`),\r\n\t\t * which can be used in conjunction with the existing built in selector\r\n\t\t * options.\r\n\t\t *\r\n\t\t * Each property is an array to which functions can be pushed. The functions\r\n\t\t * take three attributes:\r\n\t\t *\r\n\t\t * * Settings object for the host table\r\n\t\t * * Options object (`selector-modifier` object type)\r\n\t\t * * Array of selected item indexes\r\n\t\t *\r\n\t\t * The return is an array of the resulting item indexes after the custom\r\n\t\t * selector has been applied.\r\n\t\t *\r\n\t\t * @type object\r\n\t\t */\r\n\t\tselector: {\r\n\t\t\tcell: [],\r\n\t\t\tcolumn: [],\r\n\t\t\trow: []\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Internal functions, exposed for used in plug-ins.\r\n\t\t * \r\n\t\t * Please note that you should not need to use the internal methods for\r\n\t\t * anything other than a plug-in (and even then, try to avoid if possible).\r\n\t\t * The internal function may change between releases.\r\n\t\t *\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t */\r\n\t\tinternal: {},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Legacy configuration options. Enable and disable legacy options that\r\n\t\t * are available in DataTables.\r\n\t\t *\r\n\t\t * @type object\r\n\t\t */\r\n\t\tlegacy: {\r\n\t\t\t/**\r\n\t\t\t * Enable / disable DataTables 1.9 compatible server-side processing\r\n\t\t\t * requests\r\n\t\t\t *\r\n\t\t\t * @type boolean\r\n\t\t\t * @default null\r\n\t\t\t */\r\n\t\t\tajax: null\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Pagination plug-in methods.\r\n\t\t * \r\n\t\t * Each entry in this object is a function and defines which buttons should\r\n\t\t * be shown by the pagination rendering method that is used for the table:\r\n\t\t * {@link DataTable.ext.renderer.pageButton}. The renderer addresses how the\r\n\t\t * buttons are displayed in the document, while the functions here tell it\r\n\t\t * what buttons to display. This is done by returning an array of button\r\n\t\t * descriptions (what each button will do).\r\n\t\t *\r\n\t\t * Pagination types (the four built in options and any additional plug-in\r\n\t\t * options defined here) can be used through the `paginationType`\r\n\t\t * initialisation parameter.\r\n\t\t *\r\n\t\t * The functions defined take two parameters:\r\n\t\t *\r\n\t\t * 1. `{int} page` The current page index\r\n\t\t * 2. `{int} pages` The number of pages in the table\r\n\t\t *\r\n\t\t * Each function is expected to return an array where each element of the\r\n\t\t * array can be one of:\r\n\t\t *\r\n\t\t * * `first` - Jump to first page when activated\r\n\t\t * * `last` - Jump to last page when activated\r\n\t\t * * `previous` - Show previous page when activated\r\n\t\t * * `next` - Show next page when activated\r\n\t\t * * `{int}` - Show page of the index given\r\n\t\t * * `{array}` - A nested array containing the above elements to add a\r\n\t\t * containing 'DIV' element (might be useful for styling).\r\n\t\t *\r\n\t\t * Note that DataTables v1.9- used this object slightly differently whereby\r\n\t\t * an object with two functions would be defined for each plug-in. That\r\n\t\t * ability is still supported by DataTables 1.10+ to provide backwards\r\n\t\t * compatibility, but this option of use is now decremented and no longer\r\n\t\t * documented in DataTables 1.10+.\r\n\t\t *\r\n\t\t * @type object\r\n\t\t * @default {}\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Show previous, next and current page buttons only\r\n\t\t * $.fn.dataTableExt.oPagination.current = function ( page, pages ) {\r\n\t\t * return [ 'previous', page, 'next' ];\r\n\t\t * };\r\n\t\t */\r\n\t\tpager: {},\r\n\t\r\n\t\r\n\t\trenderer: {\r\n\t\t\tpageButton: {},\r\n\t\t\theader: {}\r\n\t\t},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Ordering plug-ins - custom data source\r\n\t\t * \r\n\t\t * The extension options for ordering of data available here is complimentary\r\n\t\t * to the default type based ordering that DataTables typically uses. It\r\n\t\t * allows much greater control over the the data that is being used to\r\n\t\t * order a column, but is necessarily therefore more complex.\r\n\t\t * \r\n\t\t * This type of ordering is useful if you want to do ordering based on data\r\n\t\t * live from the DOM (for example the contents of an 'input' element) rather\r\n\t\t * than just the static string that DataTables knows of.\r\n\t\t * \r\n\t\t * The way these plug-ins work is that you create an array of the values you\r\n\t\t * wish to be ordering for the column in question and then return that\r\n\t\t * array. The data in the array much be in the index order of the rows in\r\n\t\t * the table (not the currently ordering order!). Which order data gathering\r\n\t\t * function is run here depends on the `dt-init columns.orderDataType`\r\n\t\t * parameter that is used for the column (if any).\r\n\t\t *\r\n\t\t * The functions defined take two parameters:\r\n\t\t *\r\n\t\t * 1. `{object}` DataTables settings object: see\r\n\t\t * {@link DataTable.models.oSettings}\r\n\t\t * 2. `{int}` Target column index\r\n\t\t *\r\n\t\t * Each function is expected to return an array:\r\n\t\t *\r\n\t\t * * `{array}` Data for the column to be ordering upon\r\n\t\t *\r\n\t\t * @type array\r\n\t\t *\r\n\t\t * @example\r\n\t\t * // Ordering using `input` node values\r\n\t\t * $.fn.dataTable.ext.order['dom-text'] = function ( settings, col )\r\n\t\t * {\r\n\t\t * return this.api().column( col, {order:'index'} ).nodes().map( function ( td, i ) {\r\n\t\t * return $('input', td).val();\r\n\t\t * } );\r\n\t\t * }\r\n\t\t */\r\n\t\torder: {},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Type based plug-ins.\r\n\t\t *\r\n\t\t * Each column in DataTables has a type assigned to it, either by automatic\r\n\t\t * detection or by direct assignment using the `type` option for the column.\r\n\t\t * The type of a column will effect how it is ordering and search (plug-ins\r\n\t\t * can also make use of the column type if required).\r\n\t\t *\r\n\t\t * @namespace\r\n\t\t */\r\n\t\ttype: {\r\n\t\t\t/**\r\n\t\t\t * Type detection functions.\r\n\t\t\t *\r\n\t\t\t * The functions defined in this object are used to automatically detect\r\n\t\t\t * a column's type, making initialisation of DataTables super easy, even\r\n\t\t\t * when complex data is in the table.\r\n\t\t\t *\r\n\t\t\t * The functions defined take two parameters:\r\n\t\t\t *\r\n\t\t * 1. `{*}` Data from the column cell to be analysed\r\n\t\t * 2. `{settings}` DataTables settings object. This can be used to\r\n\t\t * perform context specific type detection - for example detection\r\n\t\t * based on language settings such as using a comma for a decimal\r\n\t\t * place. Generally speaking the options from the settings will not\r\n\t\t * be required\r\n\t\t\t *\r\n\t\t\t * Each function is expected to return:\r\n\t\t\t *\r\n\t\t\t * * `{string|null}` Data type detected, or null if unknown (and thus\r\n\t\t\t * pass it on to the other type detection functions.\r\n\t\t\t *\r\n\t\t\t * @type array\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Currency type detection plug-in:\r\n\t\t\t * $.fn.dataTable.ext.type.detect.push(\r\n\t\t\t * function ( data, settings ) {\r\n\t\t\t * // Check the numeric part\r\n\t\t\t * if ( ! $.isNumeric( data.substring(1) ) ) {\r\n\t\t\t * return null;\r\n\t\t\t * }\r\n\t\t\t *\r\n\t\t\t * // Check prefixed by currency\r\n\t\t\t * if ( data.charAt(0) == '$' || data.charAt(0) == '£' ) {\r\n\t\t\t * return 'currency';\r\n\t\t\t * }\r\n\t\t\t * return null;\r\n\t\t\t * }\r\n\t\t\t * );\r\n\t\t\t */\r\n\t\t\tdetect: [],\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Type based search formatting.\r\n\t\t\t *\r\n\t\t\t * The type based searching functions can be used to pre-format the\r\n\t\t\t * data to be search on. For example, it can be used to strip HTML\r\n\t\t\t * tags or to de-format telephone numbers for numeric only searching.\r\n\t\t\t *\r\n\t\t\t * Note that is a search is not defined for a column of a given type,\r\n\t\t\t * no search formatting will be performed.\r\n\t\t\t * \r\n\t\t\t * Pre-processing of searching data plug-ins - When you assign the sType\r\n\t\t\t * for a column (or have it automatically detected for you by DataTables\r\n\t\t\t * or a type detection plug-in), you will typically be using this for\r\n\t\t\t * custom sorting, but it can also be used to provide custom searching\r\n\t\t\t * by allowing you to pre-processing the data and returning the data in\r\n\t\t\t * the format that should be searched upon. This is done by adding\r\n\t\t\t * functions this object with a parameter name which matches the sType\r\n\t\t\t * for that target column. This is the corollary of afnSortData\r\n\t\t\t * for searching data.\r\n\t\t\t *\r\n\t\t\t * The functions defined take a single parameter:\r\n\t\t\t *\r\n\t\t * 1. `{*}` Data from the column cell to be prepared for searching\r\n\t\t\t *\r\n\t\t\t * Each function is expected to return:\r\n\t\t\t *\r\n\t\t\t * * `{string|null}` Formatted string that will be used for the searching.\r\n\t\t\t *\r\n\t\t\t * @type object\r\n\t\t\t * @default {}\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * $.fn.dataTable.ext.type.search['title-numeric'] = function ( d ) {\r\n\t\t\t * return d.replace(/\\n/g,\" \").replace( /<.*?>/g, \"\" );\r\n\t\t\t * }\r\n\t\t\t */\r\n\t\t\tsearch: {},\r\n\t\r\n\t\r\n\t\t\t/**\r\n\t\t\t * Type based ordering.\r\n\t\t\t *\r\n\t\t\t * The column type tells DataTables what ordering to apply to the table\r\n\t\t\t * when a column is sorted upon. The order for each type that is defined,\r\n\t\t\t * is defined by the functions available in this object.\r\n\t\t\t *\r\n\t\t\t * Each ordering option can be described by three properties added to\r\n\t\t\t * this object:\r\n\t\t\t *\r\n\t\t\t * * `{type}-pre` - Pre-formatting function\r\n\t\t\t * * `{type}-asc` - Ascending order function\r\n\t\t\t * * `{type}-desc` - Descending order function\r\n\t\t\t *\r\n\t\t\t * All three can be used together, only `{type}-pre` or only\r\n\t\t\t * `{type}-asc` and `{type}-desc` together. It is generally recommended\r\n\t\t\t * that only `{type}-pre` is used, as this provides the optimal\r\n\t\t\t * implementation in terms of speed, although the others are provided\r\n\t\t\t * for compatibility with existing Javascript sort functions.\r\n\t\t\t *\r\n\t\t\t * `{type}-pre`: Functions defined take a single parameter:\r\n\t\t\t *\r\n\t\t * 1. `{*}` Data from the column cell to be prepared for ordering\r\n\t\t\t *\r\n\t\t\t * And return:\r\n\t\t\t *\r\n\t\t\t * * `{*}` Data to be sorted upon\r\n\t\t\t *\r\n\t\t\t * `{type}-asc` and `{type}-desc`: Functions are typical Javascript sort\r\n\t\t\t * functions, taking two parameters:\r\n\t\t\t *\r\n\t\t * 1. `{*}` Data to compare to the second parameter\r\n\t\t * 2. `{*}` Data to compare to the first parameter\r\n\t\t\t *\r\n\t\t\t * And returning:\r\n\t\t\t *\r\n\t\t\t * * `{*}` Ordering match: <0 if first parameter should be sorted lower\r\n\t\t\t * than the second parameter, ===0 if the two parameters are equal and\r\n\t\t\t * >0 if the first parameter should be sorted height than the second\r\n\t\t\t * parameter.\r\n\t\t\t * \r\n\t\t\t * @type object\r\n\t\t\t * @default {}\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Numeric ordering of formatted numbers with a pre-formatter\r\n\t\t\t * $.extend( $.fn.dataTable.ext.type.order, {\r\n\t\t\t * \"string-pre\": function(x) {\r\n\t\t\t * a = (a === \"-\" || a === \"\") ? 0 : a.replace( /[^\\d\\-\\.]/g, \"\" );\r\n\t\t\t * return parseFloat( a );\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t *\r\n\t\t\t * @example\r\n\t\t\t * // Case-sensitive string ordering, with no pre-formatting method\r\n\t\t\t * $.extend( $.fn.dataTable.ext.order, {\r\n\t\t\t * \"string-case-asc\": function(x,y) {\r\n\t\t\t * return ((x < y) ? -1 : ((x > y) ? 1 : 0));\r\n\t\t\t * },\r\n\t\t\t * \"string-case-desc\": function(x,y) {\r\n\t\t\t * return ((x < y) ? 1 : ((x > y) ? -1 : 0));\r\n\t\t\t * }\r\n\t\t\t * } );\r\n\t\t\t */\r\n\t\t\torder: {}\r\n\t\t},\r\n\t\r\n\t\t/**\r\n\t\t * Unique DataTables instance counter\r\n\t\t *\r\n\t\t * @type int\r\n\t\t * @private\r\n\t\t */\r\n\t\t_unique: 0,\r\n\t\r\n\t\r\n\t\t//\r\n\t\t// Depreciated\r\n\t\t// The following properties are retained for backwards compatiblity only.\r\n\t\t// The should not be used in new projects and will be removed in a future\r\n\t\t// version\r\n\t\t//\r\n\t\r\n\t\t/**\r\n\t\t * Version check function.\r\n\t\t * @type function\r\n\t\t * @depreciated Since 1.10\r\n\t\t */\r\n\t\tfnVersionCheck: DataTable.fnVersionCheck,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Index for what 'this' index API functions should use\r\n\t\t * @type int\r\n\t\t * @deprecated Since v1.10\r\n\t\t */\r\n\t\tiApiIndex: 0,\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * jQuery UI class container\r\n\t\t * @type object\r\n\t\t * @deprecated Since v1.10\r\n\t\t */\r\n\t\toJUIClasses: {},\r\n\t\r\n\t\r\n\t\t/**\r\n\t\t * Software version\r\n\t\t * @type string\r\n\t\t * @deprecated Since v1.10\r\n\t\t */\r\n\t\tsVersion: DataTable.version\r\n\t};\r\n\t\r\n\t\r\n\t//\r\n\t// Backwards compatibility. Alias to pre 1.10 Hungarian notation counter parts\r\n\t//\r\n\t$.extend( _ext, {\r\n\t\tafnFiltering: _ext.search,\r\n\t\taTypes: _ext.type.detect,\r\n\t\tofnSearch: _ext.type.search,\r\n\t\toSort: _ext.type.order,\r\n\t\tafnSortData: _ext.order,\r\n\t\taoFeatures: _ext.feature,\r\n\t\toApi: _ext.internal,\r\n\t\toStdClasses: _ext.classes,\r\n\t\toPagination: _ext.pager\r\n\t} );\r\n\t\r\n\t\r\n\t$.extend( DataTable.ext.classes, {\r\n\t\t\"sTable\": \"dataTable\",\r\n\t\t\"sNoFooter\": \"no-footer\",\r\n\t\r\n\t\t/* Paging buttons */\r\n\t\t\"sPageButton\": \"paginate_button\",\r\n\t\t\"sPageButtonActive\": \"current\",\r\n\t\t\"sPageButtonDisabled\": \"disabled\",\r\n\t\r\n\t\t/* Striping classes */\r\n\t\t\"sStripeOdd\": \"odd\",\r\n\t\t\"sStripeEven\": \"even\",\r\n\t\r\n\t\t/* Empty row */\r\n\t\t\"sRowEmpty\": \"dataTables_empty\",\r\n\t\r\n\t\t/* Features */\r\n\t\t\"sWrapper\": \"dataTables_wrapper\",\r\n\t\t\"sFilter\": \"dataTables_filter\",\r\n\t\t\"sInfo\": \"dataTables_info\",\r\n\t\t\"sPaging\": \"dataTables_paginate paging_\", /* Note that the type is postfixed */\r\n\t\t\"sLength\": \"dataTables_length\",\r\n\t\t\"sProcessing\": \"dataTables_processing\",\r\n\t\r\n\t\t/* Sorting */\r\n\t\t\"sSortAsc\": \"sorting_asc\",\r\n\t\t\"sSortDesc\": \"sorting_desc\",\r\n\t\t\"sSortable\": \"sorting\", /* Sortable in both directions */\r\n\t\t\"sSortableAsc\": \"sorting_asc_disabled\",\r\n\t\t\"sSortableDesc\": \"sorting_desc_disabled\",\r\n\t\t\"sSortableNone\": \"sorting_disabled\",\r\n\t\t\"sSortColumn\": \"sorting_\", /* Note that an int is postfixed for the sorting order */\r\n\t\r\n\t\t/* Filtering */\r\n\t\t\"sFilterInput\": \"\",\r\n\t\r\n\t\t/* Page length */\r\n\t\t\"sLengthSelect\": \"\",\r\n\t\r\n\t\t/* Scrolling */\r\n\t\t\"sScrollWrapper\": \"dataTables_scroll\",\r\n\t\t\"sScrollHead\": \"dataTables_scrollHead\",\r\n\t\t\"sScrollHeadInner\": \"dataTables_scrollHeadInner\",\r\n\t\t\"sScrollBody\": \"dataTables_scrollBody\",\r\n\t\t\"sScrollFoot\": \"dataTables_scrollFoot\",\r\n\t\t\"sScrollFootInner\": \"dataTables_scrollFootInner\",\r\n\t\r\n\t\t/* Misc */\r\n\t\t\"sHeaderTH\": \"\",\r\n\t\t\"sFooterTH\": \"\",\r\n\t\r\n\t\t// Deprecated\r\n\t\t\"sSortJUIAsc\": \"\",\r\n\t\t\"sSortJUIDesc\": \"\",\r\n\t\t\"sSortJUI\": \"\",\r\n\t\t\"sSortJUIAscAllowed\": \"\",\r\n\t\t\"sSortJUIDescAllowed\": \"\",\r\n\t\t\"sSortJUIWrapper\": \"\",\r\n\t\t\"sSortIcon\": \"\",\r\n\t\t\"sJUIHeader\": \"\",\r\n\t\t\"sJUIFooter\": \"\"\r\n\t} );\r\n\t\r\n\t\r\n\tvar extPagination = DataTable.ext.pager;\r\n\t\r\n\tfunction _numbers ( page, pages ) {\r\n\t\tvar\r\n\t\t\tnumbers = [],\r\n\t\t\tbuttons = extPagination.numbers_length,\r\n\t\t\thalf = Math.floor( buttons / 2 ),\r\n\t\t\ti = 1;\r\n\t\r\n\t\tif ( pages <= buttons ) {\r\n\t\t\tnumbers = _range( 0, pages );\r\n\t\t}\r\n\t\telse if ( page <= half ) {\r\n\t\t\tnumbers = _range( 0, buttons-2 );\r\n\t\t\tnumbers.push( 'ellipsis' );\r\n\t\t\tnumbers.push( pages-1 );\r\n\t\t}\r\n\t\telse if ( page >= pages - 1 - half ) {\r\n\t\t\tnumbers = _range( pages-(buttons-2), pages );\r\n\t\t\tnumbers.splice( 0, 0, 'ellipsis' ); // no unshift in ie6\r\n\t\t\tnumbers.splice( 0, 0, 0 );\r\n\t\t}\r\n\t\telse {\r\n\t\t\tnumbers = _range( page-half+2, page+half-1 );\r\n\t\t\tnumbers.push( 'ellipsis' );\r\n\t\t\tnumbers.push( pages-1 );\r\n\t\t\tnumbers.splice( 0, 0, 'ellipsis' );\r\n\t\t\tnumbers.splice( 0, 0, 0 );\r\n\t\t}\r\n\t\r\n\t\tnumbers.DT_el = 'span';\r\n\t\treturn numbers;\r\n\t}\r\n\t\r\n\t\r\n\t$.extend( extPagination, {\r\n\t\tsimple: function ( page, pages ) {\r\n\t\t\treturn [ 'previous', 'next' ];\r\n\t\t},\r\n\t\r\n\t\tfull: function ( page, pages ) {\r\n\t\t\treturn [ 'first', 'previous', 'next', 'last' ];\r\n\t\t},\r\n\t\r\n\t\tnumbers: function ( page, pages ) {\r\n\t\t\treturn [ _numbers(page, pages) ];\r\n\t\t},\r\n\t\r\n\t\tsimple_numbers: function ( page, pages ) {\r\n\t\t\treturn [ 'previous', _numbers(page, pages), 'next' ];\r\n\t\t},\r\n\t\r\n\t\tfull_numbers: function ( page, pages ) {\r\n\t\t\treturn [ 'first', 'previous', _numbers(page, pages), 'next', 'last' ];\r\n\t\t},\r\n\t\t\r\n\t\tfirst_last_numbers: function (page, pages) {\r\n\t \t\treturn ['first', _numbers(page, pages), 'last'];\r\n\t \t},\r\n\t\r\n\t\t// For testing and plug-ins to use\r\n\t\t_numbers: _numbers,\r\n\t\r\n\t\t// Number of number buttons (including ellipsis) to show. _Must be odd!_\r\n\t\tnumbers_length: 7\r\n\t} );\r\n\t\r\n\t\r\n\t$.extend( true, DataTable.ext.renderer, {\r\n\t\tpageButton: {\r\n\t\t\t_: function ( settings, host, idx, buttons, page, pages ) {\r\n\t\t\t\tvar classes = settings.oClasses;\r\n\t\t\t\tvar lang = settings.oLanguage.oPaginate;\r\n\t\t\t\tvar aria = settings.oLanguage.oAria.paginate || {};\r\n\t\t\t\tvar btnDisplay, btnClass, counter=0;\r\n\t\r\n\t\t\t\tvar attach = function( container, buttons ) {\r\n\t\t\t\t\tvar i, ien, node, button;\r\n\t\t\t\t\tvar clickHandler = function ( e ) {\r\n\t\t\t\t\t\t_fnPageChange( settings, e.data.action, true );\r\n\t\t\t\t\t};\r\n\t\r\n\t\t\t\t\tfor ( i=0, ien=buttons.length ; i' )\r\n\t\t\t\t\t\t\t\t.appendTo( container );\r\n\t\t\t\t\t\t\tattach( inner, button );\r\n\t\t\t\t\t\t}\r\n\t\t\t\t\t\telse {\r\n\t\t\t\t\t\t\tbtnDisplay = null;\r\n\t\t\t\t\t\t\tbtnClass = '';\r\n\t\r\n\t\t\t\t\t\t\tswitch ( button ) {\r\n\t\t\t\t\t\t\t\tcase 'ellipsis':\r\n\t\t\t\t\t\t\t\t\tcontainer.append('…');\r\n\t\t\t\t\t\t\t\t\tbreak;\r\n\t\r\n\t\t\t\t\t\t\t\tcase 'first':\r\n\t\t\t\t\t\t\t\t\tbtnDisplay = lang.sFirst;\r\n\t\t\t\t\t\t\t\t\tbtnClass = button + (page > 0 ?\r\n\t\t\t\t\t\t\t\t\t\t'' : ' '+classes.sPageButtonDisabled);\r\n\t\t\t\t\t\t\t\t\tbreak;\r\n\t\r\n\t\t\t\t\t\t\t\tcase 'previous':\r\n\t\t\t\t\t\t\t\t\tbtnDisplay = lang.sPrevious;\r\n\t\t\t\t\t\t\t\t\tbtnClass = button + (page > 0 ?\r\n\t\t\t\t\t\t\t\t\t\t'' : ' '+classes.sPageButtonDisabled);\r\n\t\t\t\t\t\t\t\t\tbreak;\r\n\t\r\n\t\t\t\t\t\t\t\tcase 'next':\r\n\t\t\t\t\t\t\t\t\tbtnDisplay = lang.sNext;\r\n\t\t\t\t\t\t\t\t\tbtnClass = button + (page < pages-1 ?\r\n\t\t\t\t\t\t\t\t\t\t'' : ' '+classes.sPageButtonDisabled);\r\n\t\t\t\t\t\t\t\t\tbreak;\r\n\t\r\n\t\t\t\t\t\t\t\tcase 'last':\r\n\t\t\t\t\t\t\t\t\tbtnDisplay = lang.sLast;\r\n\t\t\t\t\t\t\t\t\tbtnClass = button + (page < pages-1 ?\r\n\t\t\t\t\t\t\t\t\t\t'' : ' '+classes.sPageButtonDisabled);\r\n\t\t\t\t\t\t\t\t\tbreak;\r\n\t\r\n\t\t\t\t\t\t\t\tdefault:\r\n\t\t\t\t\t\t\t\t\tbtnDisplay = button + 1;\r\n\t\t\t\t\t\t\t\t\tbtnClass = page === button ?\r\n\t\t\t\t\t\t\t\t\t\tclasses.sPageButtonActive : '';\r\n\t\t\t\t\t\t\t\t\tbreak;\r\n\t\t\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\t\t\tif ( btnDisplay !== null ) {\r\n\t\t\t\t\t\t\t\tnode = $('', {\r\n\t\t\t\t\t\t\t\t\t\t'class': classes.sPageButton+' '+btnClass,\r\n\t\t\t\t\t\t\t\t\t\t'aria-controls': settings.sTableId,\r\n\t\t\t\t\t\t\t\t\t\t'aria-label': aria[ button ],\r\n\t\t\t\t\t\t\t\t\t\t'data-dt-idx': counter,\r\n\t\t\t\t\t\t\t\t\t\t'tabindex': settings.iTabIndex,\r\n\t\t\t\t\t\t\t\t\t\t'id': idx === 0 && typeof button === 'string' ?\r\n\t\t\t\t\t\t\t\t\t\t\tsettings.sTableId +'_'+ button :\r\n\t\t\t\t\t\t\t\t\t\t\tnull\r\n\t\t\t\t\t\t\t\t\t} )\r\n\t\t\t\t\t\t\t\t\t.html( btnDisplay )\r\n\t\t\t\t\t\t\t\t\t.appendTo( container );\r\n\t\r\n\t\t\t\t\t\t\t\t_fnBindAction(\r\n\t\t\t\t\t\t\t\t\tnode, {action: button}, clickHandler\r\n\t\t\t\t\t\t\t\t);\r\n\t\r\n\t\t\t\t\t\t\t\tcounter++;\r\n\t\t\t\t\t\t\t}\r\n\t\t\t\t\t\t}\r\n\t\t\t\t\t}\r\n\t\t\t\t};\r\n\t\r\n\t\t\t\t// IE9 throws an 'unknown error' if document.activeElement is used\r\n\t\t\t\t// inside an iframe or frame. Try / catch the error. Not good for\r\n\t\t\t\t// accessibility, but neither are frames.\r\n\t\t\t\tvar activeEl;\r\n\t\r\n\t\t\t\ttry {\r\n\t\t\t\t\t// Because this approach is destroying and recreating the paging\r\n\t\t\t\t\t// elements, focus is lost on the select button which is bad for\r\n\t\t\t\t\t// accessibility. So we want to restore focus once the draw has\r\n\t\t\t\t\t// completed\r\n\t\t\t\t\tactiveEl = $(host).find(document.activeElement).data('dt-idx');\r\n\t\t\t\t}\r\n\t\t\t\tcatch (e) {}\r\n\t\r\n\t\t\t\tattach( $(host).empty(), buttons );\r\n\t\r\n\t\t\t\tif ( activeEl !== undefined ) {\r\n\t\t\t\t\t$(host).find( '[data-dt-idx='+activeEl+']' ).focus();\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t}\r\n\t} );\r\n\t\r\n\t\r\n\t\r\n\t// Built in type detection. See model.ext.aTypes for information about\r\n\t// what is required from this methods.\r\n\t$.extend( DataTable.ext.type.detect, [\r\n\t\t// Plain numbers - first since V8 detects some plain numbers as dates\r\n\t\t// e.g. Date.parse('55') (but not all, e.g. Date.parse('22')...).\r\n\t\tfunction ( d, settings )\r\n\t\t{\r\n\t\t\tvar decimal = settings.oLanguage.sDecimal;\r\n\t\t\treturn _isNumber( d, decimal ) ? 'num'+decimal : null;\r\n\t\t},\r\n\t\r\n\t\t// Dates (only those recognised by the browser's Date.parse)\r\n\t\tfunction ( d, settings )\r\n\t\t{\r\n\t\t\t// V8 tries _very_ hard to make a string passed into `Date.parse()`\r\n\t\t\t// valid, so we need to use a regex to restrict date formats. Use a\r\n\t\t\t// plug-in for anything other than ISO8601 style strings\r\n\t\t\tif ( d && !(d instanceof Date) && ! _re_date.test(d) ) {\r\n\t\t\t\treturn null;\r\n\t\t\t}\r\n\t\t\tvar parsed = Date.parse(d);\r\n\t\t\treturn (parsed !== null && !isNaN(parsed)) || _empty(d) ? 'date' : null;\r\n\t\t},\r\n\t\r\n\t\t// Formatted numbers\r\n\t\tfunction ( d, settings )\r\n\t\t{\r\n\t\t\tvar decimal = settings.oLanguage.sDecimal;\r\n\t\t\treturn _isNumber( d, decimal, true ) ? 'num-fmt'+decimal : null;\r\n\t\t},\r\n\t\r\n\t\t// HTML numeric\r\n\t\tfunction ( d, settings )\r\n\t\t{\r\n\t\t\tvar decimal = settings.oLanguage.sDecimal;\r\n\t\t\treturn _htmlNumeric( d, decimal ) ? 'html-num'+decimal : null;\r\n\t\t},\r\n\t\r\n\t\t// HTML numeric, formatted\r\n\t\tfunction ( d, settings )\r\n\t\t{\r\n\t\t\tvar decimal = settings.oLanguage.sDecimal;\r\n\t\t\treturn _htmlNumeric( d, decimal, true ) ? 'html-num-fmt'+decimal : null;\r\n\t\t},\r\n\t\r\n\t\t// HTML (this is strict checking - there must be html)\r\n\t\tfunction ( d, settings )\r\n\t\t{\r\n\t\t\treturn _empty( d ) || (typeof d === 'string' && d.indexOf('<') !== -1) ?\r\n\t\t\t\t'html' : null;\r\n\t\t}\r\n\t] );\r\n\t\r\n\t\r\n\t\r\n\t// Filter formatting functions. See model.ext.ofnSearch for information about\r\n\t// what is required from these methods.\r\n\t// \r\n\t// Note that additional search methods are added for the html numbers and\r\n\t// html formatted numbers by `_addNumericSort()` when we know what the decimal\r\n\t// place is\r\n\t\r\n\t\r\n\t$.extend( DataTable.ext.type.search, {\r\n\t\thtml: function ( data ) {\r\n\t\t\treturn _empty(data) ?\r\n\t\t\t\tdata :\r\n\t\t\t\ttypeof data === 'string' ?\r\n\t\t\t\t\tdata\r\n\t\t\t\t\t\t.replace( _re_new_lines, \" \" )\r\n\t\t\t\t\t\t.replace( _re_html, \"\" ) :\r\n\t\t\t\t\t'';\r\n\t\t},\r\n\t\r\n\t\tstring: function ( data ) {\r\n\t\t\treturn _empty(data) ?\r\n\t\t\t\tdata :\r\n\t\t\t\ttypeof data === 'string' ?\r\n\t\t\t\t\tdata.replace( _re_new_lines, \" \" ) :\r\n\t\t\t\t\tdata;\r\n\t\t}\r\n\t} );\r\n\t\r\n\t\r\n\t\r\n\tvar __numericReplace = function ( d, decimalPlace, re1, re2 ) {\r\n\t\tif ( d !== 0 && (!d || d === '-') ) {\r\n\t\t\treturn -Infinity;\r\n\t\t}\r\n\t\r\n\t\t// If a decimal place other than `.` is used, it needs to be given to the\r\n\t\t// function so we can detect it and replace with a `.` which is the only\r\n\t\t// decimal place Javascript recognises - it is not locale aware.\r\n\t\tif ( decimalPlace ) {\r\n\t\t\td = _numToDecimal( d, decimalPlace );\r\n\t\t}\r\n\t\r\n\t\tif ( d.replace ) {\r\n\t\t\tif ( re1 ) {\r\n\t\t\t\td = d.replace( re1, '' );\r\n\t\t\t}\r\n\t\r\n\t\t\tif ( re2 ) {\r\n\t\t\t\td = d.replace( re2, '' );\r\n\t\t\t}\r\n\t\t}\r\n\t\r\n\t\treturn d * 1;\r\n\t};\r\n\t\r\n\t\r\n\t// Add the numeric 'deformatting' functions for sorting and search. This is done\r\n\t// in a function to provide an easy ability for the language options to add\r\n\t// additional methods if a non-period decimal place is used.\r\n\tfunction _addNumericSort ( decimalPlace ) {\r\n\t\t$.each(\r\n\t\t\t{\r\n\t\t\t\t// Plain numbers\r\n\t\t\t\t\"num\": function ( d ) {\r\n\t\t\t\t\treturn __numericReplace( d, decimalPlace );\r\n\t\t\t\t},\r\n\t\r\n\t\t\t\t// Formatted numbers\r\n\t\t\t\t\"num-fmt\": function ( d ) {\r\n\t\t\t\t\treturn __numericReplace( d, decimalPlace, _re_formatted_numeric );\r\n\t\t\t\t},\r\n\t\r\n\t\t\t\t// HTML numeric\r\n\t\t\t\t\"html-num\": function ( d ) {\r\n\t\t\t\t\treturn __numericReplace( d, decimalPlace, _re_html );\r\n\t\t\t\t},\r\n\t\r\n\t\t\t\t// HTML numeric, formatted\r\n\t\t\t\t\"html-num-fmt\": function ( d ) {\r\n\t\t\t\t\treturn __numericReplace( d, decimalPlace, _re_html, _re_formatted_numeric );\r\n\t\t\t\t}\r\n\t\t\t},\r\n\t\t\tfunction ( key, fn ) {\r\n\t\t\t\t// Add the ordering method\r\n\t\t\t\t_ext.type.order[ key+decimalPlace+'-pre' ] = fn;\r\n\t\r\n\t\t\t\t// For HTML types add a search formatter that will strip the HTML\r\n\t\t\t\tif ( key.match(/^html\\-/) ) {\r\n\t\t\t\t\t_ext.type.search[ key+decimalPlace ] = _ext.type.search.html;\r\n\t\t\t\t}\r\n\t\t\t}\r\n\t\t);\r\n\t}\r\n\t\r\n\t\r\n\t// Default sort methods\r\n\t$.extend( _ext.type.order, {\r\n\t\t// Dates\r\n\t\t\"date-pre\": function ( d ) {\r\n\t\t\treturn Date.parse( d ) || -Infinity;\r\n\t\t},\r\n\t\r\n\t\t// html\r\n\t\t\"html-pre\": function ( a ) {\r\n\t\t\treturn _empty(a) ?\r\n\t\t\t\t'' :\r\n\t\t\t\ta.replace ?\r\n\t\t\t\t\ta.replace( /<.*?>/g, \"\" ).toLowerCase() :\r\n\t\t\t\t\ta+'';\r\n\t\t},\r\n\t\r\n\t\t// string\r\n\t\t\"string-pre\": function ( a ) {\r\n\t\t\t// This is a little complex, but faster than always calling toString,\r\n\t\t\t// http://jsperf.com/tostring-v-check\r\n\t\t\treturn _empty(a) ?\r\n\t\t\t\t'' :\r\n\t\t\t\ttypeof a === 'string' ?\r\n\t\t\t\t\ta.toLowerCase() :\r\n\t\t\t\t\t! a.toString ?\r\n\t\t\t\t\t\t'' :\r\n\t\t\t\t\t\ta.toString();\r\n\t\t},\r\n\t\r\n\t\t// string-asc and -desc are retained only for compatibility with the old\r\n\t\t// sort methods\r\n\t\t\"string-asc\": function ( x, y ) {\r\n\t\t\treturn ((x < y) ? -1 : ((x > y) ? 1 : 0));\r\n\t\t},\r\n\t\r\n\t\t\"string-desc\": function ( x, y ) {\r\n\t\t\treturn ((x < y) ? 1 : ((x > y) ? -1 : 0));\r\n\t\t}\r\n\t} );\r\n\t\r\n\t\r\n\t// Numeric sorting types - order doesn't matter here\r\n\t_addNumericSort( '' );\r\n\t\r\n\t\r\n\t$.extend( true, DataTable.ext.renderer, {\r\n\t\theader: {\r\n\t\t\t_: function ( settings, cell, column, classes ) {\r\n\t\t\t\t// No additional mark-up required\r\n\t\t\t\t// Attach a sort listener to update on sort - note that using the\r\n\t\t\t\t// `DT` namespace will allow the event to be removed automatically\r\n\t\t\t\t// on destroy, while the `dt` namespaced event is the one we are\r\n\t\t\t\t// listening for\r\n\t\t\t\t$(settings.nTable).on( 'order.dt.DT', function ( e, ctx, sorting, columns ) {\r\n\t\t\t\t\tif ( settings !== ctx ) { // need to check this this is the host\r\n\t\t\t\t\t\treturn; // table, not a nested one\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\tvar colIdx = column.idx;\r\n\t\r\n\t\t\t\t\tcell\r\n\t\t\t\t\t\t.removeClass(\r\n\t\t\t\t\t\t\tcolumn.sSortingClass +' '+\r\n\t\t\t\t\t\t\tclasses.sSortAsc +' '+\r\n\t\t\t\t\t\t\tclasses.sSortDesc\r\n\t\t\t\t\t\t)\r\n\t\t\t\t\t\t.addClass( columns[ colIdx ] == 'asc' ?\r\n\t\t\t\t\t\t\tclasses.sSortAsc : columns[ colIdx ] == 'desc' ?\r\n\t\t\t\t\t\t\t\tclasses.sSortDesc :\r\n\t\t\t\t\t\t\t\tcolumn.sSortingClass\r\n\t\t\t\t\t\t);\r\n\t\t\t\t} );\r\n\t\t\t},\r\n\t\r\n\t\t\tjqueryui: function ( settings, cell, column, classes ) {\r\n\t\t\t\t$('')\r\n\t\t\t\t\t.addClass( classes.sSortJUIWrapper )\r\n\t\t\t\t\t.append( cell.contents() )\r\n\t\t\t\t\t.append( $('')\r\n\t\t\t\t\t\t.addClass( classes.sSortIcon+' '+column.sSortingClassJUI )\r\n\t\t\t\t\t)\r\n\t\t\t\t\t.appendTo( cell );\r\n\t\r\n\t\t\t\t// Attach a sort listener to update on sort\r\n\t\t\t\t$(settings.nTable).on( 'order.dt.DT', function ( e, ctx, sorting, columns ) {\r\n\t\t\t\t\tif ( settings !== ctx ) {\r\n\t\t\t\t\t\treturn;\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\tvar colIdx = column.idx;\r\n\t\r\n\t\t\t\t\tcell\r\n\t\t\t\t\t\t.removeClass( classes.sSortAsc +\" \"+classes.sSortDesc )\r\n\t\t\t\t\t\t.addClass( columns[ colIdx ] == 'asc' ?\r\n\t\t\t\t\t\t\tclasses.sSortAsc : columns[ colIdx ] == 'desc' ?\r\n\t\t\t\t\t\t\t\tclasses.sSortDesc :\r\n\t\t\t\t\t\t\t\tcolumn.sSortingClass\r\n\t\t\t\t\t\t);\r\n\t\r\n\t\t\t\t\tcell\r\n\t\t\t\t\t\t.find( 'span.'+classes.sSortIcon )\r\n\t\t\t\t\t\t.removeClass(\r\n\t\t\t\t\t\t\tclasses.sSortJUIAsc +\" \"+\r\n\t\t\t\t\t\t\tclasses.sSortJUIDesc +\" \"+\r\n\t\t\t\t\t\t\tclasses.sSortJUI +\" \"+\r\n\t\t\t\t\t\t\tclasses.sSortJUIAscAllowed +\" \"+\r\n\t\t\t\t\t\t\tclasses.sSortJUIDescAllowed\r\n\t\t\t\t\t\t)\r\n\t\t\t\t\t\t.addClass( columns[ colIdx ] == 'asc' ?\r\n\t\t\t\t\t\t\tclasses.sSortJUIAsc : columns[ colIdx ] == 'desc' ?\r\n\t\t\t\t\t\t\t\tclasses.sSortJUIDesc :\r\n\t\t\t\t\t\t\t\tcolumn.sSortingClassJUI\r\n\t\t\t\t\t\t);\r\n\t\t\t\t} );\r\n\t\t\t}\r\n\t\t}\r\n\t} );\r\n\t\r\n\t/*\r\n\t * Public helper functions. These aren't used internally by DataTables, or\r\n\t * called by any of the options passed into DataTables, but they can be used\r\n\t * externally by developers working with DataTables. They are helper functions\r\n\t * to make working with DataTables a little bit easier.\r\n\t */\r\n\t\r\n\tvar __htmlEscapeEntities = function ( d ) {\r\n\t\treturn typeof d === 'string' ?\r\n\t\t\td.replace(//g, '>').replace(/\"/g, '"') :\r\n\t\t\td;\r\n\t};\r\n\t\r\n\t/**\r\n\t * Helpers for `columns.render`.\r\n\t *\r\n\t * The options defined here can be used with the `columns.render` initialisation\r\n\t * option to provide a display renderer. The following functions are defined:\r\n\t *\r\n\t * * `number` - Will format numeric data (defined by `columns.data`) for\r\n\t * display, retaining the original unformatted data for sorting and filtering.\r\n\t * It takes 5 parameters:\r\n\t * * `string` - Thousands grouping separator\r\n\t * * `string` - Decimal point indicator\r\n\t * * `integer` - Number of decimal points to show\r\n\t * * `string` (optional) - Prefix.\r\n\t * * `string` (optional) - Postfix (/suffix).\r\n\t * * `text` - Escape HTML to help prevent XSS attacks. It has no optional\r\n\t * parameters.\r\n\t *\r\n\t * @example\r\n\t * // Column definition using the number renderer\r\n\t * {\r\n\t * data: \"salary\",\r\n\t * render: $.fn.dataTable.render.number( '\\'', '.', 0, '$' )\r\n\t * }\r\n\t *\r\n\t * @namespace\r\n\t */\r\n\tDataTable.render = {\r\n\t\tnumber: function ( thousands, decimal, precision, prefix, postfix ) {\r\n\t\t\treturn {\r\n\t\t\t\tdisplay: function ( d ) {\r\n\t\t\t\t\tif ( typeof d !== 'number' && typeof d !== 'string' ) {\r\n\t\t\t\t\t\treturn d;\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\tvar negative = d < 0 ? '-' : '';\r\n\t\t\t\t\tvar flo = parseFloat( d );\r\n\t\r\n\t\t\t\t\t// If NaN then there isn't much formatting that we can do - just\r\n\t\t\t\t\t// return immediately, escaping any HTML (this was supposed to\r\n\t\t\t\t\t// be a number after all)\r\n\t\t\t\t\tif ( isNaN( flo ) ) {\r\n\t\t\t\t\t\treturn __htmlEscapeEntities( d );\r\n\t\t\t\t\t}\r\n\t\r\n\t\t\t\t\tflo = flo.toFixed( precision );\r\n\t\t\t\t\td = Math.abs( flo );\r\n\t\r\n\t\t\t\t\tvar intPart = parseInt( d, 10 );\r\n\t\t\t\t\tvar floatPart = precision ?\r\n\t\t\t\t\t\tdecimal+(d - intPart).toFixed( precision ).substring( 2 ):\r\n\t\t\t\t\t\t'';\r\n\t\r\n\t\t\t\t\treturn negative + (prefix||'') +\r\n\t\t\t\t\t\tintPart.toString().replace(\r\n\t\t\t\t\t\t\t/\\B(?=(\\d{3})+(?!\\d))/g, thousands\r\n\t\t\t\t\t\t) +\r\n\t\t\t\t\t\tfloatPart +\r\n\t\t\t\t\t\t(postfix||'');\r\n\t\t\t\t}\r\n\t\t\t};\r\n\t\t},\r\n\t\r\n\t\ttext: function () {\r\n\t\t\treturn {\r\n\t\t\t\tdisplay: __htmlEscapeEntities\r\n\t\t\t};\r\n\t\t}\r\n\t};\r\n\t\r\n\t\r\n\t/*\r\n\t * This is really a good bit rubbish this method of exposing the internal methods\r\n\t * publicly... - To be fixed in 2.0 using methods on the prototype\r\n\t */\r\n\t\r\n\t\r\n\t/**\r\n\t * Create a wrapper function for exporting an internal functions to an external API.\r\n\t * @param {string} fn API function name\r\n\t * @returns {function} wrapped function\r\n\t * @memberof DataTable#internal\r\n\t */\r\n\tfunction _fnExternApiFunc (fn)\r\n\t{\r\n\t\treturn function() {\r\n\t\t\tvar args = [_fnSettingsFromNode( this[DataTable.ext.iApiIndex] )].concat(\r\n\t\t\t\tArray.prototype.slice.call(arguments)\r\n\t\t\t);\r\n\t\t\treturn DataTable.ext.internal[fn].apply( this, args );\r\n\t\t};\r\n\t}\r\n\t\r\n\t\r\n\t/**\r\n\t * Reference to internal functions for use by plug-in developers. Note that\r\n\t * these methods are references to internal functions and are considered to be\r\n\t * private. If you use these methods, be aware that they are liable to change\r\n\t * between versions.\r\n\t * @namespace\r\n\t */\r\n\t$.extend( DataTable.ext.internal, {\r\n\t\t_fnExternApiFunc: _fnExternApiFunc,\r\n\t\t_fnBuildAjax: _fnBuildAjax,\r\n\t\t_fnAjaxUpdate: _fnAjaxUpdate,\r\n\t\t_fnAjaxParameters: _fnAjaxParameters,\r\n\t\t_fnAjaxUpdateDraw: _fnAjaxUpdateDraw,\r\n\t\t_fnAjaxDataSrc: _fnAjaxDataSrc,\r\n\t\t_fnAddColumn: _fnAddColumn,\r\n\t\t_fnColumnOptions: _fnColumnOptions,\r\n\t\t_fnAdjustColumnSizing: _fnAdjustColumnSizing,\r\n\t\t_fnVisibleToColumnIndex: _fnVisibleToColumnIndex,\r\n\t\t_fnColumnIndexToVisible: _fnColumnIndexToVisible,\r\n\t\t_fnVisbleColumns: _fnVisbleColumns,\r\n\t\t_fnGetColumns: _fnGetColumns,\r\n\t\t_fnColumnTypes: _fnColumnTypes,\r\n\t\t_fnApplyColumnDefs: _fnApplyColumnDefs,\r\n\t\t_fnHungarianMap: _fnHungarianMap,\r\n\t\t_fnCamelToHungarian: _fnCamelToHungarian,\r\n\t\t_fnLanguageCompat: _fnLanguageCompat,\r\n\t\t_fnBrowserDetect: _fnBrowserDetect,\r\n\t\t_fnAddData: _fnAddData,\r\n\t\t_fnAddTr: _fnAddTr,\r\n\t\t_fnNodeToDataIndex: _fnNodeToDataIndex,\r\n\t\t_fnNodeToColumnIndex: _fnNodeToColumnIndex,\r\n\t\t_fnGetCellData: _fnGetCellData,\r\n\t\t_fnSetCellData: _fnSetCellData,\r\n\t\t_fnSplitObjNotation: _fnSplitObjNotation,\r\n\t\t_fnGetObjectDataFn: _fnGetObjectDataFn,\r\n\t\t_fnSetObjectDataFn: _fnSetObjectDataFn,\r\n\t\t_fnGetDataMaster: _fnGetDataMaster,\r\n\t\t_fnClearTable: _fnClearTable,\r\n\t\t_fnDeleteIndex: _fnDeleteIndex,\r\n\t\t_fnInvalidate: _fnInvalidate,\r\n\t\t_fnGetRowElements: _fnGetRowElements,\r\n\t\t_fnCreateTr: _fnCreateTr,\r\n\t\t_fnBuildHead: _fnBuildHead,\r\n\t\t_fnDrawHead: _fnDrawHead,\r\n\t\t_fnDraw: _fnDraw,\r\n\t\t_fnReDraw: _fnReDraw,\r\n\t\t_fnAddOptionsHtml: _fnAddOptionsHtml,\r\n\t\t_fnDetectHeader: _fnDetectHeader,\r\n\t\t_fnGetUniqueThs: _fnGetUniqueThs,\r\n\t\t_fnFeatureHtmlFilter: _fnFeatureHtmlFilter,\r\n\t\t_fnFilterComplete: _fnFilterComplete,\r\n\t\t_fnFilterCustom: _fnFilterCustom,\r\n\t\t_fnFilterColumn: _fnFilterColumn,\r\n\t\t_fnFilter: _fnFilter,\r\n\t\t_fnFilterCreateSearch: _fnFilterCreateSearch,\r\n\t\t_fnEscapeRegex: _fnEscapeRegex,\r\n\t\t_fnFilterData: _fnFilterData,\r\n\t\t_fnFeatureHtmlInfo: _fnFeatureHtmlInfo,\r\n\t\t_fnUpdateInfo: _fnUpdateInfo,\r\n\t\t_fnInfoMacros: _fnInfoMacros,\r\n\t\t_fnInitialise: _fnInitialise,\r\n\t\t_fnInitComplete: _fnInitComplete,\r\n\t\t_fnLengthChange: _fnLengthChange,\r\n\t\t_fnFeatureHtmlLength: _fnFeatureHtmlLength,\r\n\t\t_fnFeatureHtmlPaginate: _fnFeatureHtmlPaginate,\r\n\t\t_fnPageChange: _fnPageChange,\r\n\t\t_fnFeatureHtmlProcessing: _fnFeatureHtmlProcessing,\r\n\t\t_fnProcessingDisplay: _fnProcessingDisplay,\r\n\t\t_fnFeatureHtmlTable: _fnFeatureHtmlTable,\r\n\t\t_fnScrollDraw: _fnScrollDraw,\r\n\t\t_fnApplyToChildren: _fnApplyToChildren,\r\n\t\t_fnCalculateColumnWidths: _fnCalculateColumnWidths,\r\n\t\t_fnThrottle: _fnThrottle,\r\n\t\t_fnConvertToWidth: _fnConvertToWidth,\r\n\t\t_fnGetWidestNode: _fnGetWidestNode,\r\n\t\t_fnGetMaxLenString: _fnGetMaxLenString,\r\n\t\t_fnStringToCss: _fnStringToCss,\r\n\t\t_fnSortFlatten: _fnSortFlatten,\r\n\t\t_fnSort: _fnSort,\r\n\t\t_fnSortAria: _fnSortAria,\r\n\t\t_fnSortListener: _fnSortListener,\r\n\t\t_fnSortAttachListener: _fnSortAttachListener,\r\n\t\t_fnSortingClasses: _fnSortingClasses,\r\n\t\t_fnSortData: _fnSortData,\r\n\t\t_fnSaveState: _fnSaveState,\r\n\t\t_fnLoadState: _fnLoadState,\r\n\t\t_fnSettingsFromNode: _fnSettingsFromNode,\r\n\t\t_fnLog: _fnLog,\r\n\t\t_fnMap: _fnMap,\r\n\t\t_fnBindAction: _fnBindAction,\r\n\t\t_fnCallbackReg: _fnCallbackReg,\r\n\t\t_fnCallbackFire: _fnCallbackFire,\r\n\t\t_fnLengthOverflow: _fnLengthOverflow,\r\n\t\t_fnRenderer: _fnRenderer,\r\n\t\t_fnDataSource: _fnDataSource,\r\n\t\t_fnRowAttributes: _fnRowAttributes,\r\n\t\t_fnCalculateEnd: function () {} // Used by a lot of plug-ins, but redundant\r\n\t\t // in 1.10, so this dead-end function is\r\n\t\t // added to prevent errors\r\n\t} );\r\n\t\r\n\r\n\t// jQuery access\r\n\t$.fn.dataTable = DataTable;\r\n\r\n\t// Provide access to the host jQuery object (circular reference)\r\n\tDataTable.$ = $;\r\n\r\n\t// Legacy aliases\r\n\t$.fn.dataTableSettings = DataTable.settings;\r\n\t$.fn.dataTableExt = DataTable.ext;\r\n\r\n\t// With a capital `D` we return a DataTables API instance rather than a\r\n\t// jQuery object\r\n\t$.fn.DataTable = function ( opts ) {\r\n\t\treturn $(this).dataTable( opts ).api();\r\n\t};\r\n\r\n\t// All properties that are available to $.fn.dataTable should also be\r\n\t// available on $.fn.DataTable\r\n\t$.each( DataTable, function ( prop, val ) {\r\n\t\t$.fn.DataTable[ prop ] = val;\r\n\t} );\r\n\r\n\r\n\t// Information about events fired by DataTables - for documentation.\r\n\t/**\r\n\t * Draw event, fired whenever the table is redrawn on the page, at the same\r\n\t * point as fnDrawCallback. This may be useful for binding events or\r\n\t * performing calculations when the table is altered at all.\r\n\t * @name DataTable#draw.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} o DataTables settings object {@link DataTable.models.oSettings}\r\n\t */\r\n\r\n\t/**\r\n\t * Search event, fired when the searching applied to the table (using the\r\n\t * built-in global search, or column filters) is altered.\r\n\t * @name DataTable#search.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} o DataTables settings object {@link DataTable.models.oSettings}\r\n\t */\r\n\r\n\t/**\r\n\t * Page change event, fired when the paging of the table is altered.\r\n\t * @name DataTable#page.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} o DataTables settings object {@link DataTable.models.oSettings}\r\n\t */\r\n\r\n\t/**\r\n\t * Order event, fired when the ordering applied to the table is altered.\r\n\t * @name DataTable#order.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} o DataTables settings object {@link DataTable.models.oSettings}\r\n\t */\r\n\r\n\t/**\r\n\t * DataTables initialisation complete event, fired when the table is fully\r\n\t * drawn, including Ajax data loaded, if Ajax data is required.\r\n\t * @name DataTable#init.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} oSettings DataTables settings object\r\n\t * @param {object} json The JSON object request from the server - only\r\n\t * present if client-side Ajax sourced data is used\r\n\t */\r\n\r\n\t/**\r\n\t * State save event, fired when the table has changed state a new state save\r\n\t * is required. This event allows modification of the state saving object\r\n\t * prior to actually doing the save, including addition or other state\r\n\t * properties (for plug-ins) or modification of a DataTables core property.\r\n\t * @name DataTable#stateSaveParams.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} oSettings DataTables settings object\r\n\t * @param {object} json The state information to be saved\r\n\t */\r\n\r\n\t/**\r\n\t * State load event, fired when the table is loading state from the stored\r\n\t * data, but prior to the settings object being modified by the saved state\r\n\t * - allowing modification of the saved state is required or loading of\r\n\t * state for a plug-in.\r\n\t * @name DataTable#stateLoadParams.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} oSettings DataTables settings object\r\n\t * @param {object} json The saved state information\r\n\t */\r\n\r\n\t/**\r\n\t * State loaded event, fired when state has been loaded from stored data and\r\n\t * the settings object has been modified by the loaded data.\r\n\t * @name DataTable#stateLoaded.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} oSettings DataTables settings object\r\n\t * @param {object} json The saved state information\r\n\t */\r\n\r\n\t/**\r\n\t * Processing event, fired when DataTables is doing some kind of processing\r\n\t * (be it, order, searcg or anything else). It can be used to indicate to\r\n\t * the end user that there is something happening, or that something has\r\n\t * finished.\r\n\t * @name DataTable#processing.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} oSettings DataTables settings object\r\n\t * @param {boolean} bShow Flag for if DataTables is doing processing or not\r\n\t */\r\n\r\n\t/**\r\n\t * Ajax (XHR) event, fired whenever an Ajax request is completed from a\r\n\t * request to made to the server for new data. This event is called before\r\n\t * DataTables processed the returned data, so it can also be used to pre-\r\n\t * process the data returned from the server, if needed.\r\n\t *\r\n\t * Note that this trigger is called in `fnServerData`, if you override\r\n\t * `fnServerData` and which to use this event, you need to trigger it in you\r\n\t * success function.\r\n\t * @name DataTable#xhr.dt\r\n\t * @event\r\n\t * @param {event} e jQuery event object\r\n\t * @param {object} o DataTables settings object {@link DataTable.models.oSettings}\r\n\t * @param {object} json JSON returned from the server\r\n\t *\r\n\t * @example\r\n\t * // Use a custom property returned from the server in another DOM element\r\n\t * $('#table').dataTable().on('xhr.dt', function (e, settings, json) {\r\n\t * $('#status').html( json.status );\r\n\t * } );\r\n\t *\r\n\t * @example\r\n\t * // Pre-process the data returned from the server\r\n\t * $('#table').dataTable().on('xhr.dt', function (e, settings, json) {\r\n\t * for ( var i=0, ien=json.aaData.length ; i {\r\n if (result) {\r\n this.submitAddSubscriptions();\r\n }\r\n });\r\n },\r\n editSubscriptions() {\r\n this.$validator.validateAll().then(result => {\r\n if (result) {\r\n this.submitEditSubscriptions();\r\n }\r\n });\r\n },\r\n removeSubscriptions() {\r\n this.$validator.validateAll().then(result => {\r\n if (result) {\r\n this.submitRemoveSubscriptions();\r\n }\r\n });\r\n },\r\n goToEditSubscriptions() {\r\n this.$validator.validate(\"tags-email-input\").then(result => {\r\n if (result) {\r\n this.submitGoToEditSubscriptions();\r\n }\r\n });\r\n },\r\n submitAddSubscriptions() {\r\n this.loading = true;\r\n const serialized = $(\"#tags-subscription-form\")\r\n .serialize()\r\n .replace(\"tag-id=all&\", \"\");\r\n let self = this;\r\n $.ajax({\r\n url: $(\"#tags-subscription-form\").attr(\r\n \"data-update-subscription-url\"\r\n ),\r\n type: \"post\",\r\n dataType: \"json\",\r\n data: serialized,\r\n success: function(data) {\r\n if (window.grecaptcha) {\r\n window.grecaptcha.reset();\r\n }\r\n self.loading = false;\r\n if (!data.IsSuccess) {\r\n subscriptionTool.errors.clear();\r\n subscriptionTool.errors.add(\r\n \"ajax-validation\",\r\n data.Message\r\n );\r\n }\r\n if (data.IsSuccess) {\r\n //redirectToEditPage(data.UserId);\r\n $(\"#tags-subscription-form\")\r\n .find(\".add-subscription\")\r\n .show();\r\n\r\n $(\"html, body\").animate(\r\n {\r\n scrollTop: 0\r\n },\r\n 1000\r\n );\r\n }\r\n },\r\n error: function(data) {\r\n self.loading = false;\r\n console.error(data);\r\n }\r\n });\r\n },\r\n submitEditSubscriptions() {\r\n this.loading = true;\r\n const serialized = $(\"#tags-subscription-form\")\r\n .serialize()\r\n .replace(\"tag-id=all&\", \"\");\r\n let self = this;\r\n $.ajax({\r\n url: $(\"#tags-subscription-form\").attr(\r\n \"data-edit-subscription-url\"\r\n ),\r\n type: \"post\",\r\n dataType: \"json\",\r\n data: serialized,\r\n success: function(data) {\r\n window.grecaptcha.reset();\r\n self.loading = false;\r\n if (!data.IsSuccess) {\r\n console.log(data.Message);\r\n subscriptionTool.errors.clear();\r\n subscriptionTool.errors.add(\r\n \"ajax-validation\",\r\n data.Message\r\n );\r\n }\r\n if (data.IsSuccess) {\r\n $(\"#tags-subscription-form\")\r\n .find(\".edit-subscription\")\r\n .show();\r\n\r\n $(\"html, body\").animate(\r\n {\r\n scrollTop: 0\r\n },\r\n 1000\r\n );\r\n }\r\n },\r\n error: function(data) {\r\n self.loading = false;\r\n console.error(data);\r\n }\r\n });\r\n },\r\n submitRemoveSubscriptions() {\r\n this.loading = true;\r\n const serialized = $(\"#tags-subscription-form\")\r\n .serialize()\r\n .replace(\"tag-id=all&\", \"\");\r\n let self = this;\r\n $.ajax({\r\n url: $(\"#tags-subscription-form\").attr(\r\n \"data-remove-subscription-url\"\r\n ),\r\n type: \"post\",\r\n dataType: \"json\",\r\n data: serialized,\r\n success: function(data) {\r\n window.grecaptcha.reset();\r\n self.loading = false;\r\n if (!data.IsSuccess) {\r\n console.log(data.Message);\r\n subscriptionTool.errors.clear();\r\n subscriptionTool.errors.add(\r\n \"ajax-validation\",\r\n data.Message\r\n );\r\n }\r\n if (data.IsSuccess) {\r\n redirectAfterUnsubscribing();\r\n }\r\n },\r\n error: function(data) {\r\n self.loading = false;\r\n console.error(data);\r\n }\r\n });\r\n },\r\n submitGoToEditSubscriptions() {\r\n this.loading = true;\r\n let self = this;\r\n $.ajax({\r\n url: $(\"#tags-subscription-form\").attr(\r\n \"data-go-to-edit-subscription-url\"\r\n ),\r\n type: \"post\",\r\n dataType: \"json\",\r\n data: $(\"#tags-subscription-form\").serialize(),\r\n success: function(data) {\r\n if (window.grecaptcha) {\r\n window.grecaptcha.reset();\r\n }\r\n self.loading = false;\r\n if (!data.IsSuccess) {\r\n console.log(data.Message);\r\n subscriptionTool.errors.clear();\r\n subscriptionTool.errors.add(\r\n \"ajax-validation\",\r\n data.Message\r\n );\r\n }\r\n if (data.IsSuccess) {\r\n $(\"#tags-subscription-form\")\r\n .find(\".go-to-edit-notification\")\r\n .show();\r\n\r\n $(\"html, body\").animate(\r\n {\r\n scrollTop: 0\r\n },\r\n 1000\r\n );\r\n }\r\n },\r\n error: function(data) {\r\n self.loading = false;\r\n console.error(data);\r\n }\r\n });\r\n },\r\n checkAll(e) {\r\n var input = $(e.target);\r\n var checkboxVal = input[0].checked;\r\n var tagList = input.closest(\".tag--list\");\r\n var checkboxes = $(\"input[type='checkbox']\", tagList).not(\r\n \"form-control__all\"\r\n );\r\n\r\n checkboxes.attr(\"checked\", checkboxVal);\r\n }\r\n }\r\n });\r\n\r\n //Initial tags slice\r\n $(\".tag--items\").each(function() {\r\n var $ps = $(this).find(\".tag--item-form-group\");\r\n $ps.slice(7).hide();\r\n });\r\n\r\n //Toggle visibility button\r\n $(\".tag--items-btn\").click(function() {\r\n var $ps = $(this)\r\n .closest(\".tag--items\")\r\n .find(\".tag--item-form-group\");\r\n $ps.slice(7).toggle();\r\n $(this).hide();\r\n });\r\n\r\n $(\".tag--subscription-form\").submit(function(e) {\r\n e.preventDefault();\r\n });\r\n});\r\n","import \"./../_polyfill/Array_from\";\r\nimport \"./../_polyfill/Array_find\";\r\nimport \"./../_polyfill/Promise\";\r\nimport flatpickr from \"flatpickr\";\r\nimport { Danish } from \"flatpickr/dist/l10n/da.js\";\r\nimport { Chinese } from \"flatpickr/dist/l10n/zh.js\";\r\n\r\nimport { getParameterByName } from \"./helperFunctions\";\r\n\r\nexport default class TaxonomyDropdown {\r\n // Inititialize TaxonomyList for a selection of lists\r\n static init(querySelector = \".module-taxonomy-dropdown-body\") {\r\n Array.prototype.forEach.call(\r\n document.querySelectorAll(querySelector),\r\n taxonomyDropdown => {\r\n new TaxonomyDropdown(taxonomyDropdown);\r\n }\r\n );\r\n }\r\n\r\n constructor(element) {\r\n this.element = element;\r\n this.tags = this.element.getAttribute(\"data-tags\");\r\n this.selects = Array.from(\r\n this.element.querySelectorAll(\".select-module select\")\r\n );\r\n this.yearSelect = this.element.querySelector(\".years-filter select\");\r\n this.fromDate = this.element.querySelector(\".fromdate\");\r\n this.fromPicker;\r\n this.toDate = this.element.querySelector(\".todate\");\r\n this.toPicker;\r\n this.dataSourceId = element.getAttribute(\"data-source-id\");\r\n this.currentPageId = this.element.getAttribute(\"data-current-page-id\");\r\n this.preSelectedTagId = this.element.getAttribute(\r\n \"data-pre-selected-tag-id\"\r\n );\r\n this.taxonomyListIds = Array.from(\r\n document.querySelectorAll([\".item-list[data-source-id]\"])\r\n ).map(x => x.getAttribute(\"data-source-id\"));\r\n\r\n // Initial fetch\r\n var pattern = /(\\d{2})\\-(\\d{2})\\-(\\d{4})/;\r\n var filterTags = getParameterByName(\"filter\")\r\n ? getParameterByName(\"filter\").split(\" \")\r\n : [];\r\n var tagIds = [this.preSelectedTagId]\r\n .concat(filterTags)\r\n .filter(x => !!x);\r\n var year = getParameterByName(\"year\") || undefined;\r\n var fromDate = getParameterByName(\"fromDate\")\r\n ? new Date(\r\n getParameterByName(\"fromDate\").replace(pattern, \"$3-$2-$1\")\r\n )\r\n : undefined;\r\n var toDate = getParameterByName(\"toDate\")\r\n ? new Date(\r\n getParameterByName(\"toDate\").replace(pattern, \"$3-$2-$1\")\r\n )\r\n : undefined;\r\n this.requestFilterOptions(\r\n this.dataSourceId,\r\n this.taxonomyListIds,\r\n this.selects.map(x => x.name),\r\n tagIds,\r\n this.tags,\r\n year,\r\n fromDate,\r\n toDate\r\n ).then(result => {\r\n // Hide the entire dropdown module if there are no valid options to pick from\r\n if (\r\n result.collections.reduce(\r\n (t, tagCollection) => t + tagCollection.tags.length,\r\n 0\r\n ) === 0 &&\r\n (result.years === undefined || result.years.length <= 1)\r\n ) {\r\n $(this.element)\r\n .closest(\".module\")\r\n .addClass(\"dropdown--no-results\");\r\n } else {\r\n // Else populate the filters, and select the filter-values from the url, if any\r\n this.renderFilterOptions(result.collections);\r\n this.renderYearOptions(result.years);\r\n this.renderValuesFromParamter();\r\n this.renderDatepickers(fromDate, toDate);\r\n }\r\n });\r\n\r\n this.selects.forEach(select => {\r\n jQuery(select).on(\"change\", event => {\r\n // Refetch on change\r\n let selectedOptions = Array.from(\r\n this.element.querySelectorAll(\r\n \".select-module option:checked\"\r\n )\r\n ).map(x => x.value);\r\n var tagIds = [this.preSelectedTagId]\r\n .concat(selectedOptions)\r\n .filter(x => !!x);\r\n var year = this.yearSelect ? this.yearSelect.value : undefined;\r\n var fromDate = this.fromDate\r\n ? new Date(this.fromDate.value.replace(pattern, \"$3-$2-$1\"))\r\n : undefined;\r\n var toDate = this.toDate\r\n ? new Date(this.toDate.value.replace(pattern, \"$3-$2-$1\"))\r\n : undefined;\r\n this.requestFilterOptions(\r\n this.dataSourceId,\r\n this.taxonomyListIds,\r\n this.selects\r\n .filter(x => x.name !== event.target.name)\r\n .map(x => x.name),\r\n tagIds,\r\n this.tags,\r\n year,\r\n fromDate,\r\n toDate\r\n ).then(result => {\r\n this.renderFilterOptions(result.collections);\r\n this.renderYearOptions(result.years);\r\n this.renderDatepickers(fromDate, toDate);\r\n });\r\n });\r\n });\r\n if (this.yearSelect) {\r\n jQuery(this.yearSelect).on(\"change\", event => {\r\n // Refetch on change\r\n let selectedOptions = Array.from(\r\n this.element.querySelectorAll(\r\n \".select-module option:checked\"\r\n )\r\n ).map(x => x.value);\r\n var tagIds = [this.preSelectedTagId]\r\n .concat(selectedOptions)\r\n .filter(x => !!x);\r\n var fromDate = this.fromDate\r\n ? new Date(this.fromDate.value.replace(pattern, \"$3-$2-$1\"))\r\n : undefined;\r\n var toDate = this.toDate\r\n ? new Date(this.toDate.value.replace(pattern, \"$3-$2-$1\"))\r\n : undefined;\r\n this.requestFilterOptions(\r\n this.dataSourceId,\r\n this.taxonomyListIds,\r\n this.selects\r\n .filter(x => x.name !== event.target.name)\r\n .map(x => x.name),\r\n tagIds,\r\n this.tags,\r\n this.yearSelect.value,\r\n fromDate,\r\n toDate\r\n ).then(result => {\r\n this.renderFilterOptions(result.collections);\r\n this.renderYearOptions(result.years);\r\n this.renderDatepickers(fromDate, toDate);\r\n });\r\n });\r\n }\r\n if (this.fromDate) {\r\n var lang = $(\"html\").attr(\"lang\");\r\n const langMap = {\r\n da: Danish,\r\n zh: Chinese,\r\n en: \"\"\r\n };\r\n if (lang !== \"en\") {\r\n flatpickr.localize(langMap[lang]);\r\n } else {\r\n flatpickr.l10ns.default.firstDayOfWeek = 1;\r\n }\r\n var _self = this;\r\n this.fromPicker = flatpickr(this.fromDate, {\r\n dateFormat: \"d-m-Y\",\r\n altInput: true,\r\n altFormat: \"F j, Y\",\r\n // onChange: function (selectedDates, dateStr, instance) {\r\n // // _self.toPicker.set('minDate', dateStr)\r\n // _self.datepickersChanged()\r\n // },\r\n onDayCreate: function(dObj, dStr, fp, dayElem) {\r\n if (\r\n _self.toPicker &&\r\n +_self.toPicker.selectedDates[0] === +dayElem.dateObj\r\n ) {\r\n dayElem.className += \" flatpickr-highlight\";\r\n }\r\n }\r\n });\r\n this.toPicker = flatpickr(this.toDate, {\r\n dateFormat: \"d-m-Y\",\r\n altInput: true,\r\n altFormat: \"F j, Y\",\r\n // onChange: function (selectedDates, dateStr, instance) {\r\n // // _self.fromPicker.set('maxDate', dateStr)\r\n // _self.datepickersChanged()\r\n // },\r\n onDayCreate: function(dObj, dStr, fp, dayElem) {\r\n if (\r\n _self.fromPicker &&\r\n +_self.fromPicker.selectedDates[0] === +dayElem.dateObj\r\n ) {\r\n dayElem.className += \" flatpickr-highlight\";\r\n }\r\n }\r\n });\r\n if (fromDate) {\r\n this.fromPicker.setDate(fromDate);\r\n this.toPicker.set(\"minDate\", fromDate);\r\n }\r\n if (toDate) {\r\n this.toPicker.setDate(toDate);\r\n this.fromPicker.set(\"maxDate\", toDate);\r\n }\r\n }\r\n\r\n this.element.querySelector(\"form\").addEventListener(\"submit\", event => {\r\n event.preventDefault();\r\n this.updateFilterParameter();\r\n });\r\n }\r\n\r\n renderFilterOptions(collections) {\r\n // Else we populate each dropdown\r\n collections.forEach(tagCollection => {\r\n var select = this.selects.find(x => x.name === tagCollection.id);\r\n let selectedOptions = Array.from(\r\n this.element.querySelectorAll(\".select-module option:checked\")\r\n );\r\n\r\n // Render new select-values and make sure previous value is still selected\r\n while (select.options.length) {\r\n select.options.remove(0);\r\n }\r\n let o = new Option(`${tagCollection.title}`, \"\");\r\n select.options.add(o);\r\n o.setAttribute(\"data-title\", tagCollection.title);\r\n tagCollection.tags.forEach(tag => {\r\n let t = new Option(`${tag.title} (${tag.facetCount})`, tag.id);\r\n select.options.add(t);\r\n t.setAttribute(\"data-title\", tag.title);\r\n });\r\n\r\n // Move items into an array\r\n var elements = Array.prototype.slice.call(select.options);\r\n\r\n // Sort the array alphabetically\r\n elements.sort(function(a, b) {\r\n return a.textContent.localeCompare(b.textContent);\r\n });\r\n\r\n // Reattach sorted items\r\n for (var i = 0, len = elements.length; i < len; i++) {\r\n var parent = elements[i].parentNode;\r\n var detatchedItem = parent.removeChild(elements[i]);\r\n parent.appendChild(detatchedItem);\r\n }\r\n let newOptions = Array.from(\r\n this.element.querySelectorAll(\".select-module option\")\r\n );\r\n selectedOptions.forEach(selectedOption => {\r\n let newOp = newOptions.find(\r\n newOption =>\r\n newOption.dataset.title === selectedOption.dataset.title\r\n );\r\n if (newOp) {\r\n newOp.selected = true;\r\n }\r\n });\r\n jQuery(select).niceSelect(\"update\");\r\n\r\n // Let's hide the select if there are no options\r\n if (select.options.length <= 1) {\r\n select.parentElement.style.display = \"none\";\r\n } else {\r\n select.parentElement.style.display = \"\";\r\n }\r\n });\r\n }\r\n\r\n renderYearOptions(years) {\r\n if (this.yearSelect) {\r\n var selectedValue = this.yearSelect.value;\r\n // Render new select-values and make sure previous value is still selected\r\n while (this.yearSelect.options.length) {\r\n this.yearSelect.options.remove(0);\r\n }\r\n\r\n var isDefaultOption = true;\r\n years.forEach(year => {\r\n if (isDefaultOption) {\r\n let o = new Option(`${year.title}` || \"\", year.id);\r\n this.yearSelect.options.add(o);\r\n o.setAttribute(\"data-title\", year.title);\r\n isDefaultOption = false;\r\n } else {\r\n let y = new Option(\r\n `${year.title} (${year.facetCount})` || \"\",\r\n year.id\r\n );\r\n this.yearSelect.options.add(y);\r\n y.setAttribute(\"data-title\", year.title);\r\n }\r\n });\r\n\r\n this.yearSelect.value = selectedValue;\r\n if (!this.yearSelect.value && this.yearSelect.options.length > 0) {\r\n this.yearSelect.options[0].selected = \"selected\";\r\n }\r\n jQuery(this.yearSelect).niceSelect(\"update\");\r\n\r\n if (this.yearSelect.options.length <= 2) {\r\n this.yearSelect.parentElement.style.display = \"none\";\r\n } else {\r\n this.yearSelect.parentElement.style.display = \"\";\r\n }\r\n }\r\n }\r\n\r\n requestFilterOptions(\r\n DropDownDataSourceId,\r\n DataSourcesIds,\r\n TagCollectionsIds,\r\n TagsIds,\r\n Tags,\r\n Year,\r\n FromDate,\r\n ToDate\r\n ) {\r\n return new Promise((resolve, reject) => {\r\n jQuery.ajax({\r\n type: \"POST\",\r\n url: `/api/taxonomylist/GetDroprdownTagCollections?sc_itemid=${this.currentPageId}`,\r\n data: JSON.stringify({\r\n DropDownDataSourceId,\r\n DataSourcesIds,\r\n TagCollectionsIds,\r\n TagsIds,\r\n Tags,\r\n Year,\r\n FromDate,\r\n ToDate\r\n }),\r\n success: resolve,\r\n failure: reject,\r\n dataType: \"json\",\r\n contentType: \"application/json\"\r\n });\r\n });\r\n }\r\n\r\n renderDatepickers(from, to) {\r\n if (this.fromDate) {\r\n if (from !== \"null\") {\r\n this.toPicker.set(\"minDate\", from);\r\n }\r\n if (to !== \"null\") {\r\n this.fromPicker.set(\"maxDate\", to);\r\n }\r\n }\r\n }\r\n\r\n renderValuesFromParamter() {\r\n if (getParameterByName(\"filter\")) {\r\n var taxonomyDropdownFilters = getParameterByName(\"filter\")\r\n .split(\" \")\r\n .filter(x => x !== \"\");\r\n taxonomyDropdownFilters.forEach(filter => {\r\n this.selects.forEach(select => {\r\n var optionWithFilter = Array.from(select.options).find(\r\n option => option.value === filter\r\n );\r\n if (optionWithFilter) {\r\n select.value = optionWithFilter.value;\r\n jQuery(select).niceSelect(\"update\");\r\n }\r\n });\r\n });\r\n }\r\n if (this.yearSelect && getParameterByName(\"year\")) {\r\n this.yearSelect.value = getParameterByName(\"year\");\r\n jQuery(this.yearSelect).niceSelect(\"update\");\r\n }\r\n }\r\n\r\n updateFilterParameter() {\r\n var taxonomyDropdownFilters = Array.from(\r\n this.element.querySelectorAll(\".select-module option:checked\")\r\n )\r\n .map(filterElement => {\r\n return filterElement.value;\r\n })\r\n .filter(x => x !== \"\");\r\n\r\n var params = [];\r\n if (taxonomyDropdownFilters.length > 0) {\r\n params.push(`filter=${taxonomyDropdownFilters.join(\"+\")}`);\r\n }\r\n if (this.yearSelect && this.yearSelect.value !== \"\") {\r\n params.push(`year=${this.yearSelect.value}`);\r\n }\r\n if (this.fromDate && this.fromDate.value !== \"\") {\r\n params.push(`fromDate=${this.fromDate.value}`);\r\n }\r\n if (this.toDate && this.toDate.value !== \"\") {\r\n params.push(`toDate=${this.toDate.value}`);\r\n }\r\n if (this.fromDate && this.toDate) {\r\n this.renderDatepickers(this.fromDate.value, this.toDate.value);\r\n }\r\n if (location.hash !== params.join(\"&\")) {\r\n location.hash = params.join(\"&\");\r\n }\r\n }\r\n\r\n /* Not used currently */\r\n datepickersChanged() {\r\n let selectedOptions = Array.from(\r\n this.element.querySelectorAll(\".select-module option:checked\")\r\n ).map(x => x.value);\r\n var tagIds = [this.preSelectedTagId]\r\n .concat(selectedOptions)\r\n .filter(x => !!x);\r\n var year = this.yearSelect ? this.yearSelect.value : undefined;\r\n var fromDate = this.fromDate\r\n ? JSON.stringify(\r\n new Date(this.fromDate.value.replace(pattern, \"$3-$2-$1\"))\r\n )\r\n : undefined;\r\n var toDate = this.toDate\r\n ? JSON.stringify(\r\n new Date(this.toDate.value.replace(pattern, \"$3-$2-$1\"))\r\n )\r\n : undefined;\r\n this.requestFilterOptions(\r\n this.dataSourceId,\r\n this.taxonomyListIds,\r\n this.selects\r\n .filter(x => x.name !== event.target.name)\r\n .map(x => x.name),\r\n tagIds,\r\n this.tags,\r\n year,\r\n fromDate,\r\n toDate\r\n ).then(result => {\r\n this.renderFilterOptions(result.collections);\r\n this.renderYearOptions(result.years);\r\n\r\n this.renderDatepickers(fromDate, toDate);\r\n });\r\n }\r\n}\r\n","export function toggleClass(elem, className, bool) {\n if (bool === true)\n return elem.classList.add(className);\n elem.classList.remove(className);\n}\nexport function createElement(tag, className, content) {\n const e = window.document.createElement(tag);\n className = className || \"\";\n content = content || \"\";\n e.className = className;\n if (content !== undefined)\n e.textContent = content;\n return e;\n}\nexport function clearNode(node) {\n while (node.firstChild)\n node.removeChild(node.firstChild);\n}\nexport function findParent(node, condition) {\n if (condition(node))\n return node;\n else if (node.parentNode)\n return findParent(node.parentNode, condition);\n return undefined;\n}\nexport function createNumberInput(inputClassName, opts) {\n const wrapper = createElement(\"div\", \"numInputWrapper\"), numInput = createElement(\"input\", \"numInput \" + inputClassName), arrowUp = createElement(\"span\", \"arrowUp\"), arrowDown = createElement(\"span\", \"arrowDown\");\n if (navigator.userAgent.indexOf(\"MSIE 9.0\") === -1) {\n numInput.type = \"number\";\n }\n else {\n numInput.type = \"text\";\n numInput.pattern = \"\\\\d*\";\n }\n if (opts !== undefined)\n for (const key in opts)\n numInput.setAttribute(key, opts[key]);\n wrapper.appendChild(numInput);\n wrapper.appendChild(arrowUp);\n wrapper.appendChild(arrowDown);\n return wrapper;\n}\nexport function getEventTarget(event) {\n try {\n if (typeof event.composedPath === \"function\") {\n const path = event.composedPath();\n return path[0];\n }\n return event.target;\n }\n catch (error) {\n return event.target;\n }\n}\n","import { tokenRegex, revFormat, formats, } from \"./formatting\";\nimport { defaults } from \"../types/options\";\nimport { english } from \"../l10n/default\";\nexport const createDateFormatter = ({ config = defaults, l10n = english, isMobile = false, }) => (dateObj, frmt, overrideLocale) => {\n const locale = overrideLocale || l10n;\n if (config.formatDate !== undefined && !isMobile) {\n return config.formatDate(dateObj, frmt, locale);\n }\n return frmt\n .split(\"\")\n .map((c, i, arr) => formats[c] && arr[i - 1] !== \"\\\\\"\n ? formats[c](dateObj, locale, config)\n : c !== \"\\\\\"\n ? c\n : \"\")\n .join(\"\");\n};\nexport const createDateParser = ({ config = defaults, l10n = english }) => (date, givenFormat, timeless, customLocale) => {\n if (date !== 0 && !date)\n return undefined;\n const locale = customLocale || l10n;\n let parsedDate;\n const dateOrig = date;\n if (date instanceof Date)\n parsedDate = new Date(date.getTime());\n else if (typeof date !== \"string\" &&\n date.toFixed !== undefined)\n parsedDate = new Date(date);\n else if (typeof date === \"string\") {\n const format = givenFormat || (config || defaults).dateFormat;\n const datestr = String(date).trim();\n if (datestr === \"today\") {\n parsedDate = new Date();\n timeless = true;\n }\n else if (/Z$/.test(datestr) ||\n /GMT$/.test(datestr))\n parsedDate = new Date(date);\n else if (config && config.parseDate)\n parsedDate = config.parseDate(date, format);\n else {\n parsedDate =\n !config || !config.noCalendar\n ? new Date(new Date().getFullYear(), 0, 1, 0, 0, 0, 0)\n : new Date(new Date().setHours(0, 0, 0, 0));\n let matched, ops = [];\n for (let i = 0, matchIndex = 0, regexStr = \"\"; i < format.length; i++) {\n const token = format[i];\n const isBackSlash = token === \"\\\\\";\n const escaped = format[i - 1] === \"\\\\\" || isBackSlash;\n if (tokenRegex[token] && !escaped) {\n regexStr += tokenRegex[token];\n const match = new RegExp(regexStr).exec(date);\n if (match && (matched = true)) {\n ops[token !== \"Y\" ? \"push\" : \"unshift\"]({\n fn: revFormat[token],\n val: match[++matchIndex],\n });\n }\n }\n else if (!isBackSlash)\n regexStr += \".\";\n ops.forEach(({ fn, val }) => (parsedDate = fn(parsedDate, val, locale) || parsedDate));\n }\n parsedDate = matched ? parsedDate : undefined;\n }\n }\n if (!(parsedDate instanceof Date && !isNaN(parsedDate.getTime()))) {\n config.errorHandler(new Error(`Invalid date provided: ${dateOrig}`));\n return undefined;\n }\n if (timeless === true)\n parsedDate.setHours(0, 0, 0, 0);\n return parsedDate;\n};\nexport function compareDates(date1, date2, timeless = true) {\n if (timeless !== false) {\n return (new Date(date1.getTime()).setHours(0, 0, 0, 0) -\n new Date(date2.getTime()).setHours(0, 0, 0, 0));\n }\n return date1.getTime() - date2.getTime();\n}\nexport function compareTimes(date1, date2) {\n return (3600 * (date1.getHours() - date2.getHours()) +\n 60 * (date1.getMinutes() - date2.getMinutes()) +\n date1.getSeconds() -\n date2.getSeconds());\n}\nexport const isBetween = (ts, ts1, ts2) => {\n return ts > Math.min(ts1, ts2) && ts < Math.max(ts1, ts2);\n};\nexport const duration = {\n DAY: 86400000,\n};\nexport function getDefaultHours(config) {\n let hours = config.defaultHour;\n let minutes = config.defaultMinute;\n let seconds = config.defaultSeconds;\n if (config.minDate !== undefined) {\n const minHour = config.minDate.getHours();\n const minMinutes = config.minDate.getMinutes();\n const minSeconds = config.minDate.getSeconds();\n if (hours < minHour) {\n hours = minHour;\n }\n if (hours === minHour && minutes < minMinutes) {\n minutes = minMinutes;\n }\n if (hours === minHour && minutes === minMinutes && seconds < minSeconds)\n seconds = config.minDate.getSeconds();\n }\n if (config.maxDate !== undefined) {\n const maxHr = config.maxDate.getHours();\n const maxMinutes = config.maxDate.getMinutes();\n hours = Math.min(hours, maxHr);\n if (hours === maxHr)\n minutes = Math.min(maxMinutes, minutes);\n if (hours === maxHr && minutes === maxMinutes)\n seconds = config.maxDate.getSeconds();\n }\n return { hours, minutes, seconds };\n}\n","\"use strict\";\nif (typeof Object.assign !== \"function\") {\n Object.assign = function (target, ...args) {\n if (!target) {\n throw TypeError(\"Cannot convert undefined or null to object\");\n }\n for (const source of args) {\n if (source) {\n Object.keys(source).forEach((key) => (target[key] = source[key]));\n }\n }\n return target;\n };\n}\n","(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports) :\n typeof define === 'function' && define.amd ? define(['exports'], factory) :\n (global = typeof globalThis !== 'undefined' ? globalThis : global || self, factory(global.da = {}));\n}(this, (function (exports) { 'use strict';\n\n var fp = typeof window !== \"undefined\" && window.flatpickr !== undefined\n ? window.flatpickr\n : {\n l10ns: {},\n };\n var Danish = {\n weekdays: {\n shorthand: [\"søn\", \"man\", \"tir\", \"ons\", \"tors\", \"fre\", \"lør\"],\n longhand: [\n \"søndag\",\n \"mandag\",\n \"tirsdag\",\n \"onsdag\",\n \"torsdag\",\n \"fredag\",\n \"lørdag\",\n ],\n },\n months: {\n shorthand: [\n \"jan\",\n \"feb\",\n \"mar\",\n \"apr\",\n \"maj\",\n \"jun\",\n \"jul\",\n \"aug\",\n \"sep\",\n \"okt\",\n \"nov\",\n \"dec\",\n ],\n longhand: [\n \"januar\",\n \"februar\",\n \"marts\",\n \"april\",\n \"maj\",\n \"juni\",\n \"juli\",\n \"august\",\n \"september\",\n \"oktober\",\n \"november\",\n \"december\",\n ],\n },\n ordinal: function () {\n return \".\";\n },\n firstDayOfWeek: 1,\n rangeSeparator: \" til \",\n weekAbbreviation: \"uge\",\n time_24hr: true,\n };\n fp.l10ns.da = Danish;\n var da = fp.l10ns;\n\n exports.Danish = Danish;\n exports.default = da;\n\n Object.defineProperty(exports, '__esModule', { value: true });\n\n})));\n","(function (global, factory) {\n typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports) :\n typeof define === 'function' && define.amd ? define(['exports'], factory) :\n (global = typeof globalThis !== 'undefined' ? globalThis : global || self, factory(global.zh = {}));\n}(this, (function (exports) { 'use strict';\n\n var fp = typeof window !== \"undefined\" && window.flatpickr !== undefined\n ? window.flatpickr\n : {\n l10ns: {},\n };\n var Mandarin = {\n weekdays: {\n shorthand: [\"周日\", \"周一\", \"周二\", \"周三\", \"周四\", \"周五\", \"周六\"],\n longhand: [\n \"星期日\",\n \"星期一\",\n \"星期二\",\n \"星期三\",\n \"星期四\",\n \"星期五\",\n \"星期六\",\n ],\n },\n months: {\n shorthand: [\n \"一月\",\n \"二月\",\n \"三月\",\n \"四月\",\n \"五月\",\n \"六月\",\n \"七月\",\n \"八月\",\n \"九月\",\n \"十月\",\n \"十一月\",\n \"十二月\",\n ],\n longhand: [\n \"一月\",\n \"二月\",\n \"三月\",\n \"四月\",\n \"五月\",\n \"六月\",\n \"七月\",\n \"八月\",\n \"九月\",\n \"十月\",\n \"十一月\",\n \"十二月\",\n ],\n },\n rangeSeparator: \" 至 \",\n weekAbbreviation: \"周\",\n scrollTitle: \"滚动切换\",\n toggleTitle: \"点击切换 12/24 小时时制\",\n };\n fp.l10ns.zh = Mandarin;\n var zh = fp.l10ns;\n\n exports.Mandarin = Mandarin;\n exports.default = zh;\n\n Object.defineProperty(exports, '__esModule', { value: true });\n\n})));\n","/* jQuery Nice Select - v1.1.0\r\n https://github.com/hernansartorio/jquery-nice-select\r\n Made by Hernán Sartorio */\r\n\r\n(function ($) {\r\n\r\n $.fn.niceSelect = function (method, openCallback) {\r\n\r\n // Methods\r\n if (typeof method == 'string') {\r\n if (method == 'update') {\r\n this.each(function () {\r\n var $select = $(this);\r\n var $dropdown = $(this).next('.nice-select');\r\n var open = $dropdown.hasClass('open');\r\n\r\n if ($dropdown.length) {\r\n $dropdown.remove();\r\n create_nice_select($select);\r\n\r\n if (open) {\r\n $select.next().trigger('click');\r\n }\r\n }\r\n });\r\n } else if (method == 'destroy') {\r\n this.each(function () {\r\n var $select = $(this);\r\n var $dropdown = $(this).next('.nice-select');\r\n\r\n if ($dropdown.length) {\r\n $dropdown.remove();\r\n $select.css('display', '');\r\n }\r\n });\r\n if ($('.nice-select').length == 0) {\r\n $(document).off('.nice_select');\r\n }\r\n } else {\r\n console.log('Method \"' + method + '\" does not exist.')\r\n }\r\n return this;\r\n }\r\n\r\n // Hide native select\r\n this.hide();\r\n\r\n // Create custom markup\r\n this.each(function () {\r\n var $select = $(this);\r\n\r\n if (!$select.next().hasClass('nice-select')) {\r\n create_nice_select($select);\r\n }\r\n });\r\n\r\n function create_nice_select($select) {\r\n $select.after($('')\r\n .addClass('nice-select')\r\n .addClass($select.attr('class') || '')\r\n .addClass($select.attr('disabled') ? 'disabled' : '')\r\n .attr('tabindex', $select.attr('disabled') ? null : '0')\r\n .html($select.attr('search') !== undefined ? '' : '')\r\n );\r\n\r\n var $dropdown = $select.next();\r\n var $options = $select.find('option');\r\n var $selected = $select.find('option:selected');\r\n\r\n $dropdown.find('.current').html($selected.data('display') || $selected.text());\r\n\r\n $options.each(function (i) {\r\n var $option = $(this);\r\n var display = $option.data('display') || null;\r\n\r\n var attributes = $option.prop(\"attributes\");\r\n var $optionListItem = $('/')\r\n .attr('data-display', (display || null))\r\n .addClass('option' +\r\n ($option.is(':selected') ? ' selected' : '') +\r\n ($option.is(':disabled') ? ' disabled' : ''))\r\n .addClass($option.attr('class'))\r\n .html($option.text());\r\n $.each(attributes, function () {\r\n $optionListItem.attr(this.name, this.value);\r\n });\r\n $optionListItem.data($.extend($option.data(), {\r\n value: $option.val(),\r\n display: display\r\n }));\r\n var ul = $dropdown.find('ul')\r\n ul.append($($optionListItem))\r\n });\r\n }\r\n\r\n /* Event listeners */\r\n\r\n // Unbind existing events in case that the plugin has been initialized before\r\n $(document).off('.nice_select');\r\n\r\n // Open/close\r\n $(document).on('click.nice_select', '.nice-select', function (event) {\r\n var $dropdown = $(this);\r\n\r\n $('.nice-select').not($dropdown).removeClass('open');\r\n $dropdown.toggleClass('open');\r\n\r\n if ($dropdown.hasClass('open')) {\r\n $dropdown.find('.option');\r\n $dropdown.find('.focus').removeClass('focus');\r\n $dropdown.find('.selected').addClass('focus');\r\n if ($dropdown.prev().attr('search') !== undefined) {\r\n var search = $dropdown.find('.nice-select-search')[0];\r\n var $options = $dropdown.find('ul li');\r\n $options.show().removeClass(\"disabled\");\r\n setTimeout(function () {\r\n $(search).val('');\r\n $(search).focus();\r\n }, 100)\r\n }\r\n openCallback($dropdown)\r\n } else {\r\n $dropdown.focus();\r\n }\r\n });\r\n\r\n // Custom search functions\r\n $(document).on('click', '.nice-select-search-box', function (event) {\r\n event.stopPropagation();\r\n return false;\r\n });\r\n $(document).on('keyup', '.nice-select-search', function (event) {\r\n var $self = $(this).parent().parent();\r\n var $text = $(this).val();\r\n var $options = $self.find('ul li');\r\n if ($text == '') {\r\n $options.show().removeClass(\"disabled\");\r\n } else if ($self.hasClass('open')) {\r\n $text = $text.toLowerCase();\r\n var $matchReg = new RegExp($text);\r\n if (0 < $options.length) {\r\n $options.each(function () {\r\n var $this = $(this);\r\n var $optionText = $this.text().toLowerCase();\r\n var $matchCheck = $matchReg.test($optionText);\r\n if ($matchCheck) {\r\n $this.show().removeClass(\"disabled\");\r\n } else {\r\n $this.hide().addClass(\"disabled\");\r\n }\r\n })\r\n } else {\r\n $options.show();\r\n }\r\n }\r\n });\r\n\r\n // Close when clicking outside\r\n $(document).on('click.nice_select', function (event) {\r\n if ($(event.target).closest('.nice-select').length === 0) {\r\n $('.nice-select').removeClass('open').find('.option');\r\n }\r\n });\r\n\r\n // Option click\r\n $(document).on('click.nice_select', '.nice-select .option:not(.disabled)', function (event) {\r\n var $option = $(this);\r\n var $dropdown = $option.closest('.nice-select');\r\n\r\n $dropdown.find('.selected').removeClass('selected');\r\n $option.addClass('selected');\r\n\r\n var text = $option.data('display') || $option.text();\r\n $dropdown.find('.current').text(text);\r\n\r\n $dropdown.prev('select').val($option.data('value')).trigger('change');\r\n });\r\n\r\n // Keyboard events\r\n $(document).on('keydown.nice_select', '.nice-select', function (event) {\r\n var $dropdown = $(this);\r\n var $focused_option = $($dropdown.find('.focus') || $dropdown.find('.list .option.selected'));\r\n\r\n // Space or Enter\r\n if (event.keyCode == 13) {\r\n if ($dropdown.hasClass('open')) {\r\n $focused_option.trigger('click');\r\n } else {\r\n $dropdown.trigger('click');\r\n }\r\n return false;\r\n // Down\r\n } else if (event.keyCode == 40) {\r\n if (!$dropdown.hasClass('open')) {\r\n $dropdown.trigger('click');\r\n } else {\r\n var $next = $focused_option.nextAll('.option:not(.disabled)').first();\r\n if ($next.length > 0) {\r\n $dropdown.find('.focus').removeClass('focus');\r\n $next.addClass('focus');\r\n }\r\n }\r\n return false;\r\n // Up\r\n } else if (event.keyCode == 38) {\r\n if (!$dropdown.hasClass('open')) {\r\n $dropdown.trigger('click');\r\n } else {\r\n var $prev = $focused_option.prevAll('.option:not(.disabled)').first();\r\n if ($prev.length > 0) {\r\n $dropdown.find('.focus').removeClass('focus');\r\n $prev.addClass('focus');\r\n }\r\n }\r\n return false;\r\n // Esc\r\n } else if (event.keyCode == 27) {\r\n if ($dropdown.hasClass('open')) {\r\n $dropdown.trigger('click');\r\n }\r\n // Tab\r\n } else if (event.keyCode == 9) {\r\n if ($dropdown.hasClass('open')) {\r\n return false;\r\n }\r\n }\r\n });\r\n\r\n // Detect CSS pointer-events support, for IE <= 10. From Modernizr.\r\n var style = document.createElement('a').style;\r\n style.cssText = 'pointer-events:auto';\r\n if (style.pointerEvents !== 'auto') {\r\n $('html').addClass('no-csspointerevents');\r\n }\r\n\r\n return this;\r\n\r\n };\r\n\r\n}(jQuery));","import TaxonomyList from \"./TaxonomyList\"\r\n\r\nexport default class ContactPeopleTaxonomyList extends TaxonomyList {\r\n static init (querySelector = '.contact-people-list[data-source-id]') {\r\n Array.prototype.forEach.call(document.querySelectorAll(querySelector), element => {\r\n new ContactPeopleTaxonomyList(element)})\r\n }\r\n \r\n render (containerElement, groupsToRender) {\r\n var itemIndex = 0\r\n containerElement.innerHTML = ''\r\n groupsToRender.forEach((group) => {\r\n if (this.groupBy === 'True') {\r\n if (this.showGroupsCondensed === 'False') {\r\n var groupElement = document.createElement(\"li\")\r\n groupElement.classList.add('col-12')\r\n groupElement.innerHTML =\r\n ``;\r\n\r\n containerElement.appendChild(groupElement)\r\n }\r\n else if (this.showGroupsCondensed === 'True') {\r\n containerElement.classList.add('display-condensed')\r\n }\r\n }\r\n\r\n group.Items.forEach((item) => {\r\n itemIndex++\r\n\r\n var itemElement = document.createElement(\"li\")\r\n itemElement.classList.add('col-6')\r\n\r\n itemElement.style.opacity = itemIndex >= this.totalNumber ? 0 : 1\r\n itemElement.style.transition = `opacity 500ms ease-in`\r\n\r\n if (this.groupBy !== 'False' && group.GroupLabel) {\r\n itemElement.classList.add(group.GroupLabel.replace(' ', '-'));\r\n }\r\n\r\n itemElement.innerHTML =\r\n (``);\r\n\r\n containerElement.appendChild(itemElement)\r\n\r\n setTimeout(() => {\r\n itemElement.style.opacity = 1\r\n var imgForUpdate = itemElement.querySelector('img');\r\n if (imgForUpdate !== null && imgForUpdate !== 'undefined') {\r\n window.bLazy.load(itemElement.querySelector('img'), true);\r\n }\r\n\r\n if (itemElement.nextElementSibling !== null && this.groupBy === 'True' && this.showGroupsCondensed === 'True') {\r\n if (itemElement.className !== itemElement.nextElementSibling.className) {\r\n itemElement.setAttribute('data-last-in-group', 'True')\r\n }\r\n }\r\n if (itemElement.previousElementSibling !== null && this.groupBy === 'True' && this.showGroupsCondensed === 'True') {\r\n if (itemElement.className !== itemElement.previousElementSibling.className) {\r\n itemElement.setAttribute('data-first-in-group', 'True')\r\n }\r\n }\r\n }, itemIndex >= this.totalNumber ? ~~(Math.sqrt(itemIndex) * 115) : 0)\r\n })\r\n })\r\n }\r\n}","$(document).ready(function () {\r\n if (!navigator.userAgent.match(/(iPad)|(iPhone)|(iPod)|(android)|(webOS)/i) && ($(\".module-footermenu-list .nice-select\").length > 0 || $(\".module-dropdown .nice-select\").length > 0)) {\r\n var li = $(\".module-footermenu-list .nice-select > ul > li, .module-dropdown .nice-select > ul > li\");\r\n\r\n li.click(function () {\r\n window.open($(this).attr(\"value\"), $(this).attr(\"data-target\"));\r\n });\r\n\r\n li.keypress(function (e) {\r\n if (e.which == 13) {\r\n window.open($(this).attr(\"value\"), $(this).attr(\"data-target\"));\r\n }\r\n });\r\n } else if ($(\".module-footermenu-list select\").length > 0 || (\".module-dropdown select\").length > 0) {\r\n var select = $(\".module-footermenu-list select, .module-dropdown select\");\r\n select.change(function () {\r\n window.location.replace($(this).val());\r\n });\r\n }\r\n});","$(document).ready(function () {\r\n var video = $(\"[data-contentheader-video]\"),\r\n toggle = $(\"[data-contentheader-video-toggle]\");\r\n\r\n toggle.click(function () {\r\n videoToggle(toggle, video);\r\n });\r\n\r\n toggle.keypress(function (e) {\r\n // If enter.\r\n if (e.which == 13) {\r\n videoToggle();\r\n }\r\n // If space.\r\n if (e.which == 32) {\r\n videoToggle();\r\n }\r\n });\r\n if (video.length) {\r\n video[0].onended = function () {\r\n toggle.addClass(\"rerun\");\r\n toggle.removeClass(\"play\");\r\n toggle.removeClass(\"pause\");\r\n }\r\n };\r\n});\r\n\r\nfunction videoToggle(toggle, video) {\r\n if (video.length) {\r\n if (video[0].paused) {\r\n video[0].play();\r\n toggle.addClass(\"pause\");\r\n toggle.removeClass(\"play\");\r\n toggle.removeClass(\"rerun\");\r\n } else {\r\n video[0].pause();\r\n toggle.addClass(\"play\");\r\n toggle.removeClass(\"pause\");\r\n toggle.removeClass(\"rerun\");\r\n }\r\n }\r\n}\r\n","// IE Polyfill for \"foreach\"\r\nif (window.NodeList && !NodeList.prototype.forEach) {\r\n NodeList.prototype.forEach = function(callback, thisArg) {\r\n thisArg = thisArg || window;\r\n for (var i = 0; i < this.length; i++) {\r\n callback.call(thisArg, this[i], i, this);\r\n }\r\n };\r\n}\r\n\r\nfunction CookieConsent() {\r\n this.cookies;\r\n this.cookiesEnabled = false;\r\n this.categories = [];\r\n this.cookieHasBeenOpen = false;\r\n this.tabelhead = function(cookieContent, cookiehead) {\r\n return `\r\n \r\n \r\n | ${cookiehead.name} | \r\n ${cookiehead.company} | \r\n ${cookiehead.description} | \r\n ${cookiehead.expires} | \r\n
\r\n \r\n \r\n ${cookieContent}\r\n \r\n
`;\r\n };\r\n this.tabelbody = function(cookie, singleCookie, cookiehead) {\r\n return `\r\n | ${singleCookie} | \r\n ${cookie.company} | \r\n ${cookie.description} | \r\n ${cookie.expires} | \r\n
\r\n `;\r\n };\r\n this.cookiehead;\r\n\r\n //Native async request function to load json\r\n this.loadJSON = function(path, success, error) {\r\n var xhr = new XMLHttpRequest();\r\n xhr.onreadystatechange = function() {\r\n if (xhr.readyState === XMLHttpRequest.DONE) {\r\n if (xhr.status === 200) {\r\n if (success) success(JSON.parse(xhr.responseText));\r\n } else {\r\n if (error) error(xhr);\r\n }\r\n }\r\n };\r\n xhr.open(\"GET\", path, true);\r\n xhr.send();\r\n };\r\n\r\n this.init = function() {\r\n var _self = this;\r\n document.addEventListener(\"DOMContentLoaded\", function(event) {\r\n _self.cookiesEnabled =\r\n document.querySelector(\".cookie-container\") != null;\r\n\r\n if (_self.cookiesEnabled) {\r\n const hiddenInputCookiesContainer = document.querySelector(\r\n \"#hiddenInputCookiesContainer\"\r\n );\r\n\r\n if (\r\n hiddenInputCookiesContainer == null ||\r\n hiddenInputCookiesContainer.value == \"\"\r\n ) {\r\n const data = JSON.parse(\"[]\");\r\n _self.cookies = data;\r\n } else {\r\n const data = JSON.parse(hiddenInputCookiesContainer.value);\r\n _self.cookies = data;\r\n }\r\n\r\n _self.createGlobalCookieBtn();\r\n //Is user previously has accepted cookies\r\n if (_self.CheckCookieExistance(\"cookiesAccepted\")) {\r\n _self.runCookieScripts();\r\n } else {\r\n _self.openConsent();\r\n }\r\n }\r\n });\r\n };\r\n\r\n this.createGlobalCookieBtn = function() {\r\n var btnContainer = document.createElement(\"div\");\r\n btnContainer.classList.add(\"cookie-button-container\");\r\n\r\n var icon = document.createElement(\"i\");\r\n icon.innerHTML = \"ⓘ\";\r\n\r\n var textEl = document.createElement(\"span\");\r\n textEl.innerText = \"Cookies\";\r\n\r\n btnContainer.appendChild(icon);\r\n btnContainer.appendChild(textEl);\r\n btnContainer.tabIndex = 0; //add tabIndex\r\n\r\n var _self = this;\r\n\r\n btnContainer.addEventListener(\"click\", function() {\r\n _self.openConsent();\r\n });\r\n\r\n // open consent with tabIndex\r\n btnContainer.addEventListener(\"keydown\", function(e) {\r\n if (e.keyCode === 13) {\r\n _self.openConsent();\r\n }\r\n });\r\n\r\n var containerBtnContainer = document.querySelector(\".cookie-container\");\r\n\r\n containerBtnContainer.parentElement.insertBefore(\r\n btnContainer,\r\n containerBtnContainer\r\n );\r\n };\r\n\r\n this.setupConsentPopup = function() {\r\n var string = document.getElementById(\"CookieTableHead\").value;\r\n this.cookiehead = JSON.parse(string);\r\n\r\n this.sortCookiesIntoCategories();\r\n var _self = this;\r\n\r\n //ACCEPT BUTTON CLICK\r\n document\r\n .querySelector(\"#acceptCookies\")\r\n .addEventListener(\"click\", () => {\r\n var today = new Date();\r\n today.setTime(today.getTime() + 730 * 24 * 60 * 60 * 1000); // 2 years (730 days) from today\r\n var expires = today.toUTCString();\r\n _self.setCategoryCookies();\r\n document.cookie =\r\n \"cookiesAccepted=true; expires=\" + expires + \"; path=/;\";\r\n document\r\n .getElementsByClassName(\"cookie-container\")[0]\r\n .classList.remove(\"cookie-container--show\");\r\n _self.runCookieScripts();\r\n });\r\n document\r\n .querySelector(\"#rejectCookies\")\r\n .addEventListener(\"click\", () => {\r\n _self.rejectCookies();\r\n var today = new Date();\r\n today.setTime(today.getTime() + 730 * 24 * 60 * 60 * 1000); // 2 years (730 days) from today\r\n var expires = today.toUTCString();\r\n _self.setCategoryCookies();\r\n document.cookie =\r\n \"cookiesAccepted=true; expires=\" + expires + \"; path=/;\";\r\n document\r\n .getElementsByClassName(\"cookie-container\")[0]\r\n .classList.remove(\"cookie-container--show\");\r\n _self.runCookieScripts();\r\n });\r\n\r\n var showDetailButtonText = document\r\n .querySelectorAll(\"[data-toggle-details]\")[0]\r\n .getAttribute(\"data-details-show-title\");\r\n var hideDetailsButtonText = document\r\n .querySelectorAll(\"[data-toggle-details]\")[0]\r\n .getAttribute(\"data-details-hide-title\");\r\n var showMoreAboutCookieButton = document.querySelectorAll(\r\n \"[data-toggle-details]\"\r\n )[0];\r\n\r\n var categoriesTypesButton = document.querySelectorAll(\r\n \"[data-declartion-button]\"\r\n )[0];\r\n var aboutCookiesButton = document.querySelectorAll(\r\n \"[data-about-cookies-button]\"\r\n )[0];\r\n\r\n var categoriesTypesContainer = document.querySelectorAll(\r\n \"[data-categories-types-container]\"\r\n )[0];\r\n var aboutCookiesContainer = document.querySelectorAll(\r\n \"[data-detail-type-content]\"\r\n )[0];\r\n\r\n showMoreAboutCookieButton.innerHTML = showDetailButtonText;\r\n\r\n categoriesTypesContainer.classList.toggle(\r\n \"cookie-detail-tab-item--show\"\r\n );\r\n categoriesTypesButton.classList.toggle(\r\n \"cookie-detail-tab-button--active\"\r\n );\r\n\r\n categoriesTypesButton.addEventListener(\"click\", function() {\r\n if (\r\n !categoriesTypesContainer.classList.contains(\r\n \"cookie-detail-tab-item--show\"\r\n )\r\n ) {\r\n categoriesTypesButton.classList.toggle(\r\n \"cookie-detail-tab-button--active\"\r\n );\r\n aboutCookiesButton.classList.toggle(\r\n \"cookie-detail-tab-button--active\"\r\n );\r\n\r\n categoriesTypesContainer.classList.toggle(\r\n \"cookie-detail-tab-item--show\"\r\n );\r\n aboutCookiesContainer.classList.toggle(\r\n \"cookie-detail-tab-item--show\"\r\n );\r\n }\r\n });\r\n\r\n aboutCookiesButton.addEventListener(\"click\", function() {\r\n if (\r\n !aboutCookiesContainer.classList.contains(\r\n \"cookie-detail-tab-item--show\"\r\n )\r\n ) {\r\n categoriesTypesButton.classList.toggle(\r\n \"cookie-detail-tab-button--active\"\r\n );\r\n aboutCookiesButton.classList.toggle(\r\n \"cookie-detail-tab-button--active\"\r\n );\r\n\r\n categoriesTypesContainer.classList.toggle(\r\n \"cookie-detail-tab-item--show\"\r\n );\r\n aboutCookiesContainer.classList.toggle(\r\n \"cookie-detail-tab-item--show\"\r\n );\r\n }\r\n });\r\n\r\n showMoreAboutCookieButton.addEventListener(\"click\", function() {\r\n document\r\n .querySelectorAll(\"[data-cookie-detail]\")[0]\r\n .classList.toggle(\"cookie-detail--show\");\r\n if (showMoreAboutCookieButton.innerHTML === showDetailButtonText) {\r\n showMoreAboutCookieButton.innerHTML = hideDetailsButtonText;\r\n } else {\r\n showMoreAboutCookieButton.innerHTML = showDetailButtonText;\r\n }\r\n });\r\n };\r\n\r\n this.setCategoryCookies = function() {\r\n var _self = this;\r\n\r\n var checkboxContainers = document.getElementsByClassName(\r\n \"cookie-setting-checkbox\"\r\n );\r\n Array.prototype.forEach.call(checkboxContainers, function(container) {\r\n var checkbox = container.getElementsByTagName(\"input\")[0];\r\n\r\n var cookieName = checkbox.id.replace(\"categoryCheckbox\", \"\");\r\n\r\n //IF COOKIE EXISTS\r\n if (_self.CheckCookieExistance(cookieName)) {\r\n //REMOVE COOKIE\r\n document.cookie =\r\n cookieName +\r\n \"=; expires=Thu, 01 Jan 1970 00:00:00 UTC; path=/;\";\r\n }\r\n\r\n if (checkbox.checked === true) {\r\n //ADD COOKIE\r\n var today = new Date();\r\n today.setTime(today.getTime() + 730 * 24 * 60 * 60 * 1000); // 2 years (730 days) from today\r\n var expires = today.toUTCString();\r\n document.cookie =\r\n cookieName + \"=allow; expires=\" + expires + \"; path=/;\";\r\n }\r\n });\r\n };\r\n\r\n this.CheckCookieExistance = function(cname) {\r\n var name = cname + \"=\";\r\n var decodedCookie = decodeURIComponent(document.cookie);\r\n var ca = decodedCookie.split(\";\");\r\n for (var i = 0; i < ca.length; i++) {\r\n var c = ca[i];\r\n while (c.charAt(0) == \" \") {\r\n c = c.substring(1);\r\n }\r\n if (c.indexOf(name) == 0) {\r\n return true;\r\n }\r\n }\r\n return false;\r\n };\r\n\r\n this.openConsent = function() {\r\n if (!this.cookieHasBeenOpen) {\r\n this.setupConsentPopup();\r\n this.cookieHasBeenOpen = true;\r\n }\r\n\r\n document\r\n .getElementsByClassName(\"cookie-container\")[0]\r\n .classList.add(\"cookie-container--show\");\r\n };\r\n\r\n this.sortCookiesIntoCategories = function() {\r\n var _self = this;\r\n this.cookies.forEach(function(cookie) {\r\n if (_self.categories.length > 0) {\r\n var categoryExist = false;\r\n\r\n _self.categories.forEach(function(category) {\r\n if (category.name === cookie.category) {\r\n var catCookie = {\r\n company: cookie.company,\r\n description: cookie.categoryDescription,\r\n expires: cookie.expires,\r\n cookies: cookie.name\r\n };\r\n\r\n category.categoryCookies.push(catCookie);\r\n\r\n categoryExist = true;\r\n }\r\n });\r\n\r\n if (!categoryExist) {\r\n var catCookie = {\r\n company: cookie.company,\r\n description: cookie.categoryDescription,\r\n expires: cookie.expires,\r\n cookies: cookie.name\r\n };\r\n\r\n var cat = {\r\n name: cookie.category,\r\n categoryCookies: [catCookie]\r\n };\r\n\r\n _self.categories.push(cat);\r\n }\r\n } else {\r\n var catCookie = {\r\n company: cookie.company,\r\n description: cookie.categoryDescription,\r\n expires: cookie.expires,\r\n cookies: cookie.name\r\n };\r\n\r\n var cat = {\r\n name: cookie.category,\r\n categoryCookies: [catCookie]\r\n };\r\n\r\n _self.categories.push(cat);\r\n }\r\n });\r\n\r\n this.createCheckboks();\r\n this.createCategoryTabels();\r\n };\r\n\r\n this.runCookieScripts = function() {\r\n if (this.CheckCookieExistance(\"CookieCategory2\")) {\r\n // ikke obligatorisk\r\n this.runScripts();\r\n }\r\n };\r\n\r\n this.createCheckboks = function() {\r\n var _self = this;\r\n this.categories.forEach(function(category) {\r\n //Container for checkbox and label\r\n var checkboxContainer = document.createElement(\"div\");\r\n checkboxContainer.className = \"cookie-setting-checkbox\";\r\n\r\n //Checkbox for toggleing each category\r\n var checkbox = document.createElement(\"input\");\r\n checkbox.type = \"checkbox\";\r\n checkbox.name = \"categoryCheckbox\" + category.name;\r\n checkbox.id = \"categoryCheckbox\" + category.name;\r\n\r\n //Start tabIndex\r\n if (category.name !== \"CookieCategory1\") {\r\n checkboxContainer.tabIndex = 0;\r\n }\r\n checkboxContainer.addEventListener(\"keydown\", function(e) {\r\n if (e.keyCode === 13) {\r\n if (category.name !== \"CookieCategory1\") {\r\n if (checkbox.checked) {\r\n checkbox.checked = false;\r\n } else {\r\n checkbox.checked = true;\r\n }\r\n }\r\n }\r\n });\r\n //End tabIndex\r\n\r\n if (category.name === \"CookieCategory1\") {\r\n //MANDATORY\r\n checkbox.checked = true;\r\n checkbox.disabled = true;\r\n } else if (!_self.CheckCookieExistance(\"cookiesAccepted\")) {\r\n //CHECK ALL ON FIRST VISIT\r\n checkbox.checked = true;\r\n } else if (_self.CheckCookieExistance(category.name)) {\r\n //CHECK IF COOKIE SET\r\n checkbox.checked = true;\r\n }\r\n\r\n //Label for checkbox\r\n var label = document.createElement(\"label\");\r\n label.htmlFor = \"categoryCheckbox\" + category.name;\r\n label.appendChild(\r\n document.createTextNode(\r\n document.getElementById(category.name).value\r\n )\r\n );\r\n\r\n //Append checkbox and label to container\r\n checkboxContainer.appendChild(checkbox);\r\n checkboxContainer.appendChild(label);\r\n\r\n //Append container to dom\r\n document\r\n .querySelectorAll(\"[data-categories]\")[0]\r\n .appendChild(checkboxContainer);\r\n });\r\n };\r\n\r\n this.runCookie = function(cookie) {\r\n if (cookie.accept && !cookie.runned) {\r\n cookie.runned = true;\r\n eval(\"(\" + cookie.accept + \")\")();\r\n }\r\n };\r\n\r\n this.rejectCookies = () => {\r\n var checkboxContainers = document.getElementsByClassName(\r\n \"cookie-setting-checkbox\"\r\n );\r\n Array.prototype.forEach.call(checkboxContainers, function(container) {\r\n var checkbox = container.getElementsByTagName(\"input\")[0];\r\n\r\n if (checkbox.name !== \"categoryCheckboxCookieCategory1\") {\r\n checkbox.checked = false;\r\n }\r\n });\r\n };\r\n\r\n this.runScripts = function() {\r\n var scriptTags = document.querySelectorAll(\"[type='text/plain']\");\r\n var _self = this;\r\n scriptTags.forEach(function(script) {\r\n var scriptToLoad = script.cloneNode(true);\r\n scriptToLoad.setAttribute(\"type\", \"text/javascript\");\r\n _self.insertAfter(script, scriptToLoad);\r\n });\r\n };\r\n\r\n this.insertAfter = function(referenceNode, newNode) {\r\n referenceNode.parentNode.insertBefore(\r\n newNode,\r\n referenceNode.nextSibling\r\n );\r\n };\r\n\r\n this.createCategoryTabels = function() {\r\n var self = this;\r\n this.categories.forEach(function(category, index) {\r\n var cookieCategoryTypeLink = document.createElement(\"a\");\r\n\r\n //Start tabIndex effect\r\n cookieCategoryTypeLink.tabIndex = 0;\r\n cookieCategoryTypeLink.addEventListener(\"keydown\", function(e) {\r\n if (e.keyCode === 13) {\r\n var cookieCategoryToShow = document.querySelectorAll(\r\n '[data-category-type=\"' + category.name + '\"]'\r\n )[0];\r\n var allCookieCategories = document.querySelectorAll(\r\n \"[data-category-type]\"\r\n );\r\n\r\n if (\r\n !cookieCategoryToShow.classList.contains(\r\n \"cookie-type-container--show\"\r\n )\r\n ) {\r\n allCookieCategories.forEach(function(el) {\r\n el.classList.remove(\"cookie-type-container--show\");\r\n });\r\n cookieCategoryToShow.classList.add(\r\n \"cookie-type-container--show\"\r\n );\r\n var allCookiteCategorieLinks = document.querySelectorAll(\r\n \"[data-categories-types] a\"\r\n );\r\n\r\n allCookiteCategorieLinks.forEach(function(el) {\r\n el.classList.remove(\"cookie-type-link--active\");\r\n });\r\n\r\n this.classList.add(\"cookie-type-link--active\");\r\n }\r\n }\r\n });\r\n //End tabIndex effect\r\n\r\n cookieCategoryTypeLink.addEventListener(\"click\", function() {\r\n var cookieCategoryToShow = document.querySelectorAll(\r\n '[data-category-type=\"' + category.name + '\"]'\r\n )[0];\r\n var allCookieCategories = document.querySelectorAll(\r\n \"[data-category-type]\"\r\n );\r\n\r\n if (\r\n !cookieCategoryToShow.classList.contains(\r\n \"cookie-type-container--show\"\r\n )\r\n ) {\r\n allCookieCategories.forEach(function(el) {\r\n el.classList.remove(\"cookie-type-container--show\");\r\n });\r\n cookieCategoryToShow.classList.add(\r\n \"cookie-type-container--show\"\r\n );\r\n var allCookiteCategorieLinks = document.querySelectorAll(\r\n \"[data-categories-types] a\"\r\n );\r\n allCookiteCategorieLinks.forEach(function(el) {\r\n el.classList.remove(\"cookie-type-link--active\");\r\n });\r\n this.classList.add(\"cookie-type-link--active\");\r\n }\r\n });\r\n\r\n cookieCategoryTypeLink.classList.add(\"cookie-type-link\");\r\n //cookieCategoryTypeLink.setAttribute(\"data-category-type-link\", category.name);\r\n\r\n var cookieCategoryTypeContainer = document.createElement(\"div\");\r\n cookieCategoryTypeContainer.setAttribute(\r\n \"data-category-type\",\r\n category.name\r\n );\r\n cookieCategoryTypeContainer.className = \"cookie-type-container\";\r\n\r\n if (index === 0) {\r\n cookieCategoryTypeContainer.classList.add(\r\n \"cookie-type-container--show\"\r\n );\r\n cookieCategoryTypeLink.classList.add(\r\n \"cookie-type-link--active\"\r\n );\r\n }\r\n var cookiesHtml = \"\";\r\n category.categoryCookies.forEach(function(cookie) {\r\n var thisCookie = cookie;\r\n\r\n cookie.cookies.forEach(function(singleCookie) {\r\n //Using template string function table body to generate html\r\n var cookieHtml = self.tabelbody(\r\n thisCookie,\r\n singleCookie,\r\n self.cookiehead\r\n );\r\n cookiesHtml += cookieHtml;\r\n });\r\n });\r\n\r\n //Using tmeplate string function, insert generated body into table head function\r\n var tabelHtml = self.tabelhead(cookiesHtml, self.cookiehead);\r\n cookieCategoryTypeContainer.innerHTML = tabelHtml;\r\n\r\n document\r\n .querySelectorAll(\"[data-categories-types-details]\")[0]\r\n .appendChild(cookieCategoryTypeContainer);\r\n cookieCategoryTypeLink.appendChild(\r\n document.createTextNode(\r\n document.getElementById(category.name).value\r\n )\r\n );\r\n document\r\n .querySelectorAll(\"[data-categories-types]\")[0]\r\n .appendChild(cookieCategoryTypeLink);\r\n });\r\n };\r\n}\r\n\r\n/*\r\n * classList.js: Cross-browser full element.classList implementation.\r\n * 1.1.20170427\r\n *\r\n * By Eli Grey, http://eligrey.com\r\n * License: Dedicated to the public domain.\r\n * See https://github.com/eligrey/classList.js/blob/master/LICENSE.md\r\n */\r\n\r\n/*global self, document, DOMException */\r\n\r\n/*! @source http://purl.eligrey.com/github/classList.js/blob/master/classList.js */\r\n\"document\" in window.self &&\r\n ((\"classList\" in document.createElement(\"_\") &&\r\n (!document.createElementNS ||\r\n \"classList\" in\r\n document.createElementNS(\"http://www.w3.org/2000/svg\", \"g\"))) ||\r\n (function(t) {\r\n \"use strict\";\r\n if (\"Element\" in t) {\r\n var e = \"classList\",\r\n n = \"prototype\",\r\n i = t.Element[n],\r\n s = Object,\r\n r =\r\n String[n].trim ||\r\n function() {\r\n return this.replace(/^\\s+|\\s+$/g, \"\");\r\n },\r\n o =\r\n Array[n].indexOf ||\r\n function(t) {\r\n for (var e = 0, n = this.length; e < n; e++)\r\n if (e in this && this[e] === t) return e;\r\n return -1;\r\n },\r\n c = function(t, e) {\r\n (this.name = t),\r\n (this.code = DOMException[t]),\r\n (this.message = e);\r\n },\r\n a = function(t, e) {\r\n if (\"\" === e)\r\n throw new c(\r\n \"SYNTAX_ERR\",\r\n \"An invalid or illegal string was specified\"\r\n );\r\n if (/\\s/.test(e))\r\n throw new c(\r\n \"INVALID_CHARACTER_ERR\",\r\n \"String contains an invalid character\"\r\n );\r\n return o.call(t, e);\r\n },\r\n l = function(t) {\r\n for (\r\n var e = r.call(t.getAttribute(\"class\") || \"\"),\r\n n = e ? e.split(/\\s+/) : [],\r\n i = 0,\r\n s = n.length;\r\n i < s;\r\n i++\r\n )\r\n this.push(n[i]);\r\n this._updateClassName = function() {\r\n t.setAttribute(\"class\", this.toString());\r\n };\r\n },\r\n u = (l[n] = []),\r\n f = function() {\r\n return new l(this);\r\n };\r\n if (\r\n ((c[n] = Error[n]),\r\n (u.item = function(t) {\r\n return this[t] || null;\r\n }),\r\n (u.contains = function(t) {\r\n return -1 !== a(this, (t += \"\"));\r\n }),\r\n (u.add = function() {\r\n for (\r\n var t, e = arguments, n = 0, i = e.length, s = !1;\r\n (t = e[n] + \"\"),\r\n -1 === a(this, t) && (this.push(t), (s = !0)),\r\n ++n < i;\r\n\r\n );\r\n s && this._updateClassName();\r\n }),\r\n (u.remove = function() {\r\n var t,\r\n e,\r\n n = arguments,\r\n i = 0,\r\n s = n.length,\r\n r = !1;\r\n do {\r\n for (t = n[i] + \"\", e = a(this, t); -1 !== e; )\r\n this.splice(e, 1), (r = !0), (e = a(this, t));\r\n } while (++i < s);\r\n r && this._updateClassName();\r\n }),\r\n (u.toggle = function(t, e) {\r\n t += \"\";\r\n var n = this.contains(t),\r\n i = n ? !0 !== e && \"remove\" : !1 !== e && \"add\";\r\n return i && this[i](t), !0 === e || !1 === e ? e : !n;\r\n }),\r\n (u.toString = function() {\r\n return this.join(\" \");\r\n }),\r\n s.defineProperty)\r\n ) {\r\n var h = { get: f, enumerable: !0, configurable: !0 };\r\n try {\r\n s.defineProperty(i, e, h);\r\n } catch (t) {\r\n (void 0 !== t.number && -2146823252 !== t.number) ||\r\n ((h.enumerable = !1), s.defineProperty(i, e, h));\r\n }\r\n } else s[n].__defineGetter__ && i.__defineGetter__(e, f);\r\n }\r\n })(window.self),\r\n (function() {\r\n \"use strict\";\r\n var t = document.createElement(\"_\");\r\n if ((t.classList.add(\"c1\", \"c2\"), !t.classList.contains(\"c2\"))) {\r\n var e = function(t) {\r\n var i = DOMTokenList.prototype[t];\r\n DOMTokenList.prototype[t] = function(t) {\r\n var e,\r\n n = arguments.length;\r\n for (e = 0; e < n; e++) (t = arguments[e]), i.call(this, t);\r\n };\r\n };\r\n e(\"add\"), e(\"remove\");\r\n }\r\n if ((t.classList.toggle(\"c3\", !1), t.classList.contains(\"c3\"))) {\r\n var n = DOMTokenList.prototype.toggle;\r\n DOMTokenList.prototype.toggle = function(t, e) {\r\n return 1 in arguments && !this.contains(t) == !e\r\n ? e\r\n : n.call(this, t);\r\n };\r\n }\r\n t = null;\r\n })());\r\n\r\nvar cookie = new CookieConsent();\r\ncookie.init();\r\n","$(document).ready(function () {\r\n // Add smooth scrolling to all links\r\n $(\"a\").on('click', function (event) {\r\n\r\n var currentUrl = window.location.origin + window.location.pathname\r\n var thisUrlStripped = $(this).attr(\"href\").replace(this.hash, \"\")\r\n // Make sure this.hash has a value before overriding default behavior\r\n if (this.hash !== \"\" && $(this.hash).length && currentUrl.indexOf(thisUrlStripped) > -1) {\r\n\r\n // Prevent default anchor click behavior\r\n event.preventDefault();\r\n\r\n // Store hash\r\n var hash = this.hash;\r\n\r\n // Using jQuery's animate() method to add smooth page scroll\r\n // The optional number (800) specifies the number of milliseconds it takes to scroll to the specified area\r\n $('html, body').animate({\r\n scrollTop: $(hash).offset().top\r\n }, 800, function () {\r\n\r\n // Add hash (#) to URL when done scrolling (default click behavior)\r\n window.location.hash = hash;\r\n });\r\n } // End if\r\n });\r\n});","$(document).ready(function () {\r\n var form = $('form[data-wffm]');\r\n\r\n var pageHeader = $('div.page-header', form);\r\n\r\n pageHeader.removeClass('page-header');\r\n\r\n $(pageHeader).replaceWith(function () {\r\n return $(this).html().replace('h1>', 'h3>');\r\n });\r\n\r\n $(document).on(\"tap click\", 'form[data-wffm] label a', function (event, data) {\r\n event.stopPropagation();\r\n event.preventDefault();\r\n window.open($(this).attr('href'), $(this).attr('target'));\r\n return false;\r\n });\r\n});","import GlueFrame from \"./../_lib/GlueFrame/GlueFrame\";\r\n\r\nwindow.youTube = function(id, videoUrl) {\r\n if (window.__youtube_inited === undefined) {\r\n window.__youtube_inited = true;\r\n\r\n var tag = document.createElement(\"script\");\r\n tag.src = \"https://www.youtube.com/iframe_api\";\r\n\r\n var firstScriptTag = document.getElementsByTagName(\"script\")[0];\r\n firstScriptTag.parentNode.insertBefore(tag, firstScriptTag);\r\n\r\n window.pendingPlayers = [];\r\n window.onYouTubeIframeAPIReady = function() {\r\n window.pendingPlayers.forEach(function(player) {\r\n player.ytPlayer = new YT.Player(player.container, {\r\n height: \"720\",\r\n width: \"1280\",\r\n videoId: player.videoId,\r\n events: {\r\n onReady: player.onPlayerReady,\r\n onStateChange: player.onPlayerStateChange\r\n },\r\n playerVars: {\r\n controls: 0,\r\n modestbranding: 1,\r\n showinfo: 0,\r\n rel: 0\r\n }\r\n });\r\n });\r\n };\r\n }\r\n\r\n var thumbnail = document\r\n .getElementById(`video-container-${id}`)\r\n .querySelector(\".module-video-thumbnail\");\r\n var timeout = setTimeout(function() {});\r\n var player = {\r\n container: document.getElementById(`video-${id}`),\r\n videoId: `${videoUrl}`,\r\n onPlayerReady: function(event) {\r\n // event.target.playVideo()\r\n },\r\n onPlayerStateChange: function(event) {\r\n if (event.data === 0) {\r\n player.ytPlayer.stopVideo();\r\n thumbnail.style.zIndex = 0;\r\n thumbnail.style.opacity = 1;\r\n }\r\n if (event.data === 1) {\r\n clearTimeout(timeout);\r\n thumbnail.style.opacity = 0;\r\n timeout = timeout = setTimeout(function() {\r\n thumbnail.style.zIndex = -1;\r\n }, 500);\r\n }\r\n if (event.data === 2) {\r\n clearTimeout(timeout);\r\n timeout = setTimeout(function() {\r\n thumbnail.style.zIndex = 0;\r\n thumbnail.style.opacity = 1;\r\n }, 200);\r\n }\r\n }\r\n };\r\n\r\n thumbnail.addEventListener(\"click\", function(event) {\r\n if (player.ytPlayer) {\r\n if (player.ytPlayer.getPlayerState() !== 1) {\r\n if (event.target.classList.contains(\"video-trigger\")) {\r\n player.ytPlayer.playVideo();\r\n thumbnail\r\n .querySelector(\".module-video-play-button\")\r\n .classList.add(\"starting\");\r\n setTimeout(function() {\r\n thumbnail\r\n .querySelector(\".module-video-play-button\")\r\n .classList.remove(\"starting\");\r\n }, 1000);\r\n }\r\n }\r\n }\r\n });\r\n\r\n window.pendingPlayers.push(player);\r\n};\r\n\r\nwindow.vimeo = function(id, videoUrl) {\r\n var options = {\r\n id: `${videoUrl}`,\r\n height: 720,\r\n width: 1280,\r\n loop: false\r\n };\r\n var thumbnail = document\r\n .getElementById(`video-container-${id}`)\r\n .querySelector(\".module-video-thumbnail\");\r\n var timeout = setTimeout(function() {});\r\n var player = new Vimeo.Player(`video-${id}`, options);\r\n\r\n player.on(\"play\", function() {\r\n clearTimeout(timeout);\r\n thumbnail.style.opacity = 0;\r\n timeout = timeout = setTimeout(function() {\r\n thumbnail.style.zIndex = -1;\r\n }, 500);\r\n });\r\n player.on(\"pause\", function() {\r\n clearTimeout(timeout);\r\n timeout = setTimeout(function() {\r\n thumbnail.style.zIndex = 0;\r\n thumbnail.style.opacity = 1;\r\n }, 200);\r\n });\r\n player.on(\"ended\", function() {\r\n thumbnail.style.zIndex = 0;\r\n thumbnail.style.opacity = 1;\r\n });\r\n\r\n thumbnail.addEventListener(\"click\", function(event) {\r\n if (event.target.classList.contains(\"video-trigger\")) {\r\n player.play();\r\n thumbnail\r\n .querySelector(\".module-video-play-button\")\r\n .classList.add(\"starting\");\r\n setTimeout(function() {\r\n thumbnail\r\n .querySelector(\".module-video-play-button\")\r\n .classList.remove(\"starting\");\r\n }, 1000);\r\n }\r\n });\r\n};\r\n\r\nwindow.twentyThree = function(id, videoUrl) {\r\n var Player;\r\n var embedIframe = ``;\r\n var container = document.getElementById(`video-${id}`);\r\n container.innerHTML = embedIframe;\r\n var frame = container.querySelectorAll(\"iframe\")[0];\r\n var thumbnail = document\r\n .getElementById(`video-container-${id}`)\r\n .querySelector(\".module-video-thumbnail\");\r\n var timeout = setTimeout(function() {});\r\n\r\n var lookForGlueGrame = function(callback) {\r\n if (typeof GlueFrame != \"undefined\") {\r\n callback();\r\n } else {\r\n window.setTimeout(function() {\r\n lookForGlueGrame(callback);\r\n }, 100);\r\n }\r\n };\r\n\r\n var loadGlueFrame = function(frame, callback) {\r\n if (typeof GlueFrame != \"undefined\") {\r\n callback(frame);\r\n } else {\r\n lookForGlueGrame(function() {\r\n callback(frame);\r\n });\r\n }\r\n };\r\n\r\n loadGlueFrame(frame, function() {\r\n Player = new GlueFrame(frame, `Player${id}`);\r\n\r\n Player.bind(\"player:video:play\", function(e) {\r\n clearTimeout(timeout);\r\n thumbnail.style.opacity = 0;\r\n timeout = timeout = setTimeout(function() {\r\n thumbnail.style.zIndex = -1;\r\n }, 500);\r\n });\r\n Player.bind(\"player:video:pause\", function(e) {\r\n clearTimeout(timeout);\r\n timeout = setTimeout(function() {\r\n thumbnail.style.zIndex = 0;\r\n thumbnail.style.opacity = 1;\r\n }, 200);\r\n });\r\n Player.bind(\"player:video:end\", function(e) {\r\n thumbnail.style.zIndex = 0;\r\n thumbnail.style.opacity = 1;\r\n });\r\n });\r\n\r\n thumbnail.addEventListener(\"click\", function(event) {\r\n if (event.target.classList.contains(\"video-trigger\")) {\r\n Player.set(\"playing\", true);\r\n thumbnail\r\n .querySelector(\".module-video-play-button\")\r\n .classList.add(\"starting\");\r\n setTimeout(function() {\r\n thumbnail\r\n .querySelector(\".module-video-play-button\")\r\n .classList.remove(\"starting\");\r\n }, 1000);\r\n }\r\n });\r\n};\r\n","// https://github.com/23/GlueFrame\r\n// GlueFrame.js Last updated 30 april 2017.\r\nexport default function(iframe, appName) {\r\n var $this = this;\r\n\r\n // GlueFrame version\r\n $this.glueframe = \"1.1.3\";\r\n\r\n // Allow posting messages only to the domain of the app\r\n var _domain = (\"\" + iframe.src)\r\n .split(\"/\")\r\n .slice(0, 3)\r\n .join(\"/\");\r\n\r\n // Determine method of communication with iframe\r\n var _method = (function() {\r\n if (\r\n _domain ==\r\n (\"\" + window.location)\r\n .split(\"/\")\r\n .slice(0, 3)\r\n .join(\"/\")\r\n ) {\r\n return \"object\";\r\n } else if (typeof window.postMessage !== \"undefined\") {\r\n return \"post\";\r\n } else {\r\n return \"none\";\r\n }\r\n })();\r\n\r\n // Poll the iframe until the app is bootstrapped\r\n $this.ready = false;\r\n var _readyInterval = window.setInterval(function() {\r\n if (!this.ready && _method === \"object\") {\r\n if (\r\n iframe.contentWindow[appName] &&\r\n iframe.contentWindow[appName].bootstrapped\r\n ) {\r\n $this.ready = true;\r\n window.clearInterval(_readyInterval);\r\n _processQueue();\r\n }\r\n } else if (!this.ready && _method === \"post\") {\r\n $this.get(\r\n \"bootstrapped\",\r\n function(bootstrapped) {\r\n if (bootstrapped) {\r\n $this.ready = true;\r\n window.clearInterval(_readyInterval);\r\n _processQueue();\r\n }\r\n },\r\n true\r\n );\r\n }\r\n }, 100);\r\n\r\n $this.glueFrameId = Math.floor(new Date().getTime() * Math.random());\r\n var _callbackCount = 0;\r\n var _callbacks = {};\r\n\r\n // Store callback functions in the parent window\r\n var _registerCallback = function(callback, requireCallback) {\r\n var callbackIdentifier = $this.glueFrameId + \"_\" + ++_callbackCount;\r\n if (typeof callback === \"function\") {\r\n _callbacks[callbackIdentifier] = callback;\r\n } else if (requireCallback) {\r\n throw \"GlueFrame: Callback not registered correctly.\";\r\n }\r\n return callbackIdentifier;\r\n };\r\n\r\n // Queue up method calls until app is ready\r\n var _queue = [];\r\n var _addToQueue = function(method, args) {\r\n _queue.push({ method: method, args: args });\r\n };\r\n\r\n // Loop through queue when app is ready\r\n var _processQueue = function() {\r\n for (var i = 0; i < _queue.length; i += 1) {\r\n var queueItem = _queue[i];\r\n queueItem.method.apply(null, queueItem.args);\r\n }\r\n _queue = [];\r\n $this.set(\"queuedEventsProcessed\", true);\r\n };\r\n\r\n $this.get = function(prop, callback, force) {\r\n if (!$this.ready && !force) {\r\n _addToQueue($this.get, [prop, callback]);\r\n return;\r\n }\r\n var cbId = _registerCallback(callback, true);\r\n if (_method === \"object\") {\r\n var value = iframe.contentWindow[appName].get.apply(null, [prop]);\r\n if (typeof _callbacks[cbId] !== \"undefined\") {\r\n _callbacks[cbId].apply(null, [value]);\r\n }\r\n } else if (_method === \"post\") {\r\n var messageObject = { f: \"get\", args: [prop], cbId: cbId };\r\n iframe.contentWindow.postMessage(\r\n JSON.stringify(messageObject),\r\n force ? \"*\" : _domain\r\n );\r\n }\r\n };\r\n\r\n $this.set = function(prop, val, callback) {\r\n if (!$this.ready) {\r\n _addToQueue($this.set, [prop, val, callback]);\r\n return;\r\n }\r\n var cbId = _registerCallback(callback, false);\r\n if (_method === \"object\") {\r\n var value = iframe.contentWindow[appName].set.apply(null, [\r\n prop,\r\n val\r\n ]);\r\n if (typeof _callbacks[cbId] !== \"undefined\") {\r\n _callbacks[cbId].apply(null, [value]);\r\n }\r\n } else if (_method === \"post\") {\r\n var messageObject = { f: \"set\", args: [prop, val], cbId: cbId };\r\n iframe.contentWindow.postMessage(\r\n JSON.stringify(messageObject),\r\n _domain\r\n );\r\n }\r\n };\r\n\r\n $this.bind = function(event, callback, triggerQueue) {\r\n var triggerQueue = triggerQueue || false;\r\n if (!$this.ready) {\r\n _addToQueue($this.bind, [event, callback, true]);\r\n return;\r\n }\r\n var cbId = _registerCallback(callback, true);\r\n if (_method === \"object\") {\r\n iframe.contentWindow[appName].bind.apply(null, [\r\n event,\r\n callback,\r\n triggerQueue\r\n ]);\r\n } else if (_method === \"post\") {\r\n var messageObject = {\r\n f: \"bind\",\r\n args: [event],\r\n cbId: cbId,\r\n triggerQueue: triggerQueue\r\n };\r\n iframe.contentWindow.postMessage(\r\n JSON.stringify(messageObject),\r\n _domain\r\n );\r\n }\r\n };\r\n\r\n $this.fire = function(event, obj) {\r\n if (!$this.ready) {\r\n _addToQueue($this.fire, [event, obj]);\r\n return;\r\n }\r\n if (_method === \"object\") {\r\n return iframe.contentWindow[appName].fire.apply(null, [event, obj]);\r\n } else if (_method === \"post\") {\r\n var messageObject = { f: \"fire\", args: [event, obj] };\r\n iframe.contentWindow.postMessage(\r\n JSON.stringify(messageObject),\r\n _domain\r\n );\r\n }\r\n };\r\n\r\n // Remove event listeners, callbacks and intervals\r\n $this.destroy = function() {\r\n if (window.addEventListener) {\r\n window.removeEventListener(\"message\", _receiveMessage, false);\r\n } else {\r\n window.detachEvent(\"onmessage\", _receiveMessage);\r\n }\r\n window.clearInterval(_readyInterval);\r\n _callbacks = {};\r\n };\r\n\r\n // Parse messages received from iframe\r\n var _receiveMessage = function(e) {\r\n if (e.origin === _domain) {\r\n var data;\r\n try {\r\n data = JSON.parse(e.data);\r\n } catch (e) {}\r\n if (\r\n typeof data !== \"undefined\" &&\r\n typeof data.cbId !== \"undefined\" &&\r\n typeof _callbacks[data.cbId] === \"function\"\r\n ) {\r\n _callbacks[data.cbId].apply(null, [data.a, data.b]);\r\n }\r\n }\r\n };\r\n\r\n // Listen for message events if need\r\n if (window.addEventListener) {\r\n window.addEventListener(\"message\", _receiveMessage, false);\r\n } else {\r\n window.attachEvent(\"onmessage\", _receiveMessage);\r\n }\r\n}\r\n","$(function() {\r\n let notifications = $(\".module-banner__notification\");\r\n notifications.each(function() {\r\n if (!$(\"body\").hasClass(\"website-state-edit\")) {\r\n let btn = $(\"button\", this);\r\n let textContent = $(\".module-banner-text-container\", this);\r\n textContent.hide();\r\n btn.on(\"click\", function() {\r\n btn.toggleClass(\"notification-expanded\");\r\n let isAriaExp = $(this).attr(\"aria-expanded\");\r\n let newAriaExp = isAriaExp == \"false\" ? \"true\" : \"false\";\r\n $(this).attr(\"aria-expanded\", newAriaExp);\r\n\r\n let isAriaHid = textContent.attr(\"aria-hidden\");\r\n\r\n if (isAriaHid == \"true\") {\r\n textContent.attr(\"aria-hidden\", \"false\");\r\n textContent.slideDown(\"fast\", function() {});\r\n } else {\r\n textContent.attr(\"aria-hidden\", \"true\");\r\n textContent.slideUp(\"fast\");\r\n }\r\n });\r\n }\r\n });\r\n});\r\n","$(document).ready(function () {\r\n const newsModule = $('#ritzauNews');\r\n const newsNav = $('.news-nav');\r\n const toggles = $('.accordion-toggle');\r\n const sections = $('.module-news-section');\r\n const search = $('.js-search-news');\r\n\r\n if (newsModule && typeof URL !== 'undefined') {\r\n // Remove query parameters from URL on page load\r\n const url = new URL(window.location.toString());\r\n var currentPage = url.searchParams.has('page') ? parseInt(url.searchParams.get('page')) : 1;\r\n var currentSearch = url.searchParams.get('search');\r\n url.searchParams.delete('page');\r\n url.searchParams.delete('search');\r\n window.history.replaceState({}, '', url);\r\n\r\n newsNav.click(function(){\r\n const index = $(this).attr('data-page');\r\n filterNews(index);\r\n });\r\n\r\n toggles.click(function() {\r\n const target = $(this).attr('data-target');\r\n const targetElement = $(`[data-id='${target}']`);\r\n\r\n if (targetElement) {\r\n toggles.removeClass('active');\r\n $(this).addClass('active');\r\n sections.hide();\r\n targetElement.show();\r\n }\r\n });\r\n\r\n search.submit(function(e) {\r\n e.preventDefault();\r\n const searchTerm = search.find('input').val();\r\n window.location.href = url + '?search=' + encodeURIComponent(searchTerm);\r\n });\r\n\r\n function filterNews(index) {\r\n const url = new URL(window.location.toString());\r\n\r\n if (index === '-') {\r\n url.searchParams.set('page', currentPage - 1);\r\n } else if (index === '+') {\r\n url.searchParams.set('page', currentPage + 1);\r\n } else {\r\n url.searchParams.set('page', index);\r\n }\r\n \r\n if (currentSearch) {\r\n url.searchParams.set('search', currentSearch);\r\n }\r\n window.history.pushState({}, '', url);\r\n window.history.go();\r\n };\r\n }\r\n});","import flatpickr from \"flatpickr\";\r\n\r\n$(document).ready(function () {\r\n const $form = $('.js-addPostingForm');\r\n const $startDate = $('.js-startDate');\r\n const $endDate = $('.js-endDate');\r\n const $postingsList = $('.js-postingsList');\r\n const $userEmail = $('.js-userEmail');\r\n\r\n initDatepickers();\r\n\r\n if ($form.length && $postingsList.length) {\r\n init();\r\n }\r\n\r\n function initDatepickers() {\r\n const startDate = flatpickr($startDate, {\r\n dateFormat: 'Y-m-d',\r\n altInput: true,\r\n altFormat: 'd-m-Y',\r\n allowInput: true,\r\n onChange: function(sel, date) {\r\n endDate.set(\"minDate\", date);\r\n }\r\n });\r\n\r\n const endDate = flatpickr($endDate, {\r\n dateFormat: 'Y-m-d',\r\n altInput: true,\r\n altFormat: 'd-m-Y',\r\n allowInput: true,\r\n onChange: function(sel, date) {\r\n startDate.set(\"maxDate\", date);\r\n }\r\n });\r\n };\r\n\r\n const dateFormatter = (dateString) => {\r\n var date = new Date(dateString);\r\n var day = String(date.getDate()).padStart(2, '0');\r\n var month = String(date.getMonth() + 1).padStart(2, '0');\r\n var year = date.getFullYear();\r\n \r\n return day + '.' + month + '.' + year;\r\n }\r\n\r\n const validFields = () => {\r\n if ($startDate.val() === '' || $endDate.val() === '') {\r\n $form.addClass('has-errors');\r\n return false;\r\n } else {\r\n $form.removeClass('has-errors');\r\n return true;\r\n }\r\n };\r\n\r\n const submitForm = (data) => {\r\n $form.addClass('is-loading');\r\n\r\n $.ajax({\r\n url: '/api/user/AddPosting',\r\n type: 'post',\r\n data,\r\n success: function (id) {\r\n loadPostings('append', id);\r\n $form.removeClass('is-loading');\r\n },\r\n error: function (err) {\r\n console.error(\"Error submitting posting - \", err)\r\n\r\n $form.addClass('has-errors');\r\n $form.removeClass('is-loading');\r\n }\r\n });\r\n };\r\n\r\n $form.submit(function(e){\r\n e.preventDefault();\r\n\r\n if(!validFields()) {\r\n return;\r\n }\r\n\r\n const data = $(this).serialize();\r\n\r\n submitForm(data);\r\n });\r\n\r\n const postingHtmlBuilder = (posting) => {\r\n return `\r\n ${posting.City}\r\n \r\n ${dateFormatter(posting.StartDate)} - \r\n ${dateFormatter(posting.EndDate)}\r\n \r\n
\r\n `;\r\n };\r\n\r\n $(document).on('click', '.js-deletePostingButton', function() {\r\n deletePosting($(this).attr('data-posting-id'));\r\n });\r\n\r\n function deletePosting(postingId) {\r\n if (!postingId) {\r\n return;\r\n }\r\n\r\n $.ajax({\r\n url: '/api/user/RemovePosting',\r\n type: 'post',\r\n contentType: 'application/json',\r\n data: JSON.stringify(postingId),\r\n success: function () {\r\n loadPostings('replace');\r\n },\r\n error: function (err) {\r\n console.error(\"Error removing posting - \", err)\r\n }\r\n });\r\n }\r\n\r\n function loadPostings(method, id = '') {\r\n if (!$userEmail) {\r\n return;\r\n }\r\n\r\n $postingsList.addClass('is-loading');\r\n\r\n $.ajax({\r\n url: `/api/user/GetPostings?email=${$userEmail.val()}`,\r\n type: 'get',\r\n success: function (postings) {\r\n if (!postings) {\r\n return;\r\n }\r\n\r\n if (method === 'replace') {\r\n $postingsList.empty();\r\n\r\n $.each(postings, function(index, posting){\r\n $postingsList.append(postingHtmlBuilder(posting));\r\n });\r\n } else if (method === 'append') {\r\n const postingToAdd = postings.find((posting) => {\r\n return posting.Id === id;\r\n });\r\n\r\n if (postingToAdd) {\r\n $postingsList.append(postingHtmlBuilder(postingToAdd));\r\n }\r\n }\r\n\r\n $postingsList.removeClass('is-loading');\r\n },\r\n error: function (err) {\r\n console.error(\"Error loading postings - \", err)\r\n $postingsList.removeClass('is-loading');\r\n }\r\n });\r\n }\r\n\r\n function init() {\r\n loadPostings('replace');\r\n }\r\n});","$(document).ready(function () {\r\n const $search = $('.js-searchPostings');\r\n const $postingsList = $('.js-allPostingsList');\r\n const $searchButton = $('.js-searchButton');\r\n const $clearButton = $('.js-clearPostings');\r\n\r\n $postingsList.children().hide()\r\n\r\n function debounce(func, wait) {\r\n let timeout;\r\n return function() {\r\n const context = this, args = arguments;\r\n clearTimeout(timeout);\r\n timeout = setTimeout(() => func.apply(context, args), wait);\r\n };\r\n };\r\n\r\n function search() {\r\n const query = $search.val().toLowerCase();\r\n if (query.length >= 2) {\r\n $clearButton.show();\r\n $postingsList.children().each(function() {\r\n const searchableText = $(this).data('search').toLowerCase();\r\n if (searchableText.includes(query)) {\r\n $(this).show();\r\n } else {\r\n $(this).hide();\r\n }\r\n });\r\n } else {\r\n $clearButton.hide();\r\n $postingsList.children().hide();\r\n }\r\n };\r\n\r\n $search.on('input', debounce(search, 200));\r\n $searchButton.on('click', function() {\r\n search();\r\n });\r\n $clearButton.on('click', function() {\r\n $search.val('');\r\n search();\r\n });\r\n});","!function (t, e) { \"object\" == typeof exports && \"object\" == typeof module ? module.exports = e() : \"function\" == typeof define && define.amd ? define([], e) : \"object\" == typeof exports ? exports.VueSelect = e() : t.VueSelect = e() }(this, function () {\r\n return function (t) { function e(r) { if (n[r]) return n[r].exports; var o = n[r] = { exports: {}, id: r, loaded: !1 }; return t[r].call(o.exports, o, o.exports, e), o.loaded = !0, o.exports } var n = {}; return e.m = t, e.c = n, e.p = \"/\", e(0) }([function (t, e, n) { \"use strict\"; function r(t) { return t && t.__esModule ? t : { default: t } } Object.defineProperty(e, \"__esModule\", { value: !0 }), e.mixins = e.VueSelect = void 0; var o = n(83), i = r(o), a = n(42), s = r(a); e.default = i.default, e.VueSelect = i.default, e.mixins = s.default }, function (t, e) { var n = t.exports = \"undefined\" != typeof window && window.Math == Math ? window : \"undefined\" != typeof self && self.Math == Math ? self : Function(\"return this\")(); \"number\" == typeof __g && (__g = n) }, function (t, e, n) { t.exports = !n(9)(function () { return 7 != Object.defineProperty({}, \"a\", { get: function () { return 7 } }).a }) }, function (t, e) { var n = {}.hasOwnProperty; t.exports = function (t, e) { return n.call(t, e) } }, function (t, e, n) { var r = n(11), o = n(33), i = n(25), a = Object.defineProperty; e.f = n(2) ? Object.defineProperty : function (t, e, n) { if (r(t), e = i(e, !0), r(n), o) try { return a(t, e, n) } catch (t) { } if (\"get\" in n || \"set\" in n) throw TypeError(\"Accessors not supported!\"); return \"value\" in n && (t[e] = n.value), t } }, function (t, e) { var n = t.exports = { version: \"2.5.2\" }; \"number\" == typeof __e && (__e = n) }, function (t, e, n) { var r = n(4), o = n(14); t.exports = n(2) ? function (t, e, n) { return r.f(t, e, o(1, n)) } : function (t, e, n) { return t[e] = n, t } }, function (t, e, n) { var r = n(59), o = n(16); t.exports = function (t) { return r(o(t)) } }, function (t, e, n) { var r = n(23)(\"wks\"), o = n(15), i = n(1).Symbol, a = \"function\" == typeof i, s = t.exports = function (t) { return r[t] || (r[t] = a && i[t] || (a ? i : o)(\"Symbol.\" + t)) }; s.store = r }, function (t, e) { t.exports = function (t) { try { return !!t() } catch (t) { return !0 } } }, function (t, e) { t.exports = function (t) { return \"object\" == typeof t ? null !== t : \"function\" == typeof t } }, function (t, e, n) { var r = n(10); t.exports = function (t) { if (!r(t)) throw TypeError(t + \" is not an object!\"); return t } }, function (t, e, n) { var r = n(1), o = n(5), i = n(56), a = n(6), s = \"prototype\", u = function (t, e, n) { var l, c, f, p = t & u.F, d = t & u.G, h = t & u.S, b = t & u.P, v = t & u.B, g = t & u.W, y = d ? o : o[e] || (o[e] = {}), m = y[s], x = d ? r : h ? r[e] : (r[e] || {})[s]; d && (n = e); for (l in n) c = !p && x && void 0 !== x[l], c && l in y || (f = c ? x[l] : n[l], y[l] = d && \"function\" != typeof x[l] ? n[l] : v && c ? i(f, r) : g && x[l] == f ? function (t) { var e = function (e, n, r) { if (this instanceof t) { switch (arguments.length) { case 0: return new t; case 1: return new t(e); case 2: return new t(e, n) }return new t(e, n, r) } return t.apply(this, arguments) }; return e[s] = t[s], e }(f) : b && \"function\" == typeof f ? i(Function.call, f) : f, b && ((y.virtual || (y.virtual = {}))[l] = f, t & u.R && m && !m[l] && a(m, l, f))) }; u.F = 1, u.G = 2, u.S = 4, u.P = 8, u.B = 16, u.W = 32, u.U = 64, u.R = 128, t.exports = u }, function (t, e, n) { var r = n(38), o = n(17); t.exports = Object.keys || function (t) { return r(t, o) } }, function (t, e) { t.exports = function (t, e) { return { enumerable: !(1 & t), configurable: !(2 & t), writable: !(4 & t), value: e } } }, function (t, e) { var n = 0, r = Math.random(); t.exports = function (t) { return \"Symbol(\".concat(void 0 === t ? \"\" : t, \")_\", (++n + r).toString(36)) } }, function (t, e) { t.exports = function (t) { if (void 0 == t) throw TypeError(\"Can't call method on \" + t); return t } }, function (t, e) { t.exports = \"constructor,hasOwnProperty,isPrototypeOf,propertyIsEnumerable,toLocaleString,toString,valueOf\".split(\",\") }, function (t, e) { t.exports = {} }, function (t, e) { t.exports = !0 }, function (t, e) { e.f = {}.propertyIsEnumerable }, function (t, e, n) { var r = n(4).f, o = n(3), i = n(8)(\"toStringTag\"); t.exports = function (t, e, n) { t && !o(t = n ? t : t.prototype, i) && r(t, i, { configurable: !0, value: e }) } }, function (t, e, n) { var r = n(23)(\"keys\"), o = n(15); t.exports = function (t) { return r[t] || (r[t] = o(t)) } }, function (t, e, n) { var r = n(1), o = \"__core-js_shared__\", i = r[o] || (r[o] = {}); t.exports = function (t) { return i[t] || (i[t] = {}) } }, function (t, e) { var n = Math.ceil, r = Math.floor; t.exports = function (t) { return isNaN(t = +t) ? 0 : (t > 0 ? r : n)(t) } }, function (t, e, n) { var r = n(10); t.exports = function (t, e) { if (!r(t)) return t; var n, o; if (e && \"function\" == typeof (n = t.toString) && !r(o = n.call(t))) return o; if (\"function\" == typeof (n = t.valueOf) && !r(o = n.call(t))) return o; if (!e && \"function\" == typeof (n = t.toString) && !r(o = n.call(t))) return o; throw TypeError(\"Can't convert object to primitive value\") } }, function (t, e, n) { var r = n(1), o = n(5), i = n(19), a = n(27), s = n(4).f; t.exports = function (t) { var e = o.Symbol || (o.Symbol = i ? {} : r.Symbol || {}); \"_\" == t.charAt(0) || t in e || s(e, t, { value: a.f(t) }) } }, function (t, e, n) { e.f = n(8) }, function (t, e) { \"use strict\"; t.exports = { props: { loading: { type: Boolean, default: !1 }, onSearch: { type: Function, default: function (t, e) { } } }, data: function () { return { mutableLoading: !1 } }, watch: { search: function () { this.search.length > 0 && (this.onSearch(this.search, this.toggleLoading), this.$emit(\"search\", this.search, this.toggleLoading)) }, loading: function (t) { this.mutableLoading = t } }, methods: { toggleLoading: function () { var t = arguments.length > 0 && void 0 !== arguments[0] ? arguments[0] : null; return null == t ? this.mutableLoading = !this.mutableLoading : this.mutableLoading = t } } } }, function (t, e) { \"use strict\"; t.exports = { watch: { typeAheadPointer: function () { this.maybeAdjustScroll() } }, methods: { maybeAdjustScroll: function () { var t = this.pixelsToPointerTop(), e = this.pixelsToPointerBottom(); return t <= this.viewport().top ? this.scrollTo(t) : e >= this.viewport().bottom ? this.scrollTo(this.viewport().top + this.pointerHeight()) : void 0 }, pixelsToPointerTop: function t() { var t = 0; if (this.$refs.dropdownMenu) for (var e = 0; e < this.typeAheadPointer; e++)t += this.$refs.dropdownMenu.children[e].offsetHeight; return t }, pixelsToPointerBottom: function () { return this.pixelsToPointerTop() + this.pointerHeight() }, pointerHeight: function () { var t = !!this.$refs.dropdownMenu && this.$refs.dropdownMenu.children[this.typeAheadPointer]; return t ? t.offsetHeight : 0 }, viewport: function () { return { top: this.$refs.dropdownMenu ? this.$refs.dropdownMenu.scrollTop : 0, bottom: this.$refs.dropdownMenu ? this.$refs.dropdownMenu.offsetHeight + this.$refs.dropdownMenu.scrollTop : 0 } }, scrollTo: function (t) { return this.$refs.dropdownMenu ? this.$refs.dropdownMenu.scrollTop = t : null } } } }, function (t, e) { \"use strict\"; t.exports = { data: function () { return { typeAheadPointer: -1 } }, watch: { filteredOptions: function () { this.typeAheadPointer = 0 } }, methods: { typeAheadUp: function () { this.typeAheadPointer > 0 && (this.typeAheadPointer-- , this.maybeAdjustScroll && this.maybeAdjustScroll()) }, typeAheadDown: function () { this.typeAheadPointer < this.filteredOptions.length - 1 && (this.typeAheadPointer++ , this.maybeAdjustScroll && this.maybeAdjustScroll()) }, typeAheadSelect: function () { this.filteredOptions[this.typeAheadPointer] ? this.select(this.filteredOptions[this.typeAheadPointer]) : this.taggable && this.search.length && this.select(this.search), this.clearSearchOnSelect && (this.search = \"\") } } } }, function (t, e) { var n = {}.toString; t.exports = function (t) { return n.call(t).slice(8, -1) } }, function (t, e, n) { var r = n(10), o = n(1).document, i = r(o) && r(o.createElement); t.exports = function (t) { return i ? o.createElement(t) : {} } }, function (t, e, n) { t.exports = !n(2) && !n(9)(function () { return 7 != Object.defineProperty(n(32)(\"div\"), \"a\", { get: function () { return 7 } }).a }) }, function (t, e, n) { \"use strict\"; var r = n(19), o = n(12), i = n(39), a = n(6), s = n(3), u = n(18), l = n(61), c = n(21), f = n(67), p = n(8)(\"iterator\"), d = !([].keys && \"next\" in [].keys()), h = \"@@iterator\", b = \"keys\", v = \"values\", g = function () { return this }; t.exports = function (t, e, n, y, m, x, w) { l(n, e, y); var S, O, _, j = function (t) { if (!d && t in A) return A[t]; switch (t) { case b: return function () { return new n(this, t) }; case v: return function () { return new n(this, t) } }return function () { return new n(this, t) } }, k = e + \" Iterator\", P = m == v, C = !1, A = t.prototype, M = A[p] || A[h] || m && A[m], L = M || j(m), T = m ? P ? j(\"entries\") : L : void 0, E = \"Array\" == e ? A.entries || M : M; if (E && (_ = f(E.call(new t)), _ !== Object.prototype && _.next && (c(_, k, !0), r || s(_, p) || a(_, p, g))), P && M && M.name !== v && (C = !0, L = function () { return M.call(this) }), r && !w || !d && !C && A[p] || a(A, p, L), u[e] = L, u[k] = g, m) if (S = { values: P ? L : j(v), keys: x ? L : j(b), entries: T }, w) for (O in S) O in A || i(A, O, S[O]); else o(o.P + o.F * (d || C), e, S); return S } }, function (t, e, n) { var r = n(11), o = n(64), i = n(17), a = n(22)(\"IE_PROTO\"), s = function () { }, u = \"prototype\", l = function () { var t, e = n(32)(\"iframe\"), r = i.length, o = \"<\", a = \">\"; for (e.style.display = \"none\", n(58).appendChild(e), e.src = \"javascript:\", t = e.contentWindow.document, t.open(), t.write(o + \"script\" + a + \"document.F=Object\" + o + \"/script\" + a), t.close(), l = t.F; r--;)delete l[u][i[r]]; return l() }; t.exports = Object.create || function (t, e) { var n; return null !== t ? (s[u] = r(t), n = new s, s[u] = null, n[a] = t) : n = l(), void 0 === e ? n : o(n, e) } }, function (t, e, n) { var r = n(38), o = n(17).concat(\"length\", \"prototype\"); e.f = Object.getOwnPropertyNames || function (t) { return r(t, o) } }, function (t, e) { e.f = Object.getOwnPropertySymbols }, function (t, e, n) { var r = n(3), o = n(7), i = n(55)(!1), a = n(22)(\"IE_PROTO\"); t.exports = function (t, e) { var n, s = o(t), u = 0, l = []; for (n in s) n != a && r(s, n) && l.push(n); for (; e.length > u;)r(s, n = e[u++]) && (~i(l, n) || l.push(n)); return l } }, function (t, e, n) { t.exports = n(6) }, function (t, e, n) { var r = n(16); t.exports = function (t) { return Object(r(t)) } }, function (t, e, n) { \"use strict\"; function r(t) { return t && t.__esModule ? t : { default: t } } Object.defineProperty(e, \"__esModule\", { value: !0 }); var o = n(44), i = r(o), a = n(47), s = r(a), u = n(48), l = r(u), c = n(29), f = r(c), p = n(30), d = r(p), h = n(28), b = r(h); e.default = { mixins: [f.default, d.default, b.default], props: { value: { default: null }, options: { type: Array, default: function () { return [] } }, disabled: { type: Boolean, default: !1 }, maxHeight: { type: String, default: \"400px\" }, searchable: { type: Boolean, default: !0 }, multiple: { type: Boolean, default: !1 }, placeholder: { type: String, default: \"\" }, transition: { type: String, default: \"fade\" }, clearSearchOnSelect: { type: Boolean, default: !0 }, closeOnSelect: { type: Boolean, default: !0 }, label: { type: String, default: \"label\" }, getOptionLabel: { type: Function, default: function (t) { return \"object\" === (\"undefined\" == typeof t ? \"undefined\" : (0, l.default)(t)) && this.label && t[this.label] ? t[this.label] : t } }, onChange: { type: Function, default: function (t) { this.$emit(\"input\", t) } }, taggable: { type: Boolean, default: !1 }, tabindex: { type: Number, default: null }, pushTags: { type: Boolean, default: !1 }, filterable: { type: Boolean, default: !0 }, createOption: { type: Function, default: function (t) { return \"object\" === (0, l.default)(this.mutableOptions[0]) && (t = (0, s.default)({}, this.label, t)), this.$emit(\"option:created\", t), t } }, resetOnOptionsChange: { type: Boolean, default: !1 }, noDrop: { type: Boolean, default: !1 }, inputId: { type: String }, dir: { type: String, default: \"auto\" } }, data: function () { return { search: \"\", open: !1, mutableValue: null, mutableOptions: [] } }, watch: { value: function (t) { this.mutableValue = t }, mutableValue: function (t, e) { this.multiple ? this.onChange ? this.onChange(t) : null : this.onChange && t !== e ? this.onChange(t) : null }, options: function (t) { this.mutableOptions = t }, mutableOptions: function () { !this.taggable && this.resetOnOptionsChange && (this.mutableValue = this.multiple ? [] : null) }, multiple: function (t) { this.mutableValue = t ? [] : null } }, created: function () { this.mutableValue = this.value, this.mutableOptions = this.options.slice(0), this.mutableLoading = this.loading, this.$on(\"option:created\", this.maybePushTag) }, methods: { select: function (t) { this.isOptionSelected(t) ? this.deselect(t) : (this.taggable && !this.optionExists(t) && (t = this.createOption(t)), this.multiple && !this.mutableValue ? this.mutableValue = [t] : this.multiple ? this.mutableValue.push(t) : this.mutableValue = t), this.onAfterSelect(t) }, deselect: function (t) { var e = this; if (this.multiple) { var n = -1; this.mutableValue.forEach(function (r) { (r === t || \"object\" === (\"undefined\" == typeof r ? \"undefined\" : (0, l.default)(r)) && r[e.label] === t[e.label]) && (n = r) }); var r = this.mutableValue.indexOf(n); this.mutableValue.splice(r, 1) } else this.mutableValue = null }, clearSelection: function () { this.mutableValue = this.multiple ? [] : null }, onAfterSelect: function (t) { this.closeOnSelect && (this.open = !this.open, this.$refs.search.blur()), this.clearSearchOnSelect && (this.search = \"\") }, toggleDropdown: function (t) { t.target !== this.$refs.openIndicator && t.target !== this.$refs.search && t.target !== this.$refs.toggle && t.target !== this.$el || (this.open ? this.$refs.search.blur() : this.disabled || (this.open = !0, this.$refs.search.focus())) }, isOptionSelected: function (t) { var e = this; if (this.multiple && this.mutableValue) { var n = !1; return this.mutableValue.forEach(function (r) { \"object\" === (\"undefined\" == typeof r ? \"undefined\" : (0, l.default)(r)) && r[e.label] === t[e.label] ? n = !0 : \"object\" === (\"undefined\" == typeof r ? \"undefined\" : (0, l.default)(r)) && r[e.label] === t ? n = !0 : r === t && (n = !0) }), n } return this.mutableValue === t }, onEscape: function () { this.search.length ? this.search = \"\" : this.$refs.search.blur() }, onSearchBlur: function () { this.clearSearchOnBlur && (this.search = \"\"), this.open = !1, this.$emit(\"search:blur\") }, onSearchFocus: function () { this.open = !0, this.$emit(\"search:focus\") }, maybeDeleteValue: function () { if (!this.$refs.search.value.length && this.mutableValue) return this.multiple ? this.mutableValue.pop() : this.mutableValue = null }, optionExists: function (t) { var e = this, n = !1; return this.mutableOptions.forEach(function (r) { \"object\" === (\"undefined\" == typeof r ? \"undefined\" : (0, l.default)(r)) && r[e.label] === t ? n = !0 : r === t && (n = !0) }), n }, maybePushTag: function (t) { this.pushTags && this.mutableOptions.push(t) } }, computed: { dropdownClasses: function () { return { open: this.dropdownOpen, single: !this.multiple, searching: this.searching, searchable: this.searchable, unsearchable: !this.searchable, loading: this.mutableLoading, rtl: \"rtl\" === this.dir, disabled: this.disabled } }, clearSearchOnBlur: function () { return this.clearSearchOnSelect && !this.multiple }, searching: function () { return !!this.search }, dropdownOpen: function () { return !this.noDrop && (this.open && !this.mutableLoading) }, searchPlaceholder: function () { if (this.isValueEmpty && this.placeholder) return this.placeholder }, filteredOptions: function () { var t = this; if (!this.filterable && !this.taggable) return this.mutableOptions.slice(); var e = this.mutableOptions.filter(function (e) { return \"object\" === (\"undefined\" == typeof e ? \"undefined\" : (0, l.default)(e)) && e.hasOwnProperty(t.label) ? e[t.label].toLowerCase().indexOf(t.search.toLowerCase()) > -1 : \"object\" !== (\"undefined\" == typeof e ? \"undefined\" : (0, l.default)(e)) || e.hasOwnProperty(t.label) ? e.toLowerCase().indexOf(t.search.toLowerCase()) > -1 : console.warn('[vue-select warn]: Label key \"option.' + t.label + '\" does not exist in options object.\\nhttp://sagalbot.github.io/vue-select/#ex-labels') }); return this.taggable && this.search.length && !this.optionExists(this.search) && e.unshift(this.search), e }, isValueEmpty: function () { return !this.mutableValue || (\"object\" === (0, l.default)(this.mutableValue) ? !(0, i.default)(this.mutableValue).length : !this.mutableValue.length) }, valueAsArray: function () { return this.multiple ? this.mutableValue : this.mutableValue ? [this.mutableValue] : [] }, showClearButton: function () { return !this.multiple && !this.open && null != this.mutableValue } } } }, function (t, e, n) { \"use strict\"; function r(t) { return t && t.__esModule ? t : { default: t } } Object.defineProperty(e, \"__esModule\", { value: !0 }); var o = n(28), i = r(o), a = n(30), s = r(a), u = n(29), l = r(u); e.default = { ajax: i.default, pointer: s.default, pointerScroll: l.default } }, function (t, e, n) { t.exports = { default: n(49), __esModule: !0 } }, function (t, e, n) { t.exports = { default: n(50), __esModule: !0 } }, function (t, e, n) { t.exports = { default: n(51), __esModule: !0 } }, function (t, e, n) { t.exports = { default: n(52), __esModule: !0 } }, function (t, e, n) { \"use strict\"; function r(t) { return t && t.__esModule ? t : { default: t } } e.__esModule = !0; var o = n(43), i = r(o); e.default = function (t, e, n) { return e in t ? (0, i.default)(t, e, { value: n, enumerable: !0, configurable: !0, writable: !0 }) : t[e] = n, t } }, function (t, e, n) { \"use strict\"; function r(t) { return t && t.__esModule ? t : { default: t } } e.__esModule = !0; var o = n(46), i = r(o), a = n(45), s = r(a), u = \"function\" == typeof s.default && \"symbol\" == typeof i.default ? function (t) { return typeof t } : function (t) { return t && \"function\" == typeof s.default && t.constructor === s.default && t !== s.default.prototype ? \"symbol\" : typeof t }; e.default = \"function\" == typeof s.default && \"symbol\" === u(i.default) ? function (t) { return \"undefined\" == typeof t ? \"undefined\" : u(t) } : function (t) { return t && \"function\" == typeof s.default && t.constructor === s.default && t !== s.default.prototype ? \"symbol\" : \"undefined\" == typeof t ? \"undefined\" : u(t) } }, function (t, e, n) { n(73); var r = n(5).Object; t.exports = function (t, e, n) { return r.defineProperty(t, e, n) } }, function (t, e, n) { n(74), t.exports = n(5).Object.keys }, function (t, e, n) { n(77), n(75), n(78), n(79), t.exports = n(5).Symbol }, function (t, e, n) { n(76), n(80), t.exports = n(27).f(\"iterator\") }, function (t, e) { t.exports = function (t) { if (\"function\" != typeof t) throw TypeError(t + \" is not a function!\"); return t } }, function (t, e) { t.exports = function () { } }, function (t, e, n) { var r = n(7), o = n(71), i = n(70); t.exports = function (t) { return function (e, n, a) { var s, u = r(e), l = o(u.length), c = i(a, l); if (t && n != n) { for (; l > c;)if (s = u[c++], s != s) return !0 } else for (; l > c; c++)if ((t || c in u) && u[c] === n) return t || c || 0; return !t && -1 } } }, function (t, e, n) { var r = n(53); t.exports = function (t, e, n) { if (r(t), void 0 === e) return t; switch (n) { case 1: return function (n) { return t.call(e, n) }; case 2: return function (n, r) { return t.call(e, n, r) }; case 3: return function (n, r, o) { return t.call(e, n, r, o) } }return function () { return t.apply(e, arguments) } } }, function (t, e, n) { var r = n(13), o = n(37), i = n(20); t.exports = function (t) { var e = r(t), n = o.f; if (n) for (var a, s = n(t), u = i.f, l = 0; s.length > l;)u.call(t, a = s[l++]) && e.push(a); return e } }, function (t, e, n) { var r = n(1).document; t.exports = r && r.documentElement }, function (t, e, n) { var r = n(31); t.exports = Object(\"z\").propertyIsEnumerable(0) ? Object : function (t) { return \"String\" == r(t) ? t.split(\"\") : Object(t) } }, function (t, e, n) { var r = n(31); t.exports = Array.isArray || function (t) { return \"Array\" == r(t) } }, function (t, e, n) { \"use strict\"; var r = n(35), o = n(14), i = n(21), a = {}; n(6)(a, n(8)(\"iterator\"), function () { return this }), t.exports = function (t, e, n) { t.prototype = r(a, { next: o(1, n) }), i(t, e + \" Iterator\") } }, function (t, e) { t.exports = function (t, e) { return { value: e, done: !!t } } }, function (t, e, n) { var r = n(15)(\"meta\"), o = n(10), i = n(3), a = n(4).f, s = 0, u = Object.isExtensible || function () { return !0 }, l = !n(9)(function () { return u(Object.preventExtensions({})) }), c = function (t) { a(t, r, { value: { i: \"O\" + ++s, w: {} } }) }, f = function (t, e) { if (!o(t)) return \"symbol\" == typeof t ? t : (\"string\" == typeof t ? \"S\" : \"P\") + t; if (!i(t, r)) { if (!u(t)) return \"F\"; if (!e) return \"E\"; c(t) } return t[r].i }, p = function (t, e) { if (!i(t, r)) { if (!u(t)) return !0; if (!e) return !1; c(t) } return t[r].w }, d = function (t) { return l && h.NEED && u(t) && !i(t, r) && c(t), t }, h = t.exports = { KEY: r, NEED: !1, fastKey: f, getWeak: p, onFreeze: d } }, function (t, e, n) { var r = n(4), o = n(11), i = n(13); t.exports = n(2) ? Object.defineProperties : function (t, e) { o(t); for (var n, a = i(e), s = a.length, u = 0; s > u;)r.f(t, n = a[u++], e[n]); return t } }, function (t, e, n) { var r = n(20), o = n(14), i = n(7), a = n(25), s = n(3), u = n(33), l = Object.getOwnPropertyDescriptor; e.f = n(2) ? l : function (t, e) { if (t = i(t), e = a(e, !0), u) try { return l(t, e) } catch (t) { } if (s(t, e)) return o(!r.f.call(t, e), t[e]) } }, function (t, e, n) { var r = n(7), o = n(36).f, i = {}.toString, a = \"object\" == typeof window && window && Object.getOwnPropertyNames ? Object.getOwnPropertyNames(window) : [], s = function (t) { try { return o(t) } catch (t) { return a.slice() } }; t.exports.f = function (t) { return a && \"[object Window]\" == i.call(t) ? s(t) : o(r(t)) } }, function (t, e, n) { var r = n(3), o = n(40), i = n(22)(\"IE_PROTO\"), a = Object.prototype; t.exports = Object.getPrototypeOf || function (t) { return t = o(t), r(t, i) ? t[i] : \"function\" == typeof t.constructor && t instanceof t.constructor ? t.constructor.prototype : t instanceof Object ? a : null } }, function (t, e, n) { var r = n(12), o = n(5), i = n(9); t.exports = function (t, e) { var n = (o.Object || {})[t] || Object[t], a = {}; a[t] = e(n), r(r.S + r.F * i(function () { n(1) }), \"Object\", a) } }, function (t, e, n) { var r = n(24), o = n(16); t.exports = function (t) { return function (e, n) { var i, a, s = String(o(e)), u = r(n), l = s.length; return u < 0 || u >= l ? t ? \"\" : void 0 : (i = s.charCodeAt(u), i < 55296 || i > 56319 || u + 1 === l || (a = s.charCodeAt(u + 1)) < 56320 || a > 57343 ? t ? s.charAt(u) : i : t ? s.slice(u, u + 2) : (i - 55296 << 10) + (a - 56320) + 65536) } } }, function (t, e, n) { var r = n(24), o = Math.max, i = Math.min; t.exports = function (t, e) { return t = r(t), t < 0 ? o(t + e, 0) : i(t, e) } }, function (t, e, n) { var r = n(24), o = Math.min; t.exports = function (t) { return t > 0 ? o(r(t), 9007199254740991) : 0 } }, function (t, e, n) { \"use strict\"; var r = n(54), o = n(62), i = n(18), a = n(7); t.exports = n(34)(Array, \"Array\", function (t, e) { this._t = a(t), this._i = 0, this._k = e }, function () { var t = this._t, e = this._k, n = this._i++; return !t || n >= t.length ? (this._t = void 0, o(1)) : \"keys\" == e ? o(0, n) : \"values\" == e ? o(0, t[n]) : o(0, [n, t[n]]) }, \"values\"), i.Arguments = i.Array, r(\"keys\"), r(\"values\"), r(\"entries\") }, function (t, e, n) { var r = n(12); r(r.S + r.F * !n(2), \"Object\", { defineProperty: n(4).f }) }, function (t, e, n) { var r = n(40), o = n(13); n(68)(\"keys\", function () { return function (t) { return o(r(t)) } }) }, function (t, e) { }, function (t, e, n) { \"use strict\"; var r = n(69)(!0); n(34)(String, \"String\", function (t) { this._t = String(t), this._i = 0 }, function () { var t, e = this._t, n = this._i; return n >= e.length ? { value: void 0, done: !0 } : (t = r(e, n), this._i += t.length, { value: t, done: !1 }) }) }, function (t, e, n) { \"use strict\"; var r = n(1), o = n(3), i = n(2), a = n(12), s = n(39), u = n(63).KEY, l = n(9), c = n(23), f = n(21), p = n(15), d = n(8), h = n(27), b = n(26), v = n(57), g = n(60), y = n(11), m = n(10), x = n(7), w = n(25), S = n(14), O = n(35), _ = n(66), j = n(65), k = n(4), P = n(13), C = j.f, A = k.f, M = _.f, L = r.Symbol, T = r.JSON, E = T && T.stringify, V = \"prototype\", B = d(\"_hidden\"), F = d(\"toPrimitive\"), $ = {}.propertyIsEnumerable, N = c(\"symbol-registry\"), D = c(\"symbols\"), I = c(\"op-symbols\"), R = Object[V], z = \"function\" == typeof L, H = r.QObject, G = !H || !H[V] || !H[V].findChild, U = i && l(function () { return 7 != O(A({}, \"a\", { get: function () { return A(this, \"a\", { value: 7 }).a } })).a }) ? function (t, e, n) { var r = C(R, e); r && delete R[e], A(t, e, n), r && t !== R && A(R, e, r) } : A, W = function (t) { var e = D[t] = O(L[V]); return e._k = t, e }, J = z && \"symbol\" == typeof L.iterator ? function (t) { return \"symbol\" == typeof t } : function (t) { return t instanceof L }, K = function (t, e, n) { return t === R && K(I, e, n), y(t), e = w(e, !0), y(n), o(D, e) ? (n.enumerable ? (o(t, B) && t[B][e] && (t[B][e] = !1), n = O(n, { enumerable: S(0, !1) })) : (o(t, B) || A(t, B, S(1, {})), t[B][e] = !0), U(t, e, n)) : A(t, e, n) }, Y = function (t, e) { y(t); for (var n, r = v(e = x(e)), o = 0, i = r.length; i > o;)K(t, n = r[o++], e[n]); return t }, q = function (t, e) { return void 0 === e ? O(t) : Y(O(t), e) }, Q = function (t) { var e = $.call(this, t = w(t, !0)); return !(this === R && o(D, t) && !o(I, t)) && (!(e || !o(this, t) || !o(D, t) || o(this, B) && this[B][t]) || e) }, Z = function (t, e) { if (t = x(t), e = w(e, !0), t !== R || !o(D, e) || o(I, e)) { var n = C(t, e); return !n || !o(D, e) || o(t, B) && t[B][e] || (n.enumerable = !0), n } }, X = function (t) { for (var e, n = M(x(t)), r = [], i = 0; n.length > i;)o(D, e = n[i++]) || e == B || e == u || r.push(e); return r }, tt = function (t) { for (var e, n = t === R, r = M(n ? I : x(t)), i = [], a = 0; r.length > a;)!o(D, e = r[a++]) || n && !o(R, e) || i.push(D[e]); return i }; z || (L = function () { if (this instanceof L) throw TypeError(\"Symbol is not a constructor!\"); var t = p(arguments.length > 0 ? arguments[0] : void 0), e = function (n) { this === R && e.call(I, n), o(this, B) && o(this[B], t) && (this[B][t] = !1), U(this, t, S(1, n)) }; return i && G && U(R, t, { configurable: !0, set: e }), W(t) }, s(L[V], \"toString\", function () { return this._k }), j.f = Z, k.f = K, n(36).f = _.f = X, n(20).f = Q, n(37).f = tt, i && !n(19) && s(R, \"propertyIsEnumerable\", Q, !0), h.f = function (t) { return W(d(t)) }), a(a.G + a.W + a.F * !z, { Symbol: L }); for (var et = \"hasInstance,isConcatSpreadable,iterator,match,replace,search,species,split,toPrimitive,toStringTag,unscopables\".split(\",\"), nt = 0; et.length > nt;)d(et[nt++]); for (var rt = P(d.store), ot = 0; rt.length > ot;)b(rt[ot++]); a(a.S + a.F * !z, \"Symbol\", { for: function (t) { return o(N, t += \"\") ? N[t] : N[t] = L(t) }, keyFor: function (t) { if (!J(t)) throw TypeError(t + \" is not a symbol!\"); for (var e in N) if (N[e] === t) return e }, useSetter: function () { G = !0 }, useSimple: function () { G = !1 } }), a(a.S + a.F * !z, \"Object\", { create: q, defineProperty: K, defineProperties: Y, getOwnPropertyDescriptor: Z, getOwnPropertyNames: X, getOwnPropertySymbols: tt }), T && a(a.S + a.F * (!z || l(function () { var t = L(); return \"[null]\" != E([t]) || \"{}\" != E({ a: t }) || \"{}\" != E(Object(t)) })), \"JSON\", { stringify: function (t) { for (var e, n, r = [t], o = 1; arguments.length > o;)r.push(arguments[o++]); if (n = e = r[1], (m(e) || void 0 !== t) && !J(t)) return g(e) || (e = function (t, e) { if (n && (e = n.call(this, t, e)), !J(e)) return e }), r[1] = e, E.apply(T, r) } }), L[V][F] || n(6)(L[V], F, L[V].valueOf), f(L, \"Symbol\"), f(Math, \"Math\", !0), f(r.JSON, \"JSON\", !0) }, function (t, e, n) { n(26)(\"asyncIterator\") }, function (t, e, n) { n(26)(\"observable\") }, function (t, e, n) { n(72); for (var r = n(1), o = n(6), i = n(18), a = n(8)(\"toStringTag\"), s = \"CSSRuleList,CSSStyleDeclaration,CSSValueList,ClientRectList,DOMRectList,DOMStringList,DOMTokenList,DataTransferItemList,FileList,HTMLAllCollection,HTMLCollection,HTMLFormElement,HTMLSelectElement,MediaList,MimeTypeArray,NamedNodeMap,NodeList,PaintRequestList,Plugin,PluginArray,SVGLengthList,SVGNumberList,SVGPathSegList,SVGPointList,SVGStringList,SVGTransformList,SourceBufferList,StyleSheetList,TextTrackCueList,TextTrackList,TouchList\".split(\",\"), u = 0; u < s.length; u++) { var l = s[u], c = r[l], f = c && c.prototype; f && !f[a] && o(f, a, l), i[l] = i.Array } }, function (t, e, n) { e = t.exports = n(82)(), e.push([t.id, '.v-select{position:relative;font-family:sans-serif}.v-select,.v-select *{box-sizing:border-box}.v-select.rtl .open-indicator{left:10px;right:auto}.v-select.rtl .selected-tag{float:right;margin-right:3px;margin-left:1px}.v-select.rtl .dropdown-menu{text-align:right}.v-select.rtl .dropdown-toggle .clear{left:30px;right:auto}.v-select .open-indicator{position:absolute;bottom:6px;right:10px;cursor:pointer;pointer-events:all;opacity:1;height:20px}.v-select .open-indicator,.v-select .open-indicator:before{display:inline-block;transition:all .15s cubic-bezier(1,-.115,.975,.855);transition-timing-function:cubic-bezier(1,-.115,.975,.855);width:10px}.v-select .open-indicator:before{border-color:rgba(60,60,60,.5);border-style:solid;border-width:3px 3px 0 0;content:\"\";height:10px;vertical-align:top;transform:rotate(133deg);box-sizing:inherit}.v-select.open .open-indicator:before{transform:rotate(315deg)}.v-select.loading .open-indicator{opacity:0}.v-select.open .open-indicator{bottom:1px}.v-select .dropdown-toggle{-webkit-appearance:none;-moz-appearance:none;appearance:none;display:block;padding:0;background:none;border:1px solid rgba(60,60,60,.26);border-radius:4px;white-space:normal}.v-select .dropdown-toggle:after{visibility:hidden;display:block;font-size:0;content:\" \";clear:both;height:0}.v-select .dropdown-toggle .clear{position:absolute;bottom:9px;right:30px;font-size:23px;font-weight:700;line-height:1;color:rgba(60,60,60,.5);padding:0;border:0;background-color:transparent;cursor:pointer}.v-select.searchable .dropdown-toggle{cursor:text}.v-select.unsearchable .dropdown-toggle{cursor:pointer}.v-select.open .dropdown-toggle{border-bottom-color:transparent;border-bottom-left-radius:0;border-bottom-right-radius:0}.v-select .dropdown-menu{display:block;position:absolute;top:100%;left:0;z-index:1000;min-width:160px;padding:5px 0;margin:0;width:100%;overflow-y:scroll;border:1px solid rgba(0,0,0,.26);box-shadow:0 3px 6px 0 rgba(0,0,0,.15);border-top:none;border-radius:0 0 4px 4px;text-align:left;list-style:none;background:#fff}.v-select .no-options{text-align:center}.v-select .selected-tag{color:#333;background-color:#f0f0f0;border:1px solid #ccc;border-radius:4px;height:26px;margin:4px 1px 0 3px;padding:1px .25em;float:left;line-height:24px}.v-select.single .selected-tag{background-color:transparent;border-color:transparent}.v-select.single.open .selected-tag{position:absolute;opacity:.5}.v-select.single.loading .selected-tag,.v-select.single.open.searching .selected-tag{display:none}.v-select .selected-tag .close{float:none;margin-right:0;font-size:20px;appearance:none;padding:0;cursor:pointer;background:0 0;border:0;font-weight:700;line-height:1;color:#000;text-shadow:0 1px 0 #fff;filter:alpha(opacity=20);opacity:.2}.v-select.single.searching:not(.open):not(.loading) input[type=search]{opacity:.2}.v-select input[type=search]::-webkit-search-cancel-button,.v-select input[type=search]::-webkit-search-decoration,.v-select input[type=search]::-webkit-search-results-button,.v-select input[type=search]::-webkit-search-results-decoration{display:none}.v-select input[type=search]::-ms-clear{display:none}.v-select input[type=search],.v-select input[type=search]:focus{appearance:none;-webkit-appearance:none;-moz-appearance:none;line-height:1.42857143;font-size:1em;height:34px;display:inline-block;border:none;outline:none;margin:0;padding:0 .5em;width:10em;max-width:100%;background:none;position:relative;box-shadow:none}.v-select.unsearchable input[type=search]{opacity:0}.v-select.unsearchable input[type=search]:hover{cursor:pointer}.v-select li{line-height:1.42857143}.v-select li>a{display:block;padding:3px 20px;clear:both;color:#333;white-space:nowrap}.v-select li:hover{cursor:pointer}.v-select .dropdown-menu .active>a{color:#333;background:rgba(50,50,50,.1)}.v-select .dropdown-menu>.highlight>a{background:#5897fb;color:#fff}.v-select .highlight:not(:last-child){margin-bottom:0}.v-select .spinner{opacity:0;position:absolute;top:5px;right:10px;font-size:5px;text-indent:-9999em;overflow:hidden;border-top:.9em solid hsla(0,0%,39%,.1);border-right:.9em solid hsla(0,0%,39%,.1);border-bottom:.9em solid hsla(0,0%,39%,.1);border-left:.9em solid rgba(60,60,60,.45);transform:translateZ(0);animation:vSelectSpinner 1.1s infinite linear;transition:opacity .1s}.v-select .spinner,.v-select .spinner:after{border-radius:50%;width:5em;height:5em}.v-select.disabled .dropdown-toggle,.v-select.disabled .dropdown-toggle .clear,.v-select.disabled .dropdown-toggle input,.v-select.disabled .open-indicator,.v-select.disabled .selected-tag .close{cursor:not-allowed;background-color:#f8f8f8}.v-select.loading .spinner{opacity:1}@-webkit-keyframes vSelectSpinner{0%{transform:rotate(0deg)}to{transform:rotate(1turn)}}@keyframes vSelectSpinner{0%{transform:rotate(0deg)}to{transform:rotate(1turn)}}.fade-enter-active,.fade-leave-active{transition:opacity .15s cubic-bezier(1,.5,.8,1)}.fade-enter,.fade-leave-to{opacity:0}', \"\"]) }, function (t, e) { t.exports = function () { var t = []; return t.toString = function () { for (var t = [], e = 0; e < this.length; e++) { var n = this[e]; n[2] ? t.push(\"@media \" + n[2] + \"{\" + n[1] + \"}\") : t.push(n[1]) } return t.join(\"\") }, t.i = function (e, n) { \"string\" == typeof e && (e = [[null, e, \"\"]]); for (var r = {}, o = 0; o < this.length; o++) { var i = this[o][0]; \"number\" == typeof i && (r[i] = !0) } for (o = 0; o < e.length; o++) { var a = e[o]; \"number\" == typeof a[0] && r[a[0]] || (n && !a[2] ? a[2] = n : n && (a[2] = \"(\" + a[2] + \") and (\" + n + \")\"), t.push(a)) } }, t } }, function (t, e, n) { n(87); var r = n(84)(n(41), n(85), null, null); t.exports = r.exports }, function (t, e) { t.exports = function (t, e, n, r) { var o, i = t = t || {}, a = typeof t.default; \"object\" !== a && \"function\" !== a || (o = t, i = t.default); var s = \"function\" == typeof i ? i.options : i; if (e && (s.render = e.render, s.staticRenderFns = e.staticRenderFns), n && (s._scopeId = n), r) { var u = s.computed || (s.computed = {}); Object.keys(r).forEach(function (t) { var e = r[t]; u[t] = function () { return e } }) } return { esModule: o, exports: i, options: s } } }, function (t, e) {\r\n t.exports = {\r\n render: function () {\r\n var t = this, e = t.$createElement, n = t._self._c || e; return n(\"div\", { staticClass: \"dropdown v-select\", class: t.dropdownClasses, attrs: { dir: t.dir } }, [n(\"div\", { ref: \"toggle\", class: [\"dropdown-toggle\", \"clearfix\"], on: { mousedown: function (e) { e.preventDefault(), t.toggleDropdown(e) } } }, [t._l(t.valueAsArray, function (e) { return n(\"span\", { key: e.index, staticClass: \"selected-tag\" }, [t._t(\"selected-option\", [t._v(\"\\n \" + t._s(t.getOptionLabel(e)) + \"\\n \")], null, e), t._v(\" \"), t.multiple ? n(\"button\", { staticClass: \"close\", attrs: { disabled: t.disabled, type: \"button\", \"aria-label\": \"Remove option\" }, on: { click: function (n) { t.deselect(e) } } }, [n(\"span\", { attrs: { \"aria-hidden\": \"true\" } }, [t._v(\"×\")])]) : t._e()], 2) }), t._v(\" \"), n(\"input\", {\r\n directives: [{ name: \"model\", rawName: \"v-model\", value: t.search, expression: \"search\" }], ref: \"search\", staticClass: \"form-control\", style: { width: t.isValueEmpty ? \"100%\" : \"auto\" }, attrs: { type: \"search\", autocomplete: \"false\", disabled: t.disabled, placeholder: t.searchPlaceholder, tabindex: t.tabindex, readonly: !t.searchable, id: t.inputId, \"aria-label\": \"Search for option\" }, domProps: { value: t.search }, on: {\r\n keydown: [function (e) { return \"button\" in e || !t._k(e.keyCode, \"delete\", [8, 46], e.key) ? void t.maybeDeleteValue(e) : null }, function (e) { return \"button\" in e || !t._k(e.keyCode, \"up\", 38, e.key) ? (e.preventDefault(), void t.typeAheadUp(e)) : null }, function (e) { return \"button\" in e || !t._k(e.keyCode, \"down\", 40, e.key) ? (e.preventDefault(), void t.typeAheadDown(e)) : null }, function (e) { return \"button\" in e || !t._k(e.keyCode, \"enter\", 13, e.key) ? (e.preventDefault(), void t.typeAheadSelect(e)) : null }], keyup: function (e) { return \"button\" in e || !t._k(e.keyCode, \"esc\", 27, e.key) ? void t.onEscape(e) : null }, blur: t.onSearchBlur, focus: t.onSearchFocus, input: function (e) {\r\n e.target.composing || (t.search = e.target.value)\r\n }\r\n }\r\n }), t._v(\" \"), n(\"button\", { directives: [{ name: \"show\", rawName: \"v-show\", value: t.showClearButton, expression: \"showClearButton\" }], staticClass: \"clear\", attrs: { disabled: t.disabled, type: \"button\", title: \"Clear selection\" }, on: { click: t.clearSelection } }, [n(\"span\", { attrs: { \"aria-hidden\": \"true\" } }, [t._v(\"×\")])]), t._v(\" \"), t.noDrop ? t._e() : n(\"i\", { ref: \"openIndicator\", staticClass: \"open-indicator\", attrs: { role: \"presentation\" } }), t._v(\" \"), t._t(\"spinner\", [n(\"div\", { directives: [{ name: \"show\", rawName: \"v-show\", value: t.mutableLoading, expression: \"mutableLoading\" }], staticClass: \"spinner\" }, [t._v(\"Loading...\")])])], 2), t._v(\" \"), n(\"transition\", { attrs: { name: t.transition } }, [t.dropdownOpen ? n(\"ul\", { ref: \"dropdownMenu\", staticClass: \"dropdown-menu\", style: { \"max-height\": t.maxHeight } }, [t._l(t.filteredOptions, function (e, r) { return n(\"li\", { key: r, class: { active: t.isOptionSelected(e), highlight: r === t.typeAheadPointer }, on: { mouseover: function (e) { t.typeAheadPointer = r } } }, [n(\"a\", { on: { mousedown: function (n) { n.preventDefault(), t.select(e) } } }, [t._t(\"option\", [t._v(\"\\n \" + t._s(t.getOptionLabel(e)) + \"\\n \")], null, e)], 2)]) }), t._v(\" \"), t.filteredOptions.length ? t._e() : n(\"li\", { staticClass: \"no-options\" }, [t._t(\"no-options\", [t._v(\"Sorry, no matching options.\")])], 2)], 2) : t._e()])], 1)\r\n }, staticRenderFns: []\r\n }\r\n }, function (t, e, n) { function r(t, e) { for (var n = 0; n < t.length; n++) { var r = t[n], o = f[r.id]; if (o) { o.refs++; for (var i = 0; i < o.parts.length; i++)o.parts[i](r.parts[i]); for (; i < r.parts.length; i++)o.parts.push(u(r.parts[i], e)) } else { for (var a = [], i = 0; i < r.parts.length; i++)a.push(u(r.parts[i], e)); f[r.id] = { id: r.id, refs: 1, parts: a } } } } function o(t) { for (var e = [], n = {}, r = 0; r < t.length; r++) { var o = t[r], i = o[0], a = o[1], s = o[2], u = o[3], l = { css: a, media: s, sourceMap: u }; n[i] ? n[i].parts.push(l) : e.push(n[i] = { id: i, parts: [l] }) } return e } function i(t, e) { var n = h(), r = g[g.length - 1]; if (\"top\" === t.insertAt) r ? r.nextSibling ? n.insertBefore(e, r.nextSibling) : n.appendChild(e) : n.insertBefore(e, n.firstChild), g.push(e); else { if (\"bottom\" !== t.insertAt) throw new Error(\"Invalid value for parameter 'insertAt'. Must be 'top' or 'bottom'.\"); n.appendChild(e) } } function a(t) { t.parentNode.removeChild(t); var e = g.indexOf(t); e >= 0 && g.splice(e, 1) } function s(t) { var e = document.createElement(\"style\"); return e.type = \"text/css\", i(t, e), e } function u(t, e) { var n, r, o; if (e.singleton) { var i = v++; n = b || (b = s(e)), r = l.bind(null, n, i, !1), o = l.bind(null, n, i, !0) } else n = s(e), r = c.bind(null, n), o = function () { a(n) }; return r(t), function (e) { if (e) { if (e.css === t.css && e.media === t.media && e.sourceMap === t.sourceMap) return; r(t = e) } else o() } } function l(t, e, n, r) { var o = n ? \"\" : r.css; if (t.styleSheet) t.styleSheet.cssText = y(e, o); else { var i = document.createTextNode(o), a = t.childNodes; a[e] && t.removeChild(a[e]), a.length ? t.insertBefore(i, a[e]) : t.appendChild(i) } } function c(t, e) { var n = e.css, r = e.media, o = e.sourceMap; if (r && t.setAttribute(\"media\", r), o && (n += \"\\n/*# sourceURL=\" + o.sources[0] + \" */\", n += \"\\n/*# sourceMappingURL=data:application/json;base64,\" + btoa(unescape(encodeURIComponent(JSON.stringify(o)))) + \" */\"), t.styleSheet) t.styleSheet.cssText = n; else { for (; t.firstChild;)t.removeChild(t.firstChild); t.appendChild(document.createTextNode(n)) } } var f = {}, p = function (t) { var e; return function () { return \"undefined\" == typeof e && (e = t.apply(this, arguments)), e } }, d = p(function () { return /msie [6-9]\\b/.test(window.navigator.userAgent.toLowerCase()) }), h = p(function () { return document.head || document.getElementsByTagName(\"head\")[0] }), b = null, v = 0, g = []; t.exports = function (t, e) { e = e || {}, \"undefined\" == typeof e.singleton && (e.singleton = d()), \"undefined\" == typeof e.insertAt && (e.insertAt = \"bottom\"); var n = o(t); return r(n, e), function (t) { for (var i = [], a = 0; a < n.length; a++) { var s = n[a], u = f[s.id]; u.refs-- , i.push(u) } if (t) { var l = o(t); r(l, e) } for (var a = 0; a < i.length; a++) { var u = i[a]; if (0 === u.refs) { for (var c = 0; c < u.parts.length; c++)u.parts[c](); delete f[u.id] } } } }; var y = function () { var t = []; return function (e, n) { return t[e] = n, t.filter(Boolean).join(\"\\n\") } }() }, function (t, e, n) { var r = n(81); \"string\" == typeof r && (r = [[t.id, r, \"\"]]); n(86)(r, {}); r.locals && (t.exports = r.locals) }])\r\n});\r\n//# sourceMappingURL=vue-select.js.map","import \"./header\"\r\nimport \"./lead-tool\"","$(window).scroll(function () {\r\n if ($(window).scrollTop() >= 20) {\r\n $('body').addClass('fixed-header');\r\n }\r\n else {\r\n $('body').removeClass('fixed-header');\r\n }\r\n});\r\n\r\n$(document).ready(function () {\r\n var isMobile = /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent);\r\n \r\n $(\"#menu-toggle\").click(function () {\r\n $(\"body\").toggleClass(\"open\");\r\n });\r\n\r\n $(\"[data-search-box-toggle]\").click(function() {\r\n $(\"[data-search-box-open]\").slideToggle(200);\r\n $(\"[data-search-box-toggle]\").toggleClass(\"open\");\r\n $(\"[data-search-box-open-input]\").focus();\r\n });\r\n\r\n if ($(\"body\").hasClass(\"page-type-search-page\") && !isMobile) {\r\n $(\"[data-search-box-open]\").slideToggle(0);\r\n $(\"[data-search-box-toggle]\").toggleClass(\"open\");\r\n }\r\n\r\n if (navigator.userAgent.indexOf('Edge') !== -1 && !isMobile) {\r\n $(\"[data-search-box-open-input]\").removeAttr(\"placeholder\"); // Removes the placeholder attribute when on Edge and not mobile, this is done to right align the input cursor, which is otherwise not possible in Edge with a placeholder active.\r\n }\r\n\r\n function setContentHeaderHeight() {\r\n $(\".contentheader-rich\").css('min-height', $(\".contentheader-rich-body\").outerHeight() + 50 + 'px');\r\n }\r\n\r\n if ($(\".contentheader-rich-body\").length != 0) {\r\n if ($(window).width() < 991 && $(\".contentheader-rich-body\").outerHeight() > 400) {\r\n setContentHeaderHeight();\r\n } else if ($(window).width() > 992 && $(window).width() < 1199 && $(\".contentheader-rich-body\").outerHeight() > 650) {\r\n setContentHeaderHeight();\r\n } else if ($(window).width() > 1200 && $(\".contentheader-rich-body\").outerHeight() > 650) {\r\n setContentHeaderHeight();\r\n }\r\n }\r\n});","import Vue from './../_lib/vue/vue.min'\r\nimport VeeValidate from './../_lib/vue/vee-validate'\r\nimport vSelect from './../_lib/vue/vue-select'\r\n\r\n// Validation customization\r\nVue.use(VeeValidate, {\r\n dictionary: {\r\n en: {\r\n custom: {\r\n email: {\r\n required: 'Udfyld venligst din e-mail',\r\n email: 'Udfyld venligst en gyldig e-mail'\r\n },\r\n fullname: {\r\n required: 'Udfyld venligst dit fulde navn'\r\n },\r\n companyName: {\r\n required: 'Udfyld venligst din virksomheds navn'\r\n },\r\n companyRegion: {\r\n required: 'Vælg venligst en region'\r\n },\r\n tlf: {\r\n required: 'Udfyld venligst dit telefonnummer'\r\n },\r\n gdprCheckbox: {\r\n required: 'Acceptér venligst for at kunne fortsætte'\r\n }\r\n }\r\n }\r\n }\r\n});\r\n\r\nwindow.onload = function() {\r\n const leadTool = new Vue({\r\n el: '[data-lead-tool]',\r\n data() {\r\n return {\r\n step: 1,\r\n exportMarketSelectedItems: [],\r\n exportMarketSelectedGuids: []\r\n }\r\n },\r\n methods: {\r\n // Base\r\n prev() {\r\n window.scrollTo(0, 0);\r\n this.step--;\r\n window.scrollTo(0, 0);\r\n },\r\n next() {\r\n window.scrollTo(0, 0);\r\n this.step++;\r\n window.scrollTo(0, 0);\r\n },\r\n validateBeforeSubmit() {\r\n this.$validator.validateAll().then((result) => {\r\n if (result) {\r\n document.getElementById('leadToolForm').submit();\r\n }\r\n });\r\n },\r\n //Step 3\r\n primaryExportSector(event) {\r\n var radios = document.querySelectorAll(\"[name='primaryExportSector'][type='radio']\"),\r\n input = document.querySelector(\"[name='primaryExportSector'][type='text']\"),\r\n nextButton = document.querySelector('.primary-export-sector .next');\r\n\r\n // If there are input in textfield remove check on radios\r\n if (event.target.type === 'text') {\r\n for (var i = 0, length = radios.length; i < length; i++) {\r\n if (radios[i].checked && input.value !== '') {\r\n radios[i].checked = false;\r\n }\r\n }\r\n }\r\n\r\n // If radio is checked remove text in textfield\r\n if (event.target.type === 'radio') {\r\n input.value = '';\r\n }\r\n\r\n // If an input has value remove disable next step\r\n if (input.value !== '') {\r\n nextButton.removeAttribute('disabled');\r\n }\r\n\r\n // If an input has value remove disable next step or set disable if all fields are empty \r\n for (var i = 0, length = radios.length; i < length; i++) {\r\n if (radios[i].checked) {\r\n nextButton.removeAttribute('disabled');\r\n break;\r\n } else if (radios[i].checked === false && input.value === '') {\r\n nextButton.setAttribute('disabled', 'disabled');\r\n }\r\n }\r\n },\r\n //Step 4\r\n exportMarketOptionsSelected(event) {\r\n var select = document.querySelector('.export-market-select'),\r\n undecidedRadio = document.querySelector('.export-market-undecided'),\r\n guidsRadio = document.querySelector('.export-market-select-guids'),\r\n nextButton = document.querySelector('.export-market-select-fieldset .next');\r\n\r\n // Disable at 3 selected markets\r\n if (event.length >= 3) {\r\n select.classList.add('disabled');\r\n }\r\n // Remove disable if less that 3 selected markets\r\n if (event.length < 3) {\r\n select.classList.remove('disabled');\r\n }\r\n // Check hidden radio if value\r\n if (event.length > 0) {\r\n guidsRadio.checked = true;\r\n }\r\n\r\n // If both radio undecided is empty and guids is empty\r\n if (event.length === 0 && guidsRadio.checked === true && undecidedRadio.checked === false) {\r\n guidsRadio.checked = false;\r\n\r\n // Set disable if all fields empty\r\n nextButton.setAttribute('disabled', 'disabled');\r\n }\r\n if (event.length !== 0 || undecidedRadio.checked) {\r\n\r\n // Remove disable if a field has value\r\n nextButton.removeAttribute('disabled');\r\n }\r\n // Uncheck undecided checkbox if an export market is selected\r\n if (event.length > 0 && undecidedRadio.checked) {\r\n undecidedRadio.checked = false;\r\n }\r\n\r\n // Set value of select\r\n this.exportMarketSelectedGuids = [];\r\n var items = document.querySelector('.v-select').__vue__._data.mutableValue;\r\n for (var i = 0, length = items.length; i < length; i++) {\r\n this.exportMarketSelectedGuids.push(items[i].value);\r\n }\r\n\r\n },\r\n exportMarketSelectClearDropdowns(event) {\r\n // Clear selected export markets when undecided is checked\r\n if (event.target.checked) {\r\n document.querySelector('.v-select').__vue__._data.mutableValue = [];\r\n this.exportMarketSelectedGuids = [];\r\n \r\n }\r\n }\r\n },\r\n mounted() {\r\n if (document.getElementById(\"leadToolForm\") && this.step < 7) {\r\n document.body.classList.add(\"lead-tool-page\");\r\n }\r\n }\r\n });\r\n};\r\n\r\nVue.component('v-select', vSelect);\r\n","import \"../Script/_shared/index\"\r\nimport \"../Script/default/index\"\r\nimport \"../Style/default/index.scss\""],"sourceRoot":""}